Version Packages (#10278 )

Co-authored-by: github-actions[bot] <github-actions[bot]@users.noreply.github.com>
[cli] Migrate bisect command to new structure (#10276 )
2025-12-27 03:39:11 +00:00 · 2023-07-31 13:31:22 -05:00 · 2023-07-31 16:03:13 +00:00 · 2023-07-31 15:42:27 +00:00 · 2023-07-31 16:11:18 +02:00 · 2023-07-28 15:40:19 -07:00
119 changed files with 7908 additions and 3869 deletions
--- a/.github/CODEOWNERS
+++ b/.github/CODEOWNERS
@@ -2,19 +2,19 @@
 # https://help.github.com/en/articles/about-code-owners

 # Restricted Paths
-*                                        @TooTallNate @EndangeredMassa @styfle @cb1kenobi @Ethan-Arrowood
-/.github/workflows                       @TooTallNate @EndangeredMassa @styfle @cb1kenobi @Ethan-Arrowood @ijjk
-/packages/fs-detectors                   @TooTallNate @EndangeredMassa @styfle @cb1kenobi @Ethan-Arrowood @agadzik @chloetedder
-/packages/next                           @TooTallNate @EndangeredMassa @styfle @cb1kenobi @Ethan-Arrowood @ijjk
-/packages/routing-utils                  @TooTallNate @EndangeredMassa @styfle @cb1kenobi @Ethan-Arrowood @ijjk
-/packages/edge                           @vercel/edge-compute
+*                                        @TooTallNate @EndangeredMassa @styfle @cb1kenobi @Ethan-Arrowood @trek
+/.github/workflows                       @TooTallNate @EndangeredMassa @styfle @cb1kenobi @Ethan-Arrowood @trek @ijjk
+/packages/fs-detectors                   @TooTallNate @EndangeredMassa @styfle @cb1kenobi @Ethan-Arrowood @trek @agadzik @chloetedder
+/packages/next                           @TooTallNate @EndangeredMassa @styfle @cb1kenobi @Ethan-Arrowood @trek @ijjk
+/packages/routing-utils                  @TooTallNate @EndangeredMassa @styfle @cb1kenobi @Ethan-Arrowood @trek @ijjk
+/packages/edge                           @vercel/compute
 /examples                                @leerob
 /examples/create-react-app               @Timer
 /examples/nextjs                         @timneutkens @ijjk @styfle
 /examples/hugo                           @styfle
 /examples/jekyll                         @styfle
 /examples/zola                           @styfle
-/packages/node                           @TooTallNate @EndangeredMassa @styfle @cb1kenobi @Ethan-Arrowood @Kikobeats
+/packages/node                           @TooTallNate @EndangeredMassa @styfle @cb1kenobi @Ethan-Arrowood @trek @Kikobeats

 # Unrestricted Paths
 .changeset/
--- a/examples/hydrogen/package.json
+++ b/examples/hydrogen/package.json
@@ -44,6 +44,5 @@
    "react-use": "^17.4.0",
    "title": "^3.4.4",
    "typographic-base": "^1.0.4"
-  },
-  "author": "nrajlich"
+  }
 }
--- a/examples/nextjs/package-lock.json
+++ b/examples/nextjs/package-lock.json
@@ -8,9 +8,9 @@
      "name": "nextjs",
      "version": "0.1.0",
      "dependencies": {
-        "eslint": "8.44.0",
-        "eslint-config-next": "13.4.9",
-        "next": "13.4.9",
+        "eslint": "8.45.0",
+        "eslint-config-next": "13.4.12",
+        "next": "13.4.12",
        "react": "18.2.0",
        "react-dom": "18.2.0"
      }
@@ -117,22 +117,22 @@
      "integrity": "sha512-ZnQMnLV4e7hDlUvw8H+U8ASL02SS2Gn6+9Ac3wGGLIe7+je2AeAOxPY+izIPJDfFDb7eDjev0Us8MO1iFRN8hA=="
    },
    "node_modules/@next/env": {
-      "version": "13.4.9",
-      "resolved": "https://registry.npmjs.org/@next/env/-/env-13.4.9.tgz",
-      "integrity": "sha512-vuDRK05BOKfmoBYLNi2cujG2jrYbEod/ubSSyqgmEx9n/W3eZaJQdRNhTfumO+qmq/QTzLurW487n/PM/fHOkw=="
+      "version": "13.4.12",
+      "resolved": "https://registry.npmjs.org/@next/env/-/env-13.4.12.tgz",
+      "integrity": "sha512-RmHanbV21saP/6OEPBJ7yJMuys68cIf8OBBWd7+uj40LdpmswVAwe1uzeuFyUsd6SfeITWT3XnQfn6wULeKwDQ=="
    },
    "node_modules/@next/eslint-plugin-next": {
-      "version": "13.4.9",
-      "resolved": "https://registry.npmjs.org/@next/eslint-plugin-next/-/eslint-plugin-next-13.4.9.tgz",
-      "integrity": "sha512-nDtGpa992tNyAkT/KmSMy7QkHfNZmGCBYhHtafU97DubqxzNdvLsqRtliQ4FU04CysRCtvP2hg8rRC1sAKUTUA==",
+      "version": "13.4.12",
+      "resolved": "https://registry.npmjs.org/@next/eslint-plugin-next/-/eslint-plugin-next-13.4.12.tgz",
+      "integrity": "sha512-6rhK9CdxEgj/j1qvXIyLTWEaeFv7zOK8yJMulz3Owel0uek0U9MJCGzmKgYxM3aAUBo3gKeywCZKyQnJKto60A==",
      "dependencies": {
        "glob": "7.1.7"
      }
    },
    "node_modules/@next/swc-darwin-arm64": {
-      "version": "13.4.9",
-      "resolved": "https://registry.npmjs.org/@next/swc-darwin-arm64/-/swc-darwin-arm64-13.4.9.tgz",
-      "integrity": "sha512-TVzGHpZoVBk3iDsTOQA/R6MGmFp0+17SWXMEWd6zG30AfuELmSSMe2SdPqxwXU0gbpWkJL1KgfLzy5ReN0crqQ==",
+      "version": "13.4.12",
+      "resolved": "https://registry.npmjs.org/@next/swc-darwin-arm64/-/swc-darwin-arm64-13.4.12.tgz",
+      "integrity": "sha512-deUrbCXTMZ6ZhbOoloqecnUeNpUOupi8SE2tx4jPfNS9uyUR9zK4iXBvH65opVcA/9F5I/p8vDXSYbUlbmBjZg==",
      "cpu": [
        "arm64"
      ],
@@ -145,9 +145,9 @@
      }
    },
    "node_modules/@next/swc-darwin-x64": {
-      "version": "13.4.9",
-      "resolved": "https://registry.npmjs.org/@next/swc-darwin-x64/-/swc-darwin-x64-13.4.9.tgz",
-      "integrity": "sha512-aSfF1fhv28N2e7vrDZ6zOQ+IIthocfaxuMWGReB5GDriF0caTqtHttAvzOMgJgXQtQx6XhyaJMozLTSEXeNN+A==",
+      "version": "13.4.12",
+      "resolved": "https://registry.npmjs.org/@next/swc-darwin-x64/-/swc-darwin-x64-13.4.12.tgz",
+      "integrity": "sha512-WRvH7RxgRHlC1yb5oG0ZLx8F7uci9AivM5/HGGv9ZyG2Als8Ij64GC3d+mQ5sJhWjusyU6T6V1WKTUoTmOB0zQ==",
      "cpu": [
        "x64"
      ],
@@ -160,9 +160,9 @@
      }
    },
    "node_modules/@next/swc-linux-arm64-gnu": {
-      "version": "13.4.9",
-      "resolved": "https://registry.npmjs.org/@next/swc-linux-arm64-gnu/-/swc-linux-arm64-gnu-13.4.9.tgz",
-      "integrity": "sha512-JhKoX5ECzYoTVyIy/7KykeO4Z2lVKq7HGQqvAH+Ip9UFn1MOJkOnkPRB7v4nmzqAoY+Je05Aj5wNABR1N18DMg==",
+      "version": "13.4.12",
+      "resolved": "https://registry.npmjs.org/@next/swc-linux-arm64-gnu/-/swc-linux-arm64-gnu-13.4.12.tgz",
+      "integrity": "sha512-YEKracAWuxp54tKiAvvq73PUs9lok57cc8meYRibTWe/VdPB2vLgkTVWFcw31YDuRXdEhdX0fWS6Q+ESBhnEig==",
      "cpu": [
        "arm64"
      ],
@@ -175,9 +175,9 @@
      }
    },
    "node_modules/@next/swc-linux-arm64-musl": {
-      "version": "13.4.9",
-      "resolved": "https://registry.npmjs.org/@next/swc-linux-arm64-musl/-/swc-linux-arm64-musl-13.4.9.tgz",
-      "integrity": "sha512-OOn6zZBIVkm/4j5gkPdGn4yqQt+gmXaLaSjRSO434WplV8vo2YaBNbSHaTM9wJpZTHVDYyjzuIYVEzy9/5RVZw==",
+      "version": "13.4.12",
+      "resolved": "https://registry.npmjs.org/@next/swc-linux-arm64-musl/-/swc-linux-arm64-musl-13.4.12.tgz",
+      "integrity": "sha512-LhJR7/RAjdHJ2Isl2pgc/JaoxNk0KtBgkVpiDJPVExVWA1c6gzY57+3zWuxuyWzTG+fhLZo2Y80pLXgIJv7g3g==",
      "cpu": [
        "arm64"
      ],
@@ -190,9 +190,9 @@
      }
    },
    "node_modules/@next/swc-linux-x64-gnu": {
-      "version": "13.4.9",
-      "resolved": "https://registry.npmjs.org/@next/swc-linux-x64-gnu/-/swc-linux-x64-gnu-13.4.9.tgz",
-      "integrity": "sha512-iA+fJXFPpW0SwGmx/pivVU+2t4zQHNOOAr5T378PfxPHY6JtjV6/0s1vlAJUdIHeVpX98CLp9k5VuKgxiRHUpg==",
+      "version": "13.4.12",
+      "resolved": "https://registry.npmjs.org/@next/swc-linux-x64-gnu/-/swc-linux-x64-gnu-13.4.12.tgz",
+      "integrity": "sha512-1DWLL/B9nBNiQRng+1aqs3OaZcxC16Nf+mOnpcrZZSdyKHek3WQh6j/fkbukObgNGwmCoVevLUa/p3UFTTqgqg==",
      "cpu": [
        "x64"
      ],
@@ -205,9 +205,9 @@
      }
    },
    "node_modules/@next/swc-linux-x64-musl": {
-      "version": "13.4.9",
-      "resolved": "https://registry.npmjs.org/@next/swc-linux-x64-musl/-/swc-linux-x64-musl-13.4.9.tgz",
-      "integrity": "sha512-rlNf2WUtMM+GAQrZ9gMNdSapkVi3koSW3a+dmBVp42lfugWVvnyzca/xJlN48/7AGx8qu62WyO0ya1ikgOxh6A==",
+      "version": "13.4.12",
+      "resolved": "https://registry.npmjs.org/@next/swc-linux-x64-musl/-/swc-linux-x64-musl-13.4.12.tgz",
+      "integrity": "sha512-kEAJmgYFhp0VL+eRWmUkVxLVunn7oL9Mdue/FS8yzRBVj7Z0AnIrHpTIeIUl1bbdQq1VaoOztnKicAjfkLTRCQ==",
      "cpu": [
        "x64"
      ],
@@ -220,9 +220,9 @@
      }
    },
    "node_modules/@next/swc-win32-arm64-msvc": {
-      "version": "13.4.9",
-      "resolved": "https://registry.npmjs.org/@next/swc-win32-arm64-msvc/-/swc-win32-arm64-msvc-13.4.9.tgz",
-      "integrity": "sha512-5T9ybSugXP77nw03vlgKZxD99AFTHaX8eT1ayKYYnGO9nmYhJjRPxcjU5FyYI+TdkQgEpIcH7p/guPLPR0EbKA==",
+      "version": "13.4.12",
+      "resolved": "https://registry.npmjs.org/@next/swc-win32-arm64-msvc/-/swc-win32-arm64-msvc-13.4.12.tgz",
+      "integrity": "sha512-GMLuL/loR6yIIRTnPRY6UGbLL9MBdw2anxkOnANxvLvsml4F0HNIgvnU3Ej4BjbqMTNjD4hcPFdlEow4XHPdZA==",
      "cpu": [
        "arm64"
      ],
@@ -235,9 +235,9 @@
      }
    },
    "node_modules/@next/swc-win32-ia32-msvc": {
-      "version": "13.4.9",
-      "resolved": "https://registry.npmjs.org/@next/swc-win32-ia32-msvc/-/swc-win32-ia32-msvc-13.4.9.tgz",
-      "integrity": "sha512-ojZTCt1lP2ucgpoiFgrFj07uq4CZsq4crVXpLGgQfoFq00jPKRPgesuGPaz8lg1yLfvafkU3Jd1i8snKwYR3LA==",
+      "version": "13.4.12",
+      "resolved": "https://registry.npmjs.org/@next/swc-win32-ia32-msvc/-/swc-win32-ia32-msvc-13.4.12.tgz",
+      "integrity": "sha512-PhgNqN2Vnkm7XaMdRmmX0ZSwZXQAtamBVSa9A/V1dfKQCV1rjIZeiy/dbBnVYGdj63ANfsOR/30XpxP71W0eww==",
      "cpu": [
        "ia32"
      ],
@@ -250,9 +250,9 @@
      }
    },
    "node_modules/@next/swc-win32-x64-msvc": {
-      "version": "13.4.9",
-      "resolved": "https://registry.npmjs.org/@next/swc-win32-x64-msvc/-/swc-win32-x64-msvc-13.4.9.tgz",
-      "integrity": "sha512-QbT03FXRNdpuL+e9pLnu+XajZdm/TtIXVYY4lA9t+9l0fLZbHXDYEKitAqxrOj37o3Vx5ufxiRAniaIebYDCgw==",
+      "version": "13.4.12",
+      "resolved": "https://registry.npmjs.org/@next/swc-win32-x64-msvc/-/swc-win32-x64-msvc-13.4.12.tgz",
+      "integrity": "sha512-Z+56e/Ljt0bUs+T+jPjhFyxYBcdY2RIq9ELFU+qAMQMteHo7ymbV7CKmlcX59RI9C4YzN8PgMgLyAoi916b5HA==",
      "cpu": [
        "x64"
      ],
@@ -334,13 +334,13 @@
      "integrity": "sha512-dRLjCWHYg4oaA77cxO64oO+7JwCwnIzkZPdrrC71jQmQtlhM556pwKo5bUzqvZndkVbeFLIIi+9TC40JNF5hNQ=="
    },
    "node_modules/@typescript-eslint/parser": {
-      "version": "5.61.0",
-      "resolved": "https://registry.npmjs.org/@typescript-eslint/parser/-/parser-5.61.0.tgz",
-      "integrity": "sha512-yGr4Sgyh8uO6fSi9hw3jAFXNBHbCtKKFMdX2IkT3ZqpKmtAq3lHS4ixB/COFuAIJpwl9/AqF7j72ZDWYKmIfvg==",
+      "version": "5.62.0",
+      "resolved": "https://registry.npmjs.org/@typescript-eslint/parser/-/parser-5.62.0.tgz",
+      "integrity": "sha512-VlJEV0fOQ7BExOsHYAGrgbEiZoi8D+Bl2+f6V2RrXerRSylnp+ZBHmPvaIa8cz0Ajx7WO7Z5RqfgYg7ED1nRhA==",
      "dependencies": {
-        "@typescript-eslint/scope-manager": "5.61.0",
-        "@typescript-eslint/types": "5.61.0",
-        "@typescript-eslint/typescript-estree": "5.61.0",
+        "@typescript-eslint/scope-manager": "5.62.0",
+        "@typescript-eslint/types": "5.62.0",
+        "@typescript-eslint/typescript-estree": "5.62.0",
        "debug": "^4.3.4"
      },
      "engines": {
@@ -360,12 +360,12 @@
      }
    },
    "node_modules/@typescript-eslint/scope-manager": {
-      "version": "5.61.0",
-      "resolved": "https://registry.npmjs.org/@typescript-eslint/scope-manager/-/scope-manager-5.61.0.tgz",
-      "integrity": "sha512-W8VoMjoSg7f7nqAROEmTt6LoBpn81AegP7uKhhW5KzYlehs8VV0ZW0fIDVbcZRcaP3aPSW+JZFua+ysQN+m/Nw==",
+      "version": "5.62.0",
+      "resolved": "https://registry.npmjs.org/@typescript-eslint/scope-manager/-/scope-manager-5.62.0.tgz",
+      "integrity": "sha512-VXuvVvZeQCQb5Zgf4HAxc04q5j+WrNAtNh9OwCsCgpKqESMTu3tF/jhZ3xG6T4NZwWl65Bg8KuS2uEvhSfLl0w==",
      "dependencies": {
-        "@typescript-eslint/types": "5.61.0",
-        "@typescript-eslint/visitor-keys": "5.61.0"
+        "@typescript-eslint/types": "5.62.0",
+        "@typescript-eslint/visitor-keys": "5.62.0"
      },
      "engines": {
        "node": "^12.22.0 || ^14.17.0 || >=16.0.0"
@@ -376,9 +376,9 @@
      }
    },
    "node_modules/@typescript-eslint/types": {
-      "version": "5.61.0",
-      "resolved": "https://registry.npmjs.org/@typescript-eslint/types/-/types-5.61.0.tgz",
-      "integrity": "sha512-ldyueo58KjngXpzloHUog/h9REmHl59G1b3a5Sng1GfBo14BkS3ZbMEb3693gnP1k//97lh7bKsp6/V/0v1veQ==",
+      "version": "5.62.0",
+      "resolved": "https://registry.npmjs.org/@typescript-eslint/types/-/types-5.62.0.tgz",
+      "integrity": "sha512-87NVngcbVXUahrRTqIK27gD2t5Cu1yuCXxbLcFtCzZGlfyVWWh8mLHkoxzjsB6DDNnvdL+fW8MiwPEJyGJQDgQ==",
      "engines": {
        "node": "^12.22.0 || ^14.17.0 || >=16.0.0"
      },
@@ -388,12 +388,12 @@
      }
    },
    "node_modules/@typescript-eslint/typescript-estree": {
-      "version": "5.61.0",
-      "resolved": "https://registry.npmjs.org/@typescript-eslint/typescript-estree/-/typescript-estree-5.61.0.tgz",
-      "integrity": "sha512-Fud90PxONnnLZ36oR5ClJBLTLfU4pIWBmnvGwTbEa2cXIqj70AEDEmOmpkFComjBZ/037ueKrOdHuYmSFVD7Rw==",
+      "version": "5.62.0",
+      "resolved": "https://registry.npmjs.org/@typescript-eslint/typescript-estree/-/typescript-estree-5.62.0.tgz",
+      "integrity": "sha512-CmcQ6uY7b9y694lKdRB8FEel7JbU/40iSAPomu++SjLMntB+2Leay2LO6i8VnJk58MtE9/nQSFIH6jpyRWyYzA==",
      "dependencies": {
-        "@typescript-eslint/types": "5.61.0",
-        "@typescript-eslint/visitor-keys": "5.61.0",
+        "@typescript-eslint/types": "5.62.0",
+        "@typescript-eslint/visitor-keys": "5.62.0",
        "debug": "^4.3.4",
        "globby": "^11.1.0",
        "is-glob": "^4.0.3",
@@ -414,11 +414,11 @@
      }
    },
    "node_modules/@typescript-eslint/visitor-keys": {
-      "version": "5.61.0",
-      "resolved": "https://registry.npmjs.org/@typescript-eslint/visitor-keys/-/visitor-keys-5.61.0.tgz",
-      "integrity": "sha512-50XQ5VdbWrX06mQXhy93WywSFZZGsv3EOjq+lqp6WC2t+j3mb6A9xYVdrRxafvK88vg9k9u+CT4l6D8PEatjKg==",
+      "version": "5.62.0",
+      "resolved": "https://registry.npmjs.org/@typescript-eslint/visitor-keys/-/visitor-keys-5.62.0.tgz",
+      "integrity": "sha512-07ny+LHRzQXepkGg6w0mFY41fVUNBrL2Roj/++7V1txKugfjm/Ci/qSND03r2RhlJhJYMcTn9AhhSSqQp0Ysyw==",
      "dependencies": {
-        "@typescript-eslint/types": "5.61.0",
+        "@typescript-eslint/types": "5.62.0",
        "eslint-visitor-keys": "^3.3.0"
      },
      "engines": {
@@ -582,6 +582,25 @@
        "get-intrinsic": "^1.1.3"
      }
    },
+    "node_modules/arraybuffer.prototype.slice": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/arraybuffer.prototype.slice/-/arraybuffer.prototype.slice-1.0.1.tgz",
+      "integrity": "sha512-09x0ZWFEjj4WD8PDbykUwo3t9arLn8NIzmmYEJFpYekOAQjpkGSyrQhNoRTcwwcFRu+ycWF78QZ63oWTqSjBcw==",
+      "dependencies": {
+        "array-buffer-byte-length": "^1.0.0",
+        "call-bind": "^1.0.2",
+        "define-properties": "^1.2.0",
+        "get-intrinsic": "^1.2.1",
+        "is-array-buffer": "^3.0.2",
+        "is-shared-array-buffer": "^1.0.2"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
    "node_modules/ast-types-flow": {
      "version": "0.0.7",
      "resolved": "https://registry.npmjs.org/ast-types-flow/-/ast-types-flow-0.0.7.tgz",
@@ -704,9 +723,9 @@
      }
    },
    "node_modules/caniuse-lite": {
-      "version": "1.0.30001512",
-      "resolved": "https://registry.npmjs.org/caniuse-lite/-/caniuse-lite-1.0.30001512.tgz",
-      "integrity": "sha512-2S9nK0G/mE+jasCUsMPlARhRCts1ebcp2Ji8Y8PWi4NDE1iRdLCnEPHkEfeBrGC45L4isBx5ur3IQ6yTE2mRZw==",
+      "version": "1.0.30001517",
+      "resolved": "https://registry.npmjs.org/caniuse-lite/-/caniuse-lite-1.0.30001517.tgz",
+      "integrity": "sha512-Vdhm5S11DaFVLlyiKu4hiUTkpZu+y1KA/rZZqVQfOD5YdDT/eQKlkt7NaE0WGOFgX32diqt9MiP9CAiFeRklaA==",
      "funding": [
        {
          "type": "opencollective",
@@ -908,17 +927,18 @@
      }
    },
    "node_modules/es-abstract": {
-      "version": "1.21.2",
-      "resolved": "https://registry.npmjs.org/es-abstract/-/es-abstract-1.21.2.tgz",
-      "integrity": "sha512-y/B5POM2iBnIxCiernH1G7rC9qQoM77lLIMQLuob0zhp8C56Po81+2Nj0WFKnd0pNReDTnkYryc+zhOzpEIROg==",
+      "version": "1.22.1",
+      "resolved": "https://registry.npmjs.org/es-abstract/-/es-abstract-1.22.1.tgz",
+      "integrity": "sha512-ioRRcXMO6OFyRpyzV3kE1IIBd4WG5/kltnzdxSCqoP8CMGs/Li+M1uF5o7lOkZVFjDs+NLesthnF66Pg/0q0Lw==",
      "dependencies": {
        "array-buffer-byte-length": "^1.0.0",
+        "arraybuffer.prototype.slice": "^1.0.1",
        "available-typed-arrays": "^1.0.5",
        "call-bind": "^1.0.2",
        "es-set-tostringtag": "^2.0.1",
        "es-to-primitive": "^1.2.1",
        "function.prototype.name": "^1.1.5",
-        "get-intrinsic": "^1.2.0",
+        "get-intrinsic": "^1.2.1",
        "get-symbol-description": "^1.0.0",
        "globalthis": "^1.0.3",
        "gopd": "^1.0.1",
@@ -938,14 +958,18 @@
        "object-inspect": "^1.12.3",
        "object-keys": "^1.1.1",
        "object.assign": "^4.1.4",
-        "regexp.prototype.flags": "^1.4.3",
+        "regexp.prototype.flags": "^1.5.0",
+        "safe-array-concat": "^1.0.0",
        "safe-regex-test": "^1.0.0",
        "string.prototype.trim": "^1.2.7",
        "string.prototype.trimend": "^1.0.6",
        "string.prototype.trimstart": "^1.0.6",
+        "typed-array-buffer": "^1.0.0",
+        "typed-array-byte-length": "^1.0.0",
+        "typed-array-byte-offset": "^1.0.0",
        "typed-array-length": "^1.0.4",
        "unbox-primitive": "^1.0.2",
-        "which-typed-array": "^1.1.9"
+        "which-typed-array": "^1.1.10"
      },
      "engines": {
        "node": ">= 0.4"
@@ -1003,9 +1027,9 @@
      }
    },
    "node_modules/eslint": {
-      "version": "8.44.0",
-      "resolved": "https://registry.npmjs.org/eslint/-/eslint-8.44.0.tgz",
-      "integrity": "sha512-0wpHoUbDUHgNCyvFB5aXLiQVfK9B0at6gUvzy83k4kAsQ/u769TQDX6iKC+aO4upIHO9WSaA3QoXYQDHbNwf1A==",
+      "version": "8.45.0",
+      "resolved": "https://registry.npmjs.org/eslint/-/eslint-8.45.0.tgz",
+      "integrity": "sha512-pd8KSxiQpdYRfYa9Wufvdoct3ZPQQuVuU5O6scNgMuOMYuxvH0IGaYK0wUFjo4UYYQQCUndlXiMbnxopwvvTiw==",
      "dependencies": {
        "@eslint-community/eslint-utils": "^4.2.0",
        "@eslint-community/regexpp": "^4.4.0",
@@ -1032,7 +1056,6 @@
        "globals": "^13.19.0",
        "graphemer": "^1.4.0",
        "ignore": "^5.2.0",
-        "import-fresh": "^3.0.0",
        "imurmurhash": "^0.1.4",
        "is-glob": "^4.0.0",
        "is-path-inside": "^3.0.3",
@@ -1044,7 +1067,6 @@
        "natural-compare": "^1.4.0",
        "optionator": "^0.9.3",
        "strip-ansi": "^6.0.1",
-        "strip-json-comments": "^3.1.0",
        "text-table": "^0.2.0"
      },
      "bin": {
@@ -1058,11 +1080,11 @@
      }
    },
    "node_modules/eslint-config-next": {
-      "version": "13.4.9",
-      "resolved": "https://registry.npmjs.org/eslint-config-next/-/eslint-config-next-13.4.9.tgz",
-      "integrity": "sha512-0fLtKRR268NArpqeXXwnLgMXPvF64YESQvptVg+RMLCaijKm3FICN9Y7Jc1p2o+yrWwE4DufJXDM/Vo53D1L7g==",
+      "version": "13.4.12",
+      "resolved": "https://registry.npmjs.org/eslint-config-next/-/eslint-config-next-13.4.12.tgz",
+      "integrity": "sha512-ZF0r5vxKaVazyZH/37Au/XItiG7qUOBw+HaH3PeyXltIMwXorsn6bdrl0Nn9N5v5v9spc+6GM2ryjugbjF6X2g==",
      "dependencies": {
-        "@next/eslint-plugin-next": "13.4.9",
+        "@next/eslint-plugin-next": "13.4.12",
        "@rushstack/eslint-patch": "^1.1.3",
        "@typescript-eslint/parser": "^5.42.0",
        "eslint-import-resolver-node": "^0.3.6",
@@ -1226,9 +1248,9 @@
      }
    },
    "node_modules/eslint-plugin-import/node_modules/semver": {
-      "version": "6.3.0",
-      "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.0.tgz",
-      "integrity": "sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==",
+      "version": "6.3.1",
+      "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.1.tgz",
+      "integrity": "sha512-BR7VvDCVHO+q2xBEWskxS6DJE1qRnb7DxzUrogb71CWoSficBxYsiAGd+Kl0mmq/MprG9yArRkyrQxTO6XjMzA==",
      "bin": {
        "semver": "bin/semver.js"
      }
@@ -1263,17 +1285,17 @@
      }
    },
    "node_modules/eslint-plugin-jsx-a11y/node_modules/semver": {
-      "version": "6.3.0",
-      "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.0.tgz",
-      "integrity": "sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==",
+      "version": "6.3.1",
+      "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.1.tgz",
+      "integrity": "sha512-BR7VvDCVHO+q2xBEWskxS6DJE1qRnb7DxzUrogb71CWoSficBxYsiAGd+Kl0mmq/MprG9yArRkyrQxTO6XjMzA==",
      "bin": {
        "semver": "bin/semver.js"
      }
    },
    "node_modules/eslint-plugin-react": {
-      "version": "7.32.2",
-      "resolved": "https://registry.npmjs.org/eslint-plugin-react/-/eslint-plugin-react-7.32.2.tgz",
-      "integrity": "sha512-t2fBMa+XzonrrNkyVirzKlvn5RXzzPwRHtMvLAtVZrt8oxgnTQaYbU6SXTOO1mwQgp1y5+toMSKInnzGr0Knqg==",
+      "version": "7.33.0",
+      "resolved": "https://registry.npmjs.org/eslint-plugin-react/-/eslint-plugin-react-7.33.0.tgz",
+      "integrity": "sha512-qewL/8P34WkY8jAqdQxsiL82pDUeT7nhs8IsuXgfgnsEloKCT4miAV9N9kGtx7/KM9NH/NCGUE7Edt9iGxLXFw==",
      "dependencies": {
        "array-includes": "^3.1.6",
        "array.prototype.flatmap": "^1.3.1",
@@ -1288,7 +1310,7 @@
        "object.values": "^1.1.6",
        "prop-types": "^15.8.1",
        "resolve": "^2.0.0-next.4",
-        "semver": "^6.3.0",
+        "semver": "^6.3.1",
        "string.prototype.matchall": "^4.0.8"
      },
      "engines": {
@@ -1337,17 +1359,17 @@
      }
    },
    "node_modules/eslint-plugin-react/node_modules/semver": {
-      "version": "6.3.0",
-      "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.0.tgz",
-      "integrity": "sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==",
+      "version": "6.3.1",
+      "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.1.tgz",
+      "integrity": "sha512-BR7VvDCVHO+q2xBEWskxS6DJE1qRnb7DxzUrogb71CWoSficBxYsiAGd+Kl0mmq/MprG9yArRkyrQxTO6XjMzA==",
      "bin": {
        "semver": "bin/semver.js"
      }
    },
    "node_modules/eslint-scope": {
-      "version": "7.2.0",
-      "resolved": "https://registry.npmjs.org/eslint-scope/-/eslint-scope-7.2.0.tgz",
-      "integrity": "sha512-DYj5deGlHBfMt15J7rdtyKNq/Nqlv5KfU4iodrQ019XESsRnwXH9KAE0y3cwtUHDo2ob7CypAnCqefh6vioWRw==",
+      "version": "7.2.1",
+      "resolved": "https://registry.npmjs.org/eslint-scope/-/eslint-scope-7.2.1.tgz",
+      "integrity": "sha512-CvefSOsDdaYYvxChovdrPo/ZGt8d5lrJWleAc1diXRKhHGiTYEI26cvo8Kle/wGnsizoCJjK73FMg1/IkIwiNA==",
      "dependencies": {
        "esrecurse": "^4.3.0",
        "estraverse": "^5.2.0"
@@ -1371,9 +1393,9 @@
      }
    },
    "node_modules/espree": {
-      "version": "9.6.0",
-      "resolved": "https://registry.npmjs.org/espree/-/espree-9.6.0.tgz",
-      "integrity": "sha512-1FH/IiruXZ84tpUlm0aCUEwMl2Ho5ilqVh0VvQXw+byAz/4SAciyHLlfmL5WYqsvD38oymdUwBss0LtK8m4s/A==",
+      "version": "9.6.1",
+      "resolved": "https://registry.npmjs.org/espree/-/espree-9.6.1.tgz",
+      "integrity": "sha512-oruZaFkjorTpF32kDSI5/75ViwGeZginGGy2NoOSg3Q9bnwlnmDm4HLnkl0RE3n+njDXR037aY1+x58Z/zFdwQ==",
      "dependencies": {
        "acorn": "^8.9.0",
        "acorn-jsx": "^5.3.2",
@@ -2118,15 +2140,11 @@
      }
    },
    "node_modules/is-typed-array": {
-      "version": "1.1.10",
-      "resolved": "https://registry.npmjs.org/is-typed-array/-/is-typed-array-1.1.10.tgz",
-      "integrity": "sha512-PJqgEHiWZvMpaFZ3uTc8kHPM4+4ADTlDniuQL7cU/UDA0Ql7F70yGfHph3cLNe+c9toaigv+DFzTJKhc2CtO6A==",
+      "version": "1.1.12",
+      "resolved": "https://registry.npmjs.org/is-typed-array/-/is-typed-array-1.1.12.tgz",
+      "integrity": "sha512-Z14TF2JNG8Lss5/HMqt0//T9JeHXttXy5pH/DBU4vi98ozO2btxzq9MwYDZYnKwU8nRsz/+GVFVRDq3DkVuSPg==",
      "dependencies": {
-        "available-typed-arrays": "^1.0.5",
-        "call-bind": "^1.0.2",
-        "for-each": "^0.3.3",
-        "gopd": "^1.0.1",
-        "has-tostringtag": "^1.0.0"
+        "which-typed-array": "^1.1.11"
      },
      "engines": {
        "node": ">= 0.4"
@@ -2171,6 +2189,11 @@
        "url": "https://github.com/sponsors/sindresorhus"
      }
    },
+    "node_modules/isarray": {
+      "version": "2.0.5",
+      "resolved": "https://registry.npmjs.org/isarray/-/isarray-2.0.5.tgz",
+      "integrity": "sha512-xHjhDr3cNBK0BzdUJSPXZntQUx/mwMS5Rw4A7lPJ90XGAO6ISP/ePDNuo0vhqOZU+UD5JoodwCAAoZQd3FeAKw=="
+    },
    "node_modules/isexe": {
      "version": "2.0.0",
      "resolved": "https://registry.npmjs.org/isexe/-/isexe-2.0.0.tgz",
@@ -2376,11 +2399,11 @@
      "integrity": "sha512-OWND8ei3VtNC9h7V60qff3SVobHr996CTwgxubgyQYEpg290h9J0buyECNNJexkFm5sOajh5G116RYA1c8ZMSw=="
    },
    "node_modules/next": {
-      "version": "13.4.9",
-      "resolved": "https://registry.npmjs.org/next/-/next-13.4.9.tgz",
-      "integrity": "sha512-vtefFm/BWIi/eWOqf1GsmKG3cjKw1k3LjuefKRcL3iiLl3zWzFdPG3as6xtxrGO6gwTzzaO1ktL4oiHt/uvTjA==",
+      "version": "13.4.12",
+      "resolved": "https://registry.npmjs.org/next/-/next-13.4.12.tgz",
+      "integrity": "sha512-eHfnru9x6NRmTMcjQp6Nz0J4XH9OubmzOa7CkWL+AUrUxpibub3vWwttjduu9No16dug1kq04hiUUpo7J3m3Xw==",
      "dependencies": {
-        "@next/env": "13.4.9",
+        "@next/env": "13.4.12",
        "@swc/helpers": "0.5.1",
        "busboy": "1.6.0",
        "caniuse-lite": "^1.0.30001406",
@@ -2396,15 +2419,15 @@
        "node": ">=16.8.0"
      },
      "optionalDependencies": {
-        "@next/swc-darwin-arm64": "13.4.9",
-        "@next/swc-darwin-x64": "13.4.9",
-        "@next/swc-linux-arm64-gnu": "13.4.9",
-        "@next/swc-linux-arm64-musl": "13.4.9",
-        "@next/swc-linux-x64-gnu": "13.4.9",
-        "@next/swc-linux-x64-musl": "13.4.9",
-        "@next/swc-win32-arm64-msvc": "13.4.9",
-        "@next/swc-win32-ia32-msvc": "13.4.9",
-        "@next/swc-win32-x64-msvc": "13.4.9"
+        "@next/swc-darwin-arm64": "13.4.12",
+        "@next/swc-darwin-x64": "13.4.12",
+        "@next/swc-linux-arm64-gnu": "13.4.12",
+        "@next/swc-linux-arm64-musl": "13.4.12",
+        "@next/swc-linux-x64-gnu": "13.4.12",
+        "@next/swc-linux-x64-musl": "13.4.12",
+        "@next/swc-win32-arm64-msvc": "13.4.12",
+        "@next/swc-win32-ia32-msvc": "13.4.12",
+        "@next/swc-win32-x64-msvc": "13.4.12"
      },
      "peerDependencies": {
        "@opentelemetry/api": "^1.1.0",
@@ -2985,6 +3008,23 @@
        "queue-microtask": "^1.2.2"
      }
    },
+    "node_modules/safe-array-concat": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/safe-array-concat/-/safe-array-concat-1.0.0.tgz",
+      "integrity": "sha512-9dVEFruWIsnie89yym+xWTAYASdpw3CJV7Li/6zBewGf9z2i1j31rP6jnY0pHEO4QZh6N0K11bFjWmdR8UGdPQ==",
+      "dependencies": {
+        "call-bind": "^1.0.2",
+        "get-intrinsic": "^1.2.0",
+        "has-symbols": "^1.0.3",
+        "isarray": "^2.0.5"
+      },
+      "engines": {
+        "node": ">=0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
    "node_modules/safe-regex-test": {
      "version": "1.0.0",
      "resolved": "https://registry.npmjs.org/safe-regex-test/-/safe-regex-test-1.0.0.tgz",
@@ -3007,9 +3047,9 @@
      }
    },
    "node_modules/semver": {
-      "version": "7.5.3",
-      "resolved": "https://registry.npmjs.org/semver/-/semver-7.5.3.tgz",
-      "integrity": "sha512-QBlUtyVk/5EeHbi7X0fw6liDZc7BBmEaSYn01fMU1OUYbf6GPsbTtd8WmnqbI20SeycoHSeiybkE/q1Q+qlThQ==",
+      "version": "7.5.4",
+      "resolved": "https://registry.npmjs.org/semver/-/semver-7.5.4.tgz",
+      "integrity": "sha512-1bCSESV6Pv+i21Hvpxp3Dx+pSD8lIPt8uVjRrxAUt/nbswYc+tK6Y2btiULjd4+fnq15PX+nqQDC7Oft7WkwcA==",
      "dependencies": {
        "lru-cache": "^6.0.0"
      },
@@ -3333,6 +3373,54 @@
        "url": "https://github.com/sponsors/sindresorhus"
      }
    },
+    "node_modules/typed-array-buffer": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/typed-array-buffer/-/typed-array-buffer-1.0.0.tgz",
+      "integrity": "sha512-Y8KTSIglk9OZEr8zywiIHG/kmQ7KWyjseXs1CbSo8vC42w7hg2HgYTxSWwP0+is7bWDc1H+Fo026CpHFwm8tkw==",
+      "dependencies": {
+        "call-bind": "^1.0.2",
+        "get-intrinsic": "^1.2.1",
+        "is-typed-array": "^1.1.10"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      }
+    },
+    "node_modules/typed-array-byte-length": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/typed-array-byte-length/-/typed-array-byte-length-1.0.0.tgz",
+      "integrity": "sha512-Or/+kvLxNpeQ9DtSydonMxCx+9ZXOswtwJn17SNLvhptaXYDJvkFFP5zbfU/uLmvnBJlI4yrnXRxpdWH/M5tNA==",
+      "dependencies": {
+        "call-bind": "^1.0.2",
+        "for-each": "^0.3.3",
+        "has-proto": "^1.0.1",
+        "is-typed-array": "^1.1.10"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/typed-array-byte-offset": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/typed-array-byte-offset/-/typed-array-byte-offset-1.0.0.tgz",
+      "integrity": "sha512-RD97prjEt9EL8YgAgpOkf3O4IF9lhJFr9g0htQkm0rchFp/Vx7LW5Q8fSXXub7BXAODyUQohRMyOc3faCPd0hg==",
+      "dependencies": {
+        "available-typed-arrays": "^1.0.5",
+        "call-bind": "^1.0.2",
+        "for-each": "^0.3.3",
+        "has-proto": "^1.0.1",
+        "is-typed-array": "^1.1.10"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
    "node_modules/typed-array-length": {
      "version": "1.0.4",
      "resolved": "https://registry.npmjs.org/typed-array-length/-/typed-array-length-1.0.4.tgz",
@@ -3431,16 +3519,15 @@
      }
    },
    "node_modules/which-typed-array": {
-      "version": "1.1.9",
-      "resolved": "https://registry.npmjs.org/which-typed-array/-/which-typed-array-1.1.9.tgz",
-      "integrity": "sha512-w9c4xkx6mPidwp7180ckYWfMmvxpjlZuIudNtDf4N/tTAUB8VJbX25qZoAsrtGuYNnGw3pa0AXgbGKRB8/EceA==",
+      "version": "1.1.11",
+      "resolved": "https://registry.npmjs.org/which-typed-array/-/which-typed-array-1.1.11.tgz",
+      "integrity": "sha512-qe9UWWpkeG5yzZ0tNYxDmd7vo58HDBc39mZ0xWWpolAGADdFOzkfamWLDxkOWcvHQKVmdTyQdLD4NOfjLWTKew==",
      "dependencies": {
        "available-typed-arrays": "^1.0.5",
        "call-bind": "^1.0.2",
        "for-each": "^0.3.3",
        "gopd": "^1.0.1",
-        "has-tostringtag": "^1.0.0",
-        "is-typed-array": "^1.1.10"
+        "has-tostringtag": "^1.0.0"
      },
      "engines": {
        "node": ">= 0.4"
--- a/examples/nextjs/package.json
+++ b/examples/nextjs/package.json
@@ -9,9 +9,9 @@
    "lint": "next lint"
  },
  "dependencies": {
-    "eslint": "8.44.0",
-    "eslint-config-next": "13.4.9",
-    "next": "13.4.9",
+    "eslint": "8.45.0",
+    "eslint-config-next": "13.4.12",
+    "next": "13.4.12",
    "react": "18.2.0",
    "react-dom": "18.2.0"
  }
--- a/examples/package.json
+++ b/examples/package.json
@@ -9,6 +9,6 @@
  },
  "devDependencies": {
    "@types/jest": "27.4.1",
-    "@vercel/frameworks": "1.4.3"
+    "@vercel/frameworks": "1.5.0"
  }
 }
--- a/package.json
+++ b/package.json
@@ -32,7 +32,7 @@
    "source-map-support": "0.5.12",
    "ts-eager": "2.0.2",
    "ts-jest": "29.1.0",
-    "turbo": "1.10.7",
+    "turbo": "1.10.9",
    "typescript": "4.9.5"
  },
  "scripts": {
--- a/packages/cli/CHANGELOG.md
+++ b/packages/cli/CHANGELOG.md
@@ -1,5 +1,64 @@
 # vercel

+## 31.2.1
+
+### Patch Changes
+
+- Migrate bisect command to new structure ([#10276](https://github.com/vercel/vercel/pull/10276))
+
+- Migrate remove command to new structure ([#10268](https://github.com/vercel/vercel/pull/10268))
+
+- Updated dependencies [[`fc413707d`](https://github.com/vercel/vercel/commit/fc413707d017e234d5013b761d885f65f9b981bc)]:
+  - @vercel/node@2.15.7
+  - @vercel/static-build@1.3.43
+
+## 31.2.0
+
+### Minor Changes
+
+- Add a "Global Options" section to help output ([#10250](https://github.com/vercel/vercel/pull/10250))
+
+### Patch Changes
+
+- Updated dependencies [[`d1b0dbe3a`](https://github.com/vercel/vercel/commit/d1b0dbe3a7d8754286aa2b7ba0c8b55d3adafdea), [`4a8622a10`](https://github.com/vercel/vercel/commit/4a8622a10d52260cb629a1c4a6f797ade05ea154), [`6469ef1b8`](https://github.com/vercel/vercel/commit/6469ef1b8ce37e93f50ab4a108aa0953d7631fe8)]:
+  - @vercel/remix-builder@1.9.0
+  - @vercel/next@3.9.3
+
+## 31.1.1
+
+### Patch Changes
+
+- Updated dependencies [[`7c30b13cc`](https://github.com/vercel/vercel/commit/7c30b13ccb79bdf0ac240282bba4c084f1d0d122)]:
+  - @vercel/next@3.9.2
+
+## 31.1.0
+
+### Minor Changes
+
+- Add 'Environment' column to 'vc list' with new '--environment' filter and pipe URLs to stdout ([#10239](https://github.com/vercel/vercel/pull/10239))
+
+### Patch Changes
+
+- Update `proxy-agent` to v6.3.0 ([#10226](https://github.com/vercel/vercel/pull/10226))
+
+- Use `getNodeBinPaths()` in `vc dev` ([#10225](https://github.com/vercel/vercel/pull/10225))
+
+- Updated dependencies [[`b1c14cde0`](https://github.com/vercel/vercel/commit/b1c14cde03f94b2c15ba12c9be9d19c72df2fdbb), [`ce4633fe4`](https://github.com/vercel/vercel/commit/ce4633fe4d00cb5c251cdabbfab08f39ec3f3b5f)]:
+  - @vercel/next@3.9.1
+  - @vercel/static-build@1.3.42
+
+## 31.0.4
+
+### Patch Changes
+
+- Detect multiple frameworks within the same root directory during `vc link --repo` ([#10203](https://github.com/vercel/vercel/pull/10203))
+
+- Updated dependencies [[`b56639b62`](https://github.com/vercel/vercel/commit/b56639b624e9ad1df048a4c85083e26888696060), [`cae60155f`](https://github.com/vercel/vercel/commit/cae60155f34883f08a5e4f51b547e2a1a5fee694), [`c670e5171`](https://github.com/vercel/vercel/commit/c670e51712022193e078bd68b055f7e61013015d), [`5439d7c0c`](https://github.com/vercel/vercel/commit/5439d7c0c9b79e7161bf4fa84ffdb357365f9e7e)]:
+  - @vercel/node@2.15.6
+  - @vercel/next@3.9.0
+  - @vercel/remix-builder@1.8.18
+  - @vercel/static-build@1.3.41
+
 ## 31.0.3

 ### Patch Changes
--- a/packages/cli/package.json
+++ b/packages/cli/package.json
@@ -1,6 +1,6 @@
 {
  "name": "vercel",
-  "version": "31.0.3",
+  "version": "31.2.1",
  "preferGlobal": true,
  "license": "Apache-2.0",
  "description": "The command-line interface for Vercel",
@@ -34,13 +34,13 @@
    "@vercel/build-utils": "6.8.2",
    "@vercel/go": "2.5.1",
    "@vercel/hydrogen": "0.0.64",
-    "@vercel/next": "3.8.8",
-    "@vercel/node": "2.15.5",
+    "@vercel/next": "3.9.3",
+    "@vercel/node": "2.15.7",
    "@vercel/python": "3.1.60",
    "@vercel/redwood": "1.1.15",
-    "@vercel/remix-builder": "1.8.17",
+    "@vercel/remix-builder": "1.9.0",
    "@vercel/ruby": "1.3.76",
-    "@vercel/static-build": "1.3.40"
+    "@vercel/static-build": "1.3.43"
  },
  "devDependencies": {
    "@alex_neo/jest-expect-message": "1.0.5",
@@ -89,8 +89,8 @@
    "@vercel-internals/types": "1.0.5",
    "@vercel/client": "12.6.5",
    "@vercel/error-utils": "1.0.10",
-    "@vercel/frameworks": "1.4.3",
-    "@vercel/fs-detectors": "4.1.0",
+    "@vercel/frameworks": "1.5.0",
+    "@vercel/fs-detectors": "4.1.1",
    "@vercel/fun": "1.0.4",
    "@vercel/ncc": "0.24.0",
    "@vercel/routing-utils": "2.2.1",
@@ -149,7 +149,7 @@
    "pluralize": "7.0.0",
    "promisepipe": "3.0.0",
    "proxy": "2.0.0",
-    "proxy-agent": "6.1.1",
+    "proxy-agent": "6.3.0",
    "psl": "1.1.31",
    "qr-image": "3.2.0",
    "raw-body": "2.4.1",
--- a/packages/cli/src/commands/bisect/command.ts
+++ b/packages/cli/src/commands/bisect/command.ts
@@ -0,0 +1,69 @@
+import { Command } from '../help';
+import { getPkgName } from '../../util/pkg-name';
+
+export const bisectCommand: Command = {
+  name: 'bisect',
+  description: 'Bisect the current project interactively.',
+  arguments: [],
+  options: [
+    {
+      name: 'bad',
+      description: 'Known bad URL',
+      argument: 'URL',
+      shorthand: 'b',
+      type: 'string',
+      deprecated: false,
+      multi: false,
+    },
+    {
+      name: 'good',
+      description: 'Known good URL',
+      argument: 'URL',
+      shorthand: 'g',
+      type: 'string',
+      deprecated: false,
+      multi: false,
+    },
+    {
+      name: 'open',
+      description: 'Automatically open each URL in the browser',
+      argument: 'URL',
+      shorthand: 'o',
+      type: 'string',
+      deprecated: false,
+      multi: false,
+    },
+    {
+      name: 'path',
+      description: 'Subpath of the deployment URL to test',
+      argument: 'URL',
+      shorthand: 'p',
+      type: 'string',
+      deprecated: false,
+      multi: false,
+    },
+    {
+      name: 'run',
+      description: 'Test script to run for each deployment',
+      argument: 'URL',
+      shorthand: 'r',
+      type: 'string',
+      deprecated: false,
+      multi: false,
+    },
+  ],
+  examples: [
+    {
+      name: 'Bisect the current project interactively',
+      value: `${getPkgName()} bisect`,
+    },
+    {
+      name: 'Bisect with a known bad deployment',
+      value: `${getPkgName()} bisect --bad example-310pce9i0.vercel.app`,
+    },
+    {
+      name: 'Automated bisect with a run script',
+      value: `${getPkgName()} bisect --run ./test.sh`,
+    },
+  ],
+};
--- a/packages/cli/src/commands/bisect/index.ts
+++ b/packages/cli/src/commands/bisect/index.ts
@@ -8,53 +8,19 @@ import { URLSearchParams, parse } from 'url';
 import box from '../../util/output/box';
 import formatDate from '../../util/format-date';
 import link from '../../util/output/link';
-import logo from '../../util/output/logo';
 import getArgs from '../../util/get-args';
 import Client from '../../util/client';
-import { getPkgName } from '../../util/pkg-name';
 import { Deployment } from '@vercel-internals/types';
 import { normalizeURL } from '../../util/bisect/normalize-url';
 import getScope from '../../util/get-scope';
 import getDeployment from '../../util/get-deployment';
+import { help } from '../help';
+import { bisectCommand } from './command';

 interface Deployments {
  deployments: Deployment[];
 }
-
-const pkgName = getPkgName();
-
-const help = () => {
-  console.log(`
-  ${chalk.bold(`${logo} ${pkgName} bisect`)} [options]
-
-  ${chalk.dim('Options:')}
-
-    -h, --help                 Output usage information
-    -d, --debug                Debug mode [off]
-    --no-color                 No color mode [off]
-    -b, --bad                  Known bad URL
-    -g, --good                 Known good URL
-    -o, --open                 Automatically open each URL in the browser
-    -p, --path                 Subpath of the deployment URL to test
-    -r, --run                  Test script to run for each deployment
-
-  ${chalk.dim('Examples:')}
-
-  ${chalk.gray('–')} Bisect the current project interactively
-
-      ${chalk.cyan(`$ ${pkgName} bisect`)}
-
-  ${chalk.gray('–')} Bisect with a known bad deployment
-
-      ${chalk.cyan(`$ ${pkgName} bisect --bad example-310pce9i0.vercel.app`)}
-
-  ${chalk.gray('–')} Automated bisect with a run script
-
-      ${chalk.cyan(`$ ${pkgName} bisect --run ./test.sh`)}
-  `);
-};
-
-export default async function main(client: Client): Promise<number> {
+export default async function bisect(client: Client): Promise<number> {
  const { output } = client;
  const scope = await getScope(client);
  const { contextName } = scope;
@@ -73,7 +39,7 @@ export default async function main(client: Client): Promise<number> {
  });

  if (argv['--help']) {
-    help();
+    output.print(help(bisectCommand, { columns: client.stderr.columns }));
    return 2;
  }

--- a/packages/cli/src/commands/dev/dev.ts
+++ b/packages/cli/src/commands/dev/dev.ts
@@ -57,12 +57,13 @@ export default async function dev(

  let projectSettings: ProjectSettings | undefined;
  let envValues: Record<string, string> = {};
+  let repoRoot: string | undefined;
  if (link.status === 'linked') {
-    const { project, org, repoRoot } = link;
+    const { project, org } = link;

    // If repo linked, update `cwd` to the repo root
-    if (repoRoot) {
-      cwd = repoRoot;
+    if (link.repoRoot) {
+      repoRoot = cwd = link.repoRoot;
    }

    client.config.currentTeam = org.type === 'team' ? org.id : undefined;
@@ -82,6 +83,7 @@ export default async function dev(
    output,
    projectSettings,
    envValues,
+    repoRoot,
  });

  // listen to SIGTERM for graceful shutdown
--- a/packages/cli/src/commands/help.ts
+++ b/packages/cli/src/commands/help.ts
@@ -30,6 +30,86 @@ export interface Command {
  examples: CommandExample[];
 }

+const globalCommandOptions: CommandOption[] = [
+  {
+    name: 'help',
+    shorthand: 'h',
+    type: 'string',
+    description: 'Output usage information',
+    deprecated: false,
+    multi: false,
+  },
+  {
+    name: 'version',
+    shorthand: 'v',
+    type: 'string',
+    description: 'Output the version number',
+    deprecated: false,
+    multi: false,
+  },
+  {
+    name: 'cwd',
+    shorthand: null,
+    type: 'string',
+    argument: 'DIR',
+    description:
+      'Sets the current working directory for a single run of a command',
+    deprecated: false,
+    multi: false,
+  },
+  {
+    name: 'local-config',
+    shorthand: 'A',
+    type: 'string',
+    argument: 'FILE',
+    description: 'Path to the local `vercel.json` file',
+    deprecated: false,
+    multi: false,
+  },
+  {
+    name: 'global-config',
+    shorthand: 'Q',
+    type: 'string',
+    argument: 'DIR',
+    description: 'Path to the global `.vercel` directory',
+    deprecated: false,
+    multi: false,
+  },
+  {
+    name: 'debug',
+    shorthand: 'd',
+    type: 'string',
+    description: 'Debug mode (default off)',
+    deprecated: false,
+    multi: false,
+  },
+  {
+    name: 'no-color',
+    shorthand: null,
+    type: 'string',
+    description: 'No color mode (default off)',
+    deprecated: false,
+    multi: false,
+  },
+  {
+    name: 'scope',
+    shorthand: 'S',
+    type: 'string',
+    description: 'Set a custom scope',
+    deprecated: false,
+    multi: false,
+  },
+  {
+    name: 'token',
+    shorthand: 't',
+    type: 'string',
+    argument: 'TOKEN',
+    description: 'Login token',
+    deprecated: false,
+    multi: false,
+  },
+];
+
 export function calcLineLength(line: string[]) {
  return stripAnsi(lineToString(line)).length;
 }
@@ -75,27 +155,32 @@ export function buildCommandSynopsisLine(command: Command) {
 }

 export function buildCommandOptionLines(
-  command: Command,
-  options: BuildHelpOutputOptions
+  commandOptions: CommandOption[],
+  options: BuildHelpOutputOptions,
+  sectionTitle: String
 ) {
  // Filter out deprecated and intentionally undocumented options
-  command.options = command.options.filter(
+  commandOptions = commandOptions.filter(
    option => !option.deprecated && option.description !== undefined
  );

+  if (commandOptions.length === 0) {
+    return '';
+  }
+
  // Initialize output array with header and empty line
-  const outputArray: string[] = [chalk.dim(`Options:`), ''];
+  const outputArray: string[] = [`${chalk.dim(sectionTitle)}:`, ''];

  // Start building option lines
  const optionLines: string[][] = [];
  // Sort command options alphabetically
-  command.options.sort((a, b) =>
+  commandOptions.sort((a, b) =>
    a.name < b.name ? -1 : a.name > b.name ? 1 : 0
  );
  // Keep track of longest "start" of an option line to determine description spacing
  let maxLineStartLength = 0;
  // Iterate over options and create the "start" of each option (e.g. `  -b, --build-env <key=value>`)
-  for (const option of command.options) {
+  for (const option of commandOptions) {
    const startLine: string[] = [INDENT];
    if (option.shorthand) {
      startLine.push(`-${option.shorthand},`);
@@ -135,7 +220,7 @@ export function buildCommandOptionLines(
   */
  for (let i = 0; i < optionLines.length; i++) {
    const optionLine = optionLines[i];
-    const option = command.options[i];
+    const option = commandOptions[i];
    // Add only 2 spaces to the longest line, and then make all shorter lines the same length.
    optionLine.push(
      ' '.repeat(2 + (maxLineStartLength - calcLineLength(optionLine)))
@@ -162,8 +247,6 @@ export function buildCommandOptionLines(
    for (const line of lines) {
      outputArray.push(lineToString(line));
    }
-    // add an empty line in between in each option block for readability (skip the last block)
-    if (i !== optionLines.length - 1) outputArray.push('');
  }

  // return the entire list of options as a single string after delete the last '\n' added to the option list
@@ -209,7 +292,9 @@ export function buildHelpOutput(
    '',
    command.description,
    '',
-    buildCommandOptionLines(command, options),
+    buildCommandOptionLines(command.options, options, 'Options'),
+    '',
+    buildCommandOptionLines(globalCommandOptions, options, 'Global Options'),
    '',
    buildCommandExampleLines(command),
    '',
--- a/packages/cli/src/commands/list.ts
+++ b/packages/cli/src/commands/list.ts
@@ -44,7 +44,9 @@ const help = () => {
    -m, --meta                     Filter deployments by metadata (e.g.: ${chalk.dim(
      '`-m KEY=value`'
    )}). Can appear many times.
-    --prod                         Filter for production URLs
+    --environment=${chalk.bold.underline(
+      'ENVIRONMENT'
+    )}      Filter by environment (production|preview)
    -N, --next                     Show next page of results

  ${chalk.dim('Examples:')}
@@ -76,11 +78,12 @@ export default async function main(client: Client) {

  try {
    argv = getArgs(client.argv.slice(2), {
+      '--environment': String,
      '--meta': [String],
      '-m': '--meta',
      '--next': Number,
      '-N': '--next',
-      '--prod': Boolean,
+      '--prod': Boolean, // this can be deprecated someday
      '--yes': Boolean,
      '-y': '--yes',

@@ -113,9 +116,14 @@ export default async function main(client: Client) {
  }

  const autoConfirm = !!argv['--yes'];
-  const prod = argv['--prod'] || false;
  const meta = parseMeta(argv['--meta']);

+  const target = argv['--prod']
+    ? 'production'
+    : typeof argv['--environment'] === 'string'
+    ? argv['--environment'].toLowerCase()
+    : undefined;
+
  // retrieve `project` and `org` from .vercel
  let link = await getLinkedProject(client, cwd);

@@ -219,15 +227,12 @@ export default async function main(client: Client) {

  debug('Fetching deployments');

-  const response = await now.list(
-    app,
-    {
-      version: 6,
-      meta,
-      nextTimestamp,
-    },
-    prod
-  );
+  const response = await now.list(app, {
+    version: 6,
+    meta,
+    nextTimestamp,
+    target,
+  });

  let {
    deployments,
@@ -280,9 +285,11 @@ export default async function main(client: Client) {
  }

  log(
-    `${prod ? `Production deployments` : `Deployments`} for ${chalk.bold(
-      app
-    )} under ${chalk.bold(contextName)} ${elapsed(Date.now() - start)}`
+    `${
+      target === 'production' ? `Production deployments` : `Deployments`
+    } for ${chalk.bold(app)} under ${chalk.bold(contextName)} ${elapsed(
+      Date.now() - start
+    )}`
  );

  // information to help the user find other deployments or instances
@@ -292,8 +299,9 @@ export default async function main(client: Client) {

  print('\n');

-  const headers = ['Age', 'Deployment', 'Status', 'Duration'];
+  const headers = ['Age', 'Deployment', 'Status', 'Environment', 'Duration'];
  if (showUsername) headers.push('Username');
+  const urls: string[] = [];

  client.output.print(
    `${table(
@@ -301,18 +309,17 @@ export default async function main(client: Client) {
        headers.map(header => chalk.bold(chalk.cyan(header))),
        ...deployments
          .sort(sortRecent())
-          .map(dep => [
-            [
+          .map(dep => {
+            urls.push(`https://${dep.url}`);
+            return [
              chalk.gray(ms(Date.now() - dep.createdAt)),
              `https://${dep.url}`,
              stateString(dep.state || ''),
+              dep.target === 'production' ? 'Production' : 'Preview',
              chalk.gray(getDeploymentDuration(dep)),
              showUsername ? chalk.gray(dep.creator?.username) : '',
-            ],
-          ])
-          // flatten since the previous step returns a nested
-          // array of the deployment and (optionally) its instances
-          .flat()
+            ];
+          })
          .filter(app =>
            // if an app wasn't supplied to filter by,
            // we only want to render one deployment per app
@@ -327,6 +334,11 @@ export default async function main(client: Client) {
    ).replace(/^/gm, '  ')}\n\n`
  );

+  if (!client.stdout.isTTY) {
+    client.stdout.write(urls.join('\n'));
+    client.stdout.write('\n');
+  }
+
  if (pagination && pagination.count === 20) {
    const flags = getCommandFlags(argv, ['_', '--next']);
    log(
--- a/packages/cli/src/commands/pull.ts
+++ b/packages/cli/src/commands/pull.ts
@@ -35,6 +35,7 @@ const help = () => {
    'DIR'
  )}    Path to the global ${'`.vercel`'} directory
    -d, --debug                    Debug mode [off]
+    --git-branch                   Specify the Git branch to pull specific Environment Variables for
    --no-color                     No color mode [off]
    --environment [environment]    Deployment environment [development]
    -y, --yes                      Skip questions when setting up new project using default scope and settings
--- a/packages/cli/src/commands/remove/command.ts
+++ b/packages/cli/src/commands/remove/command.ts
@@ -0,0 +1,45 @@
+import { Command } from '../help';
+import { getPkgName } from '../../util/pkg-name';
+
+export const removeCommand: Command = {
+  name: 'remove',
+  description: 'Remove a deployment by name or id.',
+  arguments: [
+    {
+      name: '...deploymentId|deploymentName',
+      required: true,
+    },
+  ],
+  options: [
+    {
+      name: 'yes',
+      shorthand: 'y',
+      type: 'boolean',
+      deprecated: false,
+      description: 'Skip confirmation',
+      multi: false,
+    },
+    {
+      name: 'safe',
+      shorthand: 's',
+      type: 'boolean',
+      deprecated: false,
+      description: 'Skip deployments with an active alias',
+      multi: false,
+    },
+  ],
+  examples: [
+    {
+      name: 'Remove a deployment identified by `deploymentId`',
+      value: `${getPkgName()} remove my-app`,
+    },
+    {
+      name: 'Remove all deployments with name `my-app`',
+      value: `${getPkgName()} remove deploymentId`,
+    },
+    {
+      name: 'Remove two deployments with IDs `eyWt6zuSdeus` and `uWHoA9RQ1d1o`',
+      value: `${getPkgName()} remove eyWt6zuSdeus uWHoA9RQ1d1o`,
+    },
+  ],
+};
--- a/packages/cli/src/commands/remove/index.ts
+++ b/packages/cli/src/commands/remove/index.ts
@@ -2,74 +2,31 @@ import chalk from 'chalk';
 import ms from 'ms';
 import plural from 'pluralize';
 import table from 'text-table';
-import Now from '../util';
-import getAliases from '../util/alias/get-aliases';
-import logo from '../util/output/logo';
-import elapsed from '../util/output/elapsed';
-import { normalizeURL } from '../util/url';
-import getScope from '../util/get-scope';
-import { isValidName } from '../util/is-valid-name';
-import removeProject from '../util/projects/remove-project';
-import getProjectByIdOrName from '../util/projects/get-project-by-id-or-name';
-import getDeployment from '../util/get-deployment';
-import getDeploymentsByProjectId from '../util/deploy/get-deployments-by-project-id';
-import { getPkgName, getCommandName } from '../util/pkg-name';
-import getArgs from '../util/get-args';
-import handleError from '../util/handle-error';
-import type Client from '../util/client';
-import { Output } from '../util/output';
+import Now from '../../util';
+import getAliases from '../../util/alias/get-aliases';
+import elapsed from '../../util/output/elapsed';
+import { normalizeURL } from '../../util/url';
+import getScope from '../../util/get-scope';
+import { isValidName } from '../../util/is-valid-name';
+import removeProject from '../../util/projects/remove-project';
+import getProjectByIdOrName from '../../util/projects/get-project-by-id-or-name';
+import getDeployment from '../../util/get-deployment';
+import getDeploymentsByProjectId from '../../util/deploy/get-deployments-by-project-id';
+import { getCommandName } from '../../util/pkg-name';
+import getArgs from '../../util/get-args';
+import handleError from '../../util/handle-error';
+import type Client from '../../util/client';
+import { Output } from '../../util/output';
 import { Alias, Deployment, Project } from '@vercel-internals/types';
-import { NowError } from '../util/now-error';
+import { NowError } from '../../util/now-error';
+import { help } from '../help';
+import { removeCommand } from './command';

 type DeploymentWithAliases = Deployment & {
  aliases: Alias[];
 };

-const help = () => {
-  console.log(`
-  ${chalk.bold(
-    `${logo} ${getPkgName()} remove`
-  )} [...deploymentId|deploymentName]
-
-  ${chalk.dim('Options:')}
-
-    -h, --help                     Output usage information
-    -A ${chalk.bold.underline('FILE')}, --local-config=${chalk.bold.underline(
-    'FILE'
-  )}   Path to the local ${'`vercel.json`'} file
-    -Q ${chalk.bold.underline('DIR')}, --global-config=${chalk.bold.underline(
-    'DIR'
-  )}    Path to the global ${'`.vercel`'} directory
-    -d, --debug                    Debug mode [off]
-    --no-color                     No color mode [off]
-    -t ${chalk.bold.underline('TOKEN')}, --token=${chalk.bold.underline(
-    'TOKEN'
-  )}        Login token
-    -y, --yes                      Skip confirmation
-    -s, --safe                     Skip deployments with an active alias
-    -S, --scope                    Set a custom scope
-
-  ${chalk.dim('Examples:')}
-
-  ${chalk.gray('–')} Remove a deployment identified by ${chalk.dim(
-    '`deploymentId`'
-  )}
-
-    ${chalk.cyan(`$ ${getPkgName()} rm deploymentId`)}
-
-  ${chalk.gray('–')} Remove all deployments with name ${chalk.dim('`my-app`')}
-
-    ${chalk.cyan(`$ ${getPkgName()} rm my-app`)}
-
-  ${chalk.gray('–')} Remove two deployments with IDs ${chalk.dim(
-    '`eyWt6zuSdeus`'
-  )} and ${chalk.dim('`uWHoA9RQ1d1o`')}
-
-    ${chalk.cyan(`$ ${getPkgName()} rm eyWt6zuSdeus uWHoA9RQ1d1o`)}
-`);
-};
-
-export default async function main(client: Client) {
+export default async function remove(client: Client) {
  let argv;

  try {
@@ -98,13 +55,13 @@ export default async function main(client: Client) {
  const { success, error, log } = output;

  if (argv['--help'] || ids[0] === 'help') {
-    help();
+    output.print(help(removeCommand, { columns: client.stderr.columns }));
    return 2;
  }

  if (ids.length < 1) {
    error(`${getCommandName('rm')} expects at least one argument`);
-    help();
+    output.print(help(removeCommand, { columns: client.stderr.columns }));
    return 1;
  }

--- a/packages/cli/src/util/dev/server.ts
+++ b/packages/cli/src/util/dev/server.ts
@@ -32,7 +32,7 @@ import {
  Builder,
  cloneEnv,
  Env,
-  getNodeBinPath,
+  getNodeBinPaths,
  StartDevServerResult,
  FileFsRef,
  PackageJson,
@@ -124,6 +124,7 @@ function sortBuilders(buildA: Builder, buildB: Builder) {

 export default class DevServer {
  public cwd: string;
+  public repoRoot: string;
  public output: Output;
  public proxy: httpProxy;
  public envConfigs: EnvConfigs;
@@ -169,6 +170,7 @@ export default class DevServer {

  constructor(cwd: string, options: DevServerOptions) {
    this.cwd = cwd;
+    this.repoRoot = options.repoRoot ?? cwd;
    this.output = options.output;
    this.envConfigs = { buildEnv: {}, runEnv: {}, allEnv: {} };
    this.envValues = options.envValues || {};
@@ -1412,7 +1414,7 @@ export default class DevServer {
            files,
            entrypoint: middleware.entrypoint,
            workPath,
-            repoRootPath: this.cwd,
+            repoRootPath: this.repoRoot,
            config: middleware.config || {},
            meta: {
              isDev: true,
@@ -1849,7 +1851,7 @@ export default class DevServer {
          entrypoint: match.entrypoint,
          workPath,
          config: match.config || {},
-          repoRootPath: this.cwd,
+          repoRootPath: this.repoRoot,
          meta: {
            isDev: true,
            requestPath,
@@ -2237,7 +2239,8 @@ export default class DevServer {
    );

    // add the node_modules/.bin directory to the PATH
-    const nodeBinPath = await getNodeBinPath({ cwd });
+    const nodeBinPaths = getNodeBinPaths({ base: this.repoRoot, start: cwd });
+    const nodeBinPath = nodeBinPaths.join(path.delimiter);
    env.PATH = `${nodeBinPath}${path.delimiter}${env.PATH}`;

    // This is necesary so that the dev command in the Project
--- a/packages/cli/src/util/dev/types.ts
+++ b/packages/cli/src/util/dev/types.ts
@@ -25,6 +25,7 @@ export interface DevServerOptions {
  output: Output;
  projectSettings?: ProjectSettings;
  envValues?: Record<string, string>;
+  repoRoot?: string;
 }

 export interface EnvConfigs {
--- a/packages/cli/src/util/index.ts
+++ b/packages/cli/src/util/index.ts
@@ -61,6 +61,7 @@ export interface ListOptions {
  version?: number;
  meta?: Dictionary<string>;
  nextTimestamp?: number;
+  target?: string;
 }

 export default class Now extends EventEmitter {
@@ -339,7 +340,7 @@ export default class Now extends EventEmitter {

  async list(
    app?: string,
-    { version = 4, meta = {}, nextTimestamp }: ListOptions = {},
+    { version = 4, meta = {}, nextTimestamp, target }: ListOptions = {},
    prod?: boolean
  ) {
    const fetchRetry = async (url: string, options: FetchOptions = {}) => {
@@ -405,6 +406,8 @@ export default class Now extends EventEmitter {
    }
    if (prod) {
      query.set('target', 'production');
+    } else if (target) {
+      query.set('target', target);
    }

    const response = await fetchRetry(`/v${version}/now/deployments?${query}`);
--- a/packages/cli/src/util/link/repo.ts
+++ b/packages/cli/src/util/link/repo.ts
@@ -15,6 +15,7 @@ import { emoji, prependEmoji } from '../emoji';
 import selectOrg from '../input/select-org';
 import { addToGitIgnore } from './add-to-gitignore';
 import type Client from '../client';
+import type { Framework } from '@vercel/frameworks';
 import type { Project } from '@vercel-internals/types';
 import createProject from '../projects/create-project';
 import { detectProjects } from '../projects/detect-projects';
@@ -90,7 +91,7 @@ export async function ensureRepoLink(
    // they will be ready by the time the projects are listed
    const detectedProjectsPromise = detectProjects(rootPath).catch(err => {
      output.debug(`Failed to detect local projects: ${err}`);
-      return new Map<string, string>();
+      return new Map<string, Framework[]>();
    });

    // Not yet linked, so prompt user to begin linking
@@ -187,17 +188,21 @@ export async function ensureRepoLink(
      detectedProjects.delete(project.rootDirectory ?? '');
    }

-    if (detectedProjects.size > 0) {
+    const detectedProjectsCount = Array.from(detectedProjects.values()).reduce(
+      (o, f) => o + f.length,
+      0
+    );
+    if (detectedProjectsCount > 0) {
      output.log(
        `Detected ${pluralize(
          'new Project',
-          detectedProjects.size,
+          detectedProjectsCount,
          true
        )} that may be created.`
      );
    }

-    const addSeparators = projects.length > 0 && detectedProjects.size > 0;
+    const addSeparators = projects.length > 0 && detectedProjectsCount > 0;
    const { selected } = await client.prompt({
      type: 'checkbox',
      name: 'selected',
@@ -218,23 +223,30 @@ export async function ensureRepoLink(
        ...(addSeparators
          ? [new inquirer.Separator('----- New Projects to be created -----')]
          : []),
-        ...Array.from(detectedProjects.entries()).map(
-          ([rootDirectory, framework]) => {
-            const name = slugify(
-              [basename(rootPath), basename(rootDirectory)]
-                .filter(Boolean)
-                .join('-')
-            );
-            return {
-              name: `${org.slug}/${name} (${framework})`,
-              value: {
-                newProject: true,
-                rootDirectory,
-                name,
-                framework,
-              },
-            };
-          }
+        ...Array.from(detectedProjects.entries()).flatMap(
+          ([rootDirectory, frameworks]) =>
+            frameworks.map((framework, i) => {
+              const name = slugify(
+                [
+                  basename(rootPath),
+                  basename(rootDirectory),
+                  i > 0 ? framework.slug : '',
+                ]
+                  .filter(Boolean)
+                  .join('-')
+              );
+              return {
+                name: `${org.slug}/${name} (${framework.name})`,
+                value: {
+                  newProject: true,
+                  rootDirectory,
+                  name,
+                  framework,
+                },
+                // Checked by default when there are no other existing Projects
+                checked: projects.length === 0,
+              };
+            })
        ),
      ],
    });
@@ -251,7 +263,10 @@ export async function ensureRepoLink(
      output.spinner(`Creating new Project: ${orgAndName}`);
      delete selection.newProject;
      if (!selection.rootDirectory) delete selection.rootDirectory;
-      selected[i] = await createProject(client, selection);
+      selected[i] = await createProject(client, {
+        ...selection,
+        framework: selection.framework.slug,
+      });
      await connectGitProvider(
        client,
        org,
@@ -262,7 +277,8 @@ export async function ensureRepoLink(
      output.log(
        `Created new Project: ${output.link(
          orgAndName,
-          `https://vercel.com/${orgAndName}`
+          `https://vercel.com/${orgAndName}`,
+          { fallback: false }
        )}`
      );
    }
@@ -287,9 +303,11 @@ export async function ensureRepoLink(

    output.print(
      prependEmoji(
-        `Linked to ${repoUrlLink} under ${chalk.bold(
-          org.slug
-        )} (created ${VERCEL_DIR}${
+        `Linked to ${pluralize(
+          'Project',
+          selected.length,
+          true
+        )} under ${chalk.bold(org.slug)} (created ${VERCEL_DIR}${
          isGitIgnoreUpdated ? ' and added it to .gitignore' : ''
        })`,
        emoji('link')
--- a/packages/cli/src/util/projects/detect-projects.ts
+++ b/packages/cli/src/util/projects/detect-projects.ts
@@ -1,7 +1,7 @@
 import { join } from 'path';
-import frameworks from '@vercel/frameworks';
+import frameworkList, { Framework } from '@vercel/frameworks';
 import {
-  detectFramework,
+  detectFrameworks,
  getWorkspacePackagePaths,
  getWorkspaces,
  LocalFileSystemDetector,
@@ -10,7 +10,7 @@ import {
 export async function detectProjects(cwd: string) {
  const fs = new LocalFileSystemDetector(cwd);
  const workspaces = await getWorkspaces({ fs });
-  const detectedProjects = new Map<string, string>();
+  const detectedProjects = new Map<string, Framework[]>();
  const packagePaths = (
    await Promise.all(
      workspaces.map(workspace =>
@@ -26,12 +26,12 @@ export async function detectProjects(cwd: string) {
  }
  await Promise.all(
    packagePaths.map(async p => {
-      const framework = await detectFramework({
+      const frameworks = await detectFrameworks({
        fs: fs.chdir(join('.', p)),
-        frameworkList: frameworks,
+        frameworkList,
      });
-      if (!framework) return;
-      detectedProjects.set(p.slice(1), framework);
+      if (frameworks.length === 0) return;
+      detectedProjects.set(p.slice(1), frameworks);
    })
  );
  return detectedProjects;
--- a/packages/cli/test/fixtures/unit/commands/build/storybook-with-middleware/.vercel/project.json
+++ b/packages/cli/test/fixtures/unit/commands/build/storybook-with-middleware/.vercel/project.json
@@ -2,8 +2,6 @@
  "orgId": ".",
  "projectId": ".",
  "settings": {
-    "framework": "storybook",
-    "buildCommand": "npm run build-storybook",
-    "outputDirectory": "storybook-static"
+    "framework": "storybook"
  }
 }
--- a/packages/cli/test/unit/commands/snapshots/help.test.ts.snap
+++ b/packages/cli/test/unit/commands/snapshots/help.test.ts.snap
@@ -5,7 +5,7 @@ exports[`help command help output snapshots column width 40 1`] = `

 Deploy your project to Vercel. The \`deploy\` command is the default command for the Vercel CLI, and can be omitted (\`vc deploy my-app\` equals \`vc my-app\`).

-[2mOptions:[22m
+[2mOptions[22m:

  --archive                    Compress
                               the
@@ -15,7 +15,6 @@ Deploy your project to Vercel. The \`deploy\` command is the default command for
                               before
                               uploading
                               it
-
  -b, --build-env <key=value>  Specify
                               environment
                               variables
@@ -25,7 +24,6 @@ Deploy your project to Vercel. The \`deploy\` command is the default command for
                               KEY1=value1
                               -b
                               KEY2=value2\`)
-
  -e, --env <key=value>        Specify
                               environment
                               variables
@@ -35,7 +33,6 @@ Deploy your project to Vercel. The \`deploy\` command is the default command for
                               KEY1=value1
                               -e
                               KEY2=value2\`)
-
  -f, --force                  Force a
                               new
                               deployment
@@ -43,7 +40,6 @@ Deploy your project to Vercel. The \`deploy\` command is the default command for
                               nothing
                               has
                               changed
-
  -m, --meta <key=value>       Specify
                               metadata
                               for the
@@ -52,13 +48,11 @@ Deploy your project to Vercel. The \`deploy\` command is the default command for
                               KEY1=value1
                               -m
                               KEY2=value2\`)
-
  --no-wait                    Don't
                               wait for
                               the
                               deployment
                               to finish
-
  --prebuilt                   Use in
                               combination
                               with \`vc
@@ -66,18 +60,15 @@ Deploy your project to Vercel. The \`deploy\` command is the default command for
                               Deploy an
                               existing
                               build
-
  --prod                       Create a
                               production
                               deployment
-
  -p, --public                 
                               Deployment
                               is public
                               (\`/_src\`)
                               is
                               exposed)
-
  --regions                    Set
                               default
                               regions
@@ -85,14 +76,12 @@ Deploy your project to Vercel. The \`deploy\` command is the default command for
                               the
                               deployment
                               on
-
  --with-cache                 Retain
                               build
                               cache
                               when
                               using
                               "--force"
-
  -y, --yes                    Use
                               default
                               options
@@ -100,6 +89,42 @@ Deploy your project to Vercel. The \`deploy\` command is the default command for
                               all
                               prompts

+[2mGlobal Options[22m:
+
+  --cwd <DIR>                Sets the
+                             current
+                             working
+                             directory
+                             for a
+                             single run
+                             of a
+                             command
+  -d, --debug                Debug mode
+                             (default
+                             off)
+  -Q, --global-config <DIR>  Path to the
+                             global
+                             \`.vercel\`
+                             directory
+  -h, --help                 Output
+                             usage
+                             information
+  -A, --local-config <FILE>  Path to the
+                             local
+                             \`vercel.json\`
+                             file
+  --no-color                 No color
+                             mode
+                             (default
+                             off)
+  -S, --scope                Set a
+                             custom
+                             scope
+  -t, --token <TOKEN>        Login token
+  -v, --version              Output the
+                             version
+                             number
+
 [2mExamples:[22m

  [90m-[39m Deploy the current directory
@@ -130,38 +155,40 @@ exports[`help command help output snapshots column width 80 1`] = `

 Deploy your project to Vercel. The \`deploy\` command is the default command for the Vercel CLI, and can be omitted (\`vc deploy my-app\` equals \`vc my-app\`).

-[2mOptions:[22m
+[2mOptions[22m:

  --archive                    Compress the deployment code into a file before
                               uploading it
-
  -b, --build-env <key=value>  Specify environment variables during build-time
                               (e.g. \`-b KEY1=value1 -b KEY2=value2\`)
-
  -e, --env <key=value>        Specify environment variables during run-time
                               (e.g. \`-e KEY1=value1 -e KEY2=value2\`)
-
  -f, --force                  Force a new deployment even if nothing has
                               changed
-
  -m, --meta <key=value>       Specify metadata for the deployment (e.g. \`-m
                               KEY1=value1 -m KEY2=value2\`)
-
  --no-wait                    Don't wait for the deployment to finish
-
  --prebuilt                   Use in combination with \`vc build\`. Deploy an
                               existing build
-
  --prod                       Create a production deployment
-
  -p, --public                 Deployment is public (\`/_src\`) is exposed)
-
  --regions                    Set default regions to enable the deployment on
-
  --with-cache                 Retain build cache when using "--force"
-
  -y, --yes                    Use default options to skip all prompts

+[2mGlobal Options[22m:
+
+  --cwd <DIR>                Sets the current working directory for a single run
+                             of a command
+  -d, --debug                Debug mode (default off)
+  -Q, --global-config <DIR>  Path to the global \`.vercel\` directory
+  -h, --help                 Output usage information
+  -A, --local-config <FILE>  Path to the local \`vercel.json\` file
+  --no-color                 No color mode (default off)
+  -S, --scope                Set a custom scope
+  -t, --token <TOKEN>        Login token
+  -v, --version              Output the version number
+
 [2mExamples:[22m

  [90m-[39m Deploy the current directory
@@ -192,32 +219,33 @@ exports[`help command help output snapshots column width 120 1`] = `

 Deploy your project to Vercel. The \`deploy\` command is the default command for the Vercel CLI, and can be omitted (\`vc deploy my-app\` equals \`vc my-app\`).

-[2mOptions:[22m
+[2mOptions[22m:

  --archive                    Compress the deployment code into a file before uploading it
-
  -b, --build-env <key=value>  Specify environment variables during build-time (e.g. \`-b KEY1=value1 -b KEY2=value2\`)
-
  -e, --env <key=value>        Specify environment variables during run-time (e.g. \`-e KEY1=value1 -e KEY2=value2\`)
-
  -f, --force                  Force a new deployment even if nothing has changed
-
  -m, --meta <key=value>       Specify metadata for the deployment (e.g. \`-m KEY1=value1 -m KEY2=value2\`)
-
  --no-wait                    Don't wait for the deployment to finish
-
  --prebuilt                   Use in combination with \`vc build\`. Deploy an existing build
-
  --prod                       Create a production deployment
-
  -p, --public                 Deployment is public (\`/_src\`) is exposed)
-
  --regions                    Set default regions to enable the deployment on
-
  --with-cache                 Retain build cache when using "--force"
-
  -y, --yes                    Use default options to skip all prompts

+[2mGlobal Options[22m:
+
+  --cwd <DIR>                Sets the current working directory for a single run of a command
+  -d, --debug                Debug mode (default off)
+  -Q, --global-config <DIR>  Path to the global \`.vercel\` directory
+  -h, --help                 Output usage information
+  -A, --local-config <FILE>  Path to the local \`vercel.json\` file
+  --no-color                 No color mode (default off)
+  -S, --scope                Set a custom scope
+  -t, --token <TOKEN>        Login token
+  -v, --version              Output the version number
+
 [2mExamples:[22m

  [90m-[39m Deploy the current directory
--- a/packages/cli/test/unit/commands/list.test.ts
+++ b/packages/cli/test/unit/commands/list.test.ts
@@ -58,6 +58,7 @@ describe('list', () => {
      'Age',
      'Deployment',
      'Status',
+      'Environment',
      'Duration',
      'Username',
    ]);
@@ -68,6 +69,7 @@ describe('list', () => {
    expect(data).toEqual([
      `https://${deployment.url}`,
      stateString(deployment.state || ''),
+      deployment.target === 'production' ? 'Production' : 'Preview',
      getDeploymentDuration(deployment),
      user.username,
    ]);
@@ -107,7 +109,13 @@ describe('list', () => {

    line = await lines.next();
    const header = parseSpacedTableRow(line.value!);
-    expect(header).toEqual(['Age', 'Deployment', 'Status', 'Duration']);
+    expect(header).toEqual([
+      'Age',
+      'Deployment',
+      'Status',
+      'Environment',
+      'Duration',
+    ]);

    line = await lines.next();
    const data = parseSpacedTableRow(line.value!);
@@ -116,6 +124,7 @@ describe('list', () => {
    expect(data).toEqual([
      'https://' + deployment.url,
      stateString(deployment.state || ''),
+      deployment.target === 'production' ? 'Production' : 'Preview',
      getDeploymentDuration(deployment),
    ]);
  });
@@ -160,6 +169,7 @@ describe('list', () => {
      'Age',
      'Deployment',
      'Status',
+      'Environment',
      'Duration',
      'Username',
    ]);
@@ -170,8 +180,50 @@ describe('list', () => {
    expect(data).toEqual([
      `https://${deployment.url}`,
      stateString(deployment.state || ''),
+      deployment.target === 'production' ? 'Production' : 'Preview',
      getDeploymentDuration(deployment),
      user.username,
    ]);
  });
+
+  it('should output deployment URLs to stdout', async () => {
+    const user = useUser();
+    useProject({
+      ...defaultProject,
+      id: 'with-team',
+      name: 'with-team',
+    });
+    const prodDeployment = useDeployment({
+      creator: user,
+      createdAt: Date.now() - 1000,
+      target: 'production',
+    });
+    const previewDeployment = useDeployment({
+      creator: user,
+      createdAt: Date.now(),
+      target: undefined,
+    });
+
+    client.stdout.isTTY = false;
+    client.cwd = fixture('with-team');
+
+    // run with all deployments
+    let prom = list(client);
+    await expect(client.stdout).toOutput(
+      `https://${previewDeployment.url}\nhttps://${prodDeployment.url}`
+    );
+    await prom;
+
+    // run again with preview deployments only
+    client.setArgv('--environment', 'preview');
+    prom = list(client);
+    await expect(client.stdout).toOutput(`https://${previewDeployment.url}`);
+    await prom;
+
+    // run again with production deployments only
+    client.setArgv('--environment', 'production');
+    prom = list(client);
+    await expect(client.stdout).toOutput(`https://${prodDeployment.url}`);
+    await prom;
+  });
 });
--- a/packages/cli/test/unit/util/projects/detect-projects.test.ts
+++ b/packages/cli/test/unit/util/projects/detect-projects.test.ts
@@ -1,4 +1,5 @@
 import { join } from 'path';
+import type { Framework } from '@vercel/frameworks';
 import { detectProjects } from '../../../../src/util/projects/detect-projects';

 const REPO_ROOT = join(__dirname, '../../../../../..');
@@ -8,23 +9,35 @@ const FS_DETECTORS_FIXTURES = join(
  'packages/fs-detectors/test/fixtures'
 );

+function mapDetected(
+  detected: Map<string, Framework[]>
+): Array<[string, string[]]> {
+  return [...detected.entries()]
+    .sort((a, b) => a[0].localeCompare(b[0]))
+    .map(([dir, frameworks]) => [dir, frameworks.map(f => f.slug as string)]);
+}
+
 describe('detectProjects()', () => {
-  it('should match "nextjs" example', async () => {
+  it('should match 1 Project in "nextjs" example', async () => {
    const dir = join(EXAMPLES_DIR, 'nextjs');
    const detected = await detectProjects(dir);
-    expect([...detected.entries()]).toEqual([['', 'nextjs']]);
+    expect(mapDetected(detected)).toEqual([['', ['nextjs']]]);
+  });
+
+  it('should match 2 Projects in "storybook" example', async () => {
+    const dir = join(EXAMPLES_DIR, 'storybook');
+    const detected = await detectProjects(dir);
+    expect(mapDetected(detected)).toEqual([['', ['nextjs', 'storybook']]]);
  });

  it('should match "30-double-nested-workspaces"', async () => {
    const dir = join(FS_DETECTORS_FIXTURES, '30-double-nested-workspaces');
    const detected = await detectProjects(dir);
-    expect(
-      [...detected.entries()].sort((a, b) => a[0].localeCompare(b[0]))
-    ).toEqual([
-      ['packages/backend/c', 'remix'],
-      ['packages/backend/d', 'nextjs'],
-      ['packages/frontend/a', 'hexo'],
-      ['packages/frontend/b', 'ember'],
+    expect(mapDetected(detected)).toEqual([
+      ['packages/backend/c', ['remix']],
+      ['packages/backend/d', ['nextjs']],
+      ['packages/frontend/a', ['hexo']],
+      ['packages/frontend/b', ['ember']],
    ]);
  });
 });
--- a/packages/frameworks/CHANGELOG.md
+++ b/packages/frameworks/CHANGELOG.md
@@ -1,5 +1,13 @@
 # @vercel/frameworks

+## 1.5.0
+
+### Minor Changes
+
+- Add `ignorePackageJsonScript` configuration for Framework command settings to ignore the `package.json` script. ([#10228](https://github.com/vercel/vercel/pull/10228))
+
+  Enable this mode for Storybook's `buildCommand`, since it should not invoke the "build" script, which is most likely designated for the frontend app build.
+
 ## 1.4.3

 ### Patch Changes
--- a/packages/frameworks/package.json
+++ b/packages/frameworks/package.json
@@ -1,6 +1,6 @@
 {
  "name": "@vercel/frameworks",
-  "version": "1.4.3",
+  "version": "1.5.0",
  "main": "./dist/frameworks.js",
  "types": "./dist/frameworks.d.ts",
  "files": [
--- a/packages/frameworks/src/frameworks.ts
+++ b/packages/frameworks/src/frameworks.ts
@@ -1955,6 +1955,7 @@ export const frameworks = [
      },
      buildCommand: {
        value: 'storybook build',
+        ignorePackageJsonScript: true,
      },
      devCommand: {
        value: `storybook dev -p $PORT`,
--- a/packages/frameworks/src/types.ts
+++ b/packages/frameworks/src/types.ts
@@ -32,11 +32,24 @@ export interface SettingPlaceholder {

 export interface SettingValue {
  /**
-   * A predefined setting for the detected framework
+   * A predefined setting for the detected framework.
   * @example "next dev --port $PORT"
   */
  value: string | null;
+  /**
+   * Placeholder text that may be shown in the UI when
+   * the user is configuring this setting value.
+   * @example "`npm run build` or `next build`"
+   */
  placeholder?: string;
+  /**
+   * When set to `true`, then the builder will not
+   * invoke the equivalent script in `package.json`,
+   * and instead will invoke the command specified in
+   * configuration setting directly. When this
+   * configuration is enabled, `value` must be a string.
+   */
+  ignorePackageJsonScript?: boolean;
 }

 export type Setting = SettingValue | SettingPlaceholder;
--- a/packages/frameworks/test/frameworks.unit.test.ts
+++ b/packages/frameworks/test/frameworks.unit.test.ts
@@ -49,6 +49,22 @@ const SchemaSettings = {
        },
      },
    },
+    {
+      type: 'object',
+      required: ['value', 'ignorePackageJsonScript'],
+      additionalProperties: false,
+      properties: {
+        value: {
+          type: 'string',
+        },
+        placeholder: {
+          type: 'string',
+        },
+        ignorePackageJsonScript: {
+          type: 'boolean',
+        },
+      },
+    },
    {
      type: 'object',
      required: ['placeholder'],
--- a/packages/fs-detectors/CHANGELOG.md
+++ b/packages/fs-detectors/CHANGELOG.md
@@ -1,5 +1,12 @@
 # @vercel/fs-detectors

+## 4.1.1
+
+### Patch Changes
+
+- Updated dependencies [[`ce4633fe4`](https://github.com/vercel/vercel/commit/ce4633fe4d00cb5c251cdabbfab08f39ec3f3b5f)]:
+  - @vercel/frameworks@1.5.0
+
 ## 4.1.0

 ### Minor Changes
--- a/packages/fs-detectors/package.json
+++ b/packages/fs-detectors/package.json
@@ -1,6 +1,6 @@
 {
  "name": "@vercel/fs-detectors",
-  "version": "4.1.0",
+  "version": "4.1.1",
  "description": "Vercel filesystem detectors",
  "main": "./dist/index.js",
  "types": "./dist/index.d.ts",
@@ -21,7 +21,7 @@
  },
  "dependencies": {
    "@vercel/error-utils": "1.0.10",
-    "@vercel/frameworks": "1.4.3",
+    "@vercel/frameworks": "1.5.0",
    "@vercel/routing-utils": "2.2.1",
    "glob": "8.0.3",
    "js-yaml": "4.1.0",
--- a/packages/gatsby-plugin-vercel-builder/CHANGELOG.md
+++ b/packages/gatsby-plugin-vercel-builder/CHANGELOG.md
@@ -1,5 +1,19 @@
 # @vercel/gatsby-plugin-vercel-builder

+## 1.3.15
+
+### Patch Changes
+
+- Updated dependencies [[`fc413707d`](https://github.com/vercel/vercel/commit/fc413707d017e234d5013b761d885f65f9b981bc)]:
+  - @vercel/node@2.15.7
+
+## 1.3.14
+
+### Patch Changes
+
+- Updated dependencies [[`b56639b62`](https://github.com/vercel/vercel/commit/b56639b624e9ad1df048a4c85083e26888696060)]:
+  - @vercel/node@2.15.6
+
 ## 1.3.13

 ### Patch Changes
--- a/packages/gatsby-plugin-vercel-builder/package.json
+++ b/packages/gatsby-plugin-vercel-builder/package.json
@@ -1,6 +1,6 @@
 {
  "name": "@vercel/gatsby-plugin-vercel-builder",
-  "version": "1.3.13",
+  "version": "1.3.15",
  "main": "dist/index.js",
  "files": [
    "dist",
@@ -21,7 +21,7 @@
  "dependencies": {
    "@sinclair/typebox": "0.25.24",
    "@vercel/build-utils": "6.8.2",
-    "@vercel/node": "2.15.5",
+    "@vercel/node": "2.15.7",
    "@vercel/routing-utils": "2.2.1",
    "esbuild": "0.14.47",
    "etag": "1.8.1",
--- a/packages/next/CHANGELOG.md
+++ b/packages/next/CHANGELOG.md
@@ -1,5 +1,33 @@
 # @vercel/next

+## 3.9.3
+
+### Patch Changes
+
+- fix dynamic not found pages ([#10262](https://github.com/vercel/vercel/pull/10262))
+
+## 3.9.2
+
+### Patch Changes
+
+- Fix pages/404 gsp + i18n case ([#10258](https://github.com/vercel/vercel/pull/10258))
+
+## 3.9.1
+
+### Patch Changes
+
+- Fix pages and app router i18n handling ([#10243](https://github.com/vercel/vercel/pull/10243))
+
+## 3.9.0
+
+### Minor Changes
+
+- Support maxDuration in Next.js deployments ([#10069](https://github.com/vercel/vercel/pull/10069))
+
+### Patch Changes
+
+- Fix 404 page in edge runtime ([#10223](https://github.com/vercel/vercel/pull/10223))
+
 ## 3.8.8

 ### Patch Changes
--- a/packages/next/package.json
+++ b/packages/next/package.json
@@ -1,6 +1,6 @@
 {
  "name": "@vercel/next",
-  "version": "3.8.8",
+  "version": "3.9.3",
  "license": "Apache-2.0",
  "main": "./dist/index",
  "homepage": "https://vercel.com/docs/runtimes#official-runtimes/next-js",
--- a/packages/next/src/index.ts
+++ b/packages/next/src/index.ts
@@ -90,6 +90,7 @@ import {
  validateEntrypoint,
  getOperationType,
  isApiPage,
+  getFunctionsConfigManifest,
 } from './utils';

 export const version = 2;
@@ -272,7 +273,7 @@ export const build: BuildV2 = async ({
  });

  let hasLegacyRoutes = false;
-  const hasFunctionsConfig = !!config.functions;
+  const hasFunctionsConfig = Boolean(config.functions);

  if (await pathExists(dotNextStatic)) {
    console.warn('WARNING: You should not upload the `.next` directory.');
@@ -487,7 +488,12 @@ export const build: BuildV2 = async ({
    ? await getRequiredServerFilesManifest(entryPath, outputDirectory)
    : false;

-  isServerMode = !!requiredServerFilesManifest;
+  isServerMode = Boolean(requiredServerFilesManifest);
+
+  const functionsConfigManifest = await getFunctionsConfigManifest(
+    entryPath,
+    outputDirectory
+  );

  const routesManifest = await getRoutesManifest(
    entryPath,
@@ -1133,8 +1139,9 @@ export const build: BuildV2 = async ({
    const canUsePreviewMode = Object.keys(pages).some(page =>
      isApiPage(pages[page].fsPath)
    );
-    staticPages = await filterStaticPages(
-      await glob('**/*.html', pagesDir),
+    const originalStaticPages = await glob('**/*.html', pagesDir);
+    staticPages = filterStaticPages(
+      originalStaticPages,
      dynamicPages,
      entryDirectory,
      htmlContentType,
@@ -1310,14 +1317,27 @@ export const build: BuildV2 = async ({
        );
      }

+      const localePrefixed404 = !!(
+        routesManifest.i18n &&
+        originalStaticPages[
+          path.posix.join(
+            entryDirectory,
+            routesManifest.i18n.defaultLocale,
+            '404.html'
+          )
+        ]
+      );
+
      return serverBuild({
        config,
+        functionsConfigManifest,
        nextVersion,
        trailingSlash,
        appPathRoutesManifest,
        dynamicPages,
        canUsePreviewMode,
        staticPages,
+        localePrefixed404,
        lambdaPages: pages,
        lambdaAppPaths,
        omittedPrerenderRoutes,
@@ -1570,6 +1590,7 @@ export const build: BuildV2 = async ({
      const initialPageLambdaGroups = await getPageLambdaGroups({
        entryPath,
        config,
+        functionsConfigManifest,
        pages: nonApiPages,
        prerenderRoutes: new Set(),
        pageTraces,
@@ -1586,6 +1607,7 @@ export const build: BuildV2 = async ({
      const initialApiLambdaGroups = await getPageLambdaGroups({
        entryPath,
        config,
+        functionsConfigManifest,
        pages: apiPages,
        prerenderRoutes: new Set(),
        pageTraces,
@@ -2670,6 +2692,7 @@ async function getServerlessPages(params: {
      ? Promise.all([
          glob('**/page.js', path.join(params.pagesDir, '../app')),
          glob('**/route.js', path.join(params.pagesDir, '../app')),
+          glob('**/_not-found.js', path.join(params.pagesDir, '../app')),
        ]).then(items => Object.assign(...items))
      : Promise.resolve({}),
    getMiddlewareManifest(params.entryPath, params.outputDirectory),
--- a/packages/next/src/server-build.ts
+++ b/packages/next/src/server-build.ts
@@ -44,6 +44,7 @@ import {
  getFilesMapFromReasons,
  UnwrapPromise,
  getOperationType,
+  FunctionsConfigManifestV1,
 } from './utils';
 import {
  nodeFileTrace,
@@ -66,6 +67,7 @@ export async function serverBuild({
  dynamicPages,
  pagesDir,
  config = {},
+  functionsConfigManifest,
  privateOutputs,
  baseDir,
  workPath,
@@ -89,6 +91,7 @@ export async function serverBuild({
  routesManifest,
  staticPages,
  lambdaPages,
+  localePrefixed404,
  nextVersion,
  lambdaAppPaths,
  canUsePreviewMode,
@@ -105,10 +108,12 @@ export async function serverBuild({
  dynamicPages: string[];
  trailingSlash: boolean;
  config: Config;
+  functionsConfigManifest?: FunctionsConfigManifestV1;
  pagesDir: string;
  baseDir: string;
  canUsePreviewMode: boolean;
  omittedPrerenderRoutes: Set<string>;
+  localePrefixed404: boolean;
  staticPages: { [key: string]: FileFsRef };
  lambdaAppPaths: { [key: string]: FileFsRef };
  lambdaPages: { [key: string]: FileFsRef };
@@ -212,12 +217,12 @@ export async function serverBuild({
      ? path.posix.join(entryDirectory, '_errors/404')
      : undefined;

-  if (!static404Page && i18n) {
-    static404Page = staticPages[
-      path.posix.join(entryDirectory, i18n.defaultLocale, '404')
-    ]
-      ? path.posix.join(entryDirectory, i18n.defaultLocale, '404')
-      : undefined;
+  if (
+    !static404Page &&
+    i18n &&
+    staticPages[path.posix.join(entryDirectory, i18n.defaultLocale, '404')]
+  ) {
+    static404Page = path.posix.join(entryDirectory, i18n.defaultLocale, '404');
  }

  if (!hasStatic500 && i18n) {
@@ -752,6 +757,7 @@ export async function serverBuild({
    const pageLambdaGroups = await getPageLambdaGroups({
      entryPath: projectDir,
      config,
+      functionsConfigManifest,
      pages: nonApiPages,
      prerenderRoutes,
      pageTraces,
@@ -767,6 +773,7 @@ export async function serverBuild({
    const appRouterLambdaGroups = await getPageLambdaGroups({
      entryPath: projectDir,
      config,
+      functionsConfigManifest,
      pages: appRouterPages,
      prerenderRoutes,
      pageTraces,
@@ -789,6 +796,7 @@ export async function serverBuild({
    const apiLambdaGroups = await getPageLambdaGroups({
      entryPath: projectDir,
      config,
+      functionsConfigManifest,
      pages: apiPages,
      prerenderRoutes,
      pageTraces,
@@ -961,6 +969,7 @@ export async function serverBuild({
        if (
          i18n &&
          !isPrerender &&
+          !group.isAppRouter &&
          (!isCorrectLocaleAPIRoutes ||
            !(pageNoExt === 'api' || pageNoExt.startsWith('api/')))
        ) {
@@ -998,6 +1007,7 @@ export async function serverBuild({
    isSharedLambdas: false,
    canUsePreviewMode,
    static404Page,
+    localePrefixed404,
    hasPages404: routesManifest.pages404,
    isCorrectNotFoundRoutes,
    isEmptyAllowQueryForPrendered,
@@ -1064,7 +1074,8 @@ export async function serverBuild({
      prerenderManifest,
      routesManifest,
      true,
-      isCorrectLocaleAPIRoutes
+      isCorrectLocaleAPIRoutes,
+      inversedAppPathManifest
    )
  );

@@ -1217,6 +1228,7 @@ export async function serverBuild({
  const rscVaryHeader =
    routesManifest?.rsc?.varyHeader ||
    'RSC, Next-Router-State-Tree, Next-Router-Prefetch';
+  const appNotFoundPath = path.posix.join('.', entryDirectory, '_not-found');

  return {
    wildcard: wildcardConfig,
@@ -1749,6 +1761,7 @@ export async function serverBuild({
      { handle: 'error' } as RouteWithHandle,

      // Custom Next.js 404 page
+
      ...(i18n && (static404Page || hasIsr404Page || lambdaPages['404.js'])
        ? [
            {
@@ -1783,6 +1796,10 @@ export async function serverBuild({
                  hasIsr404Page ||
                  lambdas[path.posix.join(entryDirectory, '404')]
                  ? '/404'
+                  : appPathRoutesManifest &&
+                    (middleware.edgeFunctions[appNotFoundPath] ||
+                      lambdas[appNotFoundPath])
+                  ? '/_not-found'
                  : '/_error'
              ),
              status: 404,
--- a/packages/next/src/utils.ts
+++ b/packages/next/src/utils.ts
@@ -479,7 +479,8 @@ export function localizeDynamicRoutes(
  prerenderManifest: NextPrerenderedRoutes,
  routesManifest?: RoutesManifest,
  isServerMode?: boolean,
-  isCorrectLocaleAPIRoutes?: boolean
+  isCorrectLocaleAPIRoutes?: boolean,
+  inversedAppPathRoutesManifest?: Record<string, string>
 ): RouteWithSrc[] {
  return dynamicRoutes.map((route: RouteWithSrc) => {
    // i18n is already handled for middleware
@@ -498,6 +499,9 @@ export function localizeDynamicRoutes(
      const isAutoExport =
        staticPages[addLocaleOrDefault(pathname!, routesManifest).substring(1)];

+      const isAppRoute =
+        inversedAppPathRoutesManifest?.[pathnameNoPrefix || ''];
+
      const isLocalePrefixed =
        isFallback || isBlocking || isAutoExport || isServerMode;

@@ -508,7 +512,11 @@ export function localizeDynamicRoutes(
        }${i18n.locales.map(locale => escapeStringRegexp(locale)).join('|')})?`
      );

-      if (isLocalePrefixed && !(isCorrectLocaleAPIRoutes && isApiRoute)) {
+      if (
+        isLocalePrefixed &&
+        !(isCorrectLocaleAPIRoutes && isApiRoute) &&
+        !isAppRoute
+      ) {
        // ensure destination has locale prefix to match prerender output
        // path so that the prerender object is used
        route.dest = route.dest!.replace(
@@ -1397,6 +1405,7 @@ const LAMBDA_RESERVED_COMPRESSED_SIZE = 250 * KIB;
 export async function getPageLambdaGroups({
  entryPath,
  config,
+  functionsConfigManifest,
  pages,
  prerenderRoutes,
  pageTraces,
@@ -1410,6 +1419,7 @@ export async function getPageLambdaGroups({
 }: {
  entryPath: string;
  config: Config;
+  functionsConfigManifest?: FunctionsConfigManifestV1;
  pages: string[];
  prerenderRoutes: Set<string>;
  pageTraces: {
@@ -1436,16 +1446,26 @@ export async function getPageLambdaGroups({

    let opts: { memory?: number; maxDuration?: number } = {};

+    if (
+      functionsConfigManifest &&
+      functionsConfigManifest.functions[routeName]
+    ) {
+      opts = functionsConfigManifest.functions[routeName];
+    }
+
    if (config && config.functions) {
      const sourceFile = await getSourceFilePathFromPage({
        workPath: entryPath,
        page,
        pageExtensions,
      });
-      opts = await getLambdaOptionsFromFunction({
+
+      const vercelConfigOpts = await getLambdaOptionsFromFunction({
        sourceFile,
        config,
      });
+
+      opts = { ...vercelConfigOpts, ...opts };
    }

    let matchingGroup = groups.find(group => {
@@ -1779,6 +1799,7 @@ export const onPrerenderRouteInitial = (
 type OnPrerenderRouteArgs = {
  appDir: string | null;
  pagesDir: string;
+  localePrefixed404?: boolean;
  static404Page?: string;
  hasPages404: boolean;
  entryDirectory: string;
@@ -1816,6 +1837,7 @@ export const onPrerenderRoute =
      appDir,
      pagesDir,
      static404Page,
+      localePrefixed404,
      entryDirectory,
      prerenderManifest,
      isSharedLambdas,
@@ -1951,7 +1973,9 @@ export const onPrerenderRoute =
                    // file.
                    `${
                      isOmittedOrNotFound
-                        ? addLocaleOrDefault('/404', routesManifest, locale)
+                        ? localePrefixed404
+                          ? addLocaleOrDefault('/404', routesManifest, locale)
+                          : '/404'
                        : routeFileNoExt
                    }.html`
              ),
@@ -1968,7 +1992,9 @@ export const onPrerenderRoute =
                : pagesDir,
              `${
                isOmittedOrNotFound
-                  ? addLocaleOrDefault('/404.html', routesManifest, locale)
+                  ? localePrefixed404
+                    ? addLocaleOrDefault('/404.html', routesManifest, locale)
+                    : '/404.html'
                  : isAppPathRoute
                  ? dataRoute
                  : routeFileNoExt + '.json'
@@ -2388,6 +2414,16 @@ export {
  getSourceFilePathFromPage,
 };

+export type FunctionsConfigManifestV1 = {
+  version: 1;
+  functions: Record<
+    string,
+    {
+      maxDuration?: number;
+    }
+  >;
+};
+
 type MiddlewareManifest = MiddlewareManifestV1 | MiddlewareManifestV2;

 interface MiddlewareManifestV1 {
@@ -2663,7 +2699,9 @@ export async function getMiddlewareBundle({
        shortPath = shortPath.replace(/^pages\//, '');
      } else if (
        shortPath.startsWith('app/') &&
-        (shortPath.endsWith('/page') || shortPath.endsWith('/route'))
+        (shortPath.endsWith('/page') ||
+          shortPath.endsWith('/route') ||
+          shortPath === 'app/_not-found')
      ) {
        const ogRoute = shortPath.replace(/^app\//, '/');
        shortPath = (
@@ -2731,6 +2769,37 @@ export async function getMiddlewareBundle({
  };
 }

+/**
+ * Attempts to read the functions config manifest from the pre-defined
+ * location. If the manifest can't be found it will resolve to
+ * undefined.
+ */
+export async function getFunctionsConfigManifest(
+  entryPath: string,
+  outputDirectory: string
+): Promise<FunctionsConfigManifestV1 | undefined> {
+  const functionConfigManifestPath = path.join(
+    entryPath,
+    outputDirectory,
+    './server/functions-config-manifest.json'
+  );
+
+  const hasManifest = await fs
+    .access(functionConfigManifestPath)
+    .then(() => true)
+    .catch(() => false);
+
+  if (!hasManifest) {
+    return;
+  }
+
+  const manifest: FunctionsConfigManifestV1 = await fs.readJSON(
+    functionConfigManifestPath
+  );
+
+  return manifest.version === 1 ? manifest : undefined;
+}
+
 /**
 * Attempts to read the middleware manifest from the pre-defined
 * location. If the manifest can't be found it will resolve to
--- a/packages/next/test/fixtures/00-app-dir-base-path/vercel.json
+++ b/packages/next/test/fixtures/00-app-dir-base-path/vercel.json
@@ -42,14 +42,14 @@
      "status": 200,
      "mustContain": "hello from /ssg",
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      }
    },
    {
      "path": "/hello/world/ssg",
      "status": 200,
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      },
      "headers": {
        "RSC": "1"
@@ -82,14 +82,14 @@
      "status": 200,
      "mustContain": "hello from app/dashboard/deployments/[id]/settings",
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      }
    },
    {
      "path": "/hello/world/dashboard/deployments/123/settings",
      "status": 200,
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      },
      "headers": {
        "RSC": "1"
@@ -102,14 +102,14 @@
      "status": 200,
      "mustContain": "catchall",
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      }
    },
    {
      "path": "/hello/world/dashboard/deployments/catchall/something",
      "status": 200,
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      },
      "headers": {
        "RSC": "1"
@@ -122,7 +122,7 @@
      "status": 200,
      "mustContain": "hello from app/dashboard",
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      }
    },
    {
@@ -142,7 +142,7 @@
      },
      "responseHeaders": {
        "content-type": "text/x-component",
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      }
    },
    {
--- a/packages/next/test/fixtures/00-app-dir-dynamic-404/app/layout.js
+++ b/packages/next/test/fixtures/00-app-dir-dynamic-404/app/layout.js
@@ -0,0 +1,10 @@
+export default function Layout({ children }) {
+  return (
+    <html>
+      <head>
+        <title>Hello World</title>
+      </head>
+      <body>{children}</body>
+    </html>
+  )
+}
--- a/packages/next/test/fixtures/00-app-dir-dynamic-404/app/not-found.js
+++ b/packages/next/test/fixtures/00-app-dir-dynamic-404/app/not-found.js
@@ -0,0 +1,13 @@
+import { cookies } from 'next/headers';
+
+export default function Page() {
+  cookies(); // dynamic
+
+  return (
+    <>
+      <h1>This Is The Not Found Page</h1>
+
+      <div id="timestamp">{Date.now()}</div>
+    </>
+  )
+}
--- a/packages/next/test/fixtures/00-app-dir-dynamic-404/app/page.js
+++ b/packages/next/test/fixtures/00-app-dir-dynamic-404/app/page.js
@@ -0,0 +1,3 @@
+export default function Page() {
+  return <h1>My page TEST</h1>
+}
--- a/packages/next/test/fixtures/00-app-dir-dynamic-404/index.test.js
+++ b/packages/next/test/fixtures/00-app-dir-dynamic-404/index.test.js
@@ -0,0 +1,12 @@
+/* eslint-env jest */
+const path = require('path');
+const { deployAndTest } = require('../../utils');
+
+const ctx = {};
+
+describe(`${__dirname.split(path.sep).pop()}`, () => {
+  it('should deploy and pass probe checks', async () => {
+    const info = await deployAndTest(__dirname);
+    Object.assign(ctx, info);
+  });
+});
--- a/packages/next/test/fixtures/00-app-dir-dynamic-404/next.config.js
+++ b/packages/next/test/fixtures/00-app-dir-dynamic-404/next.config.js
@@ -0,0 +1 @@
+module.exports = {};
--- a/packages/next/test/fixtures/00-app-dir-dynamic-404/package.json
+++ b/packages/next/test/fixtures/00-app-dir-dynamic-404/package.json
@@ -0,0 +1,11 @@
+{
+  "dependencies": {
+    "next": "canary",
+    "react": "experimental",
+    "react-dom": "experimental"
+  },
+  "ignoreNextjsUpdates": true,
+  "scripts": {
+    "vercel-build": "next build"
+  }
+}
--- a/packages/next/test/fixtures/00-app-dir-dynamic-404/probes.json
+++ b/packages/next/test/fixtures/00-app-dir-dynamic-404/probes.json
@@ -0,0 +1,12 @@
+{ "probes": [
+  {
+    "path": "/",
+    "status": 200,
+    "mustContain": "My page"
+  },
+  {
+    "path": "/not-found-page",
+    "status": 404,
+    "mustContain": "This Is The Not Found Page"
+  }
+]}
--- a/packages/next/test/fixtures/00-app-dir-dynamic-404/vercel.json
+++ b/packages/next/test/fixtures/00-app-dir-dynamic-404/vercel.json
@@ -0,0 +1,8 @@
+{
+  "builds": [
+    {
+      "src": "package.json",
+      "use": "@vercel/next"
+    }
+  ]
+}
--- a/packages/next/test/fixtures/00-app-dir-edge-404/app/layout.js
+++ b/packages/next/test/fixtures/00-app-dir-edge-404/app/layout.js
@@ -0,0 +1,12 @@
+export const runtime = 'edge'
+
+export default function Layout({ children }) {
+  return (
+    <html>
+      <head>
+        <title>Hello World</title>
+      </head>
+      <body>{children}</body>
+    </html>
+  )
+}
--- a/packages/next/test/fixtures/00-app-dir-edge-404/app/not-found.js
+++ b/packages/next/test/fixtures/00-app-dir-edge-404/app/not-found.js
@@ -0,0 +1,9 @@
+export default function Page() {
+  return (
+    <>
+      <h1>This Is The Not Found Page</h1>
+
+      <div id="timestamp">{Date.now()}</div>
+    </>
+  )
+}
--- a/packages/next/test/fixtures/00-app-dir-edge-404/app/not-found/not-found.js
+++ b/packages/next/test/fixtures/00-app-dir-edge-404/app/not-found/not-found.js
@@ -0,0 +1,3 @@
+export default function notFound() {
+  return <h1>custom not found</h1>
+}
--- a/packages/next/test/fixtures/00-app-dir-edge-404/app/not-found/page.js
+++ b/packages/next/test/fixtures/00-app-dir-edge-404/app/not-found/page.js
@@ -0,0 +1,3 @@
+export default function Page() {
+  return <h1>I'm still a valid page</h1>
+}
--- a/packages/next/test/fixtures/00-app-dir-edge-404/app/page.js
+++ b/packages/next/test/fixtures/00-app-dir-edge-404/app/page.js
@@ -0,0 +1,3 @@
+export default function Page() {
+  return <h1>My page</h1>
+}
--- a/packages/next/test/fixtures/00-app-dir-edge-404/index.test.js
+++ b/packages/next/test/fixtures/00-app-dir-edge-404/index.test.js
@@ -0,0 +1,12 @@
+/* eslint-env jest */
+const path = require('path');
+const { deployAndTest } = require('../../utils');
+
+const ctx = {};
+
+describe(`${__dirname.split(path.sep).pop()}`, () => {
+  it('should deploy and pass probe checks', async () => {
+    const info = await deployAndTest(__dirname);
+    Object.assign(ctx, info);
+  });
+});
--- a/packages/next/test/fixtures/00-app-dir-edge-404/next.config.js
+++ b/packages/next/test/fixtures/00-app-dir-edge-404/next.config.js
@@ -0,0 +1,5 @@
+module.exports = {
+  experimental: {
+    appDir: true,
+  },
+};
--- a/packages/next/test/fixtures/00-app-dir-edge-404/package.json
+++ b/packages/next/test/fixtures/00-app-dir-edge-404/package.json
@@ -0,0 +1,8 @@
+{
+  "dependencies": {
+    "next": "canary",
+    "react": "experimental",
+    "react-dom": "experimental"
+  },
+  "ignoreNextjsUpdates": true
+}
--- a/packages/next/test/fixtures/00-app-dir-edge-404/vercel.json
+++ b/packages/next/test/fixtures/00-app-dir-edge-404/vercel.json
@@ -0,0 +1,20 @@
+{
+  "builds": [
+    {
+      "src": "package.json",
+      "use": "@vercel/next"
+    }
+  ],
+  "probes": [
+    {
+      "path": "/",
+      "status": 200,
+      "mustContain": "My page"
+    },
+    {
+      "path": "/not-found-page",
+      "status": 404,
+      "mustContain": "This Is The Not Found Page"
+    }
+  ]
+}
--- a/packages/next/test/fixtures/00-app-dir-i18n/app/api/hello-app/route.js
+++ b/packages/next/test/fixtures/00-app-dir-i18n/app/api/hello-app/route.js
@@ -0,0 +1,3 @@
+export function GET(req) {
+  return new Response('hello world')
+}
--- a/packages/next/test/fixtures/00-app-dir-i18n/app/dynamic/[slug]/page.js
+++ b/packages/next/test/fixtures/00-app-dir-i18n/app/dynamic/[slug]/page.js
@@ -0,0 +1,16 @@
+export default function Page({ params: { slug } }) {
+  return (
+    <p>dynamic page {slug}</p>
+  )
+}
+
+export function generateStaticParams() {
+  return [
+    {
+      slug: 'first',
+    },
+    {
+      slug: 'second'
+    }
+  ]
+}
--- a/packages/next/test/fixtures/00-app-dir-i18n/next.config.js
+++ b/packages/next/test/fixtures/00-app-dir-i18n/next.config.js
@@ -3,7 +3,7 @@ module.exports = {
    appDir: true,
  },
  i18n: {
-    locales: ['en'],
+    locales: ['en', 'fr', 'de'],
    defaultLocale: 'en',
  },
 };
--- a/packages/next/test/fixtures/00-app-dir-i18n/pages/another.js
+++ b/packages/next/test/fixtures/00-app-dir-i18n/pages/another.js
@@ -0,0 +1,5 @@
+export default function Page() {
+  return <>
+    <p>pages/another.js</p>
+  </>
+}
--- a/packages/next/test/fixtures/00-app-dir-i18n/pages/api/hello.js
+++ b/packages/next/test/fixtures/00-app-dir-i18n/pages/api/hello.js
@@ -0,0 +1,3 @@
+export default function handler(req, res) {
+  res.end('hello world')
+}
--- a/packages/next/test/fixtures/00-app-dir-i18n/pages/blog/[slug].js
+++ b/packages/next/test/fixtures/00-app-dir-i18n/pages/blog/[slug].js
@@ -0,0 +1,18 @@
+export default function Page() {
+  return <p>dynamic pages page</p>;
+}
+
+export function getStaticProps() {
+  return {
+    props: {
+      now: Date.now(),
+    },
+  };
+}
+
+export function getStaticPaths() {
+  return {
+    paths: [{ params: { slug: "first" } }, { params: { slug: "second" } }],
+    fallback: "blocking",
+  };
+}
--- a/packages/next/test/fixtures/00-app-dir-i18n/probes.json
+++ b/packages/next/test/fixtures/00-app-dir-i18n/probes.json
@@ -35,6 +35,42 @@
      "path": "/en/other",
      "status": 200,
      "mustContain": "My Other Page"
+    },
+    {
+      "fetchOptions": { "redirect": "manual" },
+      "path": "/dynamic/first",
+      "status": 200,
+      "mustContain": "dynamic page"
+    },
+    {
+      "fetchOptions": { "redirect": "manual" },
+      "path": "/dynamic/third",
+      "status": 200,
+      "mustContain": "dynamic page"
+    },
+    {
+      "fetchOptions": { "redirect": "manual" },
+      "path": "/another",
+      "status": 200,
+      "mustContain": "pages/another"
+    },
+    {
+      "fetchOptions": { "redirect": "manual" },
+      "path": "/fr/another",
+      "status": 200,
+      "mustContain": "pages/another"
+    },
+    {
+      "fetchOptions": { "redirect": "manual" },
+      "path": "/api/hello",
+      "status": 200,
+      "mustContain": "hello world"
+    },
+    {
+      "fetchOptions": { "redirect": "manual" },
+      "path": "/api/hello-app",
+      "status": 200,
+      "mustContain": "hello world"
    }
  ]
 }
--- a/packages/next/test/fixtures/00-app-dir-middleware/vercel.json
+++ b/packages/next/test/fixtures/00-app-dir-middleware/vercel.json
@@ -22,7 +22,7 @@
        "redirect": "manual"
      },
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      },
      "headers": {
        "RSC": "1"
@@ -46,7 +46,7 @@
        "redirect": "manual"
      },
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      },
      "headers": {
        "RSC": "1"
@@ -70,7 +70,7 @@
        "redirect": "manual"
      },
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      },
      "headers": {
        "RSC": "1"
--- a/packages/next/test/fixtures/00-app-dir-segment-options/app/api/hello-again/route.js
+++ b/packages/next/test/fixtures/00-app-dir-segment-options/app/api/hello-again/route.js
@@ -0,0 +1,6 @@
+export const GET = req => {
+  console.log(req.url);
+  return new Response('hello world');
+};
+
+export const maxDuration = 7;
--- a/packages/next/test/fixtures/00-app-dir-segment-options/index.test.js
+++ b/packages/next/test/fixtures/00-app-dir-segment-options/index.test.js
@@ -0,0 +1,12 @@
+/* eslint-env jest */
+const path = require('path');
+const { deployAndTest } = require('../../utils');
+
+const ctx = {};
+
+describe(`${__dirname.split(path.sep).pop()}`, () => {
+  it('should deploy and pass probe checks', async () => {
+    const info = await deployAndTest(__dirname);
+    Object.assign(ctx, info);
+  });
+});
--- a/packages/next/test/fixtures/00-app-dir-segment-options/next.config.js
+++ b/packages/next/test/fixtures/00-app-dir-segment-options/next.config.js
@@ -0,0 +1 @@
+module.exports = {};
--- a/packages/next/test/fixtures/00-app-dir-segment-options/package.json
+++ b/packages/next/test/fixtures/00-app-dir-segment-options/package.json
@@ -0,0 +1,8 @@
+{
+  "dependencies": {
+    "next": "canary",
+    "react": "experimental",
+    "react-dom": "experimental"
+  },
+  "ignoreNextjsUpdates": true
+}
--- a/packages/next/test/fixtures/00-app-dir-segment-options/pages/api/hello.js
+++ b/packages/next/test/fixtures/00-app-dir-segment-options/pages/api/hello.js
@@ -0,0 +1,5 @@
+export default function handler(req, res) {
+  return res.json({ hello: 'world' });
+}
+
+export const maxDuration = 7;
--- a/packages/next/test/fixtures/00-app-dir-segment-options/vercel.json
+++ b/packages/next/test/fixtures/00-app-dir-segment-options/vercel.json
@@ -0,0 +1,8 @@
+{
+  "builds": [
+    {
+      "src": "package.json",
+      "use": "@vercel/next"
+    }
+  ]
+}
--- a/packages/next/test/fixtures/00-app-dir-static/vercel.json
+++ b/packages/next/test/fixtures/00-app-dir-static/vercel.json
@@ -11,7 +11,7 @@
      "status": 200,
      "mustContain": "hello from app/dashboard",
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      }
    },
    {
@@ -31,7 +31,7 @@
      },
      "responseHeaders": {
        "content-type": "text/x-component",
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      }
    },
    {
--- a/packages/next/test/fixtures/00-app-dir-trailing-slash/vercel.json
+++ b/packages/next/test/fixtures/00-app-dir-trailing-slash/vercel.json
@@ -23,14 +23,14 @@
      "status": 200,
      "mustContain": "hello from /ssg",
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      }
    },
    {
      "path": "/ssg/",
      "status": 200,
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      },
      "headers": {
        "RSC": "1"
@@ -63,14 +63,14 @@
      "status": 200,
      "mustContain": "hello from app/dashboard/deployments/[id]/settings",
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      }
    },
    {
      "path": "/dashboard/deployments/123/settings/",
      "status": 200,
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      },
      "headers": {
        "RSC": "1"
@@ -83,14 +83,14 @@
      "status": 200,
      "mustContain": "catchall",
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      }
    },
    {
      "path": "/dashboard/deployments/catchall/something/",
      "status": 200,
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      },
      "headers": {
        "RSC": "1"
@@ -103,7 +103,7 @@
      "status": 200,
      "mustContain": "hello from app/dashboard",
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      }
    },
    {
@@ -123,7 +123,7 @@
      },
      "responseHeaders": {
        "content-type": "text/x-component",
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      }
    },
    {
--- a/packages/next/test/fixtures/00-app-dir/vercel.json
+++ b/packages/next/test/fixtures/00-app-dir/vercel.json
@@ -42,14 +42,14 @@
      "status": 200,
      "mustContain": "hello from /ssg",
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      }
    },
    {
      "path": "/ssg",
      "status": 200,
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      },
      "headers": {
        "RSC": "1"
@@ -82,14 +82,14 @@
      "status": 200,
      "mustContain": "hello from app/dashboard/deployments/[id]/settings",
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      }
    },
    {
      "path": "/dashboard/deployments/123/settings",
      "status": 200,
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      },
      "headers": {
        "RSC": "1"
@@ -102,14 +102,14 @@
      "status": 200,
      "mustContain": "catchall",
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      }
    },
    {
      "path": "/dashboard/deployments/catchall/something",
      "status": 200,
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      },
      "headers": {
        "RSC": "1"
@@ -122,7 +122,7 @@
      "status": 200,
      "mustContain": "hello from app/dashboard",
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      }
    },
    {
@@ -142,7 +142,7 @@
      },
      "responseHeaders": {
        "content-type": "text/x-component",
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      }
    },
    {
--- a/packages/next/test/fixtures/00-i18n-404-revalidate/pages/blog/[slug].js
+++ b/packages/next/test/fixtures/00-i18n-404-revalidate/pages/blog/[slug].js
@@ -0,0 +1,38 @@
+import { useRouter } from "next/router"
+
+export default function Page(props) {
+  const router = useRouter()
+  
+  return (
+    <>
+      <p>/blog/[slug]</p>
+      <p>{JSON.stringify(router.query)}</p>
+      <p>{JSON.stringify(props)}</p>
+    </>
+  )
+}
+
+export function getStaticProps({ params }) {
+  if (params.slug === 'second') {
+    return {
+      notFound: true
+    }
+  }
+  
+  return {
+    props: {
+      now: Date.now(),
+      params
+    }
+  }
+}
+
+export function getStaticPaths() {
+  return {
+    paths: [
+      { params: { slug: 'first' } },
+      { params: { slug: 'second' } },
+    ],
+    fallback: 'blocking'
+  }
+}
--- a/packages/next/test/fixtures/01-app-dir-static/vercel.json
+++ b/packages/next/test/fixtures/01-app-dir-static/vercel.json
@@ -11,7 +11,7 @@
      "status": 200,
      "mustContain": "about",
      "responseHeaders": {
-        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch, Next-Url"
      }
    },
    {
--- a/packages/next/test/integration/integration-1.test.js
+++ b/packages/next/test/integration/integration-1.test.js
@@ -122,6 +122,40 @@ if (parseInt(process.versions.node.split('.')[0], 10) >= 16) {
    // );
  });

+  it('should build with app-dir with segment options correctly', async () => {
+    const { buildResult } = await runBuildLambda(
+      path.join(__dirname, '../fixtures/00-app-dir-segment-options')
+    );
+
+    const lambdas = new Set();
+
+    for (const key of Object.keys(buildResult.output)) {
+      if (buildResult.output[key].type === 'Lambda') {
+        lambdas.add(buildResult.output[key]);
+      }
+    }
+
+    expect(
+      buildResult.routes.some(
+        route =>
+          route.src?.includes('_next/data') && route.src?.includes('.rsc')
+      )
+    ).toBeFalsy();
+
+    expect(lambdas.size).toBe(2);
+
+    expect(buildResult.output['api/hello']).toBeDefined();
+    expect(buildResult.output['api/hello'].type).toBe('Lambda');
+    expect(buildResult.output['api/hello'].maxDuration).toBe(7);
+
+    expect(buildResult.output['api/hello-again']).toBeDefined();
+    expect(buildResult.output['api/hello-again'].type).toBe('Lambda');
+    expect(buildResult.output['api/hello-again'].maxDuration).toBe(7);
+    expect(
+      buildResult.output['api/hello-again'].supportsResponseStreaming
+    ).toBe(true);
+  });
+
  it('should build with app-dir in edge runtime correctly', async () => {
    const { buildResult } = await runBuildLambda(
      path.join(__dirname, '../fixtures/00-app-dir-edge')
--- a/packages/node/CHANGELOG.md
+++ b/packages/node/CHANGELOG.md
@@ -1,5 +1,17 @@
 # @vercel/node

+## 2.15.7
+
+### Patch Changes
+
+- fix: move content-type as dependency ([#10274](https://github.com/vercel/vercel/pull/10274))
+
+## 2.15.6
+
+### Patch Changes
+
+- [node] fix: runs edge user code inside IIFE ([#10220](https://github.com/vercel/vercel/pull/10220))
+
 ## 2.15.5

 ### Patch Changes
--- a/packages/node/package.json
+++ b/packages/node/package.json
@@ -1,6 +1,6 @@
 {
  "name": "@vercel/node",
-  "version": "2.15.5",
+  "version": "2.15.7",
  "license": "Apache-2.0",
  "main": "./dist/index",
  "homepage": "https://vercel.com/docs/runtimes#official-runtimes/node-js",
@@ -25,6 +25,7 @@
    "@types/node": "14.18.33",
    "@types/node-fetch": "2.6.3",
    "@vercel/build-utils": "6.8.2",
+    "content-type": "1.0.4",
    "@vercel/error-utils": "1.0.10",
    "@vercel/static-config": "2.0.17",
    "async-listen": "3.0.0",
@@ -33,6 +34,7 @@
    "exit-hook": "2.2.1",
    "node-fetch": "2.6.9",
    "path-to-regexp": "6.2.1",
+    "@types/content-type": "1.1.3",
    "ts-morph": "12.0.0",
    "ts-node": "10.9.1",
    "typescript": "4.9.5"
@@ -42,14 +44,12 @@
    "@babel/plugin-transform-modules-commonjs": "7.5.0",
    "@tootallnate/once": "1.1.2",
    "@types/aws-lambda": "8.10.19",
-    "@types/content-type": "1.1.3",
    "@types/cookie": "0.3.3",
    "@types/etag": "1.8.0",
    "@types/jest": "29.5.0",
    "@types/test-listen": "1.1.0",
    "@vercel/ncc": "0.24.0",
    "@vercel/nft": "0.22.5",
-    "content-type": "1.0.4",
    "cookie": "0.4.0",
    "cross-env": "7.0.3",
    "etag": "1.8.1",
--- a/packages/node/src/edge-functions/edge-handler.mts
+++ b/packages/node/src/edge-functions/edge-handler.mts
@@ -88,7 +88,10 @@ async function compileUserCode(
      "use strict";var regeneratorRuntime;

      // user code
-      ${compiledFile.text};
+      (() => {
+        ${compiledFile.text};
+      })();
+
      const userModule = module.exports;

      // request metadata
--- a/packages/node/test/dev-fixtures/edge-self.js
+++ b/packages/node/test/dev-fixtures/edge-self.js
@@ -0,0 +1,4 @@
+// eslint-disable-next-line no-undef
+delete self.__listeners;
+export default async () => fetch('https://example.vercel.sh');
+export const config = { runtime: 'edge' };
--- a/packages/node/test/unit/dev.test.ts
+++ b/packages/node/test/unit/dev.test.ts
@@ -148,6 +148,27 @@ function testForkDevServer(entrypoint: string) {
  }
 );

+test("user code doesn't interfer with runtime", async () => {
+  const child = testForkDevServer('./edge-self.js');
+  try {
+    const result = await readMessage(child);
+    if (result.state !== 'message') {
+      throw new Error('Exited. error: ' + JSON.stringify(result.value));
+    }
+
+    const { address, port } = result.value;
+    const response = await fetch(`http://${address}:${port}/api/edge-self`);
+
+    expect({
+      status: response.status,
+    }).toEqual({
+      status: 200,
+    });
+  } finally {
+    child.kill(9);
+  }
+});
+
 test('runs an edge function that uses `WebSocket`', async () => {
  const child = testForkDevServer('./edge-websocket.js');
  try {
--- a/packages/remix/CHANGELOG.md
+++ b/packages/remix/CHANGELOG.md
@@ -1,5 +1,21 @@
 # @vercel/remix-builder

+## 1.9.0
+
+### Minor Changes
+
+- Install `@vercel/remix-run-dev` at build-time instead of using symlink ([#9784](https://github.com/vercel/vercel/pull/9784))
+
+### Patch Changes
+
+- Update `@remix-run/dev` fork to v1.19.1 ([#10246](https://github.com/vercel/vercel/pull/10246))
+
+## 1.8.18
+
+### Patch Changes
+
+- Create ensured dependency symlink at the `start` directory, instead of root of repo ([#10224](https://github.com/vercel/vercel/pull/10224))
+
 ## 1.8.17

 ### Patch Changes
--- a/packages/remix/package.json
+++ b/packages/remix/package.json
@@ -1,6 +1,6 @@
 {
  "name": "@vercel/remix-builder",
-  "version": "1.8.17",
+  "version": "1.9.0",
  "license": "Apache-2.0",
  "main": "./dist/index.js",
  "homepage": "https://vercel.com/docs",
@@ -20,7 +20,6 @@
    "defaults"
  ],
  "dependencies": {
-    "@remix-run/dev": "npm:@vercel/remix-run-dev@1.18.1",
    "@vercel/build-utils": "6.8.2",
    "@vercel/nft": "0.22.5",
    "@vercel/static-config": "2.0.17",
@@ -29,6 +28,7 @@
    "ts-morph": "12.0.0"
  },
  "devDependencies": {
+    "@remix-run/dev": "npm:@vercel/remix-run-dev@1.19.1",
    "@types/jest": "27.5.1",
    "@types/node": "14.18.33",
    "@types/semver": "7.3.13"
--- a/packages/remix/src/build.ts
+++ b/packages/remix/src/build.ts
@@ -1,5 +1,5 @@
 import { Project } from 'ts-morph';
-import { promises as fs } from 'fs';
+import { readFileSync, promises as fs } from 'fs';
 import { basename, dirname, extname, join, relative, sep } from 'path';
 import {
  debug,
@@ -16,7 +16,6 @@ import {
  runNpmInstall,
  runPackageJsonScript,
  scanParentDirs,
-  walkParentDirs,
 } from '@vercel/build-utils';
 import { getConfig } from '@vercel/static-config';
 import { nodeFileTrace } from '@vercel/nft';
@@ -27,7 +26,6 @@ import type {
  PackageJson,
  BuildResultV2Typical,
 } from '@vercel/build-utils';
-import type { AppConfig } from '@remix-run/dev/dist/config';
 import type { ConfigRoute } from '@remix-run/dev/dist/config/routes';
 import type { BaseFunctionConfig } from '@vercel/static-config';
 import {
@@ -42,15 +40,22 @@ import {
  ResolvedEdgeRouteConfig,
  findEntry,
  chdirAndReadConfig,
-  addDependency,
+  addDependencies,
+  resolveSemverMinMax,
+  ensureResolvable,
+  isESM,
 } from './utils';
-import semver from 'semver';

-const _require: typeof require = eval('require');
+interface ServerBundle {
+  serverBuildPath: string;
+  routes: string[];
+}

-const REMIX_RUN_DEV_PATH = dirname(
-  _require.resolve('@remix-run/dev/package.json')
+const remixBuilderPkg = JSON.parse(
+  readFileSync(join(__dirname, '../package.json'), 'utf8')
 );
+const remixRunDevForkVersion =
+  remixBuilderPkg.devDependencies['@remix-run/dev'];

 const DEFAULTS_PATH = join(__dirname, '../defaults');

@@ -63,8 +68,17 @@ const nodeServerSrcPromise = fs.readFile(
  'utf-8'
 );

-// This value is the minimum supported version for our fork of Remix
-const minimumSupportRemixVersion = '1.10.0';
+// Minimum supported version of the `@vercel/remix` package
+const VERCEL_REMIX_MIN_VERSION = '1.10.0';
+
+// Minimum supported version of the `@vercel/remix-run-dev` forked compiler
+const REMIX_RUN_DEV_MIN_VERSION = '1.15.0';
+
+// Maximum version of `@vercel/remix-run-dev` fork
+// (and also `@vercel/remix` since they get published at the same time)
+const REMIX_RUN_DEV_MAX_VERSION = remixRunDevForkVersion.slice(
+  remixRunDevForkVersion.lastIndexOf('@') + 1
+);

 export const build: BuildV2 = async ({
  entrypoint,
@@ -133,18 +147,32 @@ export const build: BuildV2 = async ({
    repoRootPath,
    '@remix-run/dev'
  );
-
-  const remixVersion = JSON.parse(
-    await fs.readFile(join(remixRunDevPath, 'package.json'), 'utf8')
-  ).version;
+  const remixRunDevPkg = JSON.parse(
+    readFileSync(join(remixRunDevPath, 'package.json'), 'utf8')
+  );
+  const remixVersion = remixRunDevPkg.version;

  const remixConfig = await chdirAndReadConfig(
+    remixRunDevPath,
    entrypointFsDirname,
    packageJsonPath
  );
  const { serverEntryPoint, appDirectory } = remixConfig;
  const remixRoutes = Object.values(remixConfig.routes);

+  const depsToAdd: string[] = [];
+
+  if (remixRunDevPkg.name !== '@vercel/remix-run-dev') {
+    const remixDevForkVersion = resolveSemverMinMax(
+      REMIX_RUN_DEV_MIN_VERSION,
+      REMIX_RUN_DEV_MAX_VERSION,
+      remixVersion
+    );
+    depsToAdd.push(
+      `@remix-run/dev@npm:@vercel/remix-run-dev@${remixDevForkVersion}`
+    );
+  }
+
  // `app/entry.server.tsx` and `app/entry.client.tsx` are optional in Remix,
  // so if either of those files are missing then add our own versions.
  const userEntryServerFile = findEntry(appDirectory, 'entry.server');
@@ -155,44 +183,27 @@ export const build: BuildV2 = async ({
    );
    if (!pkg.dependencies['@vercel/remix']) {
      // Dependency version resolution logic
-      // 1. Users app is on 1.9.0 -> we install the 1.10.0 (minimum) version of our fork (`@vercel/remix`)
-      // 2. Users app is on 1.11.0 (a version greater than 1.10.0 and less than the latest version of the fork) -> we install the (matching) 1.11.0 version of `@vercel/remix`
-      // 3. Users app is on something greater than our latest version of the fork -> we install the latest version of our fork
-
-      // remixVersion is the version of the `@remix-run/dev` package in the *users' app*
-      const usersRemixVersion = semver.gt(
-        remixVersion,
-        minimumSupportRemixVersion
-      )
-        ? remixVersion
-        : minimumSupportRemixVersion;
-
-      // Prevent frozen lockfile rejections
-      const envForAddDep = { ...spawnOpts.env };
-      delete envForAddDep.CI;
-      delete envForAddDep.VERCEL;
-      delete envForAddDep.NOW_BUILDER;
-      await addDependency(
-        cliType,
-        [
-          `@vercel/remix@${
-            semver.gt(
-              usersRemixVersion,
-              require('@remix-run/dev/package.json').version
-            )
-              ? 'latest'
-              : usersRemixVersion
-          }`,
-        ],
-        {
-          ...spawnOpts,
-          env: envForAddDep,
-          cwd: entrypointFsDirname,
-        }
+      // 1. Users app is on 1.9.0 -> we install the 1.10.0 (minimum) version of `@vercel/remix`.
+      // 2. Users app is on 1.11.0 (a version greater than 1.10.0 and less than the known max
+      //    published version) -> we install the (matching) 1.11.0 version of `@vercel/remix`.
+      // 3. Users app is on something greater than our latest version of the fork -> we install
+      //    the latest known published version of `@vercel/remix`.
+      const vercelRemixVersion = resolveSemverMinMax(
+        VERCEL_REMIX_MIN_VERSION,
+        REMIX_RUN_DEV_MAX_VERSION,
+        remixVersion
      );
+      depsToAdd.push(`@vercel/remix@${vercelRemixVersion}`);
    }
  }

+  if (depsToAdd.length) {
+    await addDependencies(cliType, depsToAdd, {
+      ...spawnOpts,
+      cwd: entrypointFsDirname,
+    });
+  }
+
  const userEntryClientFile = findEntry(
    remixConfig.appDirectory,
    'entry.client'
@@ -210,12 +221,8 @@ export const build: BuildV2 = async ({
    ? `${remixConfigPath}.original${extname(remixConfigPath)}`
    : undefined;

-  const backupRemixRunDevPath = `${remixRunDevPath}.__vercel_backup`;
-  await fs.rename(remixRunDevPath, backupRemixRunDevPath);
-  await fs.symlink(REMIX_RUN_DEV_PATH, remixRunDevPath);
-
  // These get populated inside the try/catch below
-  let serverBundles: AppConfig['serverBundles'];
+  let serverBundles: ServerBundle[];
  const serverBundlesMap = new Map<string, ConfigRoute[]>();
  const resolvedConfigsMap = new Map<ConfigRoute, ResolvedRouteConfig>();

@@ -273,16 +280,9 @@ export const build: BuildV2 = async ({
    if (remixConfigPath && renamedRemixConfigPath) {
      await fs.rename(remixConfigPath, renamedRemixConfigPath);

-      // Figure out if the `remix.config` file is using ESM syntax
-      let isESM = false;
-      try {
-        _require(renamedRemixConfigPath);
-      } catch (err: any) {
-        isESM = err.code === 'ERR_REQUIRE_ESM';
-      }
-
      let patchedConfig: string;
-      if (isESM) {
+      // Figure out if the `remix.config` file is using ESM syntax
+      if (isESM(renamedRemixConfigPath)) {
        patchedConfig = `import config from './${basename(
          renamedRemixConfigPath
        )}';
@@ -340,10 +340,6 @@ module.exports = config;`;
    if (remixConfigWrapped && remixConfigPath && renamedRemixConfigPath) {
      await fs.rename(renamedRemixConfigPath, remixConfigPath);
    }
-
-    // Remove `@remix-run/dev` symlink
-    await fs.unlink(remixRunDevPath);
-    await fs.rename(backupRemixRunDevPath, remixRunDevPath);
  }

  // This needs to happen before we run NFT to create the Node/Edge functions
@@ -659,99 +655,6 @@ async function createRenderEdgeFunction(
  return fn;
 }

-async function ensureResolvable(
-  start: string,
-  base: string,
-  pkgName: string
-): Promise<string> {
-  try {
-    const resolvedPkgPath = _require.resolve(`${pkgName}/package.json`, {
-      paths: [start],
-    });
-    const resolvedPath = dirname(resolvedPkgPath);
-    if (!relative(base, resolvedPath).startsWith(`..${sep}`)) {
-      // Resolved path is within the root of the project, so all good
-      debug(`"${pkgName}" resolved to '${resolvedPath}'`);
-      return resolvedPath;
-    }
-  } catch (err: any) {
-    if (err.code !== 'MODULE_NOT_FOUND') {
-      throw err;
-    }
-  }
-
-  // If we got to here then `pkgName` was not resolvable up to the root
-  // of the project. Try a couple symlink tricks, otherwise we'll bail.
-
-  // Attempt to find the package in `node_modules/.pnpm` (pnpm)
-  const pnpmDir = await walkParentDirs({
-    base,
-    start,
-    filename: 'node_modules/.pnpm',
-  });
-  if (pnpmDir) {
-    const prefix = `${pkgName.replace('/', '+')}@`;
-    const packages = await fs.readdir(pnpmDir);
-    const match = packages.find(p => p.startsWith(prefix));
-    if (match) {
-      const pkgDir = join(pnpmDir, match, 'node_modules', pkgName);
-      await ensureSymlink(pkgDir, join(pnpmDir, '..'), pkgName);
-      return pkgDir;
-    }
-  }
-
-  // Attempt to find the package in `node_modules/.store` (npm 9+ linked mode)
-  const npmDir = await walkParentDirs({
-    base,
-    start,
-    filename: 'node_modules/.store',
-  });
-  if (npmDir) {
-    const prefix = `${basename(pkgName)}@`;
-    const prefixDir = join(npmDir, dirname(pkgName));
-    const packages = await fs.readdir(prefixDir);
-    const match = packages.find(p => p.startsWith(prefix));
-    if (match) {
-      const pkgDir = join(prefixDir, match, 'node_modules', pkgName);
-      await ensureSymlink(pkgDir, join(npmDir, '..'), pkgName);
-      return pkgDir;
-    }
-  }
-
-  throw new Error(
-    `Failed to resolve "${pkgName}". To fix this error, add "${pkgName}" to "dependencies" in your \`package.json\` file.`
-  );
-}
-
-async function ensureSymlink(
-  target: string,
-  nodeModulesDir: string,
-  pkgName: string
-) {
-  const symlinkPath = join(nodeModulesDir, pkgName);
-  const symlinkDir = dirname(symlinkPath);
-  const relativeTarget = relative(symlinkDir, target);
-
-  try {
-    const existingTarget = await fs.readlink(symlinkPath);
-    if (existingTarget === relativeTarget) {
-      // Symlink is already the expected value, so do nothing
-      return;
-    } else {
-      // If a symlink already exists then delete it if the target doesn't match
-      await fs.unlink(symlinkPath);
-    }
-  } catch (err: any) {
-    // Ignore when path does not exist or is not a symlink
-    if (err.code !== 'ENOENT' && err.code !== 'EINVAL') {
-      throw err;
-    }
-  }
-
-  await fs.symlink(relativeTarget, symlinkPath);
-  debug(`Created symlink for "${pkgName}"`);
-}
-
 async function writeEntrypointFile(
  path: string,
  data: string,
--- a/packages/remix/src/prepare-cache.ts
+++ b/packages/remix/src/prepare-cache.ts
@@ -1,6 +1,6 @@
 import { glob } from '@vercel/build-utils';
 import { dirname, join, relative } from 'path';
-import { chdirAndReadConfig } from './utils';
+import { _require, chdirAndReadConfig } from './utils';
 import type { PrepareCache } from '@vercel/build-utils';

 export const prepareCache: PrepareCache = async ({
@@ -12,7 +12,13 @@ export const prepareCache: PrepareCache = async ({
  const mountpoint = dirname(entrypoint);
  const entrypointFsDirname = join(workPath, mountpoint);
  const packageJsonPath = join(entrypointFsDirname, 'package.json');
+  const remixRunDevPath = dirname(
+    _require.resolve('@remix-run/dev/package.json', {
+      paths: [entrypointFsDirname],
+    })
+  );
  const remixConfig = await chdirAndReadConfig(
+    remixRunDevPath,
    entrypointFsDirname,
    packageJsonPath
  );
--- a/packages/remix/src/utils.ts
+++ b/packages/remix/src/utils.ts
@@ -1,8 +1,9 @@
+import semver from 'semver';
 import { existsSync, promises as fs } from 'fs';
-import { join, relative, resolve } from 'path';
+import { basename, dirname, join, relative, resolve, sep } from 'path';
 import { pathToRegexp, Key } from 'path-to-regexp';
 import { debug, spawnAsync } from '@vercel/build-utils';
-import { readConfig } from '@remix-run/dev/dist/config';
+import { walkParentDirs } from '@vercel/build-utils';
 import type {
  ConfigRoute,
  RouteManifest,
@@ -14,12 +15,15 @@ import type {
  SpawnOptionsExtended,
 } from '@vercel/build-utils/dist/fs/run-user-scripts';

+export const _require: typeof require = eval('require');
+
 export interface ResolvedNodeRouteConfig {
  runtime: 'nodejs';
  regions?: string[];
  maxDuration?: number;
  memory?: number;
 }
+
 export interface ResolvedEdgeRouteConfig {
  runtime: 'edge';
  regions?: BaseFunctionConfig['regions'];
@@ -209,7 +213,14 @@ export function syncEnv(source: NodeJS.ProcessEnv, dest: NodeJS.ProcessEnv) {
  return () => syncEnv(originalDest, dest);
 }

-export async function chdirAndReadConfig(dir: string, packageJsonPath: string) {
+export async function chdirAndReadConfig(
+  remixRunDevPath: string,
+  dir: string,
+  packageJsonPath: string
+) {
+  const { readConfig }: typeof import('@remix-run/dev/dist/config') =
+    await import(join(remixRunDevPath, 'dist/config.js'));
+
  const originalCwd = process.cwd();

  // As of Remix v1.14.0, reading the config may trigger adding
@@ -246,18 +257,22 @@ export async function chdirAndReadConfig(dir: string, packageJsonPath: string) {
  return remixConfig;
 }

-export interface AddDependencyOptions extends SpawnOptionsExtended {
+export interface AddDependenciesOptions extends SpawnOptionsExtended {
  saveDev?: boolean;
 }

 /**
 * Runs `npm i ${name}` / `pnpm i ${name}` / `yarn add ${name}`.
 */
-export function addDependency(
+export function addDependencies(
  cliType: CliType,
  names: string[],
-  opts: AddDependencyOptions = {}
+  opts: AddDependenciesOptions = {}
 ) {
+  debug('Installing additional dependencies:');
+  for (const name of names) {
+    debug(` - ${name}`);
+  }
  const args: string[] = [];
  if (cliType === 'npm' || cliType === 'pnpm') {
    args.push('install');
@@ -273,3 +288,116 @@ export function addDependency(
  }
  return spawnAsync(cliType, args.concat(names), opts);
 }
+
+export function resolveSemverMinMax(
+  min: string,
+  max: string,
+  version: string
+): string {
+  const floored = semver.intersects(version, `>= ${min}`) ? version : min;
+  return semver.intersects(floored, `<= ${max}`) ? floored : max;
+}
+
+export async function ensureResolvable(
+  start: string,
+  base: string,
+  pkgName: string
+): Promise<string> {
+  try {
+    const resolvedPkgPath = _require.resolve(`${pkgName}/package.json`, {
+      paths: [start],
+    });
+    const resolvedPath = dirname(resolvedPkgPath);
+    if (!relative(base, resolvedPath).startsWith(`..${sep}`)) {
+      // Resolved path is within the root of the project, so all good
+      debug(`"${pkgName}" resolved to '${resolvedPath}'`);
+      return resolvedPath;
+    }
+  } catch (err: any) {
+    if (err.code !== 'MODULE_NOT_FOUND') {
+      throw err;
+    }
+  }
+
+  // If we got to here then `pkgName` was not resolvable up to the root
+  // of the project. Try a couple symlink tricks, otherwise we'll bail.
+
+  // Attempt to find the package in `node_modules/.pnpm` (pnpm)
+  const pnpmDir = await walkParentDirs({
+    base,
+    start,
+    filename: 'node_modules/.pnpm',
+  });
+  if (pnpmDir) {
+    const prefix = `${pkgName.replace('/', '+')}@`;
+    const packages = await fs.readdir(pnpmDir);
+    const match = packages.find(p => p.startsWith(prefix));
+    if (match) {
+      const pkgDir = join(pnpmDir, match, 'node_modules', pkgName);
+      await ensureSymlink(pkgDir, join(start, 'node_modules'), pkgName);
+      return pkgDir;
+    }
+  }
+
+  // Attempt to find the package in `node_modules/.store` (npm 9+ linked mode)
+  const npmDir = await walkParentDirs({
+    base,
+    start,
+    filename: 'node_modules/.store',
+  });
+  if (npmDir) {
+    const prefix = `${basename(pkgName)}@`;
+    const prefixDir = join(npmDir, dirname(pkgName));
+    const packages = await fs.readdir(prefixDir);
+    const match = packages.find(p => p.startsWith(prefix));
+    if (match) {
+      const pkgDir = join(prefixDir, match, 'node_modules', pkgName);
+      await ensureSymlink(pkgDir, join(start, 'node_modules'), pkgName);
+      return pkgDir;
+    }
+  }
+
+  throw new Error(
+    `Failed to resolve "${pkgName}". To fix this error, add "${pkgName}" to "dependencies" in your \`package.json\` file.`
+  );
+}
+
+async function ensureSymlink(
+  target: string,
+  nodeModulesDir: string,
+  pkgName: string
+) {
+  const symlinkPath = join(nodeModulesDir, pkgName);
+  const symlinkDir = dirname(symlinkPath);
+  const relativeTarget = relative(symlinkDir, target);
+
+  try {
+    const existingTarget = await fs.readlink(symlinkPath);
+    if (existingTarget === relativeTarget) {
+      // Symlink is already the expected value, so do nothing
+      return;
+    } else {
+      // If a symlink already exists then delete it if the target doesn't match
+      await fs.unlink(symlinkPath);
+    }
+  } catch (err: any) {
+    // Ignore when path does not exist or is not a symlink
+    if (err.code !== 'ENOENT' && err.code !== 'EINVAL') {
+      throw err;
+    }
+  }
+
+  await fs.symlink(relativeTarget, symlinkPath);
+  debug(`Created symlink for "${pkgName}"`);
+}
+
+export function isESM(path: string): boolean {
+  // Figure out if the `remix.config` file is using ESM syntax
+  let isESM = false;
+  try {
+    _require(path);
+  } catch (err: any) {
+    isESM = err.code === 'ERR_REQUIRE_ESM';
+  }
+  return isESM;
+}
--- a/packages/remix/test/fixtures/00-pnpm/.gitignore
+++ b/packages/remix/test/fixtures/00-pnpm/.gitignore
@@ -0,0 +1 @@
+!node_modules
--- a/packages/remix/test/fixtures/00-pnpm/node_modules/.modules.yaml
+++ b/packages/remix/test/fixtures/00-pnpm/node_modules/.modules.yaml
@@ -0,0 +1,23 @@
+hoistPattern:
+  - '*'
+hoistedDependencies:
+  /ms/2.1.2:
+    ms: private
+included:
+  dependencies: true
+  devDependencies: true
+  optionalDependencies: true
+injectedDeps: {}
+layoutVersion: 5
+nodeLinker: isolated
+packageManager: pnpm@8.6.6
+pendingBuilds: []
+prunedAt: Mon, 17 Jul 2023 20:06:43 GMT
+publicHoistPattern:
+  - '*eslint*'
+  - '*prettier*'
+registries:
+  default: https://registry.npmjs.org/
+skipped: []
+storeDir: /Users/nrajlich/Library/pnpm/store/v3
+virtualStoreDir: .pnpm
--- a/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/debug@4.3.4/node_modules/debug/LICENSE
+++ b/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/debug@4.3.4/node_modules/debug/LICENSE
@@ -0,0 +1,20 @@
+(The MIT License)
+
+Copyright (c) 2014-2017 TJ Holowaychuk <tj@vision-media.ca>
+Copyright (c) 2018-2021 Josh Junon
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software
+and associated documentation files (the 'Software'), to deal in the Software without restriction,
+including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense,
+and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial
+portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT
+LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
+WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
--- a/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/debug@4.3.4/node_modules/debug/README.md
+++ b/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/debug@4.3.4/node_modules/debug/README.md
@@ -0,0 +1,481 @@
+# debug
+[![Build Status](https://travis-ci.org/debug-js/debug.svg?branch=master)](https://travis-ci.org/debug-js/debug)  [![Coverage Status](https://coveralls.io/repos/github/debug-js/debug/badge.svg?branch=master)](https://coveralls.io/github/debug-js/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers)
+[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
+
+A tiny JavaScript debugging utility modelled after Node.js core's debugging
+technique. Works in Node.js and web browsers.
+
+## Installation
+
+```bash
+$ npm install debug
+```
+
+## Usage
+
+`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
+
+Example [_app.js_](./examples/node/app.js):
+
+```js
+var debug = require('debug')('http')
+  , http = require('http')
+  , name = 'My App';
+
+// fake app
+
+debug('booting %o', name);
+
+http.createServer(function(req, res){
+  debug(req.method + ' ' + req.url);
+  res.end('hello\n');
+}).listen(3000, function(){
+  debug('listening');
+});
+
+// fake worker of some kind
+
+require('./worker');
+```
+
+Example [_worker.js_](./examples/node/worker.js):
+
+```js
+var a = require('debug')('worker:a')
+  , b = require('debug')('worker:b');
+
+function work() {
+  a('doing lots of uninteresting work');
+  setTimeout(work, Math.random() * 1000);
+}
+
+work();
+
+function workb() {
+  b('doing some work');
+  setTimeout(workb, Math.random() * 2000);
+}
+
+workb();
+```
+
+The `DEBUG` environment variable is then used to enable these based on space or
+comma-delimited names.
+
+Here are some examples:
+
+<img width="647" alt="screen shot 2017-08-08 at 12 53 04 pm" src="https://user-images.githubusercontent.com/71256/29091703-a6302cdc-7c38-11e7-8304-7c0b3bc600cd.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 38 pm" src="https://user-images.githubusercontent.com/71256/29091700-a62a6888-7c38-11e7-800b-db911291ca2b.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 25 pm" src="https://user-images.githubusercontent.com/71256/29091701-a62ea114-7c38-11e7-826a-2692bedca740.png">
+
+#### Windows command prompt notes
+
+##### CMD
+
+On Windows the environment variable is set using the `set` command.
+
+```cmd
+set DEBUG=*,-not_this
+```
+
+Example:
+
+```cmd
+set DEBUG=* & node app.js
+```
+
+##### PowerShell (VS Code default)
+
+PowerShell uses different syntax to set environment variables.
+
+```cmd
+$env:DEBUG = "*,-not_this"
+```
+
+Example:
+
+```cmd
+$env:DEBUG='app';node app.js
+```
+
+Then, run the program to be debugged as usual.
+
+npm script example:
+```js
+  "windowsDebug": "@powershell -Command $env:DEBUG='*';node app.js",
+```
+
+## Namespace Colors
+
+Every debug instance has a color generated for it based on its namespace name.
+This helps when visually parsing the debug output to identify which debug instance
+a debug line belongs to.
+
+#### Node.js
+
+In Node.js, colors are enabled when stderr is a TTY. You also _should_ install
+the [`supports-color`](https://npmjs.org/supports-color) module alongside debug,
+otherwise debug will only use a small handful of basic colors.
+
+<img width="521" src="https://user-images.githubusercontent.com/71256/29092181-47f6a9e6-7c3a-11e7-9a14-1928d8a711cd.png">
+
+#### Web Browser
+
+Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+option. These are WebKit web inspectors, Firefox ([since version
+31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+and the Firebug plugin for Firefox (any version).
+
+<img width="524" src="https://user-images.githubusercontent.com/71256/29092033-b65f9f2e-7c39-11e7-8e32-f6f0d8e865c1.png">
+
+
+## Millisecond diff
+
+When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
+
+When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below:
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091956-6bd78372-7c39-11e7-8c55-c948396d6edd.png">
+
+
+## Conventions
+
+If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".  If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable.  You can then use it for normal output as well as debug output.
+
+## Wildcards
+
+The `*` character may be used as a wildcard. Suppose for example your library has
+debuggers named "connect:bodyParser", "connect:compress", "connect:session",
+instead of listing all three with
+`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do
+`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+
+You can also exclude specific debuggers by prefixing them with a "-" character.
+For example, `DEBUG=*,-connect:*` would include all debuggers except those
+starting with "connect:".
+
+## Environment Variables
+
+When running through Node.js, you can set a few environment variables that will
+change the behavior of the debug logging:
+
+| Name      | Purpose                                         |
+|-----------|-------------------------------------------------|
+| `DEBUG`   | Enables/disables specific debugging namespaces. |
+| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY).  |
+| `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
+| `DEBUG_DEPTH` | Object inspection depth.                    |
+| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
+
+
+__Note:__ The environment variables beginning with `DEBUG_` end up being
+converted into an Options object that gets used with `%o`/`%O` formatters.
+See the Node.js documentation for
+[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+for the complete list.
+
+## Formatters
+
+Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting.
+Below are the officially supported formatters:
+
+| Formatter | Representation |
+|-----------|----------------|
+| `%O`      | Pretty-print an Object on multiple lines. |
+| `%o`      | Pretty-print an Object all on a single line. |
+| `%s`      | String. |
+| `%d`      | Number (both integer and float). |
+| `%j`      | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
+| `%%`      | Single percent sign ('%'). This does not consume an argument. |
+
+
+### Custom formatters
+
+You can add custom formatters by extending the `debug.formatters` object.
+For example, if you wanted to add support for rendering a Buffer as hex with
+`%h`, you could do something like:
+
+```js
+const createDebug = require('debug')
+createDebug.formatters.h = (v) => {
+  return v.toString('hex')
+}
+
+// …elsewhere
+const debug = createDebug('foo')
+debug('this is hex: %h', new Buffer('hello world'))
+//   foo this is hex: 68656c6c6f20776f726c6421 +0ms
+```
+
+
+## Browser Support
+
+You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+if you don't want to build it yourself.
+
+Debug's enable state is currently persisted by `localStorage`.
+Consider the situation shown below where you have `worker:a` and `worker:b`,
+and wish to debug both. You can enable this using `localStorage.debug`:
+
+```js
+localStorage.debug = 'worker:*'
+```
+
+And then refresh the page.
+
+```js
+a = debug('worker:a');
+b = debug('worker:b');
+
+setInterval(function(){
+  a('doing some work');
+}, 1000);
+
+setInterval(function(){
+  b('doing some work');
+}, 1200);
+```
+
+In Chromium-based web browsers (e.g. Brave, Chrome, and Electron), the JavaScript console will—by default—only show messages logged by `debug` if the "Verbose" log level is _enabled_.
+
+<img width="647" src="https://user-images.githubusercontent.com/7143133/152083257-29034707-c42c-4959-8add-3cee850e6fcf.png">
+
+## Output streams
+
+  By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
+
+Example [_stdout.js_](./examples/node/stdout.js):
+
+```js
+var debug = require('debug');
+var error = debug('app:error');
+
+// by default stderr is used
+error('goes to stderr!');
+
+var log = debug('app:log');
+// set this namespace to log via console.log
+log.log = console.log.bind(console); // don't forget to bind to console!
+log('goes to stdout');
+error('still goes to stderr!');
+
+// set all output to go via console.info
+// overrides all per-namespace log settings
+debug.log = console.info.bind(console);
+error('now goes to stdout via console.info');
+log('still goes to stdout, but via console.info now');
+```
+
+## Extend
+You can simply extend debugger 
+```js
+const log = require('debug')('auth');
+
+//creates new debug instance with extended namespace
+const logSign = log.extend('sign');
+const logLogin = log.extend('login');
+
+log('hello'); // auth hello
+logSign('hello'); //auth:sign hello
+logLogin('hello'); //auth:login hello
+```
+
+## Set dynamically
+
+You can also enable debug dynamically by calling the `enable()` method :
+
+```js
+let debug = require('debug');
+
+console.log(1, debug.enabled('test'));
+
+debug.enable('test');
+console.log(2, debug.enabled('test'));
+
+debug.disable();
+console.log(3, debug.enabled('test'));
+
+```
+
+print :   
+```
+1 false
+2 true
+3 false
+```
+
+Usage :  
+`enable(namespaces)`  
+`namespaces` can include modes separated by a colon and wildcards.
+   
+Note that calling `enable()` completely overrides previously set DEBUG variable : 
+
+```
+$ DEBUG=foo node -e 'var dbg = require("debug"); dbg.enable("bar"); console.log(dbg.enabled("foo"))'
+=> false
+```
+
+`disable()`
+
+Will disable all namespaces. The functions returns the namespaces currently
+enabled (and skipped). This can be useful if you want to disable debugging
+temporarily without knowing what was enabled to begin with.
+
+For example:
+
+```js
+let debug = require('debug');
+debug.enable('foo:*,-foo:bar');
+let namespaces = debug.disable();
+debug.enable(namespaces);
+```
+
+Note: There is no guarantee that the string will be identical to the initial
+enable string, but semantically they will be identical.
+
+## Checking whether a debug target is enabled
+
+After you've created a debug instance, you can determine whether or not it is
+enabled by checking the `enabled` property:
+
+```javascript
+const debug = require('debug')('http');
+
+if (debug.enabled) {
+  // do stuff...
+}
+```
+
+You can also manually toggle this property to force the debug instance to be
+enabled or disabled.
+
+## Usage in child processes
+
+Due to the way `debug` detects if the output is a TTY or not, colors are not shown in child processes when `stderr` is piped. A solution is to pass the `DEBUG_COLORS=1` environment variable to the child process.  
+For example:
+
+```javascript
+worker = fork(WORKER_WRAP_PATH, [workerPath], {
+  stdio: [
+    /* stdin: */ 0,
+    /* stdout: */ 'pipe',
+    /* stderr: */ 'pipe',
+    'ipc',
+  ],
+  env: Object.assign({}, process.env, {
+    DEBUG_COLORS: 1 // without this settings, colors won't be shown
+  }),
+});
+
+worker.stderr.pipe(process.stderr, { end: false });
+```
+
+
+## Authors
+
+ - TJ Holowaychuk
+ - Nathan Rajlich
+ - Andrew Rhyne
+ - Josh Junon
+
+## Backers
+
+Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
+
+<a href="https://opencollective.com/debug/backer/0/website" target="_blank"><img src="https://opencollective.com/debug/backer/0/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/1/website" target="_blank"><img src="https://opencollective.com/debug/backer/1/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/2/website" target="_blank"><img src="https://opencollective.com/debug/backer/2/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/3/website" target="_blank"><img src="https://opencollective.com/debug/backer/3/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/4/website" target="_blank"><img src="https://opencollective.com/debug/backer/4/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/5/website" target="_blank"><img src="https://opencollective.com/debug/backer/5/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/6/website" target="_blank"><img src="https://opencollective.com/debug/backer/6/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/7/website" target="_blank"><img src="https://opencollective.com/debug/backer/7/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/8/website" target="_blank"><img src="https://opencollective.com/debug/backer/8/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/9/website" target="_blank"><img src="https://opencollective.com/debug/backer/9/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/10/website" target="_blank"><img src="https://opencollective.com/debug/backer/10/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/11/website" target="_blank"><img src="https://opencollective.com/debug/backer/11/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/12/website" target="_blank"><img src="https://opencollective.com/debug/backer/12/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/13/website" target="_blank"><img src="https://opencollective.com/debug/backer/13/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/14/website" target="_blank"><img src="https://opencollective.com/debug/backer/14/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/15/website" target="_blank"><img src="https://opencollective.com/debug/backer/15/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/16/website" target="_blank"><img src="https://opencollective.com/debug/backer/16/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/17/website" target="_blank"><img src="https://opencollective.com/debug/backer/17/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/18/website" target="_blank"><img src="https://opencollective.com/debug/backer/18/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/19/website" target="_blank"><img src="https://opencollective.com/debug/backer/19/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/20/website" target="_blank"><img src="https://opencollective.com/debug/backer/20/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/21/website" target="_blank"><img src="https://opencollective.com/debug/backer/21/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/22/website" target="_blank"><img src="https://opencollective.com/debug/backer/22/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/23/website" target="_blank"><img src="https://opencollective.com/debug/backer/23/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/24/website" target="_blank"><img src="https://opencollective.com/debug/backer/24/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/25/website" target="_blank"><img src="https://opencollective.com/debug/backer/25/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/26/website" target="_blank"><img src="https://opencollective.com/debug/backer/26/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/27/website" target="_blank"><img src="https://opencollective.com/debug/backer/27/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/28/website" target="_blank"><img src="https://opencollective.com/debug/backer/28/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/29/website" target="_blank"><img src="https://opencollective.com/debug/backer/29/avatar.svg"></a>
+
+
+## Sponsors
+
+Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)]
+
+<a href="https://opencollective.com/debug/sponsor/0/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/0/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/1/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/1/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/2/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/2/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/3/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/3/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/4/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/4/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/5/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/5/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/6/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/6/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/7/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/7/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/8/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/8/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/9/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/9/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/10/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/10/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/11/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/11/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/12/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/12/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/13/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/13/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/14/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/14/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/15/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/15/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/16/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/16/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/17/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/17/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/18/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/18/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/19/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/19/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/20/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/20/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/21/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/21/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/22/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/22/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/23/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/23/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/24/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/24/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/25/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/25/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/26/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/26/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/27/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/27/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/28/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/28/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/29/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/29/avatar.svg"></a>
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2014-2017 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
+Copyright (c) 2018-2021 Josh Junon
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
--- a/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/debug@4.3.4/node_modules/debug/package.json
+++ b/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/debug@4.3.4/node_modules/debug/package.json
@@ -0,0 +1,59 @@
+{
+  "name": "debug",
+  "version": "4.3.4",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/debug-js/debug.git"
+  },
+  "description": "Lightweight debugging utility for Node.js and the browser",
+  "keywords": [
+    "debug",
+    "log",
+    "debugger"
+  ],
+  "files": [
+    "src",
+    "LICENSE",
+    "README.md"
+  ],
+  "author": "Josh Junon <josh.junon@protonmail.com>",
+  "contributors": [
+    "TJ Holowaychuk <tj@vision-media.ca>",
+    "Nathan Rajlich <nathan@tootallnate.net> (http://n8.io)",
+    "Andrew Rhyne <rhyneandrew@gmail.com>"
+  ],
+  "license": "MIT",
+  "scripts": {
+    "lint": "xo",
+    "test": "npm run test:node && npm run test:browser && npm run lint",
+    "test:node": "istanbul cover _mocha -- test.js",
+    "test:browser": "karma start --single-run",
+    "test:coverage": "cat ./coverage/lcov.info | coveralls"
+  },
+  "dependencies": {
+    "ms": "2.1.2"
+  },
+  "devDependencies": {
+    "brfs": "^2.0.1",
+    "browserify": "^16.2.3",
+    "coveralls": "^3.0.2",
+    "istanbul": "^0.4.5",
+    "karma": "^3.1.4",
+    "karma-browserify": "^6.0.0",
+    "karma-chrome-launcher": "^2.2.0",
+    "karma-mocha": "^1.3.0",
+    "mocha": "^5.2.0",
+    "mocha-lcov-reporter": "^1.2.0",
+    "xo": "^0.23.0"
+  },
+  "peerDependenciesMeta": {
+    "supports-color": {
+      "optional": true
+    }
+  },
+  "main": "./src/index.js",
+  "browser": "./src/browser.js",
+  "engines": {
+    "node": ">=6.0"
+  }
+}
--- a/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/debug@4.3.4/node_modules/debug/src/browser.js
+++ b/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/debug@4.3.4/node_modules/debug/src/browser.js
@@ -0,0 +1,269 @@
+/* eslint-env browser */
+
+/**
+ * This is the web browser implementation of `debug()`.
+ */
+
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+exports.storage = localstorage();
+exports.destroy = (() => {
+	let warned = false;
+
+	return () => {
+		if (!warned) {
+			warned = true;
+			console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.');
+		}
+	};
+})();
+
+/**
+ * Colors.
+ */
+
+exports.colors = [
+	'#0000CC',
+	'#0000FF',
+	'#0033CC',
+	'#0033FF',
+	'#0066CC',
+	'#0066FF',
+	'#0099CC',
+	'#0099FF',
+	'#00CC00',
+	'#00CC33',
+	'#00CC66',
+	'#00CC99',
+	'#00CCCC',
+	'#00CCFF',
+	'#3300CC',
+	'#3300FF',
+	'#3333CC',
+	'#3333FF',
+	'#3366CC',
+	'#3366FF',
+	'#3399CC',
+	'#3399FF',
+	'#33CC00',
+	'#33CC33',
+	'#33CC66',
+	'#33CC99',
+	'#33CCCC',
+	'#33CCFF',
+	'#6600CC',
+	'#6600FF',
+	'#6633CC',
+	'#6633FF',
+	'#66CC00',
+	'#66CC33',
+	'#9900CC',
+	'#9900FF',
+	'#9933CC',
+	'#9933FF',
+	'#99CC00',
+	'#99CC33',
+	'#CC0000',
+	'#CC0033',
+	'#CC0066',
+	'#CC0099',
+	'#CC00CC',
+	'#CC00FF',
+	'#CC3300',
+	'#CC3333',
+	'#CC3366',
+	'#CC3399',
+	'#CC33CC',
+	'#CC33FF',
+	'#CC6600',
+	'#CC6633',
+	'#CC9900',
+	'#CC9933',
+	'#CCCC00',
+	'#CCCC33',
+	'#FF0000',
+	'#FF0033',
+	'#FF0066',
+	'#FF0099',
+	'#FF00CC',
+	'#FF00FF',
+	'#FF3300',
+	'#FF3333',
+	'#FF3366',
+	'#FF3399',
+	'#FF33CC',
+	'#FF33FF',
+	'#FF6600',
+	'#FF6633',
+	'#FF9900',
+	'#FF9933',
+	'#FFCC00',
+	'#FFCC33'
+];
+
+/**
+ * Currently only WebKit-based Web Inspectors, Firefox >= v31,
+ * and the Firebug extension (any Firefox version) are known
+ * to support "%c" CSS customizations.
+ *
+ * TODO: add a `localStorage` variable to explicitly enable/disable colors
+ */
+
+// eslint-disable-next-line complexity
+function useColors() {
+	// NB: In an Electron preload script, document will be defined but not fully
+	// initialized. Since we know we're in Chrome, we'll just detect this case
+	// explicitly
+	if (typeof window !== 'undefined' && window.process && (window.process.type === 'renderer' || window.process.__nwjs)) {
+		return true;
+	}
+
+	// Internet Explorer and Edge do not support colors.
+	if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) {
+		return false;
+	}
+
+	// Is webkit? http://stackoverflow.com/a/16459606/376773
+	// document is undefined in react-native: https://github.com/facebook/react-native/pull/1632
+	return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) ||
+		// Is firebug? http://stackoverflow.com/a/398120/376773
+		(typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) ||
+		// Is firefox >= v31?
+		// https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
+		(typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) ||
+		// Double check webkit in userAgent just in case we are in a worker
+		(typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/));
+}
+
+/**
+ * Colorize log arguments if enabled.
+ *
+ * @api public
+ */
+
+function formatArgs(args) {
+	args[0] = (this.useColors ? '%c' : '') +
+		this.namespace +
+		(this.useColors ? ' %c' : ' ') +
+		args[0] +
+		(this.useColors ? '%c ' : ' ') +
+		'+' + module.exports.humanize(this.diff);
+
+	if (!this.useColors) {
+		return;
+	}
+
+	const c = 'color: ' + this.color;
+	args.splice(1, 0, c, 'color: inherit');
+
+	// The final "%c" is somewhat tricky, because there could be other
+	// arguments passed either before or after the %c, so we need to
+	// figure out the correct index to insert the CSS into
+	let index = 0;
+	let lastC = 0;
+	args[0].replace(/%[a-zA-Z%]/g, match => {
+		if (match === '%%') {
+			return;
+		}
+		index++;
+		if (match === '%c') {
+			// We only are interested in the *last* %c
+			// (the user may have provided their own)
+			lastC = index;
+		}
+	});
+
+	args.splice(lastC, 0, c);
+}
+
+/**
+ * Invokes `console.debug()` when available.
+ * No-op when `console.debug` is not a "function".
+ * If `console.debug` is not available, falls back
+ * to `console.log`.
+ *
+ * @api public
+ */
+exports.log = console.debug || console.log || (() => {});
+
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+function save(namespaces) {
+	try {
+		if (namespaces) {
+			exports.storage.setItem('debug', namespaces);
+		} else {
+			exports.storage.removeItem('debug');
+		}
+	} catch (error) {
+		// Swallow
+		// XXX (@Qix-) should we be logging these?
+	}
+}
+
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+function load() {
+	let r;
+	try {
+		r = exports.storage.getItem('debug');
+	} catch (error) {
+		// Swallow
+		// XXX (@Qix-) should we be logging these?
+	}
+
+	// If debug isn't set in LS, and we're in Electron, try to load $DEBUG
+	if (!r && typeof process !== 'undefined' && 'env' in process) {
+		r = process.env.DEBUG;
+	}
+
+	return r;
+}
+
+/**
+ * Localstorage attempts to return the localstorage.
+ *
+ * This is necessary because safari throws
+ * when a user disables cookies/localstorage
+ * and you attempt to access it.
+ *
+ * @return {LocalStorage}
+ * @api private
+ */
+
+function localstorage() {
+	try {
+		// TVMLKit (Apple TV JS Runtime) does not have a window object, just localStorage in the global context
+		// The Browser also has localStorage in the global context.
+		return localStorage;
+	} catch (error) {
+		// Swallow
+		// XXX (@Qix-) should we be logging these?
+	}
+}
+
+module.exports = require('./common')(exports);
+
+const {formatters} = module.exports;
+
+/**
+ * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default.
+ */
+
+formatters.j = function (v) {
+	try {
+		return JSON.stringify(v);
+	} catch (error) {
+		return '[UnexpectedJSONParseError]: ' + error.message;
+	}
+};
--- a/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/debug@4.3.4/node_modules/debug/src/common.js
+++ b/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/debug@4.3.4/node_modules/debug/src/common.js
@@ -0,0 +1,274 @@
+
+/**
+ * This is the common logic for both the Node.js and web browser
+ * implementations of `debug()`.
+ */
+
+function setup(env) {
+	createDebug.debug = createDebug;
+	createDebug.default = createDebug;
+	createDebug.coerce = coerce;
+	createDebug.disable = disable;
+	createDebug.enable = enable;
+	createDebug.enabled = enabled;
+	createDebug.humanize = require('ms');
+	createDebug.destroy = destroy;
+
+	Object.keys(env).forEach(key => {
+		createDebug[key] = env[key];
+	});
+
+	/**
+	* The currently active debug mode names, and names to skip.
+	*/
+
+	createDebug.names = [];
+	createDebug.skips = [];
+
+	/**
+	* Map of special "%n" handling functions, for the debug "format" argument.
+	*
+	* Valid key names are a single, lower or upper-case letter, i.e. "n" and "N".
+	*/
+	createDebug.formatters = {};
+
+	/**
+	* Selects a color for a debug namespace
+	* @param {String} namespace The namespace string for the debug instance to be colored
+	* @return {Number|String} An ANSI color code for the given namespace
+	* @api private
+	*/
+	function selectColor(namespace) {
+		let hash = 0;
+
+		for (let i = 0; i < namespace.length; i++) {
+			hash = ((hash << 5) - hash) + namespace.charCodeAt(i);
+			hash |= 0; // Convert to 32bit integer
+		}
+
+		return createDebug.colors[Math.abs(hash) % createDebug.colors.length];
+	}
+	createDebug.selectColor = selectColor;
+
+	/**
+	* Create a debugger with the given `namespace`.
+	*
+	* @param {String} namespace
+	* @return {Function}
+	* @api public
+	*/
+	function createDebug(namespace) {
+		let prevTime;
+		let enableOverride = null;
+		let namespacesCache;
+		let enabledCache;
+
+		function debug(...args) {
+			// Disabled?
+			if (!debug.enabled) {
+				return;
+			}
+
+			const self = debug;
+
+			// Set `diff` timestamp
+			const curr = Number(new Date());
+			const ms = curr - (prevTime || curr);
+			self.diff = ms;
+			self.prev = prevTime;
+			self.curr = curr;
+			prevTime = curr;
+
+			args[0] = createDebug.coerce(args[0]);
+
+			if (typeof args[0] !== 'string') {
+				// Anything else let's inspect with %O
+				args.unshift('%O');
+			}
+
+			// Apply any `formatters` transformations
+			let index = 0;
+			args[0] = args[0].replace(/%([a-zA-Z%])/g, (match, format) => {
+				// If we encounter an escaped % then don't increase the array index
+				if (match === '%%') {
+					return '%';
+				}
+				index++;
+				const formatter = createDebug.formatters[format];
+				if (typeof formatter === 'function') {
+					const val = args[index];
+					match = formatter.call(self, val);
+
+					// Now we need to remove `args[index]` since it's inlined in the `format`
+					args.splice(index, 1);
+					index--;
+				}
+				return match;
+			});
+
+			// Apply env-specific formatting (colors, etc.)
+			createDebug.formatArgs.call(self, args);
+
+			const logFn = self.log || createDebug.log;
+			logFn.apply(self, args);
+		}
+
+		debug.namespace = namespace;
+		debug.useColors = createDebug.useColors();
+		debug.color = createDebug.selectColor(namespace);
+		debug.extend = extend;
+		debug.destroy = createDebug.destroy; // XXX Temporary. Will be removed in the next major release.
+
+		Object.defineProperty(debug, 'enabled', {
+			enumerable: true,
+			configurable: false,
+			get: () => {
+				if (enableOverride !== null) {
+					return enableOverride;
+				}
+				if (namespacesCache !== createDebug.namespaces) {
+					namespacesCache = createDebug.namespaces;
+					enabledCache = createDebug.enabled(namespace);
+				}
+
+				return enabledCache;
+			},
+			set: v => {
+				enableOverride = v;
+			}
+		});
+
+		// Env-specific initialization logic for debug instances
+		if (typeof createDebug.init === 'function') {
+			createDebug.init(debug);
+		}
+
+		return debug;
+	}
+
+	function extend(namespace, delimiter) {
+		const newDebug = createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace);
+		newDebug.log = this.log;
+		return newDebug;
+	}
+
+	/**
+	* Enables a debug mode by namespaces. This can include modes
+	* separated by a colon and wildcards.
+	*
+	* @param {String} namespaces
+	* @api public
+	*/
+	function enable(namespaces) {
+		createDebug.save(namespaces);
+		createDebug.namespaces = namespaces;
+
+		createDebug.names = [];
+		createDebug.skips = [];
+
+		let i;
+		const split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/);
+		const len = split.length;
+
+		for (i = 0; i < len; i++) {
+			if (!split[i]) {
+				// ignore empty strings
+				continue;
+			}
+
+			namespaces = split[i].replace(/\*/g, '.*?');
+
+			if (namespaces[0] === '-') {
+				createDebug.skips.push(new RegExp('^' + namespaces.slice(1) + '$'));
+			} else {
+				createDebug.names.push(new RegExp('^' + namespaces + '$'));
+			}
+		}
+	}
+
+	/**
+	* Disable debug output.
+	*
+	* @return {String} namespaces
+	* @api public
+	*/
+	function disable() {
+		const namespaces = [
+			...createDebug.names.map(toNamespace),
+			...createDebug.skips.map(toNamespace).map(namespace => '-' + namespace)
+		].join(',');
+		createDebug.enable('');
+		return namespaces;
+	}
+
+	/**
+	* Returns true if the given mode name is enabled, false otherwise.
+	*
+	* @param {String} name
+	* @return {Boolean}
+	* @api public
+	*/
+	function enabled(name) {
+		if (name[name.length - 1] === '*') {
+			return true;
+		}
+
+		let i;
+		let len;
+
+		for (i = 0, len = createDebug.skips.length; i < len; i++) {
+			if (createDebug.skips[i].test(name)) {
+				return false;
+			}
+		}
+
+		for (i = 0, len = createDebug.names.length; i < len; i++) {
+			if (createDebug.names[i].test(name)) {
+				return true;
+			}
+		}
+
+		return false;
+	}
+
+	/**
+	* Convert regexp to namespace
+	*
+	* @param {RegExp} regxep
+	* @return {String} namespace
+	* @api private
+	*/
+	function toNamespace(regexp) {
+		return regexp.toString()
+			.substring(2, regexp.toString().length - 2)
+			.replace(/\.\*\?$/, '*');
+	}
+
+	/**
+	* Coerce `val`.
+	*
+	* @param {Mixed} val
+	* @return {Mixed}
+	* @api private
+	*/
+	function coerce(val) {
+		if (val instanceof Error) {
+			return val.stack || val.message;
+		}
+		return val;
+	}
+
+	/**
+	* XXX DO NOT USE. This is a temporary stub function.
+	* XXX It WILL be removed in the next major release.
+	*/
+	function destroy() {
+		console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.');
+	}
+
+	createDebug.enable(createDebug.load());
+
+	return createDebug;
+}
+
+module.exports = setup;
--- a/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/debug@4.3.4/node_modules/debug/src/index.js
+++ b/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/debug@4.3.4/node_modules/debug/src/index.js
@@ -0,0 +1,10 @@
+/**
+ * Detect Electron renderer / nwjs process, which is node, but we should
+ * treat as a browser.
+ */
+
+if (typeof process === 'undefined' || process.type === 'renderer' || process.browser === true || process.__nwjs) {
+	module.exports = require('./browser.js');
+} else {
+	module.exports = require('./node.js');
+}
--- a/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/debug@4.3.4/node_modules/debug/src/node.js
+++ b/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/debug@4.3.4/node_modules/debug/src/node.js
@@ -0,0 +1,263 @@
+/**
+ * Module dependencies.
+ */
+
+const tty = require('tty');
+const util = require('util');
+
+/**
+ * This is the Node.js implementation of `debug()`.
+ */
+
+exports.init = init;
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+exports.destroy = util.deprecate(
+	() => {},
+	'Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.'
+);
+
+/**
+ * Colors.
+ */
+
+exports.colors = [6, 2, 3, 4, 5, 1];
+
+try {
+	// Optional dependency (as in, doesn't need to be installed, NOT like optionalDependencies in package.json)
+	// eslint-disable-next-line import/no-extraneous-dependencies
+	const supportsColor = require('supports-color');
+
+	if (supportsColor && (supportsColor.stderr || supportsColor).level >= 2) {
+		exports.colors = [
+			20,
+			21,
+			26,
+			27,
+			32,
+			33,
+			38,
+			39,
+			40,
+			41,
+			42,
+			43,
+			44,
+			45,
+			56,
+			57,
+			62,
+			63,
+			68,
+			69,
+			74,
+			75,
+			76,
+			77,
+			78,
+			79,
+			80,
+			81,
+			92,
+			93,
+			98,
+			99,
+			112,
+			113,
+			128,
+			129,
+			134,
+			135,
+			148,
+			149,
+			160,
+			161,
+			162,
+			163,
+			164,
+			165,
+			166,
+			167,
+			168,
+			169,
+			170,
+			171,
+			172,
+			173,
+			178,
+			179,
+			184,
+			185,
+			196,
+			197,
+			198,
+			199,
+			200,
+			201,
+			202,
+			203,
+			204,
+			205,
+			206,
+			207,
+			208,
+			209,
+			214,
+			215,
+			220,
+			221
+		];
+	}
+} catch (error) {
+	// Swallow - we only care if `supports-color` is available; it doesn't have to be.
+}
+
+/**
+ * Build up the default `inspectOpts` object from the environment variables.
+ *
+ *   $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js
+ */
+
+exports.inspectOpts = Object.keys(process.env).filter(key => {
+	return /^debug_/i.test(key);
+}).reduce((obj, key) => {
+	// Camel-case
+	const prop = key
+		.substring(6)
+		.toLowerCase()
+		.replace(/_([a-z])/g, (_, k) => {
+			return k.toUpperCase();
+		});
+
+	// Coerce string value into JS value
+	let val = process.env[key];
+	if (/^(yes|on|true|enabled)$/i.test(val)) {
+		val = true;
+	} else if (/^(no|off|false|disabled)$/i.test(val)) {
+		val = false;
+	} else if (val === 'null') {
+		val = null;
+	} else {
+		val = Number(val);
+	}
+
+	obj[prop] = val;
+	return obj;
+}, {});
+
+/**
+ * Is stdout a TTY? Colored output is enabled when `true`.
+ */
+
+function useColors() {
+	return 'colors' in exports.inspectOpts ?
+		Boolean(exports.inspectOpts.colors) :
+		tty.isatty(process.stderr.fd);
+}
+
+/**
+ * Adds ANSI color escape codes if enabled.
+ *
+ * @api public
+ */
+
+function formatArgs(args) {
+	const {namespace: name, useColors} = this;
+
+	if (useColors) {
+		const c = this.color;
+		const colorCode = '\u001B[3' + (c < 8 ? c : '8;5;' + c);
+		const prefix = `  ${colorCode};1m${name} \u001B[0m`;
+
+		args[0] = prefix + args[0].split('\n').join('\n' + prefix);
+		args.push(colorCode + 'm+' + module.exports.humanize(this.diff) + '\u001B[0m');
+	} else {
+		args[0] = getDate() + name + ' ' + args[0];
+	}
+}
+
+function getDate() {
+	if (exports.inspectOpts.hideDate) {
+		return '';
+	}
+	return new Date().toISOString() + ' ';
+}
+
+/**
+ * Invokes `util.format()` with the specified arguments and writes to stderr.
+ */
+
+function log(...args) {
+	return process.stderr.write(util.format(...args) + '\n');
+}
+
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+function save(namespaces) {
+	if (namespaces) {
+		process.env.DEBUG = namespaces;
+	} else {
+		// If you set a process.env field to null or undefined, it gets cast to the
+		// string 'null' or 'undefined'. Just delete instead.
+		delete process.env.DEBUG;
+	}
+}
+
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+function load() {
+	return process.env.DEBUG;
+}
+
+/**
+ * Init logic for `debug` instances.
+ *
+ * Create a new `inspectOpts` object in case `useColors` is set
+ * differently for a particular `debug` instance.
+ */
+
+function init(debug) {
+	debug.inspectOpts = {};
+
+	const keys = Object.keys(exports.inspectOpts);
+	for (let i = 0; i < keys.length; i++) {
+		debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]];
+	}
+}
+
+module.exports = require('./common')(exports);
+
+const {formatters} = module.exports;
+
+/**
+ * Map %o to `util.inspect()`, all on a single line.
+ */
+
+formatters.o = function (v) {
+	this.inspectOpts.colors = this.useColors;
+	return util.inspect(v, this.inspectOpts)
+		.split('\n')
+		.map(str => str.trim())
+		.join(' ');
+};
+
+/**
+ * Map %O to `util.inspect()`, allowing multiple lines if needed.
+ */
+
+formatters.O = function (v) {
+	this.inspectOpts.colors = this.useColors;
+	return util.inspect(v, this.inspectOpts);
+};
--- a/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/debug@4.3.4/node_modules/ms
+++ b/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/debug@4.3.4/node_modules/ms
@@ -0,0 +1 @@
+../../ms@2.1.2/node_modules/ms
--- a/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/lock.yaml
+++ b/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/lock.yaml
@@ -0,0 +1,31 @@
+lockfileVersion: '6.0'
+
+settings:
+  autoInstallPeers: true
+  excludeLinksFromLockfile: false
+
+importers:
+
+  .:
+    dependencies:
+      debug:
+        specifier: 4.3.4
+        version: 4.3.4
+
+packages:
+
+  /debug@4.3.4:
+    resolution: {integrity: sha512-PRWFHuSU3eDtQJPvnNY7Jcket1j0t5OuOsFzPPzsekD52Zl8qUfFIPEiswXqIvHWGVHOgX+7G/vCNNhehwxfkQ==}
+    engines: {node: '>=6.0'}
+    peerDependencies:
+      supports-color: '*'
+    peerDependenciesMeta:
+      supports-color:
+        optional: true
+    dependencies:
+      ms: 2.1.2
+    dev: false
+
+  /ms@2.1.2:
+    resolution: {integrity: sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==}
+    dev: false
--- a/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/ms@2.1.2/node_modules/ms/index.js
+++ b/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/ms@2.1.2/node_modules/ms/index.js
@@ -0,0 +1,162 @@
+/**
+ * Helpers.
+ */
+
+var s = 1000;
+var m = s * 60;
+var h = m * 60;
+var d = h * 24;
+var w = d * 7;
+var y = d * 365.25;
+
+/**
+ * Parse or format the given `val`.
+ *
+ * Options:
+ *
+ *  - `long` verbose formatting [false]
+ *
+ * @param {String|Number} val
+ * @param {Object} [options]
+ * @throws {Error} throw an error if val is not a non-empty string or a number
+ * @return {String|Number}
+ * @api public
+ */
+
+module.exports = function(val, options) {
+  options = options || {};
+  var type = typeof val;
+  if (type === 'string' && val.length > 0) {
+    return parse(val);
+  } else if (type === 'number' && isFinite(val)) {
+    return options.long ? fmtLong(val) : fmtShort(val);
+  }
+  throw new Error(
+    'val is not a non-empty string or a valid number. val=' +
+      JSON.stringify(val)
+  );
+};
+
+/**
+ * Parse the given `str` and return milliseconds.
+ *
+ * @param {String} str
+ * @return {Number}
+ * @api private
+ */
+
+function parse(str) {
+  str = String(str);
+  if (str.length > 100) {
+    return;
+  }
+  var match = /^(-?(?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|weeks?|w|years?|yrs?|y)?$/i.exec(
+    str
+  );
+  if (!match) {
+    return;
+  }
+  var n = parseFloat(match[1]);
+  var type = (match[2] || 'ms').toLowerCase();
+  switch (type) {
+    case 'years':
+    case 'year':
+    case 'yrs':
+    case 'yr':
+    case 'y':
+      return n * y;
+    case 'weeks':
+    case 'week':
+    case 'w':
+      return n * w;
+    case 'days':
+    case 'day':
+    case 'd':
+      return n * d;
+    case 'hours':
+    case 'hour':
+    case 'hrs':
+    case 'hr':
+    case 'h':
+      return n * h;
+    case 'minutes':
+    case 'minute':
+    case 'mins':
+    case 'min':
+    case 'm':
+      return n * m;
+    case 'seconds':
+    case 'second':
+    case 'secs':
+    case 'sec':
+    case 's':
+      return n * s;
+    case 'milliseconds':
+    case 'millisecond':
+    case 'msecs':
+    case 'msec':
+    case 'ms':
+      return n;
+    default:
+      return undefined;
+  }
+}
+
+/**
+ * Short format for `ms`.
+ *
+ * @param {Number} ms
+ * @return {String}
+ * @api private
+ */
+
+function fmtShort(ms) {
+  var msAbs = Math.abs(ms);
+  if (msAbs >= d) {
+    return Math.round(ms / d) + 'd';
+  }
+  if (msAbs >= h) {
+    return Math.round(ms / h) + 'h';
+  }
+  if (msAbs >= m) {
+    return Math.round(ms / m) + 'm';
+  }
+  if (msAbs >= s) {
+    return Math.round(ms / s) + 's';
+  }
+  return ms + 'ms';
+}
+
+/**
+ * Long format for `ms`.
+ *
+ * @param {Number} ms
+ * @return {String}
+ * @api private
+ */
+
+function fmtLong(ms) {
+  var msAbs = Math.abs(ms);
+  if (msAbs >= d) {
+    return plural(ms, msAbs, d, 'day');
+  }
+  if (msAbs >= h) {
+    return plural(ms, msAbs, h, 'hour');
+  }
+  if (msAbs >= m) {
+    return plural(ms, msAbs, m, 'minute');
+  }
+  if (msAbs >= s) {
+    return plural(ms, msAbs, s, 'second');
+  }
+  return ms + ' ms';
+}
+
+/**
+ * Pluralization helper.
+ */
+
+function plural(ms, msAbs, n, name) {
+  var isPlural = msAbs >= n * 1.5;
+  return Math.round(ms / n) + ' ' + name + (isPlural ? 's' : '');
+}
--- a/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/ms@2.1.2/node_modules/ms/license.md
+++ b/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/ms@2.1.2/node_modules/ms/license.md
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2016 Zeit, Inc.
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
--- a/Show More
+++ b/Show More
Author	SHA1	Message	Date
Vercel Release Bot	fde40e731a	Version Packages (#10278 ) Co-authored-by: github-actions[bot] <github-actions[bot]@users.noreply.github.com>	2023-07-31 13:31:22 -05:00
Trek Glowacki	f353527421	[cli] Migrate `bisect` command to new structure (#10276 ) Migrating `bisect` to the command structure created in https://github.com/vercel/vercel/pull/10090. Unsure about tests. This is technically a refactor so existing tests should suffice. Before: <img width="534" alt="CleanShot 2023-07-31 at 08 14 29@2x" src="https://github.com/vercel/vercel/assets/9736/8ae53672-9b1f-444a-94d3-296ac0fa8d30"> After: <img width="674" alt="CleanShot 2023-07-31 at 08 15 02@2x" src="https://github.com/vercel/vercel/assets/9736/0ba12f19-fb34-41f3-84fb-0c1498d7a485">	2023-07-31 16:03:13 +00:00
Trek Glowacki	c1cdfb3e75	[cli] Migrate `remove` command to new structure (#10268 ) Migrating `remove` to the command structure created in #10090. Unsure about tests. This is technically a refactor so existing tests should suffice.	2023-07-31 15:42:27 +00:00
Kiko Beats	fc413707d0	fix: move content-type as dependency (#10274 ) It's required by `serverless-functions/helpers.js` causing unhandled error because it's missing. ``` Error: Cannot find module 'content-type' Require stack: - /Users/kikobeats/Library/pnpm/global/5/.pnpm/@vercel+node@2.15.6/node_modules/@vercel/node/dist/serverless-functions/helpers.js at Function.Module._resolveFilename (node:internal/modules/cjs/loader:1077:15) at Function.Module._resolveFilename.sharedData.moduleResolveFilenameHook.installedValue [as _resolveFilename] (/Users/kikobeats/Library/pnpm/global/5/.pnpm/@cspotcode+source-map-support@0.8.1/node_modules/@cspotcode/source-map-support/source-map-support.js:811:30) at Function.Module._load (node:internal/modules/cjs/loader:922:27) at Module.require (node:internal/modules/cjs/loader:1143:19) at require (node:internal/modules/cjs/helpers:110:18) at Object.<anonymous> (/Users/kikobeats/Library/pnpm/global/5/.pnpm/@vercel+node@2.15.6/node_modules/@vercel/node/dist/serverless-functions/helpers.js:6:24) at Module._compile (node:internal/modules/cjs/loader:1256:14) at Module._extensions..js (node:internal/modules/cjs/loader:1310:10) at Object.require.extensions.<computed> [as .js] (/Users/kikobeats/Library/pnpm/global/5/.pnpm/ts-node@10.9.1_@types+node@14.18.33_typescript@4.9.5/node_modules/ts-node/src/index.ts:1608:43) at Module.load (node:internal/modules/cjs/loader:1119:32) { code: 'MODULE_NOT_FOUND', requireStack: [ '/Users/kikobeats/Library/pnpm/global/5/.pnpm/@vercel+node@2.15.6/node_modules/@vercel/node/dist/serverless-functions/helpers.js' ] } ```	2023-07-31 16:11:18 +02:00
Vercel Release Bot	e842a8870e	Version Packages (#10261 ) # Releases ## vercel@31.2.0 ### Minor Changes - Add a "Global Options" section to help output ([#10250](https://github.com/vercel/vercel/pull/10250)) ### Patch Changes - Updated dependencies \[[`d1b0dbe3a`](`d1b0dbe3a7`), [`4a8622a10`](`4a8622a10d`), [`6469ef1b8`](`6469ef1b8c`)]: - @vercel/remix-builder@1.9.0 - @vercel/next@3.9.3 ## @vercel/remix-builder@1.9.0 ### Minor Changes - Install `@vercel/remix-run-dev` at build-time instead of using symlink ([#9784](https://github.com/vercel/vercel/pull/9784)) ### Patch Changes - Update `@remix-run/dev` fork to v1.19.1 ([#10246](https://github.com/vercel/vercel/pull/10246)) ## @vercel/next@3.9.3 ### Patch Changes - fix dynamic not found pages ([#10262](https://github.com/vercel/vercel/pull/10262))	2023-07-28 15:40:19 -07:00
Nathan Rajlich	d1b0dbe3a7	[remix] Install `@vercel/remix-run-dev` at build-time instead of using symlink (#9784 ) Instead of including the fork `@remix-run/dev` package as a regular dependency of `@vercel/remix-builder`, install it at build-time by modifying the project's `package.json` file. The reasons for this are: * Avoids deprecation warnings from a few packages that currently exist on the `@remix-run/dev` package when installing Vercel CLI (those warnings already show up in the build logs anyways, so nothing new there). * Allows us to install a version as close as possible to the version specified in the user's `package.json` (similar to how we do when auto-injecting the `@vercel/remix` package). This will be especially important once Remix v2 is released, which will have breaking changes compared to v1. Note: `@vercel/remix-run-dev` is still a _dev_ dependency, so that we can use TypeScript types from it, as well as, at runtime, we use the version in the Builder's `package.json` to determine the maximum versions of `@vercel/remix-run-dev` and/or `@vercel/remix` which can safely be installed. Fixes #10027. Fixes #10222.	2023-07-28 20:49:32 +00:00
Chris Barber	d614709308	[codeowners] Add @trek to codeowners (#10267 ) Adding Trek so he join in on the code review fun!	2023-07-28 13:28:45 -04:00
Trek Glowacki	d5b588bc06	[cli] Add a "Global Options" section to help output (#10250 ) Followup PR to #10090. Some of our commands duplicate global options into their `args` structure e.g. `2661f56347/packages/cli/src/commands/logs.ts (L25-L26)` Others commands omit it entirely. This updates the `--help` output for commands migrated to our new structure (so far, only `deploy`) will show a "Global Options" section: ``` ▲ vercel deploy [project-path] [options] Deploy your project to Vercel. The `deploy` command is the default command for the Vercel CLI, and can be omitted (`vc deploy my-app` equals `vc my-app`). Options --archive Compress the deployment code into a file before uploading it -b, --build-env <key=value> Specify environment variables during build-time (e.g. `-b KEY1=value1 -b KEY2=value2`) -e, --env <key=value> Specify environment variables during run-time (e.g. `-e KEY1=value1 -e KEY2=value2`) -f, --force Force a new deployment even if nothing has changed -m, --meta <key=value> Specify metadata for the deployment (e.g. `-m KEY1=value1 -m KEY2=value2`) --no-wait Don't wait for the deployment to finish --prebuilt Use in combination with `vc build`. Deploy an existing build --prod Create a production deployment -p, --public Deployment is public (`/_src`) is exposed) --regions Set default regions to enable the deployment on --with-cache Retain build cache when using "--force" -y, --yes Use default options to skip all prompts Global Options --cwd <DIR> Sets the current working directory for a single run of a command -d, --debug Debug mode (default off) -Q, --global-config <DIR> Path to the global ${'`.vercel`'} directory -h, --help Output usage information -A, --local-config <FILE> Path to the local `vercel.json` file --no-color No color mode (default off) -S, --scope Set a custom scope -t, --token <TOKEN> Login token -v, --version Output the version number ``` As commands are migrated to this new structure, they'll gain this output automatically.	2023-07-27 20:48:07 +00:00
Zack Tanner	4a8622a10d	[next] fix dynamic not found pages (#10262 ) This updates `getServerlessPages` to consider `/_not-found` pages (which might opt into dynamic rendering) - Corresponding Next.js changes https://github.com/vercel/next.js/pull/53231 - [slack x-ref](https://vercel.slack.com/archives/C03S8ED1DKM/p1683763412272429)	2023-07-27 16:18:31 +00:00
Vercel Release Bot	6469ef1b8c	[remix] Update `@remix-run/dev` to v1.19.1 (#10246 ) This auto-generated PR updates `@remix-run/dev` to version 1.19.1.	2023-07-26 22:22:21 +00:00
Nathan Rajlich	b8d42a521b	[examples] Remove "author" field from `hydrogen` template (#10253 )	2023-07-26 14:48:07 -07:00
Vercel Release Bot	b1e8c9cb6e	Version Packages (#10260 ) This PR was opened by the [Changesets release](https://github.com/changesets/action) GitHub action. When you're ready to do a release, you can merge this and the packages will be published to npm automatically. If you're not ready to do a release yet, that's fine, whenever you add more changesets to main, this PR will be updated. # Releases ## vercel@31.1.1 ### Patch Changes - Updated dependencies \[[`7c30b13cc`](`7c30b13ccb`)]: - @vercel/next@3.9.2 ## @vercel/next@3.9.2 ### Patch Changes - Fix pages/404 gsp + i18n case ([#10258](https://github.com/vercel/vercel/pull/10258)) Co-authored-by: github-actions[bot] <github-actions[bot]@users.noreply.github.com>	2023-07-26 14:50:22 -04:00
JJ Kasper	7c30b13ccb	[next] Fix pages/404 gsp + i18n case (#10258 ) This ensures we detect the locale prefixed 404 when it uses `getStaticProps` correctly. - x-ref: [slack thread](https://vercel.slack.com/archives/C05JTC58AQJ) - Closes https://github.com/vercel/vercel/pull/10248	2023-07-26 18:41:25 +00:00
Steven	e5e757de34	[tests] fix `vary` header in next tests (#10249 ) Since we run tests against canary, the latest [v13.4.13-canary.0](https://github.com/vercel/next.js/releases/tag/v13.4.13-canary.0) changed the `vary` header in https://github.com/vercel/next.js/pull/52746 so we need to update the tests to match.	2023-07-26 16:52:13 +00:00
Vercel Release Bot	2661f56347	Version Packages (#10227 ) # Releases ## vercel@31.1.0 ### Minor Changes - Add 'Environment' column to 'vc list' with new '--environment' filter and pipe URLs to stdout ([#10239](https://github.com/vercel/vercel/pull/10239)) ### Patch Changes - Update `proxy-agent` to v6.3.0 ([#10226](https://github.com/vercel/vercel/pull/10226)) - Use `getNodeBinPaths()` in `vc dev` ([#10225](https://github.com/vercel/vercel/pull/10225)) - Updated dependencies \[[`b1c14cde0`](`b1c14cde03`), [`ce4633fe4`](`ce4633fe4d`)]: - @vercel/next@3.9.1 - @vercel/static-build@1.3.42 ## @vercel/frameworks@1.5.0 ### Minor Changes - Add `ignorePackageJsonScript` configuration for Framework command settings to ignore the `package.json` script. ([#10228](https://github.com/vercel/vercel/pull/10228)) Enable this mode for Storybook's `buildCommand`, since it should not invoke the "build" script, which is most likely designated for the frontend app build. ## @vercel/fs-detectors@4.1.1 ### Patch Changes - Updated dependencies \[[`ce4633fe4`](`ce4633fe4d`)]: - @vercel/frameworks@1.5.0 ## @vercel/next@3.9.1 ### Patch Changes - Fix pages and app router i18n handling ([#10243](https://github.com/vercel/vercel/pull/10243)) ## @vercel/static-build@1.3.42 ### Patch Changes - Add `ignorePackageJsonScript` configuration for Framework command settings to ignore the `package.json` script. ([#10228](https://github.com/vercel/vercel/pull/10228)) Enable this mode for Storybook's `buildCommand`, since it should not invoke the "build" script, which is most likely designated for the frontend app build.	2023-07-24 18:02:38 -07:00
JJ Kasper	b1c14cde03	[next] Fix pages and app router i18n handling (#10243 ) Ensures app router paths are handled properly when i18n is configured for pages directory. x-ref: [slack thread](https://vercel.slack.com/archives/C03KAR5DCKC/p1687565759424049) x-ref: [slack thread](https://vercel.slack.com/archives/C03KAR5DCKC/p1687565759424049) x-ref: [slack thread](https://vercel.slack.com/archives/C03KAR5DCKC/p1672781549860349?thread_ts=1671393204.073649&cid=C03KAR5DCKC) [VCCLI-780](https://linear.app/vercel/issue/VCCLI-780/add-404i18n-invariant-case-in-nextjs-builder)	2023-07-24 23:26:25 +00:00
Chris Barber	8dd6d021df	[cli] Add "Environment" column to `vc list` (#10239 ) Also adds a new `--environment=[preview\|production]` filter and ability to pipe deployment URLs to `stdout`! <img width="380" alt="image" src="https://github.com/vercel/vercel/assets/97262/20de0caa-2d63-4112-8213-cc15d23295c7"> ``` vc list --environment preview ``` ``` vc list --environment production ``` ``` vc list --environment preview > preview_deployments.txt ```	2023-07-24 20:02:25 +00:00
Vercel Release Bot	88ec6e69d6	[examples][tests] Upgrade Next.js to version 13.4.12 (#10240 ) This auto-generated PR updates 3 packages to Next.js version 13.4.12	2023-07-23 21:51:14 +00:00
Vercel Release Bot	a6f2e7b136	[tests] Upgrade Turbo to version 1.10.9 (#10241 ) This auto-generated PR updates Turbo to version 1.10.9	2023-07-23 21:30:01 +00:00
Vercel Release Bot	e906365909	[examples][tests] Upgrade Next.js to version 13.4.11 (#10233 ) This auto-generated PR updates 3 packages to Next.js version 13.4.11	2023-07-21 19:01:10 +00:00
Nathan Rajlich	7b01a07394	[cli] Use `getNodeBinPaths()` in `vc dev` (#10225 ) This allows for the "dev command" of a Project to work better in monorepos, where the dev server might live up the node_modules hierarchy within the repo.	2023-07-19 22:19:43 +00:00
Nathan Rajlich	ce4633fe4d	[frameworks][static-build] Add `ignorePackageJsonScript` configuration for Framework command settings (#10228 ) When this property is set to `true`, then the corresponding `package.json` script will not be invoked, allowing for the default setting value will be executed. This is enabled for Storybook's `buildCommand`, since we do not want the "build" script to be invoked, since that would belong to the frontend application's build instead of Storybook's.	2023-07-19 20:23:51 +00:00
Nathan Rajlich	fdf86fda03	[cli] Update `proxy-agent` to v6.3.0 (#10226 ) This version includes a refactor for proxies specified via PAC files such that it no longer uses the deprecated `vm2` module. See https://github.com/TooTallNate/proxy-agents/issues/218.	2023-07-18 20:29:37 +00:00
Vercel Release Bot	56178e6a46	Version Packages (#10213 ) Co-authored-by: github-actions[bot] <github-actions[bot]@users.noreply.github.com>	2023-07-18 14:02:19 -05:00
Nathan Rajlich	5439d7c0c9	[remix] Create ensured dependency symlink at the `start` directory, instead of root of repo (#10224 ) When the `ensureResolvable()` function runs in a monorepo, the symlink should be created in the `node_modules` directory within the app subdirectory, rather than the root of the repository. Fixes the following issue: ![image](https://github.com/vercel/vercel/assets/71256/c0171533-881a-425e-85b9-82318ef19032)	2023-07-18 18:27:19 +00:00
Zack Tanner	c670e51712	[next] fix 404 page in edge runtime (#10223 ) Fixes Next builder to handle edge runtime on 404 pages [Related Next.js PR](https://github.com/vercel/next.js/pull/52754) [slack x-ref](https://vercel.slack.com/archives/C03S8ED1DKM/p1689312606770609)	2023-07-17 19:48:45 +00:00
Kiko Beats	b56639b624	[node] fix: runs edge user code inside IIFE (#10220 ) In this way, `self` is isolated and modify it doesn't break some Edge Runtime internals Originally reported by @jawj at https://github.com/jawj/neon-vercel-zapatos-minimal-crash	2023-07-17 16:45:05 +00:00
Kiko Beats	12bbae098c	[codeowners] @vercel/edge-compute → @vercel/compute (#10219 )	2023-07-17 14:33:25 +00:00
Nathan Rajlich	9969f0ba18	[cli] Use `detectFrameworks()` during `vc link --repo` (#10203 ) Allows for multiple frameworks to be detectable within the same root directory. This is basically specifically for Storybook. <img width="700" alt="Screenshot 2023-07-12 at 6 04 37 PM" src="https://github.com/vercel/vercel/assets/71256/5a240f1e-b000-42ad-b36f-3c151d3cd449">	2023-07-14 18:11:49 +00:00
Vercel Release Bot	24e1e3c3be	[examples][tests] Upgrade Next.js to version 13.4.10 (#10215 ) This auto-generated PR updates 3 packages to Next.js version 13.4.10	2023-07-14 16:27:44 +00:00
Steven	b61674cb2d	[tests] Fix next update cron job (#10214 ) This was supposed to be fixed in https://github.com/vercel/vercel/pull/10173 but the file was created after git commit. This PR makes sure the file is created before git commit.	2023-07-14 16:07:26 +00:00
Florentin / 珞辰	cae60155f3	[next] support maxDuration in Next.js deployments (#10069 ) Follow up PR to `8703c55f9f` which reads the newly created function config manifest and patches in the options for resource creation. --------- Co-authored-by: Steven <steven@ceriously.com>	2023-07-14 15:27:06 +02:00