Version Packages (#10213 )

Co-authored-by: github-actions[bot] <github-actions[bot]@users.noreply.github.com>
[remix] Create ensured dependency symlink at the start directory, instead of root of repo (#10224 )
2025-12-26 03:39:11 +00:00 · 2023-07-18 14:02:19 -05:00 · 2023-07-18 18:27:19 +00:00 · 2023-07-17 19:48:45 +00:00 · 2023-07-17 16:45:05 +00:00 · 2023-07-17 14:33:25 +00:00
126 changed files with 4952 additions and 897 deletions
--- a/.github/CODEOWNERS
+++ b/.github/CODEOWNERS
@@ -7,7 +7,7 @@
 /packages/fs-detectors                   @TooTallNate @EndangeredMassa @styfle @cb1kenobi @Ethan-Arrowood @agadzik @chloetedder
 /packages/next                           @TooTallNate @EndangeredMassa @styfle @cb1kenobi @Ethan-Arrowood @ijjk
 /packages/routing-utils                  @TooTallNate @EndangeredMassa @styfle @cb1kenobi @Ethan-Arrowood @ijjk
-/packages/edge                           @vercel/edge-compute
+/packages/edge                           @vercel/compute
 /examples                                @leerob
 /examples/create-react-app               @Timer
 /examples/nextjs                         @timneutkens @ijjk @styfle
--- a/examples/nextjs/package-lock.json
+++ b/examples/nextjs/package-lock.json
@@ -8,17 +8,25 @@
      "name": "nextjs",
      "version": "0.1.0",
      "dependencies": {
-        "eslint": "8.43.0",
-        "eslint-config-next": "13.4.7",
-        "next": "13.4.7",
+        "eslint": "8.45.0",
+        "eslint-config-next": "13.4.10",
+        "next": "13.4.10",
        "react": "18.2.0",
        "react-dom": "18.2.0"
      }
    },
+    "node_modules/@aashutoshrathi/word-wrap": {
+      "version": "1.2.6",
+      "resolved": "https://registry.npmjs.org/@aashutoshrathi/word-wrap/-/word-wrap-1.2.6.tgz",
+      "integrity": "sha512-1Yjs2SvM8TflER/OD3cOjhWWOZb58A2t7wpE2S9XfBYTiIl+XFhQG2bjy4Pu1I+EAlCNUzRDYDdFwFYUKvXcIA==",
+      "engines": {
+        "node": ">=0.10.0"
+      }
+    },
    "node_modules/@babel/runtime": {
-      "version": "7.22.5",
-      "resolved": "https://registry.npmjs.org/@babel/runtime/-/runtime-7.22.5.tgz",
-      "integrity": "sha512-ecjvYlnAaZ/KVneE/OdKYBYfgXV3Ptu6zQWmgEF7vwKhQnvVS6bjMD2XYgj+SNvQ1GfK/pjgokfPkC/2CO8CuA==",
+      "version": "7.22.6",
+      "resolved": "https://registry.npmjs.org/@babel/runtime/-/runtime-7.22.6.tgz",
+      "integrity": "sha512-wDb5pWm4WDdF6LFUde3Jl8WzPA+3ZbxYqkC6xAXuD3irdEHN1k0NfTRrJD8ZD378SJ61miMLCqIOXYhd8x+AJQ==",
      "dependencies": {
        "regenerator-runtime": "^0.13.11"
      },
@@ -49,13 +57,13 @@
      }
    },
    "node_modules/@eslint/eslintrc": {
-      "version": "2.0.3",
-      "resolved": "https://registry.npmjs.org/@eslint/eslintrc/-/eslintrc-2.0.3.tgz",
-      "integrity": "sha512-+5gy6OQfk+xx3q0d6jGZZC3f3KzAkXc/IanVxd1is/VIIziRqqt3ongQz0FiTUXqTk0c7aDB3OaFuKnuSoJicQ==",
+      "version": "2.1.0",
+      "resolved": "https://registry.npmjs.org/@eslint/eslintrc/-/eslintrc-2.1.0.tgz",
+      "integrity": "sha512-Lj7DECXqIVCqnqjjHMPna4vn6GJcMgul/wuS0je9OZ9gsL0zzDpKPVtcG1HaDVc+9y+qgXneTeUMbCqXJNpH1A==",
      "dependencies": {
        "ajv": "^6.12.4",
        "debug": "^4.3.2",
-        "espree": "^9.5.2",
+        "espree": "^9.6.0",
        "globals": "^13.19.0",
        "ignore": "^5.2.0",
        "import-fresh": "^3.2.1",
@@ -71,9 +79,9 @@
      }
    },
    "node_modules/@eslint/js": {
-      "version": "8.43.0",
-      "resolved": "https://registry.npmjs.org/@eslint/js/-/js-8.43.0.tgz",
-      "integrity": "sha512-s2UHCoiXfxMvmfzqoN+vrQ84ahUSYde9qNO1MdxmoEhyHWsfmwOpFlwYV+ePJEVc7gFnATGUi376WowX1N7tFg==",
+      "version": "8.44.0",
+      "resolved": "https://registry.npmjs.org/@eslint/js/-/js-8.44.0.tgz",
+      "integrity": "sha512-Ag+9YM4ocKQx9AarydN0KY2j0ErMHNIocPDrVo8zAE44xLTjEtz81OdR68/cydGtk6m6jDb5Za3r2useMzYmSw==",
      "engines": {
        "node": "^12.22.0 || ^14.17.0 || >=16.0.0"
      }
@@ -109,22 +117,22 @@
      "integrity": "sha512-ZnQMnLV4e7hDlUvw8H+U8ASL02SS2Gn6+9Ac3wGGLIe7+je2AeAOxPY+izIPJDfFDb7eDjev0Us8MO1iFRN8hA=="
    },
    "node_modules/@next/env": {
-      "version": "13.4.7",
-      "resolved": "https://registry.npmjs.org/@next/env/-/env-13.4.7.tgz",
-      "integrity": "sha512-ZlbiFulnwiFsW9UV1ku1OvX/oyIPLtMk9p/nnvDSwI0s7vSoZdRtxXNsaO+ZXrLv/pMbXVGq4lL8TbY9iuGmVw=="
+      "version": "13.4.10",
+      "resolved": "https://registry.npmjs.org/@next/env/-/env-13.4.10.tgz",
+      "integrity": "sha512-3G1yD/XKTSLdihyDSa8JEsaWOELY+OWe08o0LUYzfuHp1zHDA8SObQlzKt+v+wrkkPcnPweoLH1ImZeUa0A1NQ=="
    },
    "node_modules/@next/eslint-plugin-next": {
-      "version": "13.4.7",
-      "resolved": "https://registry.npmjs.org/@next/eslint-plugin-next/-/eslint-plugin-next-13.4.7.tgz",
-      "integrity": "sha512-ANEPltxzXbyyG7CvqxdY4PmeM5+RyWdAJGufTHnU+LA/i3J6IDV2r8Z4onKwskwKEhwqzz5lMaSYGGXLyHX+mg==",
+      "version": "13.4.10",
+      "resolved": "https://registry.npmjs.org/@next/eslint-plugin-next/-/eslint-plugin-next-13.4.10.tgz",
+      "integrity": "sha512-YJqyq6vk39JQfvaNtN83t/p5Jy45+bazRL+V4QI8FPd3FBqFYMEsULiwRLgSJMgFqkk4t4JbeZurz+gILEAFpA==",
      "dependencies": {
        "glob": "7.1.7"
      }
    },
    "node_modules/@next/swc-darwin-arm64": {
-      "version": "13.4.7",
-      "resolved": "https://registry.npmjs.org/@next/swc-darwin-arm64/-/swc-darwin-arm64-13.4.7.tgz",
-      "integrity": "sha512-VZTxPv1b59KGiv/pZHTO5Gbsdeoxcj2rU2cqJu03btMhHpn3vwzEK0gUSVC/XW96aeGO67X+cMahhwHzef24/w==",
+      "version": "13.4.10",
+      "resolved": "https://registry.npmjs.org/@next/swc-darwin-arm64/-/swc-darwin-arm64-13.4.10.tgz",
+      "integrity": "sha512-4bsdfKmmg7mgFGph0UorD1xWfZ5jZEw4kKRHYEeTK9bT1QnMbPVPlVXQRIiFPrhoDQnZUoa6duuPUJIEGLV1Jg==",
      "cpu": [
        "arm64"
      ],
@@ -137,9 +145,9 @@
      }
    },
    "node_modules/@next/swc-darwin-x64": {
-      "version": "13.4.7",
-      "resolved": "https://registry.npmjs.org/@next/swc-darwin-x64/-/swc-darwin-x64-13.4.7.tgz",
-      "integrity": "sha512-gO2bw+2Ymmga+QYujjvDz9955xvYGrWofmxTq7m70b9pDPvl7aDFABJOZ2a8SRCuSNB5mXU8eTOmVVwyp/nAew==",
+      "version": "13.4.10",
+      "resolved": "https://registry.npmjs.org/@next/swc-darwin-x64/-/swc-darwin-x64-13.4.10.tgz",
+      "integrity": "sha512-ngXhUBbcZIWZWqNbQSNxQrB9T1V+wgfCzAor2olYuo/YpaL6mUYNUEgeBMhr8qwV0ARSgKaOp35lRvB7EmCRBg==",
      "cpu": [
        "x64"
      ],
@@ -152,9 +160,9 @@
      }
    },
    "node_modules/@next/swc-linux-arm64-gnu": {
-      "version": "13.4.7",
-      "resolved": "https://registry.npmjs.org/@next/swc-linux-arm64-gnu/-/swc-linux-arm64-gnu-13.4.7.tgz",
-      "integrity": "sha512-6cqp3vf1eHxjIDhEOc7Mh/s8z1cwc/l5B6ZNkOofmZVyu1zsbEM5Hmx64s12Rd9AYgGoiCz4OJ4M/oRnkE16/Q==",
+      "version": "13.4.10",
+      "resolved": "https://registry.npmjs.org/@next/swc-linux-arm64-gnu/-/swc-linux-arm64-gnu-13.4.10.tgz",
+      "integrity": "sha512-SjCZZCOmHD4uyM75MVArSAmF5Y+IJSGroPRj2v9/jnBT36SYFTORN8Ag/lhw81W9EeexKY/CUg2e9mdebZOwsg==",
      "cpu": [
        "arm64"
      ],
@@ -167,9 +175,9 @@
      }
    },
    "node_modules/@next/swc-linux-arm64-musl": {
-      "version": "13.4.7",
-      "resolved": "https://registry.npmjs.org/@next/swc-linux-arm64-musl/-/swc-linux-arm64-musl-13.4.7.tgz",
-      "integrity": "sha512-T1kD2FWOEy5WPidOn1si0rYmWORNch4a/NR52Ghyp4q7KyxOCuiOfZzyhVC5tsLIBDH3+cNdB5DkD9afpNDaOw==",
+      "version": "13.4.10",
+      "resolved": "https://registry.npmjs.org/@next/swc-linux-arm64-musl/-/swc-linux-arm64-musl-13.4.10.tgz",
+      "integrity": "sha512-F+VlcWijX5qteoYIOxNiBbNE8ruaWuRlcYyIRK10CugqI/BIeCDzEDyrHIHY8AWwbkTwe6GRHabMdE688Rqq4Q==",
      "cpu": [
        "arm64"
      ],
@@ -182,9 +190,9 @@
      }
    },
    "node_modules/@next/swc-linux-x64-gnu": {
-      "version": "13.4.7",
-      "resolved": "https://registry.npmjs.org/@next/swc-linux-x64-gnu/-/swc-linux-x64-gnu-13.4.7.tgz",
-      "integrity": "sha512-zaEC+iEiAHNdhl6fuwl0H0shnTzQoAoJiDYBUze8QTntE/GNPfTYpYboxF5LRYIjBwETUatvE0T64W6SKDipvg==",
+      "version": "13.4.10",
+      "resolved": "https://registry.npmjs.org/@next/swc-linux-x64-gnu/-/swc-linux-x64-gnu-13.4.10.tgz",
+      "integrity": "sha512-WDv1YtAV07nhfy3i1visr5p/tjiH6CeXp4wX78lzP1jI07t4PnHHG1WEDFOduXh3WT4hG6yN82EQBQHDi7hBrQ==",
      "cpu": [
        "x64"
      ],
@@ -197,9 +205,9 @@
      }
    },
    "node_modules/@next/swc-linux-x64-musl": {
-      "version": "13.4.7",
-      "resolved": "https://registry.npmjs.org/@next/swc-linux-x64-musl/-/swc-linux-x64-musl-13.4.7.tgz",
-      "integrity": "sha512-X6r12F8d8SKAtYJqLZBBMIwEqcTRvUdVm+xIq+l6pJqlgT2tNsLLf2i5Cl88xSsIytBICGsCNNHd+siD2fbWBA==",
+      "version": "13.4.10",
+      "resolved": "https://registry.npmjs.org/@next/swc-linux-x64-musl/-/swc-linux-x64-musl-13.4.10.tgz",
+      "integrity": "sha512-zFkzqc737xr6qoBgDa3AwC7jPQzGLjDlkNmt/ljvQJ/Veri5ECdHjZCUuiTUfVjshNIIpki6FuP0RaQYK9iCRg==",
      "cpu": [
        "x64"
      ],
@@ -212,9 +220,9 @@
      }
    },
    "node_modules/@next/swc-win32-arm64-msvc": {
-      "version": "13.4.7",
-      "resolved": "https://registry.npmjs.org/@next/swc-win32-arm64-msvc/-/swc-win32-arm64-msvc-13.4.7.tgz",
-      "integrity": "sha512-NPnmnV+vEIxnu6SUvjnuaWRglZzw4ox5n/MQTxeUhb5iwVWFedolPFebMNwgrWu4AELwvTdGtWjqof53AiWHcw==",
+      "version": "13.4.10",
+      "resolved": "https://registry.npmjs.org/@next/swc-win32-arm64-msvc/-/swc-win32-arm64-msvc-13.4.10.tgz",
+      "integrity": "sha512-IboRS8IWz5mWfnjAdCekkl8s0B7ijpWeDwK2O8CdgZkoCDY0ZQHBSGiJ2KViAG6+BJVfLvcP+a2fh6cdyBr9QQ==",
      "cpu": [
        "arm64"
      ],
@@ -227,9 +235,9 @@
      }
    },
    "node_modules/@next/swc-win32-ia32-msvc": {
-      "version": "13.4.7",
-      "resolved": "https://registry.npmjs.org/@next/swc-win32-ia32-msvc/-/swc-win32-ia32-msvc-13.4.7.tgz",
-      "integrity": "sha512-6Hxijm6/a8XqLQpOOf/XuwWRhcuc/g4rBB2oxjgCMuV9Xlr2bLs5+lXyh8w9YbAUMYR3iC9mgOlXbHa79elmXw==",
+      "version": "13.4.10",
+      "resolved": "https://registry.npmjs.org/@next/swc-win32-ia32-msvc/-/swc-win32-ia32-msvc-13.4.10.tgz",
+      "integrity": "sha512-bSA+4j8jY4EEiwD/M2bol4uVEu1lBlgsGdvM+mmBm/BbqofNBfaZ2qwSbwE2OwbAmzNdVJRFRXQZ0dkjopTRaQ==",
      "cpu": [
        "ia32"
      ],
@@ -242,9 +250,9 @@
      }
    },
    "node_modules/@next/swc-win32-x64-msvc": {
-      "version": "13.4.7",
-      "resolved": "https://registry.npmjs.org/@next/swc-win32-x64-msvc/-/swc-win32-x64-msvc-13.4.7.tgz",
-      "integrity": "sha512-sW9Yt36Db1nXJL+mTr2Wo0y+VkPWeYhygvcHj1FF0srVtV+VoDjxleKtny21QHaG05zdeZnw2fCtf2+dEqgwqA==",
+      "version": "13.4.10",
+      "resolved": "https://registry.npmjs.org/@next/swc-win32-x64-msvc/-/swc-win32-x64-msvc-13.4.10.tgz",
+      "integrity": "sha512-g2+tU63yTWmcVQKDGY0MV1PjjqgZtwM4rB1oVVi/v0brdZAcrcTV+04agKzWtvWroyFz6IqtT0MoZJA7PNyLVw==",
      "cpu": [
        "x64"
      ],
@@ -289,16 +297,16 @@
      }
    },
    "node_modules/@pkgr/utils": {
-      "version": "2.4.1",
-      "resolved": "https://registry.npmjs.org/@pkgr/utils/-/utils-2.4.1.tgz",
-      "integrity": "sha512-JOqwkgFEyi+OROIyq7l4Jy28h/WwhDnG/cPkXG2Z1iFbubB6jsHW1NDvmyOzTBxHr3yg68YGirmh1JUgMqa+9w==",
+      "version": "2.4.2",
+      "resolved": "https://registry.npmjs.org/@pkgr/utils/-/utils-2.4.2.tgz",
+      "integrity": "sha512-POgTXhjrTfbTV63DiFXav4lBHiICLKKwDeaKn9Nphwj7WH6m0hMMCaJkMyRWjgtPFyRKRVoMXXjczsTQRDEhYw==",
      "dependencies": {
        "cross-spawn": "^7.0.3",
-        "fast-glob": "^3.2.12",
+        "fast-glob": "^3.3.0",
        "is-glob": "^4.0.3",
        "open": "^9.1.0",
        "picocolors": "^1.0.0",
-        "tslib": "^2.5.0"
+        "tslib": "^2.6.0"
      },
      "engines": {
        "node": "^12.20.0 || ^14.18.0 || >=16.0.0"
@@ -326,13 +334,13 @@
      "integrity": "sha512-dRLjCWHYg4oaA77cxO64oO+7JwCwnIzkZPdrrC71jQmQtlhM556pwKo5bUzqvZndkVbeFLIIi+9TC40JNF5hNQ=="
    },
    "node_modules/@typescript-eslint/parser": {
-      "version": "5.60.0",
-      "resolved": "https://registry.npmjs.org/@typescript-eslint/parser/-/parser-5.60.0.tgz",
-      "integrity": "sha512-jBONcBsDJ9UoTWrARkRRCgDz6wUggmH5RpQVlt7BimSwaTkTjwypGzKORXbR4/2Hqjk9hgwlon2rVQAjWNpkyQ==",
+      "version": "5.62.0",
+      "resolved": "https://registry.npmjs.org/@typescript-eslint/parser/-/parser-5.62.0.tgz",
+      "integrity": "sha512-VlJEV0fOQ7BExOsHYAGrgbEiZoi8D+Bl2+f6V2RrXerRSylnp+ZBHmPvaIa8cz0Ajx7WO7Z5RqfgYg7ED1nRhA==",
      "dependencies": {
-        "@typescript-eslint/scope-manager": "5.60.0",
-        "@typescript-eslint/types": "5.60.0",
-        "@typescript-eslint/typescript-estree": "5.60.0",
+        "@typescript-eslint/scope-manager": "5.62.0",
+        "@typescript-eslint/types": "5.62.0",
+        "@typescript-eslint/typescript-estree": "5.62.0",
        "debug": "^4.3.4"
      },
      "engines": {
@@ -352,12 +360,12 @@
      }
    },
    "node_modules/@typescript-eslint/scope-manager": {
-      "version": "5.60.0",
-      "resolved": "https://registry.npmjs.org/@typescript-eslint/scope-manager/-/scope-manager-5.60.0.tgz",
-      "integrity": "sha512-hakuzcxPwXi2ihf9WQu1BbRj1e/Pd8ZZwVTG9kfbxAMZstKz8/9OoexIwnmLzShtsdap5U/CoQGRCWlSuPbYxQ==",
+      "version": "5.62.0",
+      "resolved": "https://registry.npmjs.org/@typescript-eslint/scope-manager/-/scope-manager-5.62.0.tgz",
+      "integrity": "sha512-VXuvVvZeQCQb5Zgf4HAxc04q5j+WrNAtNh9OwCsCgpKqESMTu3tF/jhZ3xG6T4NZwWl65Bg8KuS2uEvhSfLl0w==",
      "dependencies": {
-        "@typescript-eslint/types": "5.60.0",
-        "@typescript-eslint/visitor-keys": "5.60.0"
+        "@typescript-eslint/types": "5.62.0",
+        "@typescript-eslint/visitor-keys": "5.62.0"
      },
      "engines": {
        "node": "^12.22.0 || ^14.17.0 || >=16.0.0"
@@ -368,9 +376,9 @@
      }
    },
    "node_modules/@typescript-eslint/types": {
-      "version": "5.60.0",
-      "resolved": "https://registry.npmjs.org/@typescript-eslint/types/-/types-5.60.0.tgz",
-      "integrity": "sha512-ascOuoCpNZBccFVNJRSC6rPq4EmJ2NkuoKnd6LDNyAQmdDnziAtxbCGWCbefG1CNzmDvd05zO36AmB7H8RzKPA==",
+      "version": "5.62.0",
+      "resolved": "https://registry.npmjs.org/@typescript-eslint/types/-/types-5.62.0.tgz",
+      "integrity": "sha512-87NVngcbVXUahrRTqIK27gD2t5Cu1yuCXxbLcFtCzZGlfyVWWh8mLHkoxzjsB6DDNnvdL+fW8MiwPEJyGJQDgQ==",
      "engines": {
        "node": "^12.22.0 || ^14.17.0 || >=16.0.0"
      },
@@ -380,12 +388,12 @@
      }
    },
    "node_modules/@typescript-eslint/typescript-estree": {
-      "version": "5.60.0",
-      "resolved": "https://registry.npmjs.org/@typescript-eslint/typescript-estree/-/typescript-estree-5.60.0.tgz",
-      "integrity": "sha512-R43thAuwarC99SnvrBmh26tc7F6sPa2B3evkXp/8q954kYL6Ro56AwASYWtEEi+4j09GbiNAHqYwNNZuNlARGQ==",
+      "version": "5.62.0",
+      "resolved": "https://registry.npmjs.org/@typescript-eslint/typescript-estree/-/typescript-estree-5.62.0.tgz",
+      "integrity": "sha512-CmcQ6uY7b9y694lKdRB8FEel7JbU/40iSAPomu++SjLMntB+2Leay2LO6i8VnJk58MtE9/nQSFIH6jpyRWyYzA==",
      "dependencies": {
-        "@typescript-eslint/types": "5.60.0",
-        "@typescript-eslint/visitor-keys": "5.60.0",
+        "@typescript-eslint/types": "5.62.0",
+        "@typescript-eslint/visitor-keys": "5.62.0",
        "debug": "^4.3.4",
        "globby": "^11.1.0",
        "is-glob": "^4.0.3",
@@ -406,11 +414,11 @@
      }
    },
    "node_modules/@typescript-eslint/visitor-keys": {
-      "version": "5.60.0",
-      "resolved": "https://registry.npmjs.org/@typescript-eslint/visitor-keys/-/visitor-keys-5.60.0.tgz",
-      "integrity": "sha512-wm9Uz71SbCyhUKgcaPRauBdTegUyY/ZWl8gLwD/i/ybJqscrrdVSFImpvUz16BLPChIeKBK5Fa9s6KDQjsjyWw==",
+      "version": "5.62.0",
+      "resolved": "https://registry.npmjs.org/@typescript-eslint/visitor-keys/-/visitor-keys-5.62.0.tgz",
+      "integrity": "sha512-07ny+LHRzQXepkGg6w0mFY41fVUNBrL2Roj/++7V1txKugfjm/Ci/qSND03r2RhlJhJYMcTn9AhhSSqQp0Ysyw==",
      "dependencies": {
-        "@typescript-eslint/types": "5.60.0",
+        "@typescript-eslint/types": "5.62.0",
        "eslint-visitor-keys": "^3.3.0"
      },
      "engines": {
@@ -422,9 +430,9 @@
      }
    },
    "node_modules/acorn": {
-      "version": "8.9.0",
-      "resolved": "https://registry.npmjs.org/acorn/-/acorn-8.9.0.tgz",
-      "integrity": "sha512-jaVNAFBHNLXspO543WnNNPZFRtavh3skAkITqD0/2aeMkKZTN+254PyhwxFYrk3vQ1xfY+2wbesJMs/JC8/PwQ==",
+      "version": "8.10.0",
+      "resolved": "https://registry.npmjs.org/acorn/-/acorn-8.10.0.tgz",
+      "integrity": "sha512-F0SAmZ8iUtS//m8DmCTA0jlh6TDKkHQyK6xc6V4KDTyZKA9dnvX9/3sRTVQrWm79glUAZbnmmNcdYwUIHWVybw==",
      "bin": {
        "acorn": "bin/acorn"
      },
@@ -483,9 +491,9 @@
      "integrity": "sha512-8+9WqebbFzpX9OR+Wa6O29asIogeRMzcGtAINdpMHHyAg10f05aSFVBbcEqGf/PXw1EjAZ+q2/bEBg3DvurK3Q=="
    },
    "node_modules/aria-query": {
-      "version": "5.2.1",
-      "resolved": "https://registry.npmjs.org/aria-query/-/aria-query-5.2.1.tgz",
-      "integrity": "sha512-7uFg4b+lETFgdaJyETnILsXgnnzVnkHcgRbwbPwevm5x/LmUlt3MjczMRe1zg824iBgXZNRPTBftNYyRSKLp2g==",
+      "version": "5.3.0",
+      "resolved": "https://registry.npmjs.org/aria-query/-/aria-query-5.3.0.tgz",
+      "integrity": "sha512-b0P0sZPKtyu8HkeRAfCq0IfURZK+SuwMjY1UXGBU27wpAiTwQAIlq56IbIO+ytk/JjS1fMR14ee5WBBfKi5J6A==",
      "dependencies": {
        "dequal": "^2.0.3"
      }
@@ -696,9 +704,9 @@
      }
    },
    "node_modules/caniuse-lite": {
-      "version": "1.0.30001506",
-      "resolved": "https://registry.npmjs.org/caniuse-lite/-/caniuse-lite-1.0.30001506.tgz",
-      "integrity": "sha512-6XNEcpygZMCKaufIcgpQNZNf00GEqc7VQON+9Rd0K1bMYo8xhMZRAo5zpbnbMNizi4YNgIDAFrdykWsvY3H4Hw==",
+      "version": "1.0.30001515",
+      "resolved": "https://registry.npmjs.org/caniuse-lite/-/caniuse-lite-1.0.30001515.tgz",
+      "integrity": "sha512-eEFDwUOZbE24sb+Ecsx3+OvNETqjWIdabMy52oOkIgcUtAsQifjUG9q4U9dgTHJM2mfk4uEPxc0+xuFdJ629QA==",
      "funding": [
        {
          "type": "opencollective",
@@ -900,9 +908,9 @@
      }
    },
    "node_modules/es-abstract": {
-      "version": "1.21.2",
-      "resolved": "https://registry.npmjs.org/es-abstract/-/es-abstract-1.21.2.tgz",
-      "integrity": "sha512-y/B5POM2iBnIxCiernH1G7rC9qQoM77lLIMQLuob0zhp8C56Po81+2Nj0WFKnd0pNReDTnkYryc+zhOzpEIROg==",
+      "version": "1.21.3",
+      "resolved": "https://registry.npmjs.org/es-abstract/-/es-abstract-1.21.3.tgz",
+      "integrity": "sha512-ZU4miiY1j3sGPFLJ34VJXEqhpmL+HGByCinGHv4HC+Fxl2fI2Z4yR6tl0mORnDr6PA8eihWo4LmSWDbvhALckg==",
      "dependencies": {
        "array-buffer-byte-length": "^1.0.0",
        "available-typed-arrays": "^1.0.5",
@@ -910,7 +918,7 @@
        "es-set-tostringtag": "^2.0.1",
        "es-to-primitive": "^1.2.1",
        "function.prototype.name": "^1.1.5",
-        "get-intrinsic": "^1.2.0",
+        "get-intrinsic": "^1.2.1",
        "get-symbol-description": "^1.0.0",
        "globalthis": "^1.0.3",
        "gopd": "^1.0.1",
@@ -930,14 +938,15 @@
        "object-inspect": "^1.12.3",
        "object-keys": "^1.1.1",
        "object.assign": "^4.1.4",
-        "regexp.prototype.flags": "^1.4.3",
+        "regexp.prototype.flags": "^1.5.0",
        "safe-regex-test": "^1.0.0",
        "string.prototype.trim": "^1.2.7",
        "string.prototype.trimend": "^1.0.6",
        "string.prototype.trimstart": "^1.0.6",
+        "typed-array-byte-offset": "^1.0.0",
        "typed-array-length": "^1.0.4",
        "unbox-primitive": "^1.0.2",
-        "which-typed-array": "^1.1.9"
+        "which-typed-array": "^1.1.10"
      },
      "engines": {
        "node": ">= 0.4"
@@ -995,14 +1004,14 @@
      }
    },
    "node_modules/eslint": {
-      "version": "8.43.0",
-      "resolved": "https://registry.npmjs.org/eslint/-/eslint-8.43.0.tgz",
-      "integrity": "sha512-aaCpf2JqqKesMFGgmRPessmVKjcGXqdlAYLLC3THM8t5nBRZRQ+st5WM/hoJXkdioEXLLbXgclUpM0TXo5HX5Q==",
+      "version": "8.45.0",
+      "resolved": "https://registry.npmjs.org/eslint/-/eslint-8.45.0.tgz",
+      "integrity": "sha512-pd8KSxiQpdYRfYa9Wufvdoct3ZPQQuVuU5O6scNgMuOMYuxvH0IGaYK0wUFjo4UYYQQCUndlXiMbnxopwvvTiw==",
      "dependencies": {
        "@eslint-community/eslint-utils": "^4.2.0",
        "@eslint-community/regexpp": "^4.4.0",
-        "@eslint/eslintrc": "^2.0.3",
-        "@eslint/js": "8.43.0",
+        "@eslint/eslintrc": "^2.1.0",
+        "@eslint/js": "8.44.0",
        "@humanwhocodes/config-array": "^0.11.10",
        "@humanwhocodes/module-importer": "^1.0.1",
        "@nodelib/fs.walk": "^1.2.8",
@@ -1014,7 +1023,7 @@
        "escape-string-regexp": "^4.0.0",
        "eslint-scope": "^7.2.0",
        "eslint-visitor-keys": "^3.4.1",
-        "espree": "^9.5.2",
+        "espree": "^9.6.0",
        "esquery": "^1.4.2",
        "esutils": "^2.0.2",
        "fast-deep-equal": "^3.1.3",
@@ -1024,7 +1033,6 @@
        "globals": "^13.19.0",
        "graphemer": "^1.4.0",
        "ignore": "^5.2.0",
-        "import-fresh": "^3.0.0",
        "imurmurhash": "^0.1.4",
        "is-glob": "^4.0.0",
        "is-path-inside": "^3.0.3",
@@ -1034,9 +1042,8 @@
        "lodash.merge": "^4.6.2",
        "minimatch": "^3.1.2",
        "natural-compare": "^1.4.0",
-        "optionator": "^0.9.1",
+        "optionator": "^0.9.3",
        "strip-ansi": "^6.0.1",
-        "strip-json-comments": "^3.1.0",
        "text-table": "^0.2.0"
      },
      "bin": {
@@ -1050,11 +1057,11 @@
      }
    },
    "node_modules/eslint-config-next": {
-      "version": "13.4.7",
-      "resolved": "https://registry.npmjs.org/eslint-config-next/-/eslint-config-next-13.4.7.tgz",
-      "integrity": "sha512-+IRAyD0+J1MZaTi9RQMPUfr6Q+GCZ1wOkK6XM52Vokh7VI4R6YFGOFzdkEFHl4ZyIX4FKa5vcwUP2WscSFNjNQ==",
+      "version": "13.4.10",
+      "resolved": "https://registry.npmjs.org/eslint-config-next/-/eslint-config-next-13.4.10.tgz",
+      "integrity": "sha512-+JjcM6lQmFR5Mw0ORm9o1CR29+z/uajgSfYAPEGIBxOhTHBgCMs7ysuwi72o7LkMmA8E3N7/h09pSGZxs0s85g==",
      "dependencies": {
-        "@next/eslint-plugin-next": "13.4.7",
+        "@next/eslint-plugin-next": "13.4.10",
        "@rushstack/eslint-patch": "^1.1.3",
        "@typescript-eslint/parser": "^5.42.0",
        "eslint-import-resolver-node": "^0.3.6",
@@ -1062,7 +1069,7 @@
        "eslint-plugin-import": "^2.26.0",
        "eslint-plugin-jsx-a11y": "^6.5.1",
        "eslint-plugin-react": "^7.31.7",
-        "eslint-plugin-react-hooks": "^4.5.0"
+        "eslint-plugin-react-hooks": "5.0.0-canary-7118f5dd7-20230705"
      },
      "peerDependencies": {
        "eslint": "^7.23.0 || ^8.0.0",
@@ -1118,13 +1125,13 @@
      }
    },
    "node_modules/eslint-import-resolver-typescript/node_modules/globby": {
-      "version": "13.2.0",
-      "resolved": "https://registry.npmjs.org/globby/-/globby-13.2.0.tgz",
-      "integrity": "sha512-jWsQfayf13NvqKUIL3Ta+CIqMnvlaIDFveWE/dpOZ9+3AMEJozsxDvKA02zync9UuvOM8rOXzsD5GqKP4OnWPQ==",
+      "version": "13.2.2",
+      "resolved": "https://registry.npmjs.org/globby/-/globby-13.2.2.tgz",
+      "integrity": "sha512-Y1zNGV+pzQdh7H39l9zgB4PJqjRNqydvdYCDG4HFXM4XuvSaQQlEc91IU1yALL8gUTDomgBAfz3XJdmUS+oo0w==",
      "dependencies": {
        "dir-glob": "^3.0.1",
-        "fast-glob": "^3.2.11",
-        "ignore": "^5.2.0",
+        "fast-glob": "^3.3.0",
+        "ignore": "^5.2.4",
        "merge2": "^1.4.1",
        "slash": "^4.0.0"
      },
@@ -1218,9 +1225,9 @@
      }
    },
    "node_modules/eslint-plugin-import/node_modules/semver": {
-      "version": "6.3.0",
-      "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.0.tgz",
-      "integrity": "sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==",
+      "version": "6.3.1",
+      "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.1.tgz",
+      "integrity": "sha512-BR7VvDCVHO+q2xBEWskxS6DJE1qRnb7DxzUrogb71CWoSficBxYsiAGd+Kl0mmq/MprG9yArRkyrQxTO6XjMzA==",
      "bin": {
        "semver": "bin/semver.js"
      }
@@ -1255,9 +1262,9 @@
      }
    },
    "node_modules/eslint-plugin-jsx-a11y/node_modules/semver": {
-      "version": "6.3.0",
-      "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.0.tgz",
-      "integrity": "sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==",
+      "version": "6.3.1",
+      "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.1.tgz",
+      "integrity": "sha512-BR7VvDCVHO+q2xBEWskxS6DJE1qRnb7DxzUrogb71CWoSficBxYsiAGd+Kl0mmq/MprG9yArRkyrQxTO6XjMzA==",
      "bin": {
        "semver": "bin/semver.js"
      }
@@ -1291,9 +1298,9 @@
      }
    },
    "node_modules/eslint-plugin-react-hooks": {
-      "version": "4.6.0",
-      "resolved": "https://registry.npmjs.org/eslint-plugin-react-hooks/-/eslint-plugin-react-hooks-4.6.0.tgz",
-      "integrity": "sha512-oFc7Itz9Qxh2x4gNHStv3BqJq54ExXmfC+a1NjAta66IAN87Wu0R/QArgIS9qKzX3dXKPI9H5crl9QchNMY9+g==",
+      "version": "5.0.0-canary-7118f5dd7-20230705",
+      "resolved": "https://registry.npmjs.org/eslint-plugin-react-hooks/-/eslint-plugin-react-hooks-5.0.0-canary-7118f5dd7-20230705.tgz",
+      "integrity": "sha512-AZYbMo/NW9chdL7vk6HQzQhT+PvTAEVqWk9ziruUoW2kAOcN5qNyelv70e0F1VNQAbvutOC9oc+xfWycI9FxDw==",
      "engines": {
        "node": ">=10"
      },
@@ -1329,17 +1336,17 @@
      }
    },
    "node_modules/eslint-plugin-react/node_modules/semver": {
-      "version": "6.3.0",
-      "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.0.tgz",
-      "integrity": "sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==",
+      "version": "6.3.1",
+      "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.1.tgz",
+      "integrity": "sha512-BR7VvDCVHO+q2xBEWskxS6DJE1qRnb7DxzUrogb71CWoSficBxYsiAGd+Kl0mmq/MprG9yArRkyrQxTO6XjMzA==",
      "bin": {
        "semver": "bin/semver.js"
      }
    },
    "node_modules/eslint-scope": {
-      "version": "7.2.0",
-      "resolved": "https://registry.npmjs.org/eslint-scope/-/eslint-scope-7.2.0.tgz",
-      "integrity": "sha512-DYj5deGlHBfMt15J7rdtyKNq/Nqlv5KfU4iodrQ019XESsRnwXH9KAE0y3cwtUHDo2ob7CypAnCqefh6vioWRw==",
+      "version": "7.2.1",
+      "resolved": "https://registry.npmjs.org/eslint-scope/-/eslint-scope-7.2.1.tgz",
+      "integrity": "sha512-CvefSOsDdaYYvxChovdrPo/ZGt8d5lrJWleAc1diXRKhHGiTYEI26cvo8Kle/wGnsizoCJjK73FMg1/IkIwiNA==",
      "dependencies": {
        "esrecurse": "^4.3.0",
        "estraverse": "^5.2.0"
@@ -1363,11 +1370,11 @@
      }
    },
    "node_modules/espree": {
-      "version": "9.5.2",
-      "resolved": "https://registry.npmjs.org/espree/-/espree-9.5.2.tgz",
-      "integrity": "sha512-7OASN1Wma5fum5SrNhFMAMJxOUAbhyfQ8dQ//PJaJbNw0URTPWqIghHWt1MmAANKhHZIYOHruW4Kw4ruUWOdGw==",
+      "version": "9.6.1",
+      "resolved": "https://registry.npmjs.org/espree/-/espree-9.6.1.tgz",
+      "integrity": "sha512-oruZaFkjorTpF32kDSI5/75ViwGeZginGGy2NoOSg3Q9bnwlnmDm4HLnkl0RE3n+njDXR037aY1+x58Z/zFdwQ==",
      "dependencies": {
-        "acorn": "^8.8.0",
+        "acorn": "^8.9.0",
        "acorn-jsx": "^5.3.2",
        "eslint-visitor-keys": "^3.4.1"
      },
@@ -1444,9 +1451,9 @@
      "integrity": "sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q=="
    },
    "node_modules/fast-glob": {
-      "version": "3.2.12",
-      "resolved": "https://registry.npmjs.org/fast-glob/-/fast-glob-3.2.12.tgz",
-      "integrity": "sha512-DVj4CQIYYow0BlaelwK1pHl5n5cRSJfM60UA0zK891sVInoPri2Ekj7+e1CT3/3qxXenpI+nBBmQAcJPJgaj4w==",
+      "version": "3.3.0",
+      "resolved": "https://registry.npmjs.org/fast-glob/-/fast-glob-3.3.0.tgz",
+      "integrity": "sha512-ChDuvbOypPuNjO8yIDf36x7BlZX1smcUMTTcyoIjycexOxd6DFsKsg21qVBzEmr3G7fUKIRy2/psii+CIUt7FA==",
      "dependencies": {
        "@nodelib/fs.stat": "^2.0.2",
        "@nodelib/fs.walk": "^1.2.3",
@@ -1625,9 +1632,9 @@
      }
    },
    "node_modules/get-tsconfig": {
-      "version": "4.6.0",
-      "resolved": "https://registry.npmjs.org/get-tsconfig/-/get-tsconfig-4.6.0.tgz",
-      "integrity": "sha512-lgbo68hHTQnFddybKbbs/RDRJnJT5YyGy2kQzVwbq+g67X73i+5MVTval34QxGkOe9X5Ujf1UYpCaphLyltjEg==",
+      "version": "4.6.2",
+      "resolved": "https://registry.npmjs.org/get-tsconfig/-/get-tsconfig-4.6.2.tgz",
+      "integrity": "sha512-E5XrT4CbbXcXWy+1jChlZmrmCwd5KGx502kDCXJJ7y898TtWW9FwoG5HfOLVRKmlmDGkWN2HM9Ho+/Y8F0sJDg==",
      "dependencies": {
        "resolve-pkg-maps": "^1.0.0"
      },
@@ -2206,12 +2213,14 @@
      }
    },
    "node_modules/jsx-ast-utils": {
-      "version": "3.3.3",
-      "resolved": "https://registry.npmjs.org/jsx-ast-utils/-/jsx-ast-utils-3.3.3.tgz",
-      "integrity": "sha512-fYQHZTZ8jSfmWZ0iyzfwiU4WDX4HpHbMCZ3gPlWYiCl3BoeOTsqKBqnTVfH2rYT7eP5c3sVbeSPHnnJOaTrWiw==",
+      "version": "3.3.4",
+      "resolved": "https://registry.npmjs.org/jsx-ast-utils/-/jsx-ast-utils-3.3.4.tgz",
+      "integrity": "sha512-fX2TVdCViod6HwKEtSWGHs57oFhVfCMwieb9PuRDgjDPh5XeqJiHFFFJCHxU5cnTc3Bu/GRL+kPiFmw8XWOfKw==",
      "dependencies": {
-        "array-includes": "^3.1.5",
-        "object.assign": "^4.1.3"
+        "array-includes": "^3.1.6",
+        "array.prototype.flat": "^1.3.1",
+        "object.assign": "^4.1.4",
+        "object.values": "^1.1.6"
      },
      "engines": {
        "node": ">=4.0"
@@ -2366,11 +2375,11 @@
      "integrity": "sha512-OWND8ei3VtNC9h7V60qff3SVobHr996CTwgxubgyQYEpg290h9J0buyECNNJexkFm5sOajh5G116RYA1c8ZMSw=="
    },
    "node_modules/next": {
-      "version": "13.4.7",
-      "resolved": "https://registry.npmjs.org/next/-/next-13.4.7.tgz",
-      "integrity": "sha512-M8z3k9VmG51SRT6v5uDKdJXcAqLzP3C+vaKfLIAM0Mhx1um1G7MDnO63+m52qPdZfrTFzMZNzfsgvm3ghuVHIQ==",
+      "version": "13.4.10",
+      "resolved": "https://registry.npmjs.org/next/-/next-13.4.10.tgz",
+      "integrity": "sha512-4ep6aKxVTQ7rkUW2fBLhpBr/5oceCuf4KmlUpvG/aXuDTIf9mexNSpabUD6RWPspu6wiJJvozZREhXhueYO36A==",
      "dependencies": {
-        "@next/env": "13.4.7",
+        "@next/env": "13.4.10",
        "@swc/helpers": "0.5.1",
        "busboy": "1.6.0",
        "caniuse-lite": "^1.0.30001406",
@@ -2386,15 +2395,15 @@
        "node": ">=16.8.0"
      },
      "optionalDependencies": {
-        "@next/swc-darwin-arm64": "13.4.7",
-        "@next/swc-darwin-x64": "13.4.7",
-        "@next/swc-linux-arm64-gnu": "13.4.7",
-        "@next/swc-linux-arm64-musl": "13.4.7",
-        "@next/swc-linux-x64-gnu": "13.4.7",
-        "@next/swc-linux-x64-musl": "13.4.7",
-        "@next/swc-win32-arm64-msvc": "13.4.7",
-        "@next/swc-win32-ia32-msvc": "13.4.7",
-        "@next/swc-win32-x64-msvc": "13.4.7"
+        "@next/swc-darwin-arm64": "13.4.10",
+        "@next/swc-darwin-x64": "13.4.10",
+        "@next/swc-linux-arm64-gnu": "13.4.10",
+        "@next/swc-linux-arm64-musl": "13.4.10",
+        "@next/swc-linux-x64-gnu": "13.4.10",
+        "@next/swc-linux-x64-musl": "13.4.10",
+        "@next/swc-win32-arm64-msvc": "13.4.10",
+        "@next/swc-win32-ia32-msvc": "13.4.10",
+        "@next/swc-win32-x64-msvc": "13.4.10"
      },
      "peerDependencies": {
        "@opentelemetry/api": "^1.1.0",
@@ -2578,16 +2587,16 @@
      }
    },
    "node_modules/optionator": {
-      "version": "0.9.1",
-      "resolved": "https://registry.npmjs.org/optionator/-/optionator-0.9.1.tgz",
-      "integrity": "sha512-74RlY5FCnhq4jRxVUPKDaRwrVNXMqsGsiW6AJw4XK8hmtm10wC0ypZBLw5IIp85NZMr91+qd1RvvENwg7jjRFw==",
+      "version": "0.9.3",
+      "resolved": "https://registry.npmjs.org/optionator/-/optionator-0.9.3.tgz",
+      "integrity": "sha512-JjCoypp+jKn1ttEFExxhetCKeJt9zhAgAve5FXHixTvFDW/5aEktX9bufBKLRRMdU7bNtpLfcGu94B3cdEJgjg==",
      "dependencies": {
+        "@aashutoshrathi/word-wrap": "^1.2.3",
        "deep-is": "^0.1.3",
        "fast-levenshtein": "^2.0.6",
        "levn": "^0.4.1",
        "prelude-ls": "^1.2.1",
-        "type-check": "^0.4.0",
-        "word-wrap": "^1.2.3"
+        "type-check": "^0.4.0"
      },
      "engines": {
        "node": ">= 0.8.0"
@@ -2997,9 +3006,9 @@
      }
    },
    "node_modules/semver": {
-      "version": "7.5.2",
-      "resolved": "https://registry.npmjs.org/semver/-/semver-7.5.2.tgz",
-      "integrity": "sha512-SoftuTROv/cRjCze/scjGyiDtcUyxw1rgYQSZY7XTmtR5hX+dm76iDbTH8TkLPHCQmlbQVSSbNZCPM2hb0knnQ==",
+      "version": "7.5.4",
+      "resolved": "https://registry.npmjs.org/semver/-/semver-7.5.4.tgz",
+      "integrity": "sha512-1bCSESV6Pv+i21Hvpxp3Dx+pSD8lIPt8uVjRrxAUt/nbswYc+tK6Y2btiULjd4+fnq15PX+nqQDC7Oft7WkwcA==",
      "dependencies": {
        "lru-cache": "^6.0.0"
      },
@@ -3278,9 +3287,9 @@
      }
    },
    "node_modules/tslib": {
-      "version": "2.5.3",
-      "resolved": "https://registry.npmjs.org/tslib/-/tslib-2.5.3.tgz",
-      "integrity": "sha512-mSxlJJwl3BMEQCUNnxXBU9jP4JBktcEGhURcPR6VQVlnP0FdDEsIaz0C35dXNGLyRfrATNofF0F5p2KPxQgB+w=="
+      "version": "2.6.0",
+      "resolved": "https://registry.npmjs.org/tslib/-/tslib-2.6.0.tgz",
+      "integrity": "sha512-7At1WUettjcSRHXCyYtTselblcHl9PJFFVKiCAy/bY97+BPZXSQ2wbq0P9s8tK2G7dFQfNnlJnPAiArVBVBsfA=="
    },
    "node_modules/tsutils": {
      "version": "3.21.0",
@@ -3323,6 +3332,24 @@
        "url": "https://github.com/sponsors/sindresorhus"
      }
    },
+    "node_modules/typed-array-byte-offset": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/typed-array-byte-offset/-/typed-array-byte-offset-1.0.0.tgz",
+      "integrity": "sha512-RD97prjEt9EL8YgAgpOkf3O4IF9lhJFr9g0htQkm0rchFp/Vx7LW5Q8fSXXub7BXAODyUQohRMyOc3faCPd0hg==",
+      "dependencies": {
+        "available-typed-arrays": "^1.0.5",
+        "call-bind": "^1.0.2",
+        "for-each": "^0.3.3",
+        "has-proto": "^1.0.1",
+        "is-typed-array": "^1.1.10"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
    "node_modules/typed-array-length": {
      "version": "1.0.4",
      "resolved": "https://registry.npmjs.org/typed-array-length/-/typed-array-length-1.0.4.tgz",
@@ -3337,9 +3364,9 @@
      }
    },
    "node_modules/typescript": {
-      "version": "5.1.3",
-      "resolved": "https://registry.npmjs.org/typescript/-/typescript-5.1.3.tgz",
-      "integrity": "sha512-XH627E9vkeqhlZFQuL+UsyAXEnibT0kWR2FWONlr4sTjvxyJYnyefgrkyECLzM5NenmKzRAy2rR/OlYLA1HkZw==",
+      "version": "5.1.6",
+      "resolved": "https://registry.npmjs.org/typescript/-/typescript-5.1.6.tgz",
+      "integrity": "sha512-zaWCozRZ6DLEWAWFrVDz1H6FVXzUSfTy5FUMWsQlU8Ym5JP9eO4xkTIROFCQvhQf61z6O/G6ugw3SgAnvvm+HA==",
      "peer": true,
      "bin": {
        "tsc": "bin/tsc",
@@ -3421,9 +3448,9 @@
      }
    },
    "node_modules/which-typed-array": {
-      "version": "1.1.9",
-      "resolved": "https://registry.npmjs.org/which-typed-array/-/which-typed-array-1.1.9.tgz",
-      "integrity": "sha512-w9c4xkx6mPidwp7180ckYWfMmvxpjlZuIudNtDf4N/tTAUB8VJbX25qZoAsrtGuYNnGw3pa0AXgbGKRB8/EceA==",
+      "version": "1.1.10",
+      "resolved": "https://registry.npmjs.org/which-typed-array/-/which-typed-array-1.1.10.tgz",
+      "integrity": "sha512-uxoA5vLUfRPdjCuJ1h5LlYdmTLbYfums398v3WLkM+i/Wltl2/XyZpQWKbN++ck5L64SR/grOHqtXCUKmlZPNA==",
      "dependencies": {
        "available-typed-arrays": "^1.0.5",
        "call-bind": "^1.0.2",
@@ -3439,14 +3466,6 @@
        "url": "https://github.com/sponsors/ljharb"
      }
    },
-    "node_modules/word-wrap": {
-      "version": "1.2.3",
-      "resolved": "https://registry.npmjs.org/word-wrap/-/word-wrap-1.2.3.tgz",
-      "integrity": "sha512-Hz/mrNwitNRh/HUAtM/VT/5VH+ygD6DV7mYKZAtHOrbs8U7lvPS6xf7EJKMF0uW1KJCl0H701g3ZGus+muE5vQ==",
-      "engines": {
-        "node": ">=0.10.0"
-      }
-    },
    "node_modules/wrappy": {
      "version": "1.0.2",
      "resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz",
--- a/examples/nextjs/package.json
+++ b/examples/nextjs/package.json
@@ -9,9 +9,9 @@
    "lint": "next lint"
  },
  "dependencies": {
-    "eslint": "8.43.0",
-    "eslint-config-next": "13.4.7",
-    "next": "13.4.7",
+    "eslint": "8.45.0",
+    "eslint-config-next": "13.4.10",
+    "next": "13.4.10",
    "react": "18.2.0",
    "react-dom": "18.2.0"
  }
--- a/internals/constants/CHANGELOG.md
+++ b/internals/constants/CHANGELOG.md
@@ -1,5 +1,11 @@
 # @vercel-internals/constants

+## 1.0.4
+
+### Patch Changes
+
+- Create new help output and arg parsing for deploy command ([#10090](https://github.com/vercel/vercel/pull/10090))
+
 ## 1.0.3

 ### Patch Changes
--- a/internals/constants/package.json
+++ b/internals/constants/package.json
@@ -1,16 +1,13 @@
 {
  "private": true,
  "name": "@vercel-internals/constants",
-  "version": "1.0.3",
+  "version": "1.0.4",
  "types": "dist/index.d.ts",
  "main": "dist/index.js",
  "scripts": {
    "build": "tsc -p tsconfig.json"
  },
-  "dependencies": {
-    "@vercel/build-utils": "6.8.0",
-    "@vercel/routing-utils": "2.2.1"
-  },
+  "dependencies": {},
  "devDependencies": {
    "@vercel-internals/tsconfig": "1.0.0",
    "@vercel/style-guide": "4.0.2",
--- a/internals/constants/src/index.ts
+++ b/internals/constants/src/index.ts
@@ -3,3 +3,7 @@ export const PROJECT_ENV_TARGET = [
  'preview',
  'development',
 ] as const;
+
+export const LOGO = '▲' as const;
+export const NAME = 'vercel' as const;
+export const TITLE = 'Vercel' as const;
--- a/internals/types/CHANGELOG.md
+++ b/internals/types/CHANGELOG.md
@@ -1,5 +1,20 @@
 # @vercel-internals/types

+## 1.0.5
+
+### Patch Changes
+
+- Updated dependencies [[`0750517af`](https://github.com/vercel/vercel/commit/0750517af99aea41410d4f1f772ce427699554e7)]:
+  - @vercel/build-utils@6.8.2
+
+## 1.0.4
+
+### Patch Changes
+
+- Updated dependencies [[`7021279b2`](https://github.com/vercel/vercel/commit/7021279b284f314a4d1bdbb4306b4c22291efa08), [`718bbd365`](https://github.com/vercel/vercel/commit/718bbd365a50271a980bdca231ca801a0eead32b)]:
+  - @vercel/build-utils@6.8.1
+  - @vercel-internals/constants@1.0.4
+
 ## 1.0.3

 ### Patch Changes
--- a/internals/types/index.d.ts
+++ b/internals/types/index.d.ts
@@ -1,5 +1,6 @@
 import type { BuilderFunctions } from '@vercel/build-utils';
 import type { Readable, Writable } from 'stream';
+import type * as tty from 'tty';
 import type { Route } from '@vercel/routing-utils';
 import { PROJECT_ENV_TARGET } from '@vercel-internals/constants';

@@ -631,6 +632,6 @@ export interface WritableTTY extends Writable {

 export interface Stdio {
  stdin: ReadableTTY;
-  stdout: WritableTTY;
-  stderr: WritableTTY;
+  stdout: tty.WriteStream;
+  stderr: tty.WriteStream;
 }
--- a/internals/types/package.json
+++ b/internals/types/package.json
@@ -1,13 +1,13 @@
 {
  "private": true,
  "name": "@vercel-internals/types",
-  "version": "1.0.3",
+  "version": "1.0.5",
  "types": "index.d.ts",
  "main": "index.d.ts",
  "dependencies": {
    "@types/node": "14.14.31",
-    "@vercel-internals/constants": "1.0.3",
-    "@vercel/build-utils": "6.8.0",
+    "@vercel-internals/constants": "1.0.4",
+    "@vercel/build-utils": "6.8.2",
    "@vercel/routing-utils": "2.2.1"
  },
  "devDependencies": {
--- a/package.json
+++ b/package.json
@@ -32,7 +32,7 @@
    "source-map-support": "0.5.12",
    "ts-eager": "2.0.2",
    "ts-jest": "29.1.0",
-    "turbo": "1.10.6",
+    "turbo": "1.10.7",
    "typescript": "4.9.5"
  },
  "scripts": {
--- a/packages/build-utils/CHANGELOG.md
+++ b/packages/build-utils/CHANGELOG.md
@@ -1,5 +1,17 @@
 # @vercel/build-utils

+## 6.8.2
+
+### Patch Changes
+
+- Push back `nodejs16.x` discontinue date to `2024-02-06` ([#10209](https://github.com/vercel/vercel/pull/10209))
+
+## 6.8.1
+
+### Patch Changes
+
+- Revert "[build-utils] Allow file-ref sema to be controlled through env flag" ([#10167](https://github.com/vercel/vercel/pull/10167))
+
 ## 6.8.0

 ### Minor Changes
--- a/packages/build-utils/package.json
+++ b/packages/build-utils/package.json
@@ -1,6 +1,6 @@
 {
  "name": "@vercel/build-utils",
-  "version": "6.8.0",
+  "version": "6.8.2",
  "license": "Apache-2.0",
  "main": "./dist/index.js",
  "types": "./dist/index.d.js",
--- a/packages/build-utils/src/file-fs-ref.ts
+++ b/packages/build-utils/src/file-fs-ref.ts
@@ -5,13 +5,7 @@ import path from 'path';
 import Sema from 'async-sema';
 import { FileBase } from './types';

-const DEFAULT_SEMA = 20;
-const semaToPreventEMFILE = new Sema(
-  parseInt(
-    process.env.VERCEL_INTERNAL_FILE_FS_REF_SEMA || String(DEFAULT_SEMA),
-    10
-  ) || DEFAULT_SEMA
-);
+const semaToPreventEMFILE = new Sema(20);

 interface FileFsRefOptions {
  mode?: number;
--- a/packages/build-utils/src/file-ref.ts
+++ b/packages/build-utils/src/file-ref.ts
@@ -12,13 +12,7 @@ interface FileRefOptions {
  mutable?: boolean;
 }

-const DEFAULT_SEMA = 5;
-const semaToDownloadFromS3 = new Sema(
-  parseInt(
-    process.env.VERCEL_INTERNAL_FILE_REF_SEMA || String(DEFAULT_SEMA),
-    10
-  ) || DEFAULT_SEMA
-);
+const semaToDownloadFromS3 = new Sema(5);

 class BailableError extends Error {
  public bail: boolean;
--- a/packages/build-utils/src/fs/node-version.ts
+++ b/packages/build-utils/src/fs/node-version.ts
@@ -10,7 +10,7 @@ function getOptions() {
      major: 16,
      range: '16.x',
      runtime: 'nodejs16.x',
-      discontinueDate: new Date('2023-08-15'),
+      discontinueDate: new Date('2024-02-06'),
    },
    {
      major: 14,
--- a/packages/build-utils/test/unit.test.ts
+++ b/packages/build-utils/test/unit.test.ts
@@ -238,7 +238,7 @@ it('should get latest node version', async () => {
 it('should throw for discontinued versions', async () => {
  // Mock a future date so that Node 8 and 10 become discontinued
  const realDateNow = Date.now.bind(global.Date);
-  global.Date.now = () => new Date('2023-10-01').getTime();
+  global.Date.now = () => new Date('2024-02-13').getTime();

  expect(getSupportedNodeVersion('8.10.x', false)).rejects.toThrow();
  expect(getSupportedNodeVersion('8.10.x', true)).rejects.toThrow();
@@ -306,8 +306,8 @@ it('should warn for deprecated versions, soon to be discontinued', async () => {
    'Error: Node.js version 12.x has reached End-of-Life. Deployments created on or after 2022-10-03 will fail to build. Please set Node.js Version to 18.x in your Project Settings to use Node.js 18.',
    'Error: Node.js version 14.x has reached End-of-Life. Deployments created on or after 2023-08-15 will fail to build. Please set "engines": { "node": "18.x" } in your `package.json` file to use Node.js 18.',
    'Error: Node.js version 14.x has reached End-of-Life. Deployments created on or after 2023-08-15 will fail to build. Please set Node.js Version to 18.x in your Project Settings to use Node.js 18.',
-    'Error: Node.js version 16.x has reached End-of-Life. Deployments created on or after 2023-08-15 will fail to build. Please set "engines": { "node": "18.x" } in your `package.json` file to use Node.js 18.',
-    'Error: Node.js version 16.x has reached End-of-Life. Deployments created on or after 2023-08-15 will fail to build. Please set Node.js Version to 18.x in your Project Settings to use Node.js 18.',
+    'Error: Node.js version 16.x has reached End-of-Life. Deployments created on or after 2024-02-06 will fail to build. Please set "engines": { "node": "18.x" } in your `package.json` file to use Node.js 18.',
+    'Error: Node.js version 16.x has reached End-of-Life. Deployments created on or after 2024-02-06 will fail to build. Please set Node.js Version to 18.x in your Project Settings to use Node.js 18.',
  ]);

  global.Date.now = realDateNow;
--- a/packages/cli/CHANGELOG.md
+++ b/packages/cli/CHANGELOG.md
@@ -1,5 +1,63 @@
 # vercel

+## 31.0.4
+
+### Patch Changes
+
+- Detect multiple frameworks within the same root directory during `vc link --repo` ([#10203](https://github.com/vercel/vercel/pull/10203))
+
+- Updated dependencies [[`b56639b62`](https://github.com/vercel/vercel/commit/b56639b624e9ad1df048a4c85083e26888696060), [`cae60155f`](https://github.com/vercel/vercel/commit/cae60155f34883f08a5e4f51b547e2a1a5fee694), [`c670e5171`](https://github.com/vercel/vercel/commit/c670e51712022193e078bd68b055f7e61013015d), [`5439d7c0c`](https://github.com/vercel/vercel/commit/5439d7c0c9b79e7161bf4fa84ffdb357365f9e7e)]:
+  - @vercel/node@2.15.6
+  - @vercel/next@3.9.0
+  - @vercel/remix-builder@1.8.18
+  - @vercel/static-build@1.3.41
+
+## 31.0.3
+
+### Patch Changes
+
+- Fix redeploy target to be undefined when null ([#10201](https://github.com/vercel/vercel/pull/10201))
+
+- Respect forbidden API responses ([#10178](https://github.com/vercel/vercel/pull/10178))
+
+- Update `supports-hyperlinks` to v3 ([#10208](https://github.com/vercel/vercel/pull/10208))
+
+- Updated dependencies [[`0750517af`](https://github.com/vercel/vercel/commit/0750517af99aea41410d4f1f772ce427699554e7)]:
+  - @vercel/build-utils@6.8.2
+  - @vercel/static-build@1.3.40
+  - @vercel/node@2.15.5
+  - @vercel/remix-builder@1.8.17
+
+## 31.0.2
+
+### Patch Changes
+
+- Allow additional project settings in `createProject()` ([#10172](https://github.com/vercel/vercel/pull/10172))
+
+- Run local Project detection during `vc link --repo`. ([#10094](https://github.com/vercel/vercel/pull/10094))
+  This allows for creation of new Projects that do not yet exist under the selected scope.
+
+- Redeploy command no longer redeploys preview deployments to production ([#10186](https://github.com/vercel/vercel/pull/10186))
+
+- Added trailing new line at end of help output ([#10170](https://github.com/vercel/vercel/pull/10170))
+
+- Create new help output and arg parsing for deploy command ([#10090](https://github.com/vercel/vercel/pull/10090))
+
+- [cli] Remove `preinstall` script ([#10157](https://github.com/vercel/vercel/pull/10157))
+
+- Updated dependencies [[`7021279b2`](https://github.com/vercel/vercel/commit/7021279b284f314a4d1bdbb4306b4c22291efa08), [`5e5332fbc`](https://github.com/vercel/vercel/commit/5e5332fbc9317a8f3cc4ed0b72ec1a2c76020891), [`027bce00b`](https://github.com/vercel/vercel/commit/027bce00b3821d9b4a8f7ec320cd1c43ab9f4215)]:
+  - @vercel/build-utils@6.8.1
+  - @vercel/node@2.15.4
+  - @vercel/remix-builder@1.8.16
+  - @vercel/static-build@1.3.39
+
+## 31.0.1
+
+### Patch Changes
+
+- Updated dependencies [[`aa734efc6`](https://github.com/vercel/vercel/commit/aa734efc6c42badd4aa9bf64487904aa64e9bd49)]:
+  - @vercel/next@3.8.8
+
 ## 31.0.0

 ### Major Changes
--- a/packages/cli/package.json
+++ b/packages/cli/package.json
@@ -1,6 +1,6 @@
 {
  "name": "vercel",
-  "version": "31.0.0",
+  "version": "31.0.4",
  "preferGlobal": true,
  "license": "Apache-2.0",
  "description": "The command-line interface for Vercel",
@@ -11,7 +11,6 @@
    "directory": "packages/cli"
  },
  "scripts": {
-    "preinstall": "node ./scripts/preinstall.js",
    "test": "jest --env node --verbose --bail",
    "test-unit": "pnpm test test/unit/",
    "test-e2e": "rimraf test/fixtures/integration && pnpm test test/integration-1.test.ts test/integration-2.test.ts test/integration-3.test.ts",
@@ -32,16 +31,16 @@
    "node": ">= 14"
  },
  "dependencies": {
-    "@vercel/build-utils": "6.8.0",
+    "@vercel/build-utils": "6.8.2",
    "@vercel/go": "2.5.1",
    "@vercel/hydrogen": "0.0.64",
-    "@vercel/next": "3.8.7",
-    "@vercel/node": "2.15.3",
+    "@vercel/next": "3.9.0",
+    "@vercel/node": "2.15.6",
    "@vercel/python": "3.1.60",
    "@vercel/redwood": "1.1.15",
-    "@vercel/remix-builder": "1.8.15",
+    "@vercel/remix-builder": "1.8.18",
    "@vercel/ruby": "1.3.76",
-    "@vercel/static-build": "1.3.38"
+    "@vercel/static-build": "1.3.41"
  },
  "devDependencies": {
    "@alex_neo/jest-expect-message": "1.0.5",
@@ -85,13 +84,13 @@
    "@types/which": "3.0.0",
    "@types/write-json-file": "2.2.1",
    "@types/yauzl-promise": "2.1.0",
-    "@vercel-internals/constants": "1.0.3",
+    "@vercel-internals/constants": "1.0.4",
    "@vercel-internals/get-package-json": "1.0.0",
-    "@vercel-internals/types": "1.0.3",
-    "@vercel/client": "12.6.3",
+    "@vercel-internals/types": "1.0.5",
+    "@vercel/client": "12.6.5",
    "@vercel/error-utils": "1.0.10",
    "@vercel/frameworks": "1.4.3",
-    "@vercel/fs-detectors": "4.0.1",
+    "@vercel/fs-detectors": "4.1.0",
    "@vercel/fun": "1.0.4",
    "@vercel/ncc": "0.24.0",
    "@vercel/routing-utils": "2.2.1",
@@ -159,7 +158,7 @@
    "serve-handler": "6.1.1",
    "strip-ansi": "6.0.1",
    "stripe": "5.1.0",
-    "supports-hyperlinks": "2.2.0",
+    "supports-hyperlinks": "3.0.0",
    "tar-fs": "1.16.3",
    "test-listen": "1.1.0",
    "text-table": "0.2.0",
--- a/packages/cli/scripts/preinstall.js
+++ b/packages/cli/scripts/preinstall.js
@@ -1,101 +0,0 @@
-#!/usr/bin/env node
-const { join } = require('path');
-const { statSync } = require('fs');
-const pkg = require('../package');
-
-function error(command) {
-  console.error('> Error:', command);
-}
-
-function debug(str) {
-  if (
-    process.argv.find(str => str === '--debug') ||
-    process.env.PREINSTALL_DEBUG
-  ) {
-    console.log(`[debug] [${new Date().toISOString()}]`, str);
-  }
-}
-
-function isYarn() {
-  return process.env.npm_config_heading !== 'npm';
-}
-
-function isGlobal() {
-  const cmd = JSON.parse(process.env.npm_config_argv || '{ "original": [] }');
-
-  return isYarn()
-    ? cmd.original.includes('global')
-    : Boolean(process.env.npm_config_global);
-}
-
-function isVercel() {
-  return pkg.name === 'vercel';
-}
-
-function validateNodeVersion() {
-  let semver = '>= 0';
-  let major = '1';
-
-  try {
-    major = process.versions.node.split('.')[0];
-    const pkg = require('../package.json');
-    semver = pkg.engines.node;
-  } catch (e) {
-    debug('Failed to read package.json engines');
-  }
-
-  const isValid = eval(`${major} ${semver}`);
-  return { isValid, expected: semver, actual: process.versions.node };
-}
-
-function isInNodeModules(name) {
-  try {
-    const nodeModules = join(__dirname, '..', '..');
-    const stat = statSync(join(nodeModules, name));
-    return stat.isDirectory();
-  } catch (err) {
-    return false;
-  }
-}
-
-async function main() {
-  if (!isGlobal()) {
-    debug('Skipping preinstall since Vercel CLI is being installed locally');
-    return;
-  }
-
-  const ver = validateNodeVersion();
-
-  if (!ver.isValid) {
-    error(
-      `Detected unsupported Node.js version.\n` +
-        `Expected "${ver.expected}" but found "${ver.actual}".\n` +
-        `Please update to the latest Node.js LTS version to install Vercel CLI.`
-    );
-    process.exit(1);
-  }
-
-  if (isVercel() && isInNodeModules('now')) {
-    const uninstall = isYarn()
-      ? 'yarn global remove now'
-      : 'npm uninstall -g now';
-    console.error(`NOTE: Run \`${uninstall}\` to uninstall \`now\`\n`);
-  }
-}
-
-process.on('unhandledRejection', err => {
-  console.error('Unhandled Rejection:');
-  console.error(err);
-  process.exit(1);
-});
-
-process.on('uncaughtException', err => {
-  console.error('Uncaught Exception:');
-  console.error(err);
-  process.exit(1);
-});
-
-main().catch(err => {
-  console.error(err);
-  process.exit(1);
-});
--- a/packages/cli/src/commands/deploy/args.ts
+++ b/packages/cli/src/commands/deploy/args.ts
@@ -1,50 +0,0 @@
-import chalk from 'chalk';
-import logo from '../../util/output/logo';
-import { getPkgName } from '../../util/pkg-name';
-
-export const help = () => {
-  return `
-  ${chalk.bold(`${logo} ${getPkgName()} [deploy]`)} [path-to-project] [options]
-
-  --prod                         Create a production deployment
-  -p, --public                   Deployment is public (${chalk.dim(
-    '`/_src`'
-  )} is exposed)
-  -e, --env                      Include an env var during run time (e.g.: ${chalk.dim(
-    '`-e KEY=value`'
-  )}). Can appear many times.
-  -b, --build-env                Similar to ${chalk.dim(
-    '`--env`'
-  )} but for build time only.
-  -m, --meta                     Add metadata for the deployment (e.g.: ${chalk.dim(
-    '`-m KEY=value`'
-  )}). Can appear many times.
-  --no-wait                      Don't wait for the deployment to finish
-  -f, --force                    Force a new deployment even if nothing has changed
-  --with-cache                   Retain build cache when using "--force"
-  --regions                      Set default regions to enable the deployment on
-
-  ${chalk.dim('Examples:')}
-
-  ${chalk.gray('–')} Deploy the current directory
-
-    ${chalk.cyan(`$ ${getPkgName()}`)}
-
-  ${chalk.gray('–')} Deploy a custom path
-
-    ${chalk.cyan(`$ ${getPkgName()} /usr/src/project`)}
-
-  ${chalk.gray('–')} Deploy with Environment Variables
-
-    ${chalk.cyan(`$ ${getPkgName()} -e NODE_ENV=production`)}
-
-  ${chalk.gray('–')} Deploy with prebuilt outputs
-
-    ${chalk.cyan(`$ ${getPkgName()} build`)}
-    ${chalk.cyan(`$ ${getPkgName()} deploy --prebuilt`)}
-
-  ${chalk.gray('–')} Write Deployment URL to a file
-
-    ${chalk.cyan(`$ ${getPkgName()} > deployment-url.txt`)}
-`;
-};
--- a/packages/cli/src/commands/deploy/command.ts
+++ b/packages/cli/src/commands/deploy/command.ts
@@ -0,0 +1,181 @@
+import { Command } from '../help';
+
+export const deployCommand: Command = {
+  name: 'deploy',
+  description:
+    'Deploy your project to Vercel. The `deploy` command is the default command for the Vercel CLI, and can be omitted (`vc deploy my-app` equals `vc my-app`).',
+  arguments: [
+    {
+      name: 'project-path',
+      required: false,
+    },
+  ],
+  options: [
+    {
+      name: 'force',
+      shorthand: 'f',
+      type: 'boolean',
+      deprecated: false,
+      description: 'Force a new deployment even if nothing has changed',
+      multi: false,
+    },
+    {
+      name: 'with-cache',
+      shorthand: null,
+      type: 'boolean',
+      deprecated: false,
+      description: 'Retain build cache when using "--force"',
+      multi: false,
+    },
+    {
+      name: 'public',
+      shorthand: 'p',
+      type: 'boolean',
+      deprecated: false,
+      description: 'Deployment is public (`/_src`) is exposed)',
+      multi: false,
+    },
+    {
+      name: 'env',
+      shorthand: 'e',
+      type: 'string',
+      argument: 'key=value',
+      deprecated: false,
+      multi: true,
+      description:
+        'Specify environment variables during run-time (e.g. `-e KEY1=value1 -e KEY2=value2`)',
+    },
+    {
+      name: 'build-env',
+      shorthand: 'b',
+      type: 'string',
+      argument: 'key=value',
+      deprecated: false,
+      multi: true,
+      description:
+        'Specify environment variables during build-time (e.g. `-b KEY1=value1 -b KEY2=value2`)',
+    },
+    {
+      name: 'meta',
+      shorthand: 'm',
+      type: 'string',
+      argument: 'key=value',
+      deprecated: false,
+      multi: true,
+      description:
+        'Specify metadata for the deployment (e.g. `-m KEY1=value1 -m KEY2=value2`)',
+    },
+    {
+      name: 'regions',
+      shorthand: null,
+      type: 'string',
+      deprecated: false,
+      description: 'Set default regions to enable the deployment on',
+      multi: false,
+    },
+    {
+      name: 'prebuilt',
+      shorthand: null,
+      type: 'boolean',
+      deprecated: false,
+      description:
+        'Use in combination with `vc build`. Deploy an existing build',
+      multi: false,
+    },
+    {
+      name: 'prod',
+      shorthand: null,
+      type: 'boolean',
+      deprecated: false,
+      description: 'Create a production deployment',
+      multi: false,
+    },
+    {
+      name: 'archive',
+      shorthand: null,
+      type: 'string',
+      deprecated: false,
+      description:
+        'Compress the deployment code into a file before uploading it',
+      multi: false,
+    },
+    {
+      name: 'no-wait',
+      shorthand: null,
+      type: 'boolean',
+      deprecated: false,
+      description: "Don't wait for the deployment to finish",
+      multi: false,
+    },
+    {
+      name: 'skip-domain',
+      shorthand: null,
+      type: 'boolean',
+      deprecated: false,
+      description: undefined,
+      multi: false,
+    },
+    {
+      name: 'yes',
+      shorthand: 'y',
+      type: 'boolean',
+      deprecated: false,
+      description: 'Use default options to skip all prompts',
+      multi: false,
+    },
+    {
+      name: 'name',
+      shorthand: 'n',
+      type: 'string',
+      deprecated: true,
+      description: 'Provide a Vercel Project name',
+      multi: false,
+    },
+    {
+      name: 'no-clipboard',
+      shorthand: null,
+      type: 'boolean',
+      deprecated: true,
+      description: 'Do not copy deployment URL to clipboard',
+      multi: false,
+    },
+    {
+      name: 'target',
+      shorthand: null,
+      type: 'string',
+      deprecated: true,
+      description: 'Specify the target deployment environment',
+      multi: false,
+    },
+    {
+      name: 'confirm',
+      shorthand: 'c',
+      type: 'boolean',
+      deprecated: true,
+      description: 'Use default options to skip all prompts',
+      multi: false,
+    },
+  ],
+  examples: [
+    {
+      name: 'Deploy the current directory',
+      value: 'vercel',
+    },
+    {
+      name: 'Deploy a custom path',
+      value: 'vercel /usr/src/project',
+    },
+    {
+      name: 'Deploy with run-time Environment Variables',
+      value: 'vercel -e NODE_ENV=production',
+    },
+    {
+      name: 'Deploy with prebuilt outputs',
+      value: ['vercel build', 'vercel deploy --prebuilt'],
+    },
+    {
+      name: 'Write Deployment URL to a file',
+      value: 'vercel > deployment-url.txt',
+    },
+  ],
+};
--- a/packages/cli/src/commands/deploy/index.ts
+++ b/packages/cli/src/commands/deploy/index.ts
@@ -59,7 +59,6 @@ import validatePaths, {
 } from '../../util/validate-paths';
 import { getCommandName } from '../../util/pkg-name';
 import { Output } from '../../util/output';
-import { help } from './args';
 import { getDeploymentChecks } from '../../util/deploy/get-deployment-checks';
 import parseTarget from '../../util/deploy/parse-target';
 import getPrebuiltJson from '../../util/deploy/get-prebuilt-json';
@@ -69,44 +68,38 @@ import { parseEnv } from '../../util/parse-env';
 import { errorToString, isErrnoException, isError } from '@vercel/error-utils';
 import { pickOverrides } from '../../util/projects/project-settings';
 import { printDeploymentStatus } from '../../util/deploy/print-deployment-status';
+import { help } from '../help';
+import { deployCommand } from './command';

 export default async (client: Client): Promise<number> => {
  const { output } = client;

  let argv = null;

-  try {
-    argv = getArgs(client.argv.slice(2), {
-      '--force': Boolean,
-      '--with-cache': Boolean,
-      '--public': Boolean,
-      '--env': [String],
-      '--build-env': [String],
-      '--meta': [String],
-      // This is not an array in favor of matching
-      // the config property name.
-      '--regions': String,
-      '--prebuilt': Boolean,
-      '--prod': Boolean,
-      '--archive': String,
-      '--no-wait': Boolean,
-      '--skip-domain': Boolean,
-      '--yes': Boolean,
-      '-f': '--force',
-      '-p': '--public',
-      '-e': '--env',
-      '-b': '--build-env',
-      '-m': '--meta',
-      '-y': '--yes',
+  const argOptions: {
+    [k: string]:
+      | BooleanConstructor
+      | StringConstructor
+      | string
+      | [StringConstructor];
+  } = {};
+  for (const option of deployCommand.options) {
+    argOptions[`--${option.name}`] =
+      option.type === 'boolean' ? Boolean : String;
+    if (option.shorthand) {
+      argOptions[`-${option.shorthand}`] = `--${option.name}`;
+    }
+    if (
+      option.name === 'env' ||
+      option.name === 'build-env' ||
+      option.name === 'meta'
+    ) {
+      argOptions[`--${option.name}`] = [String];
+    }
+  }

-      // deprecated
-      '--name': String,
-      '-n': '--name',
-      '--no-clipboard': Boolean,
-      '--target': String,
-      '--confirm': Boolean,
-      '-c': '--confirm',
-    });
+  try {
+    argv = getArgs(client.argv.slice(2), argOptions);

    if ('--confirm' in argv) {
      output.warn('`--confirm` is deprecated, please use `--yes` instead');
@@ -118,7 +111,7 @@ export default async (client: Client): Promise<number> => {
  }

  if (argv['--help']) {
-    output.print(help());
+    output.print(help(deployCommand, { columns: client.stderr.columns }));
    return 2;
  }

--- a/packages/cli/src/commands/help.ts
+++ b/packages/cli/src/commands/help.ts
@@ -0,0 +1,229 @@
+import chalk from 'chalk';
+import stripAnsi from 'strip-ansi';
+import { LOGO, NAME } from '@vercel-internals/constants';
+
+const INDENT = ' '.repeat(2);
+const NEWLINE = '\n';
+
+export interface CommandOption {
+  name: string;
+  shorthand: string | null;
+  type: 'boolean' | 'string';
+  argument?: string;
+  deprecated: boolean;
+  description?: string;
+  multi: boolean;
+}
+export interface CommandArgument {
+  name: string;
+  required: boolean;
+}
+export interface CommandExample {
+  name: string;
+  value: string | string[];
+}
+export interface Command {
+  name: string;
+  description: string;
+  arguments: CommandArgument[];
+  options: CommandOption[];
+  examples: CommandExample[];
+}
+
+export function calcLineLength(line: string[]) {
+  return stripAnsi(lineToString(line)).length;
+}
+
+// Insert spaces in between non-whitespace items only
+export function lineToString(line: string[]) {
+  let string = '';
+  for (let i = 0; i < line.length; i++) {
+    if (i === line.length - 1) {
+      string += line[i];
+    } else {
+      const curr = line[i];
+      const next = line[i + 1];
+      string += curr;
+      if (curr.trim() !== '' && next.trim() !== '') {
+        string += ' ';
+      }
+    }
+  }
+  return string;
+}
+
+export function outputArrayToString(outputArray: string[]) {
+  return outputArray.join(NEWLINE);
+}
+
+/**
+ * Example: `▲ vercel deploy [path] [options]`
+ * @param command
+ * @returns
+ */
+export function buildCommandSynopsisLine(command: Command) {
+  const line: string[] = [LOGO, chalk.bold(NAME), chalk.bold(command.name)];
+  if (command.arguments.length > 0) {
+    for (const argument of command.arguments) {
+      line.push(argument.required ? argument.name : `[${argument.name}]`);
+    }
+  }
+  if (command.options.length > 0) {
+    line.push('[options]');
+  }
+  return lineToString(line);
+}
+
+export function buildCommandOptionLines(
+  command: Command,
+  options: BuildHelpOutputOptions
+) {
+  // Filter out deprecated and intentionally undocumented options
+  command.options = command.options.filter(
+    option => !option.deprecated && option.description !== undefined
+  );
+
+  // Initialize output array with header and empty line
+  const outputArray: string[] = [chalk.dim(`Options:`), ''];
+
+  // Start building option lines
+  const optionLines: string[][] = [];
+  // Sort command options alphabetically
+  command.options.sort((a, b) =>
+    a.name < b.name ? -1 : a.name > b.name ? 1 : 0
+  );
+  // Keep track of longest "start" of an option line to determine description spacing
+  let maxLineStartLength = 0;
+  // Iterate over options and create the "start" of each option (e.g. `  -b, --build-env <key=value>`)
+  for (const option of command.options) {
+    const startLine: string[] = [INDENT];
+    if (option.shorthand) {
+      startLine.push(`-${option.shorthand},`);
+    }
+    startLine.push(`--${option.name}`);
+    if (option.argument) {
+      startLine.push(`<${option.argument}>`);
+    }
+    // the length includes the INDENT
+    const lineLength = calcLineLength(startLine);
+    maxLineStartLength = Math.max(lineLength, maxLineStartLength);
+    optionLines.push(startLine);
+  }
+  /*
+   * Iterate over in-progress option lines to add space-filler and description
+   * For Example:
+   * |  --archive                    My description starts here.
+   * |
+   * |  -b, --build-env <key=value>  Start of description here then
+   * |                               it wraps here.
+   * |
+   * |  -e, --env <key=value>        My description is short.
+   *
+   * Breaking down option lines:
+   * |  -b, --build-env <key=value>  Start of description here then
+   * |[][                         ][][                             ]
+   * |↑ ↑                          ↑ ↑
+   * |1 2                          3 4
+   * |                               it wraps here.
+   * |[][                           ][                            ]
+   * |↑ ↑                            ↑
+   * |5 6                            7
+   * | 1, 5 = indent
+   * | 2 = start
+   * | 3, 6 = space-filler
+   * | 4, 7 = description
+   */
+  for (let i = 0; i < optionLines.length; i++) {
+    const optionLine = optionLines[i];
+    const option = command.options[i];
+    // Add only 2 spaces to the longest line, and then make all shorter lines the same length.
+    optionLine.push(
+      ' '.repeat(2 + (maxLineStartLength - calcLineLength(optionLine)))
+    );
+
+    // Descriptions may be longer than max line length. Wrap them to the same column as the first description line
+    const lines: string[][] = [optionLine];
+    if (option.description) {
+      for (const descriptionWord of option.description.split(' ')) {
+        // insert a new line when the next word would match or exceed the maximum line length
+        if (
+          calcLineLength(lines[lines.length - 1]) +
+            stripAnsi(descriptionWord).length >=
+          options.columns
+        ) {
+          // initialize the new line with the necessary whitespace. The INDENT is apart of `maxLineStartLength`
+          lines.push([' '.repeat(maxLineStartLength + 2)]);
+        }
+        // insert the word to the current last line
+        lines[lines.length - 1].push(descriptionWord);
+      }
+    }
+    // for every line, transform into a string and push it to the output
+    for (const line of lines) {
+      outputArray.push(lineToString(line));
+    }
+    // add an empty line in between in each option block for readability (skip the last block)
+    if (i !== optionLines.length - 1) outputArray.push('');
+  }
+
+  // return the entire list of options as a single string after delete the last '\n' added to the option list
+  return outputArrayToString(outputArray);
+}
+
+export function buildCommandExampleLines(command: Command) {
+  const outputArray: string[] = [chalk.dim(`Examples:`), ''];
+  for (const example of command.examples) {
+    const nameLine: string[] = [INDENT];
+    nameLine.push(chalk.gray('-'));
+    nameLine.push(example.name);
+    outputArray.push(lineToString(nameLine));
+    outputArray.push('');
+    const buildValueLine = (value: string) => {
+      return lineToString([INDENT, INDENT, chalk.cyan(`$ ${value}`)]);
+    };
+    if (Array.isArray(example.value)) {
+      for (const line of example.value) {
+        outputArray.push(buildValueLine(line));
+      }
+    } else {
+      outputArray.push(buildValueLine(example.value));
+    }
+    outputArray.push('');
+  }
+  // delete the last newline added after examples iteration
+  outputArray.splice(-1);
+
+  return outputArrayToString(outputArray);
+}
+
+interface BuildHelpOutputOptions {
+  columns: number;
+}
+
+export function buildHelpOutput(
+  command: Command,
+  options: BuildHelpOutputOptions
+) {
+  const outputArray: string[] = [
+    buildCommandSynopsisLine(command),
+    '',
+    command.description,
+    '',
+    buildCommandOptionLines(command, options),
+    '',
+    buildCommandExampleLines(command),
+    '',
+  ];
+
+  return outputArrayToString(outputArray);
+}
+
+export interface HelpOptions {
+  columns?: number;
+}
+
+export function help(command: Command, options: HelpOptions) {
+  return buildHelpOutput(command, {
+    columns: options.columns ?? 80,
+  });
+}
--- a/packages/cli/src/commands/link/index.ts
+++ b/packages/cli/src/commands/link/index.ts
@@ -97,7 +97,7 @@ export default async function main(client: Client) {
    client.output.warn(
      `The ${cmd('--repo')} flag is in alpha, please report issues`
    );
-    await ensureRepoLink(client, cwd, yes);
+    await ensureRepoLink(client, cwd, { yes, overwrite: true });
  } else {
    const link = await ensureLink('link', client, cwd, {
      autoConfirm: yes,
--- a/packages/cli/src/commands/project/rm.ts
+++ b/packages/cli/src/commands/project/rm.ts
@@ -38,6 +38,10 @@ export default async function rm(client: Client, args: string[]) {
      client.output.error('No such project exists');
      return 1;
    }
+    if (isAPIError(err) && err.status === 403) {
+      client.output.error(err.message);
+      return 1;
+    }
  }
  const elapsed = ms(Date.now() - start);
  client.output.log(
--- a/packages/cli/src/commands/redeploy.ts
+++ b/packages/cli/src/commands/redeploy.ts
@@ -108,7 +108,7 @@ export default async (client: Client): Promise<number> => {
          action: 'redeploy',
        },
        name: fromDeployment.name,
-        target: fromDeployment.target || 'production',
+        target: fromDeployment.target ?? undefined,
      },
      method: 'POST',
    });
--- a/packages/cli/src/util/client.ts
+++ b/packages/cli/src/util/client.ts
@@ -18,7 +18,6 @@ import type {
  JSONObject,
  Stdio,
  ReadableTTY,
-  WritableTTY,
  PaginationOptions,
 } from '@vercel-internals/types';
 import { sharedPromise } from './promise';
@@ -26,6 +25,7 @@ import { APIError } from './errors-ts';
 import { normalizeError } from '@vercel/error-utils';
 import type { Agent } from 'http';
 import sleep from './sleep';
+import type * as tty from 'tty';

 const isSAMLError = (v: any): v is SAMLError => {
  return v && v.saml;
@@ -59,8 +59,8 @@ export default class Client extends EventEmitter implements Stdio {
  apiUrl: string;
  authConfig: AuthConfig;
  stdin: ReadableTTY;
-  stdout: WritableTTY;
-  stderr: WritableTTY;
+  stdout: tty.WriteStream;
+  stderr: tty.WriteStream;
  output: Output;
  config: GlobalConfig;
  agent?: Agent;
@@ -146,7 +146,8 @@ export default class Client extends EventEmitter implements Stdio {
      if (!res.ok) {
        const error = await responseError(res);

-        if (isSAMLError(error)) {
+        // we should force reauth only if error has a teamId
+        if (isSAMLError(error) && error.teamId) {
          try {
            // A SAML error means the token is expired, or is not
            // designated for the requested team, so the user needs
--- a/packages/cli/src/util/deploy/process-deployment.ts
+++ b/packages/cli/src/util/deploy/process-deployment.ts
@@ -234,6 +234,10 @@ export default async function processDeployment({
          return error;
        }

+        if (error.code === 'forbidden') {
+          return error;
+        }
+
        throw error;
      }

--- a/packages/cli/src/util/get-project-name.ts
+++ b/packages/cli/src/util/get-project-name.ts
@@ -2,7 +2,7 @@ import { basename } from 'path';
 import { VercelConfig } from '@vercel/client';

 export interface GetProjectNameOptions {
-  argv: { '--name'?: string };
+  argv: { [k: string]: string | undefined };
  nowConfig?: VercelConfig;
  paths?: string[];
 }
--- a/packages/cli/src/util/git/repo-info-to-url.ts
+++ b/packages/cli/src/util/git/repo-info-to-url.ts
@@ -0,0 +1,5 @@
+import type { RepoInfo } from './connect-git-provider';
+
+export function repoInfoToUrl(info: RepoInfo): string {
+  return `https://${info.provider}.com/${info.org}/${info.repo}`;
+}
--- a/packages/cli/src/util/link/repo.ts
+++ b/packages/cli/src/util/link/repo.ts
@@ -1,7 +1,9 @@
 import chalk from 'chalk';
+import inquirer from 'inquirer';
 import pluralize from 'pluralize';
 import { homedir } from 'os';
-import { join, normalize } from 'path';
+import slugify from '@sindresorhus/slugify';
+import { basename, join, normalize } from 'path';
 import { normalizePath, traverseUpDirectories } from '@vercel/build-utils';
 import { lstat, readJSON, outputJSON } from 'fs-extra';
 import confirm from '../input/confirm';
@@ -13,7 +15,12 @@ import { emoji, prependEmoji } from '../emoji';
 import selectOrg from '../input/select-org';
 import { addToGitIgnore } from './add-to-gitignore';
 import type Client from '../client';
+import type { Framework } from '@vercel/frameworks';
 import type { Project } from '@vercel-internals/types';
+import createProject from '../projects/create-project';
+import { detectProjects } from '../projects/detect-projects';
+import { repoInfoToUrl } from '../git/repo-info-to-url';
+import { connectGitProvider, parseRepoUrl } from '../git/connect-git-provider';

 const home = homedir();

@@ -35,6 +42,11 @@ export interface RepoLink {
  repoConfig?: RepoProjectsConfig;
 }

+export interface EnsureRepoLinkOptions {
+  yes: boolean;
+  overwrite: boolean;
+}
+
 /**
 * Given a directory path `cwd`, finds the root of the Git repository
 * and returns the parsed `.vercel/repo.json` file if the repository
@@ -62,7 +74,7 @@ export async function getRepoLink(
 export async function ensureRepoLink(
  client: Client,
  cwd: string,
-  yes = false
+  { yes, overwrite }: EnsureRepoLinkOptions
 ): Promise<RepoLink | undefined> {
  const { output } = client;

@@ -74,7 +86,14 @@ export async function ensureRepoLink(
  }
  let { rootPath, repoConfig, repoConfigPath } = repoLink;

-  if (!repoConfig) {
+  if (overwrite || !repoConfig) {
+    // Detect the projects on the filesystem out of band, so that
+    // they will be ready by the time the projects are listed
+    const detectedProjectsPromise = detectProjects(rootPath).catch(err => {
+      output.debug(`Failed to detect local projects: ${err}`);
+      return new Map<string, Framework[]>();
+    });
+
    // Not yet linked, so prompt user to begin linking
    let shouldLink =
      yes ||
@@ -111,41 +130,36 @@ export async function ensureRepoLink(
      remoteName = remoteNames[0];
    } else {
      // Prompt user to select which remote to use
-      const originIndex = remoteNames.indexOf('origin');
      const answer = await client.prompt({
        type: 'list',
        name: 'value',
        message: 'Which Git remote should be used?',
-        choices: remoteNames.map(name => {
+        choices: remoteNames.sort().map(name => {
          return { name: name, value: name };
        }),
-        default: originIndex === -1 ? 0 : originIndex,
+        default: remoteNames.includes('origin') ? 'origin' : undefined,
      });
      remoteName = answer.value;
    }
    const repoUrl = remoteUrls[remoteName];
+    const parsedRepoUrl = parseRepoUrl(repoUrl);
+    if (!parsedRepoUrl) {
+      throw new Error(`Failed to parse Git URL: ${repoUrl}`);
+    }
+    const repoUrlLink = output.link(repoUrl, repoInfoToUrl(parsedRepoUrl), {
+      fallback: () => link(repoUrl),
+    });
    output.spinner(
-      `Fetching Projects for ${link(repoUrl)} under ${chalk.bold(org.slug)}…`
+      `Fetching Projects for ${repoUrlLink} under ${chalk.bold(org.slug)}…`
    );
    let projects: Project[] = [];
    const query = new URLSearchParams({ repoUrl });
    const projectsIterator = client.fetchPaginated<{
      projects: Project[];
    }>(`/v9/projects?${query}`);
-    let printedFound = false;
+    const detectedProjects = await detectedProjectsPromise;
    for await (const chunk of projectsIterator) {
      projects = projects.concat(chunk.projects);
-      if (!printedFound && projects.length > 0) {
-        output.log(
-          `${pluralize('Project', chunk.projects.length)} linked to ${link(
-            repoUrl
-          )} under ${chalk.bold(org.slug)}:`
-        );
-        printedFound = true;
-      }
-      for (const project of chunk.projects) {
-        output.print(`  * ${chalk.cyan(`${org.slug}/${project.name}\n`)}`);
-      }
      if (chunk.pagination.next) {
        output.spinner(`Found ${chalk.bold(projects.length)} Projects…`, 0);
      }
@@ -153,36 +167,126 @@ export async function ensureRepoLink(

    if (projects.length === 0) {
      output.log(
-        `No Projects are linked to ${link(repoUrl)} under ${chalk.bold(
+        `No Projects are linked to ${repoUrlLink} under ${chalk.bold(
          org.slug
        )}.`
      );
-      // TODO: run detection logic to find potential projects.
-      // then prompt user to select valid projects.
-      // then create new Projects
+    } else {
+      output.log(
+        `Found ${pluralize(
+          'Project',
+          projects.length,
+          true
+        )} linked to ${repoUrlLink} under ${chalk.bold(org.slug)}`
+      );
    }

-    shouldLink =
-      yes ||
-      (await confirm(
-        client,
-        `Link to ${
-          projects.length === 1
-            ? 'this Project'
-            : `these ${chalk.bold(projects.length)} Projects`
-        }?`,
-        true
-      ));
+    // For any projects that already exists on Vercel, remove them from the
+    // locally detected directories. Any remaining ones will be prompted to
+    // create new Projects for.
+    for (const project of projects) {
+      detectedProjects.delete(project.rootDirectory ?? '');
+    }

-    if (!shouldLink) {
-      output.print(`Canceled. Repository not linked.\n`);
+    const detectedProjectsCount = Array.from(detectedProjects.values()).reduce(
+      (o, f) => o + f.length,
+      0
+    );
+    if (detectedProjectsCount > 0) {
+      output.log(
+        `Detected ${pluralize(
+          'new Project',
+          detectedProjectsCount,
+          true
+        )} that may be created.`
+      );
+    }
+
+    const addSeparators = projects.length > 0 && detectedProjectsCount > 0;
+    const { selected } = await client.prompt({
+      type: 'checkbox',
+      name: 'selected',
+      message: `Which Projects should be ${
+        projects.length ? 'linked to' : 'created'
+      }?`,
+      choices: [
+        ...(addSeparators
+          ? [new inquirer.Separator('----- Existing Projects -----')]
+          : []),
+        ...projects.map(project => {
+          return {
+            name: `${org.slug}/${project.name}`,
+            value: project,
+            checked: true,
+          };
+        }),
+        ...(addSeparators
+          ? [new inquirer.Separator('----- New Projects to be created -----')]
+          : []),
+        ...Array.from(detectedProjects.entries()).flatMap(
+          ([rootDirectory, frameworks]) =>
+            frameworks.map((framework, i) => {
+              const name = slugify(
+                [
+                  basename(rootPath),
+                  basename(rootDirectory),
+                  i > 0 ? framework.slug : '',
+                ]
+                  .filter(Boolean)
+                  .join('-')
+              );
+              return {
+                name: `${org.slug}/${name} (${framework.name})`,
+                value: {
+                  newProject: true,
+                  rootDirectory,
+                  name,
+                  framework,
+                },
+                // Checked by default when there are no other existing Projects
+                checked: projects.length === 0,
+              };
+            })
+        ),
+      ],
+    });
+
+    if (selected.length === 0) {
+      output.print(`No Projects were selected. Repository not linked.\n`);
      return;
    }

+    for (let i = 0; i < selected.length; i++) {
+      const selection = selected[i];
+      if (!selection.newProject) continue;
+      const orgAndName = `${org.slug}/${selection.name}`;
+      output.spinner(`Creating new Project: ${orgAndName}`);
+      delete selection.newProject;
+      if (!selection.rootDirectory) delete selection.rootDirectory;
+      selected[i] = await createProject(client, {
+        ...selection,
+        framework: selection.framework.slug,
+      });
+      await connectGitProvider(
+        client,
+        org,
+        selected[i].id,
+        parsedRepoUrl.provider,
+        `${parsedRepoUrl.org}/${parsedRepoUrl.repo}`
+      );
+      output.log(
+        `Created new Project: ${output.link(
+          orgAndName,
+          `https://vercel.com/${orgAndName}`,
+          { fallback: false }
+        )}`
+      );
+    }
+
    repoConfig = {
      orgId: org.id,
      remoteName,
-      projects: projects.map(project => {
+      projects: selected.map((project: Project) => {
        return {
          id: project.id,
          name: project.name,
@@ -199,9 +303,11 @@ export async function ensureRepoLink(

    output.print(
      prependEmoji(
-        `Linked to ${link(repoUrl)} under ${chalk.bold(
-          org.slug
-        )} (created ${VERCEL_DIR}${
+        `Linked to ${pluralize(
+          'Project',
+          selected.length,
+          true
+        )} under ${chalk.bold(org.slug)} (created ${VERCEL_DIR}${
          isGitIgnoreUpdated ? ' and added it to .gitignore' : ''
        })`,
        emoji('link')
--- a/packages/cli/src/util/link/setup-and-link.ts
+++ b/packages/cli/src/util/link/setup-and-link.ts
@@ -10,7 +10,6 @@ import {
  VERCEL_DIR_PROJECT,
 } from '../projects/link';
 import createProject from '../projects/create-project';
-import updateProject from '../projects/update-project';
 import Client from '../client';
 import handleError from '../handle-error';
 import confirm from '../input/confirm';
@@ -245,10 +244,10 @@ export default async function setupAndLink(
      settings.rootDirectory = rootDirectory;
    }

-    const project = await createProject(client, newProjectName);
-
-    await updateProject(client, project.id, settings);
-    Object.assign(project, settings);
+    const project = await createProject(client, {
+      ...settings,
+      name: newProjectName,
+    });

    await linkFolderToProject(
      client,
--- a/packages/cli/src/util/output/create-output.ts
+++ b/packages/cli/src/util/output/create-output.ts
@@ -3,9 +3,9 @@ import * as ansiEscapes from 'ansi-escapes';
 import { supportsHyperlink as detectSupportsHyperlink } from 'supports-hyperlinks';
 import renderLink from './link';
 import wait, { StopSpinner } from './wait';
-import type { WritableTTY } from '@vercel-internals/types';
 import { errorToString } from '@vercel/error-utils';
 import { removeEmoji } from '../emoji';
+import type * as tty from 'tty';

 const IS_TEST = process.env.NODE_ENV === 'test';

@@ -24,7 +24,7 @@ interface LinkOptions {
 }

 export class Output {
-  stream: WritableTTY;
+  stream: tty.WriteStream;
  debugEnabled: boolean;
  supportsHyperlink: boolean;
  colorDisabled: boolean;
@@ -32,7 +32,7 @@ export class Output {
  private _spinner: StopSpinner | null;

  constructor(
-    stream: WritableTTY,
+    stream: tty.WriteStream,
    {
      debug: debugEnabled = false,
      supportsHyperlink = detectSupportsHyperlink(stream),
--- a/packages/cli/src/util/projects/create-project.ts
+++ b/packages/cli/src/util/projects/create-project.ts
@@ -1,13 +1,13 @@
 import Client from '../client';
-import type { Project } from '@vercel-internals/types';
+import type { Project, ProjectSettings } from '@vercel-internals/types';

 export default async function createProject(
  client: Client,
-  projectName: string
+  settings: ProjectSettings & { name: string }
 ) {
  const project = await client.fetch<Project>('/v1/projects', {
    method: 'POST',
-    body: { name: projectName },
+    body: { ...settings },
  });
  return project;
 }
--- a/packages/cli/src/util/projects/detect-projects.ts
+++ b/packages/cli/src/util/projects/detect-projects.ts
@@ -0,0 +1,38 @@
+import { join } from 'path';
+import frameworkList, { Framework } from '@vercel/frameworks';
+import {
+  detectFrameworks,
+  getWorkspacePackagePaths,
+  getWorkspaces,
+  LocalFileSystemDetector,
+} from '@vercel/fs-detectors';
+
+export async function detectProjects(cwd: string) {
+  const fs = new LocalFileSystemDetector(cwd);
+  const workspaces = await getWorkspaces({ fs });
+  const detectedProjects = new Map<string, Framework[]>();
+  const packagePaths = (
+    await Promise.all(
+      workspaces.map(workspace =>
+        getWorkspacePackagePaths({
+          fs,
+          workspace,
+        })
+      )
+    )
+  ).flat();
+  if (packagePaths.length === 0) {
+    packagePaths.push('/');
+  }
+  await Promise.all(
+    packagePaths.map(async p => {
+      const frameworks = await detectFrameworks({
+        fs: fs.chdir(join('.', p)),
+        frameworkList,
+      });
+      if (frameworks.length === 0) return;
+      detectedProjects.set(p.slice(1), frameworks);
+    })
+  );
+  return detectedProjects;
+}
--- a/packages/cli/src/util/projects/update-project.ts
+++ b/packages/cli/src/util/projects/update-project.ts
@@ -1,26 +1,16 @@
 import Client from '../client';
-import type { JSONObject, ProjectSettings } from '@vercel-internals/types';
-
-interface ProjectSettingsResponse extends ProjectSettings {
-  id: string;
-  name: string;
-  updatedAt: number;
-  createdAt: number;
-}
+import type { Project, ProjectSettings } from '@vercel-internals/types';

 export default async function updateProject(
  client: Client,
  prjNameOrId: string,
  settings: ProjectSettings
 ) {
-  // `ProjectSettings` is technically compatible with JSONObject
-  const body = settings as JSONObject;
-
-  const res = await client.fetch<ProjectSettingsResponse>(
+  const res = await client.fetch<Project>(
    `/v2/projects/${encodeURIComponent(prjNameOrId)}`,
    {
      method: 'PATCH',
-      body,
+      body: { ...settings },
    }
  );
  return res;
--- a/packages/cli/test/unit/commands/snapshots/help.test.ts.snap
+++ b/packages/cli/test/unit/commands/snapshots/help.test.ts.snap
@@ -0,0 +1,244 @@
+// Jest Snapshot v1, https://goo.gl/fbAQLP
+
+exports[`help command help output snapshots column width 40 1`] = `
+"▲ [1mvercel[22m [1mdeploy[22m [project-path] [options]
+
+Deploy your project to Vercel. The \`deploy\` command is the default command for the Vercel CLI, and can be omitted (\`vc deploy my-app\` equals \`vc my-app\`).
+
+[2mOptions:[22m
+
+  --archive                    Compress
+                               the
+                               deployment
+                               code into
+                               a file
+                               before
+                               uploading
+                               it
+
+  -b, --build-env <key=value>  Specify
+                               environment
+                               variables
+                               during
+                               build-time
+                               (e.g. \`-b
+                               KEY1=value1
+                               -b
+                               KEY2=value2\`)
+
+  -e, --env <key=value>        Specify
+                               environment
+                               variables
+                               during
+                               run-time
+                               (e.g. \`-e
+                               KEY1=value1
+                               -e
+                               KEY2=value2\`)
+
+  -f, --force                  Force a
+                               new
+                               deployment
+                               even if
+                               nothing
+                               has
+                               changed
+
+  -m, --meta <key=value>       Specify
+                               metadata
+                               for the
+                               deployment
+                               (e.g. \`-m
+                               KEY1=value1
+                               -m
+                               KEY2=value2\`)
+
+  --no-wait                    Don't
+                               wait for
+                               the
+                               deployment
+                               to finish
+
+  --prebuilt                   Use in
+                               combination
+                               with \`vc
+                               build\`.
+                               Deploy an
+                               existing
+                               build
+
+  --prod                       Create a
+                               production
+                               deployment
+
+  -p, --public                 
+                               Deployment
+                               is public
+                               (\`/_src\`)
+                               is
+                               exposed)
+
+  --regions                    Set
+                               default
+                               regions
+                               to enable
+                               the
+                               deployment
+                               on
+
+  --with-cache                 Retain
+                               build
+                               cache
+                               when
+                               using
+                               "--force"
+
+  -y, --yes                    Use
+                               default
+                               options
+                               to skip
+                               all
+                               prompts
+
+[2mExamples:[22m
+
+  [90m-[39m Deploy the current directory
+
+    [36m$ vercel[39m
+
+  [90m-[39m Deploy a custom path
+
+    [36m$ vercel /usr/src/project[39m
+
+  [90m-[39m Deploy with run-time Environment Variables
+
+    [36m$ vercel -e NODE_ENV=production[39m
+
+  [90m-[39m Deploy with prebuilt outputs
+
+    [36m$ vercel build[39m
+    [36m$ vercel deploy --prebuilt[39m
+
+  [90m-[39m Write Deployment URL to a file
+
+    [36m$ vercel > deployment-url.txt[39m
+"
+`;
+
+exports[`help command help output snapshots column width 80 1`] = `
+"▲ [1mvercel[22m [1mdeploy[22m [project-path] [options]
+
+Deploy your project to Vercel. The \`deploy\` command is the default command for the Vercel CLI, and can be omitted (\`vc deploy my-app\` equals \`vc my-app\`).
+
+[2mOptions:[22m
+
+  --archive                    Compress the deployment code into a file before
+                               uploading it
+
+  -b, --build-env <key=value>  Specify environment variables during build-time
+                               (e.g. \`-b KEY1=value1 -b KEY2=value2\`)
+
+  -e, --env <key=value>        Specify environment variables during run-time
+                               (e.g. \`-e KEY1=value1 -e KEY2=value2\`)
+
+  -f, --force                  Force a new deployment even if nothing has
+                               changed
+
+  -m, --meta <key=value>       Specify metadata for the deployment (e.g. \`-m
+                               KEY1=value1 -m KEY2=value2\`)
+
+  --no-wait                    Don't wait for the deployment to finish
+
+  --prebuilt                   Use in combination with \`vc build\`. Deploy an
+                               existing build
+
+  --prod                       Create a production deployment
+
+  -p, --public                 Deployment is public (\`/_src\`) is exposed)
+
+  --regions                    Set default regions to enable the deployment on
+
+  --with-cache                 Retain build cache when using "--force"
+
+  -y, --yes                    Use default options to skip all prompts
+
+[2mExamples:[22m
+
+  [90m-[39m Deploy the current directory
+
+    [36m$ vercel[39m
+
+  [90m-[39m Deploy a custom path
+
+    [36m$ vercel /usr/src/project[39m
+
+  [90m-[39m Deploy with run-time Environment Variables
+
+    [36m$ vercel -e NODE_ENV=production[39m
+
+  [90m-[39m Deploy with prebuilt outputs
+
+    [36m$ vercel build[39m
+    [36m$ vercel deploy --prebuilt[39m
+
+  [90m-[39m Write Deployment URL to a file
+
+    [36m$ vercel > deployment-url.txt[39m
+"
+`;
+
+exports[`help command help output snapshots column width 120 1`] = `
+"▲ [1mvercel[22m [1mdeploy[22m [project-path] [options]
+
+Deploy your project to Vercel. The \`deploy\` command is the default command for the Vercel CLI, and can be omitted (\`vc deploy my-app\` equals \`vc my-app\`).
+
+[2mOptions:[22m
+
+  --archive                    Compress the deployment code into a file before uploading it
+
+  -b, --build-env <key=value>  Specify environment variables during build-time (e.g. \`-b KEY1=value1 -b KEY2=value2\`)
+
+  -e, --env <key=value>        Specify environment variables during run-time (e.g. \`-e KEY1=value1 -e KEY2=value2\`)
+
+  -f, --force                  Force a new deployment even if nothing has changed
+
+  -m, --meta <key=value>       Specify metadata for the deployment (e.g. \`-m KEY1=value1 -m KEY2=value2\`)
+
+  --no-wait                    Don't wait for the deployment to finish
+
+  --prebuilt                   Use in combination with \`vc build\`. Deploy an existing build
+
+  --prod                       Create a production deployment
+
+  -p, --public                 Deployment is public (\`/_src\`) is exposed)
+
+  --regions                    Set default regions to enable the deployment on
+
+  --with-cache                 Retain build cache when using "--force"
+
+  -y, --yes                    Use default options to skip all prompts
+
+[2mExamples:[22m
+
+  [90m-[39m Deploy the current directory
+
+    [36m$ vercel[39m
+
+  [90m-[39m Deploy a custom path
+
+    [36m$ vercel /usr/src/project[39m
+
+  [90m-[39m Deploy with run-time Environment Variables
+
+    [36m$ vercel -e NODE_ENV=production[39m
+
+  [90m-[39m Deploy with prebuilt outputs
+
+    [36m$ vercel build[39m
+    [36m$ vercel deploy --prebuilt[39m
+
+  [90m-[39m Write Deployment URL to a file
+
+    [36m$ vercel > deployment-url.txt[39m
+"
+`;
--- a/packages/cli/test/unit/commands/help.test.ts
+++ b/packages/cli/test/unit/commands/help.test.ts
@@ -0,0 +1,71 @@
+import {
+  calcLineLength,
+  help,
+  lineToString,
+  outputArrayToString,
+} from '../../../src/commands/help';
+import { deployCommand } from '../../../src/commands/deploy/command';
+
+import chalk from 'chalk';
+
+describe('help command', () => {
+  describe('calcLineLength', () => {
+    test.each([
+      {
+        name: 'without ansi',
+        line: ['a line without ansi'],
+        expectedLength: 19,
+      },
+      {
+        name: 'with ansi',
+        line: [`a line with ${chalk.red('ansi')}`],
+        expectedLength: 16,
+      },
+    ])(
+      'should calculate the correct line length $name',
+      ({ line, expectedLength }) => {
+        expect(calcLineLength(line)).toBe(expectedLength);
+      }
+    );
+  });
+
+  describe('lineToString', () => {
+    test.each([
+      {
+        line: ['a', 'b', 'c'],
+        expected: 'a b c',
+      },
+      {
+        line: [' ', 'a', ' ', 'b', ' ', 'c', ' '],
+        expected: ' a b c ',
+      },
+      {
+        line: [' ', '  ', '   '],
+        expected: '      ',
+      },
+      {
+        line: ['a', '  ', '   ', 'b', 'c'],
+        expected: 'a     b c',
+      },
+    ])(
+      'should insert spaces between non-whitespace items only; $line',
+      ({ line, expected }) => {
+        expect(lineToString(line)).toBe(expected);
+      }
+    );
+  });
+
+  describe('outputArrayToString', () => {
+    test('should join a list of strings using newlines', () => {
+      expect(outputArrayToString(['line 1', 'line 2', 'line 3'])).toBe(
+        'line 1\nline 2\nline 3'
+      );
+    });
+  });
+
+  describe('help output snapshots', () => {
+    test.each([40, 80, 120])('column width %i', width => {
+      expect(help(deployCommand, { columns: width })).toMatchSnapshot();
+    });
+  });
+});
--- a/packages/cli/test/unit/commands/redeploy.test.ts
+++ b/packages/cli/test/unit/commands/redeploy.test.ts
@@ -5,6 +5,7 @@ import { setupUnitFixture } from '../../helpers/setup-unit-fixture';
 import { useDeployment } from '../../mocks/deployment';
 import { useTeams } from '../../mocks/team';
 import { useUser } from '../../mocks/user';
+import { Deployment } from '@vercel-internals/types';

 describe('redeploy', () => {
  it('should error if missing deployment url', async () => {
@@ -77,9 +78,20 @@ describe('redeploy', () => {

    await expect(exitCodePromise).resolves.toEqual(0);
  });
+
+  it('should redeploy to preview', async () => {
+    const { fromDeployment } = initRedeployTest({ target: null });
+    client.setArgv('rollback', fromDeployment.id);
+    const exitCodePromise = redeploy(client);
+    await expect(client.stderr).toOutput(
+      `Fetching deployment "${fromDeployment.id}" in ${fromDeployment.creator?.username}`
+    );
+    await expect(client.stderr).toOutput('Preview');
+    await expect(exitCodePromise).resolves.toEqual(0);
+  });
 });

-function initRedeployTest() {
+function initRedeployTest({ target }: { target?: Deployment['target'] } = {}) {
  setupUnitFixture('commands/redeploy/simple-static');
  const user = useUser();
  useTeams('team_dummy');
@@ -88,10 +100,18 @@ function initRedeployTest() {
    id: 'vercel-redeploy',
    name: 'vercel-redeploy',
  });
-  const fromDeployment = useDeployment({ creator: user });
-  const toDeployment = useDeployment({ creator: user });
+  const fromDeployment = useDeployment({ creator: user, target });
+  const toDeployment = useDeployment({ creator: user, target });

  client.scenario.post(`/v13/deployments`, (req, res) => {
+    const { target } = req.body;
+    if (target !== undefined && typeof target !== 'string') {
+      res.status(400).json({
+        message: 'Invalid request: `target` should be string',
+      });
+      return;
+    }
+
    res.json(toDeployment);
  });

--- a/packages/cli/test/unit/util/git/repo-info-to-url.test.ts
+++ b/packages/cli/test/unit/util/git/repo-info-to-url.test.ts
@@ -0,0 +1,34 @@
+import { repoInfoToUrl } from '../../../../src/util/git/repo-info-to-url';
+import type { RepoInfo } from '../../../../src/util/git/connect-git-provider';
+
+describe('repoInfoToUrl()', () => {
+  it('should support "github" URL', () => {
+    const info: RepoInfo = {
+      provider: 'github',
+      org: 'vercel',
+      repo: 'foo',
+      url: 'git@github.com:vercel/foo.git',
+    };
+    expect(repoInfoToUrl(info)).toEqual('https://github.com/vercel/foo');
+  });
+
+  it('should support "gitlab" URL', () => {
+    const info: RepoInfo = {
+      provider: 'gitlab',
+      org: 'vercel',
+      repo: 'foo',
+      url: 'git@gitlab.com:vercel/foo.git',
+    };
+    expect(repoInfoToUrl(info)).toEqual('https://gitlab.com/vercel/foo');
+  });
+
+  it('should support "bitbucket" URL', () => {
+    const info: RepoInfo = {
+      provider: 'bitbucket',
+      org: 'vercel',
+      repo: 'foo',
+      url: 'git@bitbucket.com:vercel/foo.git',
+    };
+    expect(repoInfoToUrl(info)).toEqual('https://bitbucket.com/vercel/foo');
+  });
+});
--- a/packages/cli/test/unit/util/projects/detect-projects.test.ts
+++ b/packages/cli/test/unit/util/projects/detect-projects.test.ts
@@ -0,0 +1,43 @@
+import { join } from 'path';
+import type { Framework } from '@vercel/frameworks';
+import { detectProjects } from '../../../../src/util/projects/detect-projects';
+
+const REPO_ROOT = join(__dirname, '../../../../../..');
+const EXAMPLES_DIR = join(REPO_ROOT, 'examples');
+const FS_DETECTORS_FIXTURES = join(
+  REPO_ROOT,
+  'packages/fs-detectors/test/fixtures'
+);
+
+function mapDetected(
+  detected: Map<string, Framework[]>
+): Array<[string, string[]]> {
+  return [...detected.entries()]
+    .sort((a, b) => a[0].localeCompare(b[0]))
+    .map(([dir, frameworks]) => [dir, frameworks.map(f => f.slug as string)]);
+}
+
+describe('detectProjects()', () => {
+  it('should match 1 Project in "nextjs" example', async () => {
+    const dir = join(EXAMPLES_DIR, 'nextjs');
+    const detected = await detectProjects(dir);
+    expect(mapDetected(detected)).toEqual([['', ['nextjs']]]);
+  });
+
+  it('should match 2 Projects in "storybook" example', async () => {
+    const dir = join(EXAMPLES_DIR, 'storybook');
+    const detected = await detectProjects(dir);
+    expect(mapDetected(detected)).toEqual([['', ['nextjs', 'storybook']]]);
+  });
+
+  it('should match "30-double-nested-workspaces"', async () => {
+    const dir = join(FS_DETECTORS_FIXTURES, '30-double-nested-workspaces');
+    const detected = await detectProjects(dir);
+    expect(mapDetected(detected)).toEqual([
+      ['packages/backend/c', ['remix']],
+      ['packages/backend/d', ['nextjs']],
+      ['packages/frontend/a', ['hexo']],
+      ['packages/frontend/b', ['ember']],
+    ]);
+  });
+});
--- a/packages/cli/types/supports-hyperlinks/index.d.ts
+++ b/packages/cli/types/supports-hyperlinks/index.d.ts
@@ -1,4 +0,0 @@
-declare module 'supports-hyperlinks' {
-  import { Writable } from 'stream';
-  export function supportsHyperlink(stream: Writable): boolean;
-}
--- a/packages/client/CHANGELOG.md
+++ b/packages/client/CHANGELOG.md
@@ -1,5 +1,19 @@
 # @vercel/client

+## 12.6.5
+
+### Patch Changes
+
+- Updated dependencies [[`0750517af`](https://github.com/vercel/vercel/commit/0750517af99aea41410d4f1f772ce427699554e7)]:
+  - @vercel/build-utils@6.8.2
+
+## 12.6.4
+
+### Patch Changes
+
+- Updated dependencies [[`7021279b2`](https://github.com/vercel/vercel/commit/7021279b284f314a4d1bdbb4306b4c22291efa08)]:
+  - @vercel/build-utils@6.8.1
+
 ## 12.6.3

 ### Patch Changes
--- a/packages/client/package.json
+++ b/packages/client/package.json
@@ -1,6 +1,6 @@
 {
  "name": "@vercel/client",
-  "version": "12.6.3",
+  "version": "12.6.5",
  "main": "dist/index.js",
  "typings": "dist/index.d.ts",
  "homepage": "https://vercel.com",
@@ -35,7 +35,7 @@
    "typescript": "4.9.5"
  },
  "dependencies": {
-    "@vercel/build-utils": "6.8.0",
+    "@vercel/build-utils": "6.8.2",
    "@vercel/routing-utils": "2.2.1",
    "@zeit/fetch": "5.2.0",
    "async-retry": "1.2.3",
--- a/packages/fs-detectors/CHANGELOG.md
+++ b/packages/fs-detectors/CHANGELOG.md
@@ -1,5 +1,11 @@
 # @vercel/fs-detectors

+## 4.1.0
+
+### Minor Changes
+
+- Add `detectFrameworks()` function ([#10195](https://github.com/vercel/vercel/pull/10195))
+
 ## 4.0.1

 ### Patch Changes
--- a/packages/fs-detectors/package.json
+++ b/packages/fs-detectors/package.json
@@ -1,6 +1,6 @@
 {
  "name": "@vercel/fs-detectors",
-  "version": "4.0.1",
+  "version": "4.1.0",
  "description": "Vercel filesystem detectors",
  "main": "./dist/index.js",
  "types": "./dist/index.d.ts",
@@ -36,7 +36,7 @@
    "@types/minimatch": "3.0.5",
    "@types/node": "14.18.33",
    "@types/semver": "7.3.10",
-    "@vercel/build-utils": "6.8.0",
+    "@vercel/build-utils": "6.8.2",
    "typescript": "4.9.5"
  }
 }
--- a/packages/fs-detectors/src/detect-framework.ts
+++ b/packages/fs-detectors/src/detect-framework.ts
@@ -151,6 +151,24 @@ export async function detectFramework({
  return result.find(res => res !== null) ?? null;
 }

+/**
+ * Detects all matching Frameworks based on the given virtual filesystem.
+ */
+export async function detectFrameworks({
+  fs,
+  frameworkList,
+}: DetectFrameworkRecordOptions): Promise<Framework[]> {
+  const result = await Promise.all(
+    frameworkList.map(async frameworkMatch => {
+      if (await matches(fs, frameworkMatch)) {
+        return frameworkMatch;
+      }
+      return null;
+    })
+  );
+  return result.filter(res => res !== null) as Framework[];
+}
+
 /**
 * Framework with a `detectedVersion` specifying the version
 * or version range of the relevant package
--- a/packages/fs-detectors/src/index.ts
+++ b/packages/fs-detectors/src/index.ts
@@ -7,6 +7,7 @@ export {
 export { detectFileSystemAPI } from './detect-file-system-api';
 export {
  detectFramework,
+  detectFrameworks,
  detectFrameworkRecord,
  detectFrameworkVersion,
 } from './detect-framework';
--- a/packages/fs-detectors/test/fixtures/30-double-nested-workspaces/packages/backend/c/package.json
+++ b/packages/fs-detectors/test/fixtures/30-double-nested-workspaces/packages/backend/c/package.json
@@ -1,4 +1,5 @@
 {
+  "private": true,
  "name": "backend-c30",
  "license": "MIT",
  "version": "0.1.0"
--- a/packages/fs-detectors/test/fixtures/30-double-nested-workspaces/packages/backend/c/remix.config.js
+++ b/packages/fs-detectors/test/fixtures/30-double-nested-workspaces/packages/backend/c/remix.config.js
--- a/packages/fs-detectors/test/fixtures/30-double-nested-workspaces/packages/backend/d/package.json
+++ b/packages/fs-detectors/test/fixtures/30-double-nested-workspaces/packages/backend/d/package.json
@@ -1,8 +1,10 @@
 {
+  "private": true,
  "name": "backend-d30",
  "license": "MIT",
  "version": "0.1.0",
  "devDependencies": {
+    "next": "*",
    "once": "1.4.0"
  }
 }
--- a/packages/fs-detectors/test/fixtures/30-double-nested-workspaces/packages/frontend/a/package.json
+++ b/packages/fs-detectors/test/fixtures/30-double-nested-workspaces/packages/frontend/a/package.json
@@ -1,4 +1,5 @@
 {
+  "private": true,
  "name": "frontend-a30",
  "version": "1.0.0",
  "description": "",
@@ -10,6 +11,7 @@
  "author": "",
  "license": "ISC",
  "dependencies": {
-    "debug": "^4.3.2"
+    "debug": "^4.3.2",
+    "hexo": "*"
  }
 }
--- a/packages/fs-detectors/test/fixtures/30-double-nested-workspaces/packages/frontend/b/package.json
+++ b/packages/fs-detectors/test/fixtures/30-double-nested-workspaces/packages/frontend/b/package.json
@@ -1,4 +1,5 @@
 {
+  "private": true,
  "name": "frontend-b30",
  "version": "1.0.0",
  "description": "",
@@ -10,6 +11,7 @@
  "author": "",
  "license": "ISC",
  "dependencies": {
-    "cowsay": "^1.5.0"
+    "cowsay": "^1.5.0",
+    "ember-cli": "*"
  }
 }
--- a/packages/fs-detectors/test/unit.framework-detector.test.ts
+++ b/packages/fs-detectors/test/unit.framework-detector.test.ts
@@ -1,6 +1,6 @@
 import frameworkList from '@vercel/frameworks';
 import workspaceManagers from '../src/workspaces/workspace-managers';
-import { detectFramework } from '../src';
+import { detectFramework, detectFrameworks } from '../src';
 import VirtualFilesystem from './virtual-file-system';

 describe('DetectorFilesystem', () => {
@@ -114,12 +114,12 @@ describe('DetectorFilesystem', () => {
    expect(await packagesFs.isFile('app2')).toBe(false);
    expect(await packagesFs.isFile('app1/package.json')).toBe(true);
    expect(await packagesFs.isFile('app2/package.json')).toBe(true);
-    expect(
-      await (await packagesFs.readFile('app1/package.json')).toString()
-    ).toEqual(nextPackageJson);
-    expect(
-      await (await packagesFs.readFile('app2/package.json')).toString()
-    ).toEqual(gatsbyPackageJson);
+    expect((await packagesFs.readFile('app1/package.json')).toString()).toEqual(
+      nextPackageJson
+    );
+    expect((await packagesFs.readFile('app2/package.json')).toString()).toEqual(
+      gatsbyPackageJson
+    );

    expect(await detectFramework({ fs: packagesFs, frameworkList })).toBe(null);

@@ -143,266 +143,294 @@ describe('DetectorFilesystem', () => {
      { name: 'package.json', path: 'package.json', type: 'file' },
    ]);

-    expect(
-      await (await gatsbyAppFs.readFile('package.json')).toString()
-    ).toEqual(gatsbyPackageJson);
+    expect((await gatsbyAppFs.readFile('package.json')).toString()).toEqual(
+      gatsbyPackageJson
+    );

    expect(await detectFramework({ fs: gatsbyAppFs, frameworkList })).toBe(
      'gatsby'
    );
  });
+});

-  describe('#detectFramework', () => {
-    it('Do not detect anything', async () => {
-      const fs = new VirtualFilesystem({
-        'README.md': '# hi',
-        'api/cheese.js': 'export default (req, res) => res.end("cheese");',
-      });
-
-      expect(await detectFramework({ fs, frameworkList })).toBe(null);
+describe('detectFramework()', () => {
+  it('Do not detect anything', async () => {
+    const fs = new VirtualFilesystem({
+      'README.md': '# hi',
+      'api/cheese.js': 'export default (req, res) => res.end("cheese");',
    });

-    it('Detect nx', async () => {
-      const fs = new VirtualFilesystem({
-        'workspace.json': JSON.stringify({
-          projects: { 'app-one': 'apps/app-one' },
-        }),
-      });
+    expect(await detectFramework({ fs, frameworkList })).toBe(null);
+  });

-      expect(
-        await detectFramework({ fs, frameworkList: workspaceManagers })
-      ).toBe('nx');
+  it('Detect nx', async () => {
+    const fs = new VirtualFilesystem({
+      'workspace.json': JSON.stringify({
+        projects: { 'app-one': 'apps/app-one' },
+      }),
    });

-    it('Do not detect anything', async () => {
-      const fs = new VirtualFilesystem({
-        'workspace.json': JSON.stringify({ projects: {} }),
-      });
+    expect(
+      await detectFramework({ fs, frameworkList: workspaceManagers })
+    ).toBe('nx');
+  });

-      expect(
-        await detectFramework({ fs, frameworkList: workspaceManagers })
-      ).toBe(null);
+  it('Do not detect anything', async () => {
+    const fs = new VirtualFilesystem({
+      'workspace.json': JSON.stringify({ projects: {} }),
    });

-    it('Detect Next.js', async () => {
-      const fs = new VirtualFilesystem({
-        'package.json': JSON.stringify({
-          dependencies: {
-            next: '9.0.0',
-          },
-        }),
-      });
+    expect(
+      await detectFramework({ fs, frameworkList: workspaceManagers })
+    ).toBe(null);
+  });

-      expect(await detectFramework({ fs, frameworkList })).toBe('nextjs');
+  it('Detect Next.js', async () => {
+    const fs = new VirtualFilesystem({
+      'package.json': JSON.stringify({
+        dependencies: {
+          next: '9.0.0',
+        },
+      }),
    });

-    it('Detect frameworks based on ascending order in framework list', async () => {
-      const fs = new VirtualFilesystem({
-        'package.json': JSON.stringify({
-          dependencies: {
-            next: '9.0.0',
-            gatsby: '4.18.0',
-          },
-        }),
-      });
+    expect(await detectFramework({ fs, frameworkList })).toBe('nextjs');
+  });

-      expect(await detectFramework({ fs, frameworkList })).toBe('nextjs');
+  it('Detect frameworks based on ascending order in framework list', async () => {
+    const fs = new VirtualFilesystem({
+      'package.json': JSON.stringify({
+        dependencies: {
+          next: '9.0.0',
+          gatsby: '4.18.0',
+        },
+      }),
    });

-    it('Detect Nuxt.js', async () => {
-      const fs = new VirtualFilesystem({
-        'package.json': JSON.stringify({
-          dependencies: {
-            nuxt: '1.0.0',
-          },
-        }),
-      });
+    expect(await detectFramework({ fs, frameworkList })).toBe('nextjs');
+  });

-      expect(await detectFramework({ fs, frameworkList })).toBe('nuxtjs');
+  it('Detect Nuxt.js', async () => {
+    const fs = new VirtualFilesystem({
+      'package.json': JSON.stringify({
+        dependencies: {
+          nuxt: '1.0.0',
+        },
+      }),
    });

-    it('Detect Nuxt.js Edge', async () => {
-      const fs = new VirtualFilesystem({
-        'package.json': JSON.stringify({
-          dependencies: {
-            'nuxt-edge': '1.0.0',
-          },
-        }),
-      });
+    expect(await detectFramework({ fs, frameworkList })).toBe('nuxtjs');
+  });

-      expect(await detectFramework({ fs, frameworkList })).toBe('nuxtjs');
+  it('Detect Nuxt.js Edge', async () => {
+    const fs = new VirtualFilesystem({
+      'package.json': JSON.stringify({
+        dependencies: {
+          'nuxt-edge': '1.0.0',
+        },
+      }),
    });

-    it('Detect Nuxt.js 3', async () => {
-      const fs = new VirtualFilesystem({
-        'package.json': JSON.stringify({
-          dependencies: {
-            nuxt3: '1.0.0',
-          },
-        }),
-      });
+    expect(await detectFramework({ fs, frameworkList })).toBe('nuxtjs');
+  });

-      expect(await detectFramework({ fs, frameworkList })).toBe('nuxtjs');
+  it('Detect Nuxt.js 3', async () => {
+    const fs = new VirtualFilesystem({
+      'package.json': JSON.stringify({
+        dependencies: {
+          nuxt3: '1.0.0',
+        },
+      }),
    });

-    it('Detect Gatsby', async () => {
-      const fs = new VirtualFilesystem({
-        'package.json': JSON.stringify({
-          dependencies: {
-            gatsby: '1.0.0',
-          },
-        }),
-      });
+    expect(await detectFramework({ fs, frameworkList })).toBe('nuxtjs');
+  });

-      expect(await detectFramework({ fs, frameworkList })).toBe('gatsby');
+  it('Detect Gatsby', async () => {
+    const fs = new VirtualFilesystem({
+      'package.json': JSON.stringify({
+        dependencies: {
+          gatsby: '1.0.0',
+        },
+      }),
    });

-    it('Detect Hugo #1', async () => {
-      const fs = new VirtualFilesystem({
-        'config.yaml': 'baseURL: http://example.org/',
-        'content/post.md': '# hello world',
-      });
+    expect(await detectFramework({ fs, frameworkList })).toBe('gatsby');
+  });

-      expect(await detectFramework({ fs, frameworkList })).toBe('hugo');
+  it('Detect Hugo #1', async () => {
+    const fs = new VirtualFilesystem({
+      'config.yaml': 'baseURL: http://example.org/',
+      'content/post.md': '# hello world',
    });

-    it('Detect Hugo #2', async () => {
-      const fs = new VirtualFilesystem({
-        'config.json': '{ "baseURL": "http://example.org/" }',
-        'content/post.md': '# hello world',
-      });
+    expect(await detectFramework({ fs, frameworkList })).toBe('hugo');
+  });

-      expect(await detectFramework({ fs, frameworkList })).toBe('hugo');
+  it('Detect Hugo #2', async () => {
+    const fs = new VirtualFilesystem({
+      'config.json': '{ "baseURL": "http://example.org/" }',
+      'content/post.md': '# hello world',
    });

-    it('Detect Hugo #3', async () => {
-      const fs = new VirtualFilesystem({
-        'config.toml': 'baseURL = "http://example.org/"',
-        'content/post.md': '# hello world',
-      });
+    expect(await detectFramework({ fs, frameworkList })).toBe('hugo');
+  });

-      expect(await detectFramework({ fs, frameworkList })).toBe('hugo');
+  it('Detect Hugo #3', async () => {
+    const fs = new VirtualFilesystem({
+      'config.toml': 'baseURL = "http://example.org/"',
+      'content/post.md': '# hello world',
    });

-    it('Detect Jekyll', async () => {
-      const fs = new VirtualFilesystem({
-        '_config.yml': 'config',
-      });
+    expect(await detectFramework({ fs, frameworkList })).toBe('hugo');
+  });

-      expect(await detectFramework({ fs, frameworkList })).toBe('jekyll');
+  it('Detect Jekyll', async () => {
+    const fs = new VirtualFilesystem({
+      '_config.yml': 'config',
    });

-    it('Detect Middleman', async () => {
-      const fs = new VirtualFilesystem({
-        'config.rb': 'config',
-      });
+    expect(await detectFramework({ fs, frameworkList })).toBe('jekyll');
+  });

-      expect(await detectFramework({ fs, frameworkList })).toBe('middleman');
+  it('Detect Middleman', async () => {
+    const fs = new VirtualFilesystem({
+      'config.rb': 'config',
    });

-    it('Detect Scully', async () => {
-      const fs = new VirtualFilesystem({
-        'package.json': JSON.stringify({
-          dependencies: {
-            '@angular/cli': 'latest',
-            '@scullyio/init': 'latest',
-          },
-        }),
-      });
+    expect(await detectFramework({ fs, frameworkList })).toBe('middleman');
+  });

-      expect(await detectFramework({ fs, frameworkList })).toBe('scully');
+  it('Detect Scully', async () => {
+    const fs = new VirtualFilesystem({
+      'package.json': JSON.stringify({
+        dependencies: {
+          '@angular/cli': 'latest',
+          '@scullyio/init': 'latest',
+        },
+      }),
    });

-    it('Detect Zola', async () => {
-      const fs = new VirtualFilesystem({
-        'config.toml': 'base_url = "/"',
-      });
+    expect(await detectFramework({ fs, frameworkList })).toBe('scully');
+  });

-      expect(await detectFramework({ fs, frameworkList })).toBe('zola');
+  it('Detect Zola', async () => {
+    const fs = new VirtualFilesystem({
+      'config.toml': 'base_url = "/"',
    });

-    it('Detect Blitz.js (Legacy)', async () => {
-      const fs = new VirtualFilesystem({
-        'blitz.config.js': '// some config',
-      });
+    expect(await detectFramework({ fs, frameworkList })).toBe('zola');
+  });

-      expect(await detectFramework({ fs, frameworkList })).toBe('blitzjs');
+  it('Detect Blitz.js (Legacy)', async () => {
+    const fs = new VirtualFilesystem({
+      'blitz.config.js': '// some config',
    });

-    it('Detect Ember via `ember-source`', async () => {
-      const fs = new VirtualFilesystem({
-        'package.json': JSON.stringify({
-          dependencies: {
-            'ember-source': 'latest',
-          },
-        }),
-      });
+    expect(await detectFramework({ fs, frameworkList })).toBe('blitzjs');
+  });

-      expect(await detectFramework({ fs, frameworkList })).toBe('ember');
+  it('Detect Ember via `ember-source`', async () => {
+    const fs = new VirtualFilesystem({
+      'package.json': JSON.stringify({
+        dependencies: {
+          'ember-source': 'latest',
+        },
+      }),
    });

-    it('Detect Ember via `ember-cli`', async () => {
-      const fs = new VirtualFilesystem({
-        'package.json': JSON.stringify({
-          dependencies: {
-            'ember-cli': 'latest',
-          },
-        }),
-      });
+    expect(await detectFramework({ fs, frameworkList })).toBe('ember');
+  });

-      expect(await detectFramework({ fs, frameworkList })).toBe('ember');
+  it('Detect Ember via `ember-cli`', async () => {
+    const fs = new VirtualFilesystem({
+      'package.json': JSON.stringify({
+        dependencies: {
+          'ember-cli': 'latest',
+        },
+      }),
    });

-    it('Detect Brunch via `brunch`', async () => {
-      const fs = new VirtualFilesystem({
-        'package.json': JSON.stringify({
-          dependencies: {
-            brunch: 'latest',
-          },
-        }),
-      });
+    expect(await detectFramework({ fs, frameworkList })).toBe('ember');
+  });

-      expect(await detectFramework({ fs, frameworkList })).toBe('brunch');
+  it('Detect Brunch via `brunch`', async () => {
+    const fs = new VirtualFilesystem({
+      'package.json': JSON.stringify({
+        dependencies: {
+          brunch: 'latest',
+        },
+      }),
    });

-    it('Detect Brunch via `brunch-config.js`', async () => {
-      const fs = new VirtualFilesystem({
-        'brunch-config.js': '// some config',
-      });
+    expect(await detectFramework({ fs, frameworkList })).toBe('brunch');
+  });

-      expect(await detectFramework({ fs, frameworkList })).toBe('brunch');
+  it('Detect Brunch via `brunch-config.js`', async () => {
+    const fs = new VirtualFilesystem({
+      'brunch-config.js': '// some config',
    });

-    it('Detect Hydrogen via `hydrogen.config.js`', async () => {
-      const fs = new VirtualFilesystem({
-        'hydrogen.config.js': '// some config',
-      });
+    expect(await detectFramework({ fs, frameworkList })).toBe('brunch');
+  });

-      expect(await detectFramework({ fs, frameworkList })).toBe('hydrogen');
+  it('Detect Hydrogen via `hydrogen.config.js`', async () => {
+    const fs = new VirtualFilesystem({
+      'hydrogen.config.js': '// some config',
    });

-    it('Detect Hydrogen via `@shopify/hydrogen`', async () => {
-      const fs = new VirtualFilesystem({
-        'package.json': JSON.stringify({
-          dependencies: {
-            '@shopify/hydrogen': 'latest',
-          },
-        }),
-      });
+    expect(await detectFramework({ fs, frameworkList })).toBe('hydrogen');
+  });

-      expect(await detectFramework({ fs, frameworkList })).toBe('hydrogen');
+  it('Detect Hydrogen via `@shopify/hydrogen`', async () => {
+    const fs = new VirtualFilesystem({
+      'package.json': JSON.stringify({
+        dependencies: {
+          '@shopify/hydrogen': 'latest',
+        },
+      }),
    });

-    it('Detect Storybook via `storybook`', async () => {
-      const fs = new VirtualFilesystem({
-        'package.json': JSON.stringify({
-          dependencies: {
-            storybook: 'latest',
-          },
-        }),
-      });
+    expect(await detectFramework({ fs, frameworkList })).toBe('hydrogen');
+  });

-      expect(await detectFramework({ fs, frameworkList })).toBe('storybook');
+  it('Detect Storybook via `storybook`', async () => {
+    const fs = new VirtualFilesystem({
+      'package.json': JSON.stringify({
+        dependencies: {
+          storybook: 'latest',
+        },
+      }),
    });
+
+    expect(await detectFramework({ fs, frameworkList })).toBe('storybook');
+  });
+});
+
+describe('detectFrameworks()', () => {
+  it('Return empty array when there are no matches', async () => {
+    const fs = new VirtualFilesystem({
+      'package.json': JSON.stringify({
+        dependencies: {},
+      }),
+    });
+
+    expect(await detectFrameworks({ fs, frameworkList })).toEqual([]);
+  });
+
+  it('Detect `nextjs` and `storybook`', async () => {
+    const fs = new VirtualFilesystem({
+      'package.json': JSON.stringify({
+        dependencies: {
+          next: 'latest',
+          storybook: 'latest',
+        },
+      }),
+    });
+
+    const slugs = (await detectFrameworks({ fs, frameworkList })).map(
+      f => f.slug
+    );
+    expect(slugs).toEqual(['nextjs', 'storybook']);
  });
 });
--- a/packages/gatsby-plugin-vercel-builder/CHANGELOG.md
+++ b/packages/gatsby-plugin-vercel-builder/CHANGELOG.md
@@ -1,5 +1,28 @@
 # @vercel/gatsby-plugin-vercel-builder

+## 1.3.14
+
+### Patch Changes
+
+- Updated dependencies [[`b56639b62`](https://github.com/vercel/vercel/commit/b56639b624e9ad1df048a4c85083e26888696060)]:
+  - @vercel/node@2.15.6
+
+## 1.3.13
+
+### Patch Changes
+
+- Updated dependencies [[`0750517af`](https://github.com/vercel/vercel/commit/0750517af99aea41410d4f1f772ce427699554e7)]:
+  - @vercel/build-utils@6.8.2
+  - @vercel/node@2.15.5
+
+## 1.3.12
+
+### Patch Changes
+
+- Updated dependencies [[`7021279b2`](https://github.com/vercel/vercel/commit/7021279b284f314a4d1bdbb4306b4c22291efa08), [`5e5332fbc`](https://github.com/vercel/vercel/commit/5e5332fbc9317a8f3cc4ed0b72ec1a2c76020891)]:
+  - @vercel/build-utils@6.8.1
+  - @vercel/node@2.15.4
+
 ## 1.3.11

 ### Patch Changes
--- a/packages/gatsby-plugin-vercel-builder/package.json
+++ b/packages/gatsby-plugin-vercel-builder/package.json
@@ -1,6 +1,6 @@
 {
  "name": "@vercel/gatsby-plugin-vercel-builder",
-  "version": "1.3.11",
+  "version": "1.3.14",
  "main": "dist/index.js",
  "files": [
    "dist",
@@ -20,8 +20,8 @@
  },
  "dependencies": {
    "@sinclair/typebox": "0.25.24",
-    "@vercel/build-utils": "6.8.0",
-    "@vercel/node": "2.15.3",
+    "@vercel/build-utils": "6.8.2",
+    "@vercel/node": "2.15.6",
    "@vercel/routing-utils": "2.2.1",
    "esbuild": "0.14.47",
    "etag": "1.8.1",
--- a/packages/go/package.json
+++ b/packages/go/package.json
@@ -27,7 +27,7 @@
    "@types/node-fetch": "^2.3.0",
    "@types/tar": "^4.0.0",
    "@types/yauzl-promise": "2.1.0",
-    "@vercel/build-utils": "6.8.0",
+    "@vercel/build-utils": "6.8.2",
    "@vercel/ncc": "0.24.0",
    "async-retry": "1.3.1",
    "execa": "^1.0.0",
--- a/packages/hydrogen/package.json
+++ b/packages/hydrogen/package.json
@@ -21,7 +21,7 @@
  "devDependencies": {
    "@types/jest": "27.5.1",
    "@types/node": "14.18.33",
-    "@vercel/build-utils": "6.8.0",
+    "@vercel/build-utils": "6.8.2",
    "@vercel/static-config": "2.0.17",
    "execa": "3.2.0",
    "fs-extra": "11.1.0",
--- a/packages/next/.gitignore
+++ b/packages/next/.gitignore
@@ -1,2 +1,3 @@
 /dist
-test/builder-info.json
+test/builder-info.json
+test/fixtures/**/tmp-contents
--- a/packages/next/CHANGELOG.md
+++ b/packages/next/CHANGELOG.md
@@ -1,5 +1,21 @@
 # @vercel/next

+## 3.9.0
+
+### Minor Changes
+
+- Support maxDuration in Next.js deployments ([#10069](https://github.com/vercel/vercel/pull/10069))
+
+### Patch Changes
+
+- Fix 404 page in edge runtime ([#10223](https://github.com/vercel/vercel/pull/10223))
+
+## 3.8.8
+
+### Patch Changes
+
+- [next] Ensure RSC paths handle basePath ([#10155](https://github.com/vercel/vercel/pull/10155))
+
 ## 3.8.7

 ### Patch Changes
--- a/packages/next/package.json
+++ b/packages/next/package.json
@@ -1,6 +1,6 @@
 {
  "name": "@vercel/next",
-  "version": "3.8.7",
+  "version": "3.9.0",
  "license": "Apache-2.0",
  "main": "./dist/index",
  "homepage": "https://vercel.com/docs/runtimes#official-runtimes/next-js",
@@ -35,7 +35,7 @@
    "@types/semver": "6.0.0",
    "@types/text-table": "0.2.1",
    "@types/webpack-sources": "3.2.0",
-    "@vercel/build-utils": "6.8.0",
+    "@vercel/build-utils": "6.8.2",
    "@vercel/nft": "0.22.5",
    "@vercel/routing-utils": "2.2.1",
    "async-sema": "3.0.1",
--- a/packages/next/src/index.ts
+++ b/packages/next/src/index.ts
@@ -90,6 +90,7 @@ import {
  validateEntrypoint,
  getOperationType,
  isApiPage,
+  getFunctionsConfigManifest,
 } from './utils';

 export const version = 2;
@@ -272,7 +273,7 @@ export const build: BuildV2 = async ({
  });

  let hasLegacyRoutes = false;
-  const hasFunctionsConfig = !!config.functions;
+  const hasFunctionsConfig = Boolean(config.functions);

  if (await pathExists(dotNextStatic)) {
    console.warn('WARNING: You should not upload the `.next` directory.');
@@ -487,7 +488,12 @@ export const build: BuildV2 = async ({
    ? await getRequiredServerFilesManifest(entryPath, outputDirectory)
    : false;

-  isServerMode = !!requiredServerFilesManifest;
+  isServerMode = Boolean(requiredServerFilesManifest);
+
+  const functionsConfigManifest = await getFunctionsConfigManifest(
+    entryPath,
+    outputDirectory
+  );

  const routesManifest = await getRoutesManifest(
    entryPath,
@@ -1312,6 +1318,7 @@ export const build: BuildV2 = async ({

      return serverBuild({
        config,
+        functionsConfigManifest,
        nextVersion,
        trailingSlash,
        appPathRoutesManifest,
@@ -1570,6 +1577,7 @@ export const build: BuildV2 = async ({
      const initialPageLambdaGroups = await getPageLambdaGroups({
        entryPath,
        config,
+        functionsConfigManifest,
        pages: nonApiPages,
        prerenderRoutes: new Set(),
        pageTraces,
@@ -1586,6 +1594,7 @@ export const build: BuildV2 = async ({
      const initialApiLambdaGroups = await getPageLambdaGroups({
        entryPath,
        config,
+        functionsConfigManifest,
        pages: apiPages,
        prerenderRoutes: new Set(),
        pageTraces,
--- a/packages/next/src/server-build.ts
+++ b/packages/next/src/server-build.ts
@@ -44,6 +44,7 @@ import {
  getFilesMapFromReasons,
  UnwrapPromise,
  getOperationType,
+  FunctionsConfigManifestV1,
 } from './utils';
 import {
  nodeFileTrace,
@@ -66,6 +67,7 @@ export async function serverBuild({
  dynamicPages,
  pagesDir,
  config = {},
+  functionsConfigManifest,
  privateOutputs,
  baseDir,
  workPath,
@@ -105,6 +107,7 @@ export async function serverBuild({
  dynamicPages: string[];
  trailingSlash: boolean;
  config: Config;
+  functionsConfigManifest?: FunctionsConfigManifestV1;
  pagesDir: string;
  baseDir: string;
  canUsePreviewMode: boolean;
@@ -752,6 +755,7 @@ export async function serverBuild({
    const pageLambdaGroups = await getPageLambdaGroups({
      entryPath: projectDir,
      config,
+      functionsConfigManifest,
      pages: nonApiPages,
      prerenderRoutes,
      pageTraces,
@@ -767,6 +771,7 @@ export async function serverBuild({
    const appRouterLambdaGroups = await getPageLambdaGroups({
      entryPath: projectDir,
      config,
+      functionsConfigManifest,
      pages: appRouterPages,
      prerenderRoutes,
      pageTraces,
@@ -789,6 +794,7 @@ export async function serverBuild({
    const apiLambdaGroups = await getPageLambdaGroups({
      entryPath: projectDir,
      config,
+      functionsConfigManifest,
      pages: apiPages,
      prerenderRoutes,
      pageTraces,
@@ -1198,7 +1204,11 @@ export async function serverBuild({
      if (ogRoute.endsWith('/route')) {
        continue;
      }
-      route = path.posix.join('./', route === '/' ? '/index' : route);
+      route = path.posix.join(
+        './',
+        entryDirectory,
+        route === '/' ? '/index' : route
+      );

      if (lambdas[route]) {
        lambdas[`${route}.rsc`] = lambdas[route];
@@ -1213,6 +1223,7 @@ export async function serverBuild({
  const rscVaryHeader =
    routesManifest?.rsc?.varyHeader ||
    'RSC, Next-Router-State-Tree, Next-Router-Prefetch';
+  const appNotFoundPath = path.posix.join('.', entryDirectory, '_not-found');

  return {
    wildcard: wildcardConfig,
@@ -1745,6 +1756,7 @@ export async function serverBuild({
      { handle: 'error' } as RouteWithHandle,

      // Custom Next.js 404 page
+
      ...(i18n && (static404Page || hasIsr404Page || lambdaPages['404.js'])
        ? [
            {
@@ -1779,6 +1791,10 @@ export async function serverBuild({
                  hasIsr404Page ||
                  lambdas[path.posix.join(entryDirectory, '404')]
                  ? '/404'
+                  : appPathRoutesManifest &&
+                    (middleware.edgeFunctions[appNotFoundPath] ||
+                      lambdas[appNotFoundPath])
+                  ? '/_not-found'
                  : '/_error'
              ),
              status: 404,
--- a/packages/next/src/utils.ts
+++ b/packages/next/src/utils.ts
@@ -1397,6 +1397,7 @@ const LAMBDA_RESERVED_COMPRESSED_SIZE = 250 * KIB;
 export async function getPageLambdaGroups({
  entryPath,
  config,
+  functionsConfigManifest,
  pages,
  prerenderRoutes,
  pageTraces,
@@ -1410,6 +1411,7 @@ export async function getPageLambdaGroups({
 }: {
  entryPath: string;
  config: Config;
+  functionsConfigManifest?: FunctionsConfigManifestV1;
  pages: string[];
  prerenderRoutes: Set<string>;
  pageTraces: {
@@ -1436,16 +1438,26 @@ export async function getPageLambdaGroups({

    let opts: { memory?: number; maxDuration?: number } = {};

+    if (
+      functionsConfigManifest &&
+      functionsConfigManifest.functions[routeName]
+    ) {
+      opts = functionsConfigManifest.functions[routeName];
+    }
+
    if (config && config.functions) {
      const sourceFile = await getSourceFilePathFromPage({
        workPath: entryPath,
        page,
        pageExtensions,
      });
-      opts = await getLambdaOptionsFromFunction({
+
+      const vercelConfigOpts = await getLambdaOptionsFromFunction({
        sourceFile,
        config,
      });
+
+      opts = { ...vercelConfigOpts, ...opts };
    }

    let matchingGroup = groups.find(group => {
@@ -2388,6 +2400,16 @@ export {
  getSourceFilePathFromPage,
 };

+export type FunctionsConfigManifestV1 = {
+  version: 1;
+  functions: Record<
+    string,
+    {
+      maxDuration?: number;
+    }
+  >;
+};
+
 type MiddlewareManifest = MiddlewareManifestV1 | MiddlewareManifestV2;

 interface MiddlewareManifestV1 {
@@ -2663,7 +2685,9 @@ export async function getMiddlewareBundle({
        shortPath = shortPath.replace(/^pages\//, '');
      } else if (
        shortPath.startsWith('app/') &&
-        (shortPath.endsWith('/page') || shortPath.endsWith('/route'))
+        (shortPath.endsWith('/page') ||
+          shortPath.endsWith('/route') ||
+          shortPath === 'app/_not-found')
      ) {
        const ogRoute = shortPath.replace(/^app\//, '/');
        shortPath = (
@@ -2731,6 +2755,37 @@ export async function getMiddlewareBundle({
  };
 }

+/**
+ * Attempts to read the functions config manifest from the pre-defined
+ * location. If the manifest can't be found it will resolve to
+ * undefined.
+ */
+export async function getFunctionsConfigManifest(
+  entryPath: string,
+  outputDirectory: string
+): Promise<FunctionsConfigManifestV1 | undefined> {
+  const functionConfigManifestPath = path.join(
+    entryPath,
+    outputDirectory,
+    './server/functions-config-manifest.json'
+  );
+
+  const hasManifest = await fs
+    .access(functionConfigManifestPath)
+    .then(() => true)
+    .catch(() => false);
+
+  if (!hasManifest) {
+    return;
+  }
+
+  const manifest: FunctionsConfigManifestV1 = await fs.readJSON(
+    functionConfigManifestPath
+  );
+
+  return manifest.version === 1 ? manifest : undefined;
+}
+
 /**
 * Attempts to read the middleware manifest from the pre-defined
 * location. If the manifest can't be found it will resolve to
--- a/packages/next/test/fixtures/00-app-dir-base-path/index.test.js
+++ b/packages/next/test/fixtures/00-app-dir-base-path/index.test.js
@@ -0,0 +1,32 @@
+/* eslint-env jest */
+const path = require('path');
+const fs = require('fs-extra');
+const { deployAndTest } = require('../../utils');
+
+const ctx = {};
+
+describe(`${__dirname.split(path.sep).pop()}`, () => {
+  const fixtureDir = path.join(__dirname, 'tmp-contents');
+
+  afterAll(() => fs.remove(fixtureDir));
+
+  it('should deploy and pass probe checks', async () => {
+    await fs.copy(path.join(__dirname, '../00-app-dir'), fixtureDir);
+    const nextConfigPath = path.join(fixtureDir, 'next.config.js');
+
+    await fs.writeFile(
+      nextConfigPath,
+      (
+        await fs.readFile(nextConfigPath, 'utf8')
+      ).replace('experimental:', 'basePath: "/hello/world",experimental:')
+    );
+
+    await fs.copy(
+      path.join(__dirname, 'vercel.json'),
+      path.join(fixtureDir, 'vercel.json')
+    );
+
+    const info = await deployAndTest(fixtureDir);
+    Object.assign(ctx, info);
+  });
+});
--- a/packages/next/test/fixtures/00-app-dir-base-path/vercel.json
+++ b/packages/next/test/fixtures/00-app-dir-base-path/vercel.json
@@ -0,0 +1,198 @@
+{
+  "builds": [
+    {
+      "src": "package.json",
+      "use": "@vercel/next",
+      "config": {
+        "functions": {
+          "app/**/*": {
+            "maxDuration": 5,
+            "memory": 512
+          },
+          "pages/api/**/*": {
+            "maxDuration": 5,
+            "memory": 512
+          }
+        }
+      }
+    }
+  ],
+  "probes": [
+    {
+      "path": "/hello/world/dashboard/hello",
+      "status": 200,
+      "mustContain": "hello from app/dashboard/rootonly/hello"
+    },
+    {
+      "path": "/hello/world/dashboard/another-edge",
+      "status": 200,
+      "mustContain": "hello from newroot/dashboard/another"
+    },
+    {
+      "path": "/hello/world/dynamic/category-1/id-1",
+      "status": 200,
+      "headers": {
+        "RSC": "1"
+      },
+      "mustContain": ":{",
+      "mustNotContain": "<html"
+    },
+    {
+      "path": "/hello/world/ssg",
+      "status": 200,
+      "mustContain": "hello from /ssg",
+      "responseHeaders": {
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+      }
+    },
+    {
+      "path": "/hello/world/ssg",
+      "status": 200,
+      "responseHeaders": {
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+      },
+      "headers": {
+        "RSC": "1"
+      },
+      "mustContain": ":{",
+      "mustNotContain": "<html"
+    },
+    {
+      "path": "/hello/world/ssg?override=1",
+      "status": 307,
+      "responseHeaders": {
+        "location": "/overridden/"
+      },
+      "fetchOptions": {
+        "redirect": "manual"
+      }
+    },
+    {
+      "path": "/hello/world/ssg?override=1",
+      "status": 307,
+      "responseHeaders": {
+        "location": "/overridden/"
+      },
+      "fetchOptions": {
+        "redirect": "manual"
+      }
+    },
+    {
+      "path": "/hello/world/dashboard/deployments/123/settings",
+      "status": 200,
+      "mustContain": "hello from app/dashboard/deployments/[id]/settings",
+      "responseHeaders": {
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+      }
+    },
+    {
+      "path": "/hello/world/dashboard/deployments/123/settings",
+      "status": 200,
+      "responseHeaders": {
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+      },
+      "headers": {
+        "RSC": "1"
+      },
+      "mustContain": ":{",
+      "mustNotContain": "<html"
+    },
+    {
+      "path": "/hello/world/dashboard/deployments/catchall/something",
+      "status": 200,
+      "mustContain": "catchall",
+      "responseHeaders": {
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+      }
+    },
+    {
+      "path": "/hello/world/dashboard/deployments/catchall/something",
+      "status": 200,
+      "responseHeaders": {
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+      },
+      "headers": {
+        "RSC": "1"
+      },
+      "mustContain": ":{",
+      "mustNotContain": "<html"
+    },
+    {
+      "path": "/hello/world/dashboard",
+      "status": 200,
+      "mustContain": "hello from app/dashboard",
+      "responseHeaders": {
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+      }
+    },
+    {
+      "path": "/hello/world/dashboard",
+      "status": 200,
+      "headers": {
+        "RSC": "1"
+      },
+      "mustContain": ":{",
+      "mustNotContain": "<html"
+    },
+    {
+      "path": "/hello/world/dashboard",
+      "status": 200,
+      "headers": {
+        "RSC": "1"
+      },
+      "responseHeaders": {
+        "content-type": "text/x-component",
+        "vary": "RSC, Next-Router-State-Tree, Next-Router-Prefetch"
+      }
+    },
+    {
+      "path": "/hello/world/dashboard/another",
+      "status": 200,
+      "mustContain": "hello from newroot/dashboard/another"
+    },
+    {
+      "path": "/hello/world/dashboard/deployments/123",
+      "status": 200,
+      "mustContain": "hello from app/dashboard/deployments/[id]. ID is: <!-- -->123"
+    },
+    {
+      "path": "/hello/world/",
+      "status": 200,
+      "mustContain": "index app page"
+    },
+    {
+      "path": "/hello/world/blog/123",
+      "status": 200,
+      "mustContain": "hello from pages/blog/[slug]"
+    },
+    {
+      "path": "/hello/world/blog-ssr/123",
+      "status": 200,
+      "mustContain": "hello from pages/blog-ssr/[slug]"
+    },
+    {
+      "path": "/hello/world/blog-ssr/321",
+      "status": 200,
+      "mustContain": "hello context"
+    },
+    {
+      "path": "/hello/world/dynamic/category-1/id-1",
+      "status": 200,
+      "mustContain": "{&quot;category&quot;:&quot;category-1&quot;,&quot;id&quot;:&quot;id-1&quot;}"
+    },
+    {
+      "path": "/hello/world/dashboard/changelog",
+      "status": 200,
+      "mustContain": "hello from app/dashboard/changelog"
+    },
+    {
+      "path": "/hello/world/",
+      "status": 200,
+      "headers": {
+        "RSC": "1"
+      },
+      "mustContain": ":{",
+      "mustNotContain": "<html"
+    }
+  ]
+}
--- a/packages/next/test/fixtures/00-app-dir-edge-404/app/layout.js
+++ b/packages/next/test/fixtures/00-app-dir-edge-404/app/layout.js
@@ -0,0 +1,12 @@
+export const runtime = 'edge'
+
+export default function Layout({ children }) {
+  return (
+    <html>
+      <head>
+        <title>Hello World</title>
+      </head>
+      <body>{children}</body>
+    </html>
+  )
+}
--- a/packages/next/test/fixtures/00-app-dir-edge-404/app/not-found.js
+++ b/packages/next/test/fixtures/00-app-dir-edge-404/app/not-found.js
@@ -0,0 +1,9 @@
+export default function Page() {
+  return (
+    <>
+      <h1>This Is The Not Found Page</h1>
+
+      <div id="timestamp">{Date.now()}</div>
+    </>
+  )
+}
--- a/packages/next/test/fixtures/00-app-dir-edge-404/app/not-found/not-found.js
+++ b/packages/next/test/fixtures/00-app-dir-edge-404/app/not-found/not-found.js
@@ -0,0 +1,3 @@
+export default function notFound() {
+  return <h1>custom not found</h1>
+}
--- a/packages/next/test/fixtures/00-app-dir-edge-404/app/not-found/page.js
+++ b/packages/next/test/fixtures/00-app-dir-edge-404/app/not-found/page.js
@@ -0,0 +1,3 @@
+export default function Page() {
+  return <h1>I'm still a valid page</h1>
+}
--- a/packages/next/test/fixtures/00-app-dir-edge-404/app/page.js
+++ b/packages/next/test/fixtures/00-app-dir-edge-404/app/page.js
@@ -0,0 +1,3 @@
+export default function Page() {
+  return <h1>My page</h1>
+}
--- a/packages/next/test/fixtures/00-app-dir-edge-404/index.test.js
+++ b/packages/next/test/fixtures/00-app-dir-edge-404/index.test.js
@@ -0,0 +1,12 @@
+/* eslint-env jest */
+const path = require('path');
+const { deployAndTest } = require('../../utils');
+
+const ctx = {};
+
+describe(`${__dirname.split(path.sep).pop()}`, () => {
+  it('should deploy and pass probe checks', async () => {
+    const info = await deployAndTest(__dirname);
+    Object.assign(ctx, info);
+  });
+});
--- a/packages/next/test/fixtures/00-app-dir-edge-404/next.config.js
+++ b/packages/next/test/fixtures/00-app-dir-edge-404/next.config.js
@@ -0,0 +1,5 @@
+module.exports = {
+  experimental: {
+    appDir: true,
+  },
+};
--- a/packages/next/test/fixtures/00-app-dir-edge-404/package.json
+++ b/packages/next/test/fixtures/00-app-dir-edge-404/package.json
@@ -0,0 +1,8 @@
+{
+  "dependencies": {
+    "next": "canary",
+    "react": "experimental",
+    "react-dom": "experimental"
+  },
+  "ignoreNextjsUpdates": true
+}
--- a/packages/next/test/fixtures/00-app-dir-edge-404/vercel.json
+++ b/packages/next/test/fixtures/00-app-dir-edge-404/vercel.json
@@ -0,0 +1,20 @@
+{
+  "builds": [
+    {
+      "src": "package.json",
+      "use": "@vercel/next"
+    }
+  ],
+  "probes": [
+    {
+      "path": "/",
+      "status": 200,
+      "mustContain": "My page"
+    },
+    {
+      "path": "/not-found-page",
+      "status": 404,
+      "mustContain": "This Is The Not Found Page"
+    }
+  ]
+}
--- a/packages/next/test/fixtures/00-app-dir-segment-options/app/api/hello-again/route.js
+++ b/packages/next/test/fixtures/00-app-dir-segment-options/app/api/hello-again/route.js
@@ -0,0 +1,6 @@
+export const GET = req => {
+  console.log(req.url);
+  return new Response('hello world');
+};
+
+export const maxDuration = 7;
--- a/packages/next/test/fixtures/00-app-dir-segment-options/index.test.js
+++ b/packages/next/test/fixtures/00-app-dir-segment-options/index.test.js
@@ -0,0 +1,12 @@
+/* eslint-env jest */
+const path = require('path');
+const { deployAndTest } = require('../../utils');
+
+const ctx = {};
+
+describe(`${__dirname.split(path.sep).pop()}`, () => {
+  it('should deploy and pass probe checks', async () => {
+    const info = await deployAndTest(__dirname);
+    Object.assign(ctx, info);
+  });
+});
--- a/packages/next/test/fixtures/00-app-dir-segment-options/next.config.js
+++ b/packages/next/test/fixtures/00-app-dir-segment-options/next.config.js
@@ -0,0 +1 @@
+module.exports = {};
--- a/packages/next/test/fixtures/00-app-dir-segment-options/package.json
+++ b/packages/next/test/fixtures/00-app-dir-segment-options/package.json
@@ -0,0 +1,8 @@
+{
+  "dependencies": {
+    "next": "canary",
+    "react": "experimental",
+    "react-dom": "experimental"
+  },
+  "ignoreNextjsUpdates": true
+}
--- a/packages/next/test/fixtures/00-app-dir-segment-options/pages/api/hello.js
+++ b/packages/next/test/fixtures/00-app-dir-segment-options/pages/api/hello.js
@@ -0,0 +1,5 @@
+export default function handler(req, res) {
+  return res.json({ hello: 'world' });
+}
+
+export const maxDuration = 7;
--- a/packages/next/test/fixtures/00-app-dir-segment-options/vercel.json
+++ b/packages/next/test/fixtures/00-app-dir-segment-options/vercel.json
@@ -0,0 +1,8 @@
+{
+  "builds": [
+    {
+      "src": "package.json",
+      "use": "@vercel/next"
+    }
+  ]
+}
--- a/packages/next/test/integration/integration-1.test.js
+++ b/packages/next/test/integration/integration-1.test.js
@@ -122,6 +122,40 @@ if (parseInt(process.versions.node.split('.')[0], 10) >= 16) {
    // );
  });

+  it('should build with app-dir with segment options correctly', async () => {
+    const { buildResult } = await runBuildLambda(
+      path.join(__dirname, '../fixtures/00-app-dir-segment-options')
+    );
+
+    const lambdas = new Set();
+
+    for (const key of Object.keys(buildResult.output)) {
+      if (buildResult.output[key].type === 'Lambda') {
+        lambdas.add(buildResult.output[key]);
+      }
+    }
+
+    expect(
+      buildResult.routes.some(
+        route =>
+          route.src?.includes('_next/data') && route.src?.includes('.rsc')
+      )
+    ).toBeFalsy();
+
+    expect(lambdas.size).toBe(2);
+
+    expect(buildResult.output['api/hello']).toBeDefined();
+    expect(buildResult.output['api/hello'].type).toBe('Lambda');
+    expect(buildResult.output['api/hello'].maxDuration).toBe(7);
+
+    expect(buildResult.output['api/hello-again']).toBeDefined();
+    expect(buildResult.output['api/hello-again'].type).toBe('Lambda');
+    expect(buildResult.output['api/hello-again'].maxDuration).toBe(7);
+    expect(
+      buildResult.output['api/hello-again'].supportsResponseStreaming
+    ).toBe(true);
+  });
+
  it('should build with app-dir in edge runtime correctly', async () => {
    const { buildResult } = await runBuildLambda(
      path.join(__dirname, '../fixtures/00-app-dir-edge')
--- a/packages/node/CHANGELOG.md
+++ b/packages/node/CHANGELOG.md
@@ -1,5 +1,27 @@
 # @vercel/node

+## 2.15.6
+
+### Patch Changes
+
+- [node] fix: runs edge user code inside IIFE ([#10220](https://github.com/vercel/vercel/pull/10220))
+
+## 2.15.5
+
+### Patch Changes
+
+- Updated dependencies [[`0750517af`](https://github.com/vercel/vercel/commit/0750517af99aea41410d4f1f772ce427699554e7)]:
+  - @vercel/build-utils@6.8.2
+
+## 2.15.4
+
+### Patch Changes
+
+- [node] fix decompress mismatching ([#10184](https://github.com/vercel/vercel/pull/10184))
+
+- Updated dependencies [[`7021279b2`](https://github.com/vercel/vercel/commit/7021279b284f314a4d1bdbb4306b4c22291efa08)]:
+  - @vercel/build-utils@6.8.1
+
 ## 2.15.3

 ### Patch Changes
--- a/packages/node/package.json
+++ b/packages/node/package.json
@@ -1,6 +1,6 @@
 {
  "name": "@vercel/node",
-  "version": "2.15.3",
+  "version": "2.15.6",
  "license": "Apache-2.0",
  "main": "./dist/index",
  "homepage": "https://vercel.com/docs/runtimes#official-runtimes/node-js",
@@ -24,7 +24,7 @@
    "@edge-runtime/vm": "3.0.1",
    "@types/node": "14.18.33",
    "@types/node-fetch": "2.6.3",
-    "@vercel/build-utils": "6.8.0",
+    "@vercel/build-utils": "6.8.2",
    "@vercel/error-utils": "1.0.10",
    "@vercel/static-config": "2.0.17",
    "async-listen": "3.0.0",
--- a/packages/node/src/edge-functions/edge-handler.mts
+++ b/packages/node/src/edge-functions/edge-handler.mts
@@ -88,7 +88,10 @@ async function compileUserCode(
      "use strict";var regeneratorRuntime;

      // user code
-      ${compiledFile.text};
+      (() => {
+        ${compiledFile.text};
+      })();
+
      const userModule = module.exports;

      // request metadata
--- a/packages/node/src/serverless-functions/serverless-handler.mts
+++ b/packages/node/src/serverless-functions/serverless-handler.mts
@@ -7,6 +7,7 @@ import fetch from 'node-fetch';
 import { listen } from 'async-listen';
 import { isAbsolute } from 'path';
 import { pathToFileURL } from 'url';
+import zlib from 'zlib';
 import type { ServerResponse, IncomingMessage } from 'http';
 import type { VercelProxyResponse } from '../types.js';
 import type { VercelRequest, VercelResponse } from './helpers.js';
@@ -34,6 +35,27 @@ const HTTP_METHODS = [
  'PATCH',
 ];

+function compress(body: Buffer, encoding: string): Buffer {
+  switch (encoding) {
+    case 'br':
+      return zlib.brotliCompressSync(body, {
+        params: {
+          [zlib.constants.BROTLI_PARAM_QUALITY]: 0,
+        },
+      });
+    case 'gzip':
+      return zlib.gzipSync(body, {
+        level: zlib.constants.Z_BEST_SPEED,
+      });
+    case 'deflate':
+      return zlib.deflateSync(body, {
+        level: zlib.constants.Z_BEST_SPEED,
+      });
+    default:
+      throw new Error(`encoding '${encoding}' not supported`);
+  }
+}
+
 async function createServerlessServer(userCode: ServerlessFunctionSignature) {
  const server = createServer(userCode);
  exitHook(() => server.close());
@@ -78,12 +100,14 @@ export async function createServerlessEventHandler(
 ): Promise<(request: IncomingMessage) => Promise<VercelProxyResponse>> {
  const userCode = await compileUserCode(entrypointPath, options);
  const server = await createServerlessServer(userCode);
+  const isStreaming = options.mode === 'streaming';

  return async function (request: IncomingMessage) {
    const url = new URL(request.url ?? '/', server.url);
    // @ts-expect-error
    const response = await fetch(url, {
      body: await serializeBody(request),
+      compress: isStreaming,
      headers: {
        ...request.headers,
        host: request.headers['x-forwarded-host'],
@@ -93,12 +117,22 @@ export async function createServerlessEventHandler(
    });

    let body;
-    if (options.mode === 'streaming') {
+    if (isStreaming) {
      body = response.body;
    } else {
      body = await streamToBuffer(response.body);
+
+      const contentEncoding = response.headers.get('content-encoding');
+      if (contentEncoding) {
+        body = compress(body, contentEncoding);
+        response.headers.set('content-length', Buffer.byteLength(body));
+      }
+
+      /**
+       * `transfer-encoding` is related to streaming chunks.
+       * Since we are buffering the response.body, it should be stripped.
+       */
      response.headers.delete('transfer-encoding');
-      response.headers.set('content-length', body.length);
    }

    return {
--- a/packages/node/test/dev-fixtures/edge-self.js
+++ b/packages/node/test/dev-fixtures/edge-self.js
@@ -0,0 +1,4 @@
+// eslint-disable-next-line no-undef
+delete self.__listeners;
+export default async () => fetch('https://example.vercel.sh');
+export const config = { runtime: 'edge' };
--- a/packages/node/test/dev-fixtures/serverless-fetch.js
+++ b/packages/node/test/dev-fixtures/serverless-fetch.js
@@ -0,0 +1,10 @@
+const baseUrl = ({ headers }) =>
+  `${headers.get('x-forwarded-proto')}://${headers.get('x-forwarded-host')}`;
+
+export function GET(request) {
+  const { searchParams } = new URL(request.url, baseUrl(request));
+  const url = searchParams.get('url');
+  const encoding = searchParams.get('encoding');
+  const serverUrl = `${url}?encoding=${encoding}`;
+  return fetch(serverUrl);
+}
--- a/packages/node/test/unit/dev.test.ts
+++ b/packages/node/test/unit/dev.test.ts
@@ -1,6 +1,9 @@
 import { forkDevServer, readMessage } from '../../src/fork-dev-server';
 import { resolve, extname } from 'path';
 import fetch from 'node-fetch';
+import { createServer } from 'http';
+import { listen } from 'async-listen';
+import zlib from 'zlib';

 jest.setTimeout(20 * 1000);

@@ -29,7 +32,7 @@ function testForkDevServer(entrypoint: string) {
 (NODE_MAJOR < 18 ? test.skip : test)(
  'runs an serverless function that exports GET',
  async () => {
-    const child = testForkDevServer('./serverless-web.js');
+    const child = testForkDevServer('./serverless-response.js');
    try {
      const result = await readMessage(child);
      if (result.state !== 'message') {
@@ -40,7 +43,7 @@ function testForkDevServer(entrypoint: string) {

      {
        const response = await fetch(
-          `http://${address}:${port}/api/serverless-web?name=Vercel`
+          `http://${address}:${port}/api/serverless-response?name=Vercel`
        );
        expect({
          status: response.status,
@@ -50,7 +53,7 @@ function testForkDevServer(entrypoint: string) {

      {
        const response = await fetch(
-          `http://${address}:${port}/api/serverless-web?name=Vercel`,
+          `http://${address}:${port}/api/serverless-response?name=Vercel`,
          { method: 'HEAD' }
        );
        expect({ status: response.status }).toEqual({ status: 405 });
@@ -61,6 +64,111 @@ function testForkDevServer(entrypoint: string) {
  }
 );

+(NODE_MAJOR < 18 ? test.skip : test)(
+  'buffer fetch response correctly',
+  async () => {
+    const child = testForkDevServer('./serverless-fetch.js');
+
+    const server = createServer((req, res) => {
+      res.setHeader('Content-Encoding', 'br');
+      const searchParams = new URLSearchParams(req.url!.substring(1));
+      const encoding = searchParams.get('encoding') ?? 'identity';
+      res.writeHead(200, {
+        'content-type': 'text/plain',
+        'content-encoding': encoding,
+      });
+      let payload = Buffer.from('Greetings, Vercel');
+
+      if (encoding === 'br') {
+        payload = zlib.brotliCompressSync(payload, {
+          params: {
+            [zlib.constants.BROTLI_PARAM_QUALITY]: 0,
+          },
+        });
+      } else if (encoding === 'gzip') {
+        payload = zlib.gzipSync(payload, {
+          level: zlib.constants.Z_BEST_SPEED,
+        });
+      } else if (encoding === 'deflate') {
+        payload = zlib.deflateSync(payload, {
+          level: zlib.constants.Z_BEST_SPEED,
+        });
+      }
+
+      res.end(payload);
+    });
+
+    const serverUrl = (await listen(server)).toString();
+
+    try {
+      const result = await readMessage(child);
+      if (result.state !== 'message') {
+        throw new Error('Exited. error: ' + JSON.stringify(result.value));
+      }
+
+      const { address, port } = result.value;
+
+      {
+        const response = await fetch(
+          `http://${address}:${port}/api/serverless-fetch?url=${serverUrl}&encoding=br`
+        );
+        expect(response.headers.get('content-encoding')).toBe('br');
+        expect(response.headers.get('content-length')).toBe('21');
+        expect({
+          status: response.status,
+          body: await response.text(),
+        }).toEqual({ status: 200, body: 'Greetings, Vercel' });
+      }
+      {
+        const response = await fetch(
+          `http://${address}:${port}/api/serverless-fetch?url=${serverUrl}&encoding=gzip`
+        );
+        expect(response.headers.get('content-encoding')).toBe('gzip');
+        expect(response.headers.get('content-length')).toBe('37');
+        expect({
+          status: response.status,
+          body: await response.text(),
+        }).toEqual({ status: 200, body: 'Greetings, Vercel' });
+      }
+      {
+        const response = await fetch(
+          `http://${address}:${port}/api/serverless-fetch?url=${serverUrl}&encoding=deflate`
+        );
+        expect(response.headers.get('content-encoding')).toBe('deflate');
+        expect(response.headers.get('content-length')).toBe('25');
+        expect({
+          status: response.status,
+          body: await response.text(),
+        }).toEqual({ status: 200, body: 'Greetings, Vercel' });
+      }
+    } finally {
+      server.close();
+      child.kill(9);
+    }
+  }
+);
+
+test("user code doesn't interfer with runtime", async () => {
+  const child = testForkDevServer('./edge-self.js');
+  try {
+    const result = await readMessage(child);
+    if (result.state !== 'message') {
+      throw new Error('Exited. error: ' + JSON.stringify(result.value));
+    }
+
+    const { address, port } = result.value;
+    const response = await fetch(`http://${address}:${port}/api/edge-self`);
+
+    expect({
+      status: response.status,
+    }).toEqual({
+      status: 200,
+    });
+  } finally {
+    child.kill(9);
+  }
+});
+
 test('runs an edge function that uses `WebSocket`', async () => {
  const child = testForkDevServer('./edge-websocket.js');
  try {
--- a/packages/python/package.json
+++ b/packages/python/package.json
@@ -23,7 +23,7 @@
    "@types/execa": "^0.9.0",
    "@types/jest": "27.4.1",
    "@types/node": "14.18.33",
-    "@vercel/build-utils": "6.8.0",
+    "@vercel/build-utils": "6.8.2",
    "@vercel/ncc": "0.24.0",
    "execa": "^1.0.0"
  }
--- a/packages/redwood/package.json
+++ b/packages/redwood/package.json
@@ -27,7 +27,7 @@
    "@types/aws-lambda": "8.10.19",
    "@types/node": "14.18.33",
    "@types/semver": "6.0.0",
-    "@vercel/build-utils": "6.8.0",
+    "@vercel/build-utils": "6.8.2",
    "execa": "3.2.0",
    "fs-extra": "11.1.0"
  }
--- a/packages/remix/CHANGELOG.md
+++ b/packages/remix/CHANGELOG.md
@@ -1,5 +1,27 @@
 # @vercel/remix-builder

+## 1.8.18
+
+### Patch Changes
+
+- Create ensured dependency symlink at the `start` directory, instead of root of repo ([#10224](https://github.com/vercel/vercel/pull/10224))
+
+## 1.8.17
+
+### Patch Changes
+
+- Updated dependencies [[`0750517af`](https://github.com/vercel/vercel/commit/0750517af99aea41410d4f1f772ce427699554e7)]:
+  - @vercel/build-utils@6.8.2
+
+## 1.8.16
+
+### Patch Changes
+
+- Update `@remix-run/dev` fork to v1.18.1 ([#10180](https://github.com/vercel/vercel/pull/10180))
+
+- Updated dependencies [[`7021279b2`](https://github.com/vercel/vercel/commit/7021279b284f314a4d1bdbb4306b4c22291efa08)]:
+  - @vercel/build-utils@6.8.1
+
 ## 1.8.15

 ### Patch Changes
--- a/packages/remix/package.json
+++ b/packages/remix/package.json
@@ -1,6 +1,6 @@
 {
  "name": "@vercel/remix-builder",
-  "version": "1.8.15",
+  "version": "1.8.18",
  "license": "Apache-2.0",
  "main": "./dist/index.js",
  "homepage": "https://vercel.com/docs",
@@ -20,8 +20,8 @@
    "defaults"
  ],
  "dependencies": {
-    "@remix-run/dev": "npm:@vercel/remix-run-dev@1.18.0",
-    "@vercel/build-utils": "6.8.0",
+    "@remix-run/dev": "npm:@vercel/remix-run-dev@1.18.1",
+    "@vercel/build-utils": "6.8.2",
    "@vercel/nft": "0.22.5",
    "@vercel/static-config": "2.0.17",
    "path-to-regexp": "6.2.1",
--- a/packages/remix/src/build.ts
+++ b/packages/remix/src/build.ts
@@ -16,7 +16,6 @@ import {
  runNpmInstall,
  runPackageJsonScript,
  scanParentDirs,
-  walkParentDirs,
 } from '@vercel/build-utils';
 import { getConfig } from '@vercel/static-config';
 import { nodeFileTrace } from '@vercel/nft';
@@ -43,6 +42,7 @@ import {
  findEntry,
  chdirAndReadConfig,
  addDependency,
+  ensureResolvable,
 } from './utils';
 import semver from 'semver';

@@ -659,99 +659,6 @@ async function createRenderEdgeFunction(
  return fn;
 }

-async function ensureResolvable(
-  start: string,
-  base: string,
-  pkgName: string
-): Promise<string> {
-  try {
-    const resolvedPkgPath = _require.resolve(`${pkgName}/package.json`, {
-      paths: [start],
-    });
-    const resolvedPath = dirname(resolvedPkgPath);
-    if (!relative(base, resolvedPath).startsWith(`..${sep}`)) {
-      // Resolved path is within the root of the project, so all good
-      debug(`"${pkgName}" resolved to '${resolvedPath}'`);
-      return resolvedPath;
-    }
-  } catch (err: any) {
-    if (err.code !== 'MODULE_NOT_FOUND') {
-      throw err;
-    }
-  }
-
-  // If we got to here then `pkgName` was not resolvable up to the root
-  // of the project. Try a couple symlink tricks, otherwise we'll bail.
-
-  // Attempt to find the package in `node_modules/.pnpm` (pnpm)
-  const pnpmDir = await walkParentDirs({
-    base,
-    start,
-    filename: 'node_modules/.pnpm',
-  });
-  if (pnpmDir) {
-    const prefix = `${pkgName.replace('/', '+')}@`;
-    const packages = await fs.readdir(pnpmDir);
-    const match = packages.find(p => p.startsWith(prefix));
-    if (match) {
-      const pkgDir = join(pnpmDir, match, 'node_modules', pkgName);
-      await ensureSymlink(pkgDir, join(pnpmDir, '..'), pkgName);
-      return pkgDir;
-    }
-  }
-
-  // Attempt to find the package in `node_modules/.store` (npm 9+ linked mode)
-  const npmDir = await walkParentDirs({
-    base,
-    start,
-    filename: 'node_modules/.store',
-  });
-  if (npmDir) {
-    const prefix = `${basename(pkgName)}@`;
-    const prefixDir = join(npmDir, dirname(pkgName));
-    const packages = await fs.readdir(prefixDir);
-    const match = packages.find(p => p.startsWith(prefix));
-    if (match) {
-      const pkgDir = join(prefixDir, match, 'node_modules', pkgName);
-      await ensureSymlink(pkgDir, join(npmDir, '..'), pkgName);
-      return pkgDir;
-    }
-  }
-
-  throw new Error(
-    `Failed to resolve "${pkgName}". To fix this error, add "${pkgName}" to "dependencies" in your \`package.json\` file.`
-  );
-}
-
-async function ensureSymlink(
-  target: string,
-  nodeModulesDir: string,
-  pkgName: string
-) {
-  const symlinkPath = join(nodeModulesDir, pkgName);
-  const symlinkDir = dirname(symlinkPath);
-  const relativeTarget = relative(symlinkDir, target);
-
-  try {
-    const existingTarget = await fs.readlink(symlinkPath);
-    if (existingTarget === relativeTarget) {
-      // Symlink is already the expected value, so do nothing
-      return;
-    } else {
-      // If a symlink already exists then delete it if the target doesn't match
-      await fs.unlink(symlinkPath);
-    }
-  } catch (err: any) {
-    // Ignore when path does not exist or is not a symlink
-    if (err.code !== 'ENOENT' && err.code !== 'EINVAL') {
-      throw err;
-    }
-  }
-
-  await fs.symlink(relativeTarget, symlinkPath);
-  debug(`Created symlink for "${pkgName}"`);
-}
-
 async function writeEntrypointFile(
  path: string,
  data: string,
--- a/packages/remix/src/utils.ts
+++ b/packages/remix/src/utils.ts
@@ -1,8 +1,9 @@
 import { existsSync, promises as fs } from 'fs';
-import { join, relative, resolve } from 'path';
+import { basename, dirname, join, relative, resolve, sep } from 'path';
 import { pathToRegexp, Key } from 'path-to-regexp';
 import { debug, spawnAsync } from '@vercel/build-utils';
 import { readConfig } from '@remix-run/dev/dist/config';
+import { walkParentDirs } from '@vercel/build-utils';
 import type {
  ConfigRoute,
  RouteManifest,
@@ -42,6 +43,8 @@ export interface ResolvedRoutePaths {
  rePath: string;
 }

+const _require: typeof require = eval('require');
+
 const SPLAT_PATH = '/:params*';

 const entryExts = ['.js', '.jsx', '.ts', '.tsx'];
@@ -273,3 +276,96 @@ export function addDependency(
  }
  return spawnAsync(cliType, args.concat(names), opts);
 }
+
+export async function ensureResolvable(
+  start: string,
+  base: string,
+  pkgName: string
+): Promise<string> {
+  try {
+    const resolvedPkgPath = _require.resolve(`${pkgName}/package.json`, {
+      paths: [start],
+    });
+    const resolvedPath = dirname(resolvedPkgPath);
+    if (!relative(base, resolvedPath).startsWith(`..${sep}`)) {
+      // Resolved path is within the root of the project, so all good
+      debug(`"${pkgName}" resolved to '${resolvedPath}'`);
+      return resolvedPath;
+    }
+  } catch (err: any) {
+    if (err.code !== 'MODULE_NOT_FOUND') {
+      throw err;
+    }
+  }
+
+  // If we got to here then `pkgName` was not resolvable up to the root
+  // of the project. Try a couple symlink tricks, otherwise we'll bail.
+
+  // Attempt to find the package in `node_modules/.pnpm` (pnpm)
+  const pnpmDir = await walkParentDirs({
+    base,
+    start,
+    filename: 'node_modules/.pnpm',
+  });
+  if (pnpmDir) {
+    const prefix = `${pkgName.replace('/', '+')}@`;
+    const packages = await fs.readdir(pnpmDir);
+    const match = packages.find(p => p.startsWith(prefix));
+    if (match) {
+      const pkgDir = join(pnpmDir, match, 'node_modules', pkgName);
+      await ensureSymlink(pkgDir, join(start, 'node_modules'), pkgName);
+      return pkgDir;
+    }
+  }
+
+  // Attempt to find the package in `node_modules/.store` (npm 9+ linked mode)
+  const npmDir = await walkParentDirs({
+    base,
+    start,
+    filename: 'node_modules/.store',
+  });
+  if (npmDir) {
+    const prefix = `${basename(pkgName)}@`;
+    const prefixDir = join(npmDir, dirname(pkgName));
+    const packages = await fs.readdir(prefixDir);
+    const match = packages.find(p => p.startsWith(prefix));
+    if (match) {
+      const pkgDir = join(prefixDir, match, 'node_modules', pkgName);
+      await ensureSymlink(pkgDir, join(start, 'node_modules'), pkgName);
+      return pkgDir;
+    }
+  }
+
+  throw new Error(
+    `Failed to resolve "${pkgName}". To fix this error, add "${pkgName}" to "dependencies" in your \`package.json\` file.`
+  );
+}
+
+async function ensureSymlink(
+  target: string,
+  nodeModulesDir: string,
+  pkgName: string
+) {
+  const symlinkPath = join(nodeModulesDir, pkgName);
+  const symlinkDir = dirname(symlinkPath);
+  const relativeTarget = relative(symlinkDir, target);
+
+  try {
+    const existingTarget = await fs.readlink(symlinkPath);
+    if (existingTarget === relativeTarget) {
+      // Symlink is already the expected value, so do nothing
+      return;
+    } else {
+      // If a symlink already exists then delete it if the target doesn't match
+      await fs.unlink(symlinkPath);
+    }
+  } catch (err: any) {
+    // Ignore when path does not exist or is not a symlink
+    if (err.code !== 'ENOENT' && err.code !== 'EINVAL') {
+      throw err;
+    }
+  }
+
+  await fs.symlink(relativeTarget, symlinkPath);
+  debug(`Created symlink for "${pkgName}"`);
+}
--- a/packages/remix/test/fixtures/00-pnpm/.gitignore
+++ b/packages/remix/test/fixtures/00-pnpm/.gitignore
@@ -0,0 +1 @@
+!node_modules
--- a/packages/remix/test/fixtures/00-pnpm/node_modules/.modules.yaml
+++ b/packages/remix/test/fixtures/00-pnpm/node_modules/.modules.yaml
@@ -0,0 +1,23 @@
+hoistPattern:
+  - '*'
+hoistedDependencies:
+  /ms/2.1.2:
+    ms: private
+included:
+  dependencies: true
+  devDependencies: true
+  optionalDependencies: true
+injectedDeps: {}
+layoutVersion: 5
+nodeLinker: isolated
+packageManager: pnpm@8.6.6
+pendingBuilds: []
+prunedAt: Mon, 17 Jul 2023 20:06:43 GMT
+publicHoistPattern:
+  - '*eslint*'
+  - '*prettier*'
+registries:
+  default: https://registry.npmjs.org/
+skipped: []
+storeDir: /Users/nrajlich/Library/pnpm/store/v3
+virtualStoreDir: .pnpm
--- a/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/debug@4.3.4/node_modules/debug/LICENSE
+++ b/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/debug@4.3.4/node_modules/debug/LICENSE
@@ -0,0 +1,20 @@
+(The MIT License)
+
+Copyright (c) 2014-2017 TJ Holowaychuk <tj@vision-media.ca>
+Copyright (c) 2018-2021 Josh Junon
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software
+and associated documentation files (the 'Software'), to deal in the Software without restriction,
+including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense,
+and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial
+portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT
+LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
+WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
--- a/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/debug@4.3.4/node_modules/debug/README.md
+++ b/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/debug@4.3.4/node_modules/debug/README.md
@@ -0,0 +1,481 @@
+# debug
+[![Build Status](https://travis-ci.org/debug-js/debug.svg?branch=master)](https://travis-ci.org/debug-js/debug)  [![Coverage Status](https://coveralls.io/repos/github/debug-js/debug/badge.svg?branch=master)](https://coveralls.io/github/debug-js/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers)
+[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
+
+A tiny JavaScript debugging utility modelled after Node.js core's debugging
+technique. Works in Node.js and web browsers.
+
+## Installation
+
+```bash
+$ npm install debug
+```
+
+## Usage
+
+`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
+
+Example [_app.js_](./examples/node/app.js):
+
+```js
+var debug = require('debug')('http')
+  , http = require('http')
+  , name = 'My App';
+
+// fake app
+
+debug('booting %o', name);
+
+http.createServer(function(req, res){
+  debug(req.method + ' ' + req.url);
+  res.end('hello\n');
+}).listen(3000, function(){
+  debug('listening');
+});
+
+// fake worker of some kind
+
+require('./worker');
+```
+
+Example [_worker.js_](./examples/node/worker.js):
+
+```js
+var a = require('debug')('worker:a')
+  , b = require('debug')('worker:b');
+
+function work() {
+  a('doing lots of uninteresting work');
+  setTimeout(work, Math.random() * 1000);
+}
+
+work();
+
+function workb() {
+  b('doing some work');
+  setTimeout(workb, Math.random() * 2000);
+}
+
+workb();
+```
+
+The `DEBUG` environment variable is then used to enable these based on space or
+comma-delimited names.
+
+Here are some examples:
+
+<img width="647" alt="screen shot 2017-08-08 at 12 53 04 pm" src="https://user-images.githubusercontent.com/71256/29091703-a6302cdc-7c38-11e7-8304-7c0b3bc600cd.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 38 pm" src="https://user-images.githubusercontent.com/71256/29091700-a62a6888-7c38-11e7-800b-db911291ca2b.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 25 pm" src="https://user-images.githubusercontent.com/71256/29091701-a62ea114-7c38-11e7-826a-2692bedca740.png">
+
+#### Windows command prompt notes
+
+##### CMD
+
+On Windows the environment variable is set using the `set` command.
+
+```cmd
+set DEBUG=*,-not_this
+```
+
+Example:
+
+```cmd
+set DEBUG=* & node app.js
+```
+
+##### PowerShell (VS Code default)
+
+PowerShell uses different syntax to set environment variables.
+
+```cmd
+$env:DEBUG = "*,-not_this"
+```
+
+Example:
+
+```cmd
+$env:DEBUG='app';node app.js
+```
+
+Then, run the program to be debugged as usual.
+
+npm script example:
+```js
+  "windowsDebug": "@powershell -Command $env:DEBUG='*';node app.js",
+```
+
+## Namespace Colors
+
+Every debug instance has a color generated for it based on its namespace name.
+This helps when visually parsing the debug output to identify which debug instance
+a debug line belongs to.
+
+#### Node.js
+
+In Node.js, colors are enabled when stderr is a TTY. You also _should_ install
+the [`supports-color`](https://npmjs.org/supports-color) module alongside debug,
+otherwise debug will only use a small handful of basic colors.
+
+<img width="521" src="https://user-images.githubusercontent.com/71256/29092181-47f6a9e6-7c3a-11e7-9a14-1928d8a711cd.png">
+
+#### Web Browser
+
+Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+option. These are WebKit web inspectors, Firefox ([since version
+31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+and the Firebug plugin for Firefox (any version).
+
+<img width="524" src="https://user-images.githubusercontent.com/71256/29092033-b65f9f2e-7c39-11e7-8e32-f6f0d8e865c1.png">
+
+
+## Millisecond diff
+
+When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
+
+When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below:
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091956-6bd78372-7c39-11e7-8c55-c948396d6edd.png">
+
+
+## Conventions
+
+If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".  If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable.  You can then use it for normal output as well as debug output.
+
+## Wildcards
+
+The `*` character may be used as a wildcard. Suppose for example your library has
+debuggers named "connect:bodyParser", "connect:compress", "connect:session",
+instead of listing all three with
+`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do
+`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+
+You can also exclude specific debuggers by prefixing them with a "-" character.
+For example, `DEBUG=*,-connect:*` would include all debuggers except those
+starting with "connect:".
+
+## Environment Variables
+
+When running through Node.js, you can set a few environment variables that will
+change the behavior of the debug logging:
+
+| Name      | Purpose                                         |
+|-----------|-------------------------------------------------|
+| `DEBUG`   | Enables/disables specific debugging namespaces. |
+| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY).  |
+| `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
+| `DEBUG_DEPTH` | Object inspection depth.                    |
+| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
+
+
+__Note:__ The environment variables beginning with `DEBUG_` end up being
+converted into an Options object that gets used with `%o`/`%O` formatters.
+See the Node.js documentation for
+[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+for the complete list.
+
+## Formatters
+
+Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting.
+Below are the officially supported formatters:
+
+| Formatter | Representation |
+|-----------|----------------|
+| `%O`      | Pretty-print an Object on multiple lines. |
+| `%o`      | Pretty-print an Object all on a single line. |
+| `%s`      | String. |
+| `%d`      | Number (both integer and float). |
+| `%j`      | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
+| `%%`      | Single percent sign ('%'). This does not consume an argument. |
+
+
+### Custom formatters
+
+You can add custom formatters by extending the `debug.formatters` object.
+For example, if you wanted to add support for rendering a Buffer as hex with
+`%h`, you could do something like:
+
+```js
+const createDebug = require('debug')
+createDebug.formatters.h = (v) => {
+  return v.toString('hex')
+}
+
+// …elsewhere
+const debug = createDebug('foo')
+debug('this is hex: %h', new Buffer('hello world'))
+//   foo this is hex: 68656c6c6f20776f726c6421 +0ms
+```
+
+
+## Browser Support
+
+You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+if you don't want to build it yourself.
+
+Debug's enable state is currently persisted by `localStorage`.
+Consider the situation shown below where you have `worker:a` and `worker:b`,
+and wish to debug both. You can enable this using `localStorage.debug`:
+
+```js
+localStorage.debug = 'worker:*'
+```
+
+And then refresh the page.
+
+```js
+a = debug('worker:a');
+b = debug('worker:b');
+
+setInterval(function(){
+  a('doing some work');
+}, 1000);
+
+setInterval(function(){
+  b('doing some work');
+}, 1200);
+```
+
+In Chromium-based web browsers (e.g. Brave, Chrome, and Electron), the JavaScript console will—by default—only show messages logged by `debug` if the "Verbose" log level is _enabled_.
+
+<img width="647" src="https://user-images.githubusercontent.com/7143133/152083257-29034707-c42c-4959-8add-3cee850e6fcf.png">
+
+## Output streams
+
+  By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
+
+Example [_stdout.js_](./examples/node/stdout.js):
+
+```js
+var debug = require('debug');
+var error = debug('app:error');
+
+// by default stderr is used
+error('goes to stderr!');
+
+var log = debug('app:log');
+// set this namespace to log via console.log
+log.log = console.log.bind(console); // don't forget to bind to console!
+log('goes to stdout');
+error('still goes to stderr!');
+
+// set all output to go via console.info
+// overrides all per-namespace log settings
+debug.log = console.info.bind(console);
+error('now goes to stdout via console.info');
+log('still goes to stdout, but via console.info now');
+```
+
+## Extend
+You can simply extend debugger 
+```js
+const log = require('debug')('auth');
+
+//creates new debug instance with extended namespace
+const logSign = log.extend('sign');
+const logLogin = log.extend('login');
+
+log('hello'); // auth hello
+logSign('hello'); //auth:sign hello
+logLogin('hello'); //auth:login hello
+```
+
+## Set dynamically
+
+You can also enable debug dynamically by calling the `enable()` method :
+
+```js
+let debug = require('debug');
+
+console.log(1, debug.enabled('test'));
+
+debug.enable('test');
+console.log(2, debug.enabled('test'));
+
+debug.disable();
+console.log(3, debug.enabled('test'));
+
+```
+
+print :   
+```
+1 false
+2 true
+3 false
+```
+
+Usage :  
+`enable(namespaces)`  
+`namespaces` can include modes separated by a colon and wildcards.
+   
+Note that calling `enable()` completely overrides previously set DEBUG variable : 
+
+```
+$ DEBUG=foo node -e 'var dbg = require("debug"); dbg.enable("bar"); console.log(dbg.enabled("foo"))'
+=> false
+```
+
+`disable()`
+
+Will disable all namespaces. The functions returns the namespaces currently
+enabled (and skipped). This can be useful if you want to disable debugging
+temporarily without knowing what was enabled to begin with.
+
+For example:
+
+```js
+let debug = require('debug');
+debug.enable('foo:*,-foo:bar');
+let namespaces = debug.disable();
+debug.enable(namespaces);
+```
+
+Note: There is no guarantee that the string will be identical to the initial
+enable string, but semantically they will be identical.
+
+## Checking whether a debug target is enabled
+
+After you've created a debug instance, you can determine whether or not it is
+enabled by checking the `enabled` property:
+
+```javascript
+const debug = require('debug')('http');
+
+if (debug.enabled) {
+  // do stuff...
+}
+```
+
+You can also manually toggle this property to force the debug instance to be
+enabled or disabled.
+
+## Usage in child processes
+
+Due to the way `debug` detects if the output is a TTY or not, colors are not shown in child processes when `stderr` is piped. A solution is to pass the `DEBUG_COLORS=1` environment variable to the child process.  
+For example:
+
+```javascript
+worker = fork(WORKER_WRAP_PATH, [workerPath], {
+  stdio: [
+    /* stdin: */ 0,
+    /* stdout: */ 'pipe',
+    /* stderr: */ 'pipe',
+    'ipc',
+  ],
+  env: Object.assign({}, process.env, {
+    DEBUG_COLORS: 1 // without this settings, colors won't be shown
+  }),
+});
+
+worker.stderr.pipe(process.stderr, { end: false });
+```
+
+
+## Authors
+
+ - TJ Holowaychuk
+ - Nathan Rajlich
+ - Andrew Rhyne
+ - Josh Junon
+
+## Backers
+
+Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
+
+<a href="https://opencollective.com/debug/backer/0/website" target="_blank"><img src="https://opencollective.com/debug/backer/0/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/1/website" target="_blank"><img src="https://opencollective.com/debug/backer/1/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/2/website" target="_blank"><img src="https://opencollective.com/debug/backer/2/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/3/website" target="_blank"><img src="https://opencollective.com/debug/backer/3/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/4/website" target="_blank"><img src="https://opencollective.com/debug/backer/4/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/5/website" target="_blank"><img src="https://opencollective.com/debug/backer/5/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/6/website" target="_blank"><img src="https://opencollective.com/debug/backer/6/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/7/website" target="_blank"><img src="https://opencollective.com/debug/backer/7/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/8/website" target="_blank"><img src="https://opencollective.com/debug/backer/8/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/9/website" target="_blank"><img src="https://opencollective.com/debug/backer/9/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/10/website" target="_blank"><img src="https://opencollective.com/debug/backer/10/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/11/website" target="_blank"><img src="https://opencollective.com/debug/backer/11/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/12/website" target="_blank"><img src="https://opencollective.com/debug/backer/12/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/13/website" target="_blank"><img src="https://opencollective.com/debug/backer/13/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/14/website" target="_blank"><img src="https://opencollective.com/debug/backer/14/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/15/website" target="_blank"><img src="https://opencollective.com/debug/backer/15/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/16/website" target="_blank"><img src="https://opencollective.com/debug/backer/16/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/17/website" target="_blank"><img src="https://opencollective.com/debug/backer/17/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/18/website" target="_blank"><img src="https://opencollective.com/debug/backer/18/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/19/website" target="_blank"><img src="https://opencollective.com/debug/backer/19/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/20/website" target="_blank"><img src="https://opencollective.com/debug/backer/20/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/21/website" target="_blank"><img src="https://opencollective.com/debug/backer/21/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/22/website" target="_blank"><img src="https://opencollective.com/debug/backer/22/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/23/website" target="_blank"><img src="https://opencollective.com/debug/backer/23/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/24/website" target="_blank"><img src="https://opencollective.com/debug/backer/24/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/25/website" target="_blank"><img src="https://opencollective.com/debug/backer/25/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/26/website" target="_blank"><img src="https://opencollective.com/debug/backer/26/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/27/website" target="_blank"><img src="https://opencollective.com/debug/backer/27/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/28/website" target="_blank"><img src="https://opencollective.com/debug/backer/28/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/29/website" target="_blank"><img src="https://opencollective.com/debug/backer/29/avatar.svg"></a>
+
+
+## Sponsors
+
+Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)]
+
+<a href="https://opencollective.com/debug/sponsor/0/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/0/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/1/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/1/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/2/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/2/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/3/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/3/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/4/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/4/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/5/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/5/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/6/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/6/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/7/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/7/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/8/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/8/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/9/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/9/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/10/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/10/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/11/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/11/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/12/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/12/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/13/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/13/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/14/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/14/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/15/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/15/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/16/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/16/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/17/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/17/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/18/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/18/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/19/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/19/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/20/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/20/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/21/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/21/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/22/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/22/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/23/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/23/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/24/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/24/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/25/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/25/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/26/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/26/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/27/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/27/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/28/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/28/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/29/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/29/avatar.svg"></a>
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2014-2017 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
+Copyright (c) 2018-2021 Josh Junon
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
--- a/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/debug@4.3.4/node_modules/debug/package.json
+++ b/packages/remix/test/fixtures/00-pnpm/node_modules/.pnpm/debug@4.3.4/node_modules/debug/package.json
@@ -0,0 +1,59 @@
+{
+  "name": "debug",
+  "version": "4.3.4",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/debug-js/debug.git"
+  },
+  "description": "Lightweight debugging utility for Node.js and the browser",
+  "keywords": [
+    "debug",
+    "log",
+    "debugger"
+  ],
+  "files": [
+    "src",
+    "LICENSE",
+    "README.md"
+  ],
+  "author": "Josh Junon <josh.junon@protonmail.com>",
+  "contributors": [
+    "TJ Holowaychuk <tj@vision-media.ca>",
+    "Nathan Rajlich <nathan@tootallnate.net> (http://n8.io)",
+    "Andrew Rhyne <rhyneandrew@gmail.com>"
+  ],
+  "license": "MIT",
+  "scripts": {
+    "lint": "xo",
+    "test": "npm run test:node && npm run test:browser && npm run lint",
+    "test:node": "istanbul cover _mocha -- test.js",
+    "test:browser": "karma start --single-run",
+    "test:coverage": "cat ./coverage/lcov.info | coveralls"
+  },
+  "dependencies": {
+    "ms": "2.1.2"
+  },
+  "devDependencies": {
+    "brfs": "^2.0.1",
+    "browserify": "^16.2.3",
+    "coveralls": "^3.0.2",
+    "istanbul": "^0.4.5",
+    "karma": "^3.1.4",
+    "karma-browserify": "^6.0.0",
+    "karma-chrome-launcher": "^2.2.0",
+    "karma-mocha": "^1.3.0",
+    "mocha": "^5.2.0",
+    "mocha-lcov-reporter": "^1.2.0",
+    "xo": "^0.23.0"
+  },
+  "peerDependenciesMeta": {
+    "supports-color": {
+      "optional": true
+    }
+  },
+  "main": "./src/index.js",
+  "browser": "./src/browser.js",
+  "engines": {
+    "node": ">=6.0"
+  }
+}
--- a/Show More
+++ b/Show More
Author	SHA1	Message	Date
Vercel Release Bot	56178e6a46	Version Packages (#10213 ) Co-authored-by: github-actions[bot] <github-actions[bot]@users.noreply.github.com>	2023-07-18 14:02:19 -05:00
Nathan Rajlich	5439d7c0c9	[remix] Create ensured dependency symlink at the `start` directory, instead of root of repo (#10224 ) When the `ensureResolvable()` function runs in a monorepo, the symlink should be created in the `node_modules` directory within the app subdirectory, rather than the root of the repository. Fixes the following issue: ![image](https://github.com/vercel/vercel/assets/71256/c0171533-881a-425e-85b9-82318ef19032)	2023-07-18 18:27:19 +00:00
Zack Tanner	c670e51712	[next] fix 404 page in edge runtime (#10223 ) Fixes Next builder to handle edge runtime on 404 pages [Related Next.js PR](https://github.com/vercel/next.js/pull/52754) [slack x-ref](https://vercel.slack.com/archives/C03S8ED1DKM/p1689312606770609)	2023-07-17 19:48:45 +00:00
Kiko Beats	b56639b624	[node] fix: runs edge user code inside IIFE (#10220 ) In this way, `self` is isolated and modify it doesn't break some Edge Runtime internals Originally reported by @jawj at https://github.com/jawj/neon-vercel-zapatos-minimal-crash	2023-07-17 16:45:05 +00:00
Kiko Beats	12bbae098c	[codeowners] @vercel/edge-compute → @vercel/compute (#10219 )	2023-07-17 14:33:25 +00:00
Nathan Rajlich	9969f0ba18	[cli] Use `detectFrameworks()` during `vc link --repo` (#10203 ) Allows for multiple frameworks to be detectable within the same root directory. This is basically specifically for Storybook. <img width="700" alt="Screenshot 2023-07-12 at 6 04 37 PM" src="https://github.com/vercel/vercel/assets/71256/5a240f1e-b000-42ad-b36f-3c151d3cd449">	2023-07-14 18:11:49 +00:00
Vercel Release Bot	24e1e3c3be	[examples][tests] Upgrade Next.js to version 13.4.10 (#10215 ) This auto-generated PR updates 3 packages to Next.js version 13.4.10	2023-07-14 16:27:44 +00:00
Steven	b61674cb2d	[tests] Fix next update cron job (#10214 ) This was supposed to be fixed in https://github.com/vercel/vercel/pull/10173 but the file was created after git commit. This PR makes sure the file is created before git commit.	2023-07-14 16:07:26 +00:00
Florentin / 珞辰	cae60155f3	[next] support maxDuration in Next.js deployments (#10069 ) Follow up PR to `8703c55f9f` which reads the newly created function config manifest and patches in the options for resource creation. --------- Co-authored-by: Steven <steven@ceriously.com>	2023-07-14 15:27:06 +02:00
Vercel Release Bot	a91bde5287	Version Packages (#10192 ) This PR was opened by the [Changesets release](https://github.com/changesets/action) GitHub action. When you're ready to do a release, you can merge this and the packages will be published to npm automatically. If you're not ready to do a release yet, that's fine, whenever you add more changesets to main, this PR will be updated. # Releases ## @vercel/fs-detectors@4.1.0 ### Minor Changes - Add `detectFrameworks()` function ([#10195](https://github.com/vercel/vercel/pull/10195)) ## @vercel/build-utils@6.8.2 ### Patch Changes - Push back `nodejs16.x` discontinue date to `2024-02-06` ([#10209](https://github.com/vercel/vercel/pull/10209)) ## vercel@31.0.3 ### Patch Changes - Fix redeploy target to be undefined when null ([#10201](https://github.com/vercel/vercel/pull/10201)) - Respect forbidden API responses ([#10178](https://github.com/vercel/vercel/pull/10178)) - Update `supports-hyperlinks` to v3 ([#10208](https://github.com/vercel/vercel/pull/10208)) - Updated dependencies \[[`0750517af`](`0750517af9`)]: - @vercel/build-utils@6.8.2 - @vercel/static-build@1.3.40 - @vercel/node@2.15.5 - @vercel/remix-builder@1.8.17 ## @vercel/client@12.6.5 ### Patch Changes - Updated dependencies \[[`0750517af`](`0750517af9`)]: - @vercel/build-utils@6.8.2 ## @vercel/gatsby-plugin-vercel-builder@1.3.13 ### Patch Changes - Updated dependencies \[[`0750517af`](`0750517af9`)]: - @vercel/build-utils@6.8.2 - @vercel/node@2.15.5 ## @vercel/node@2.15.5 ### Patch Changes - Updated dependencies \[[`0750517af`](`0750517af9`)]: - @vercel/build-utils@6.8.2 ## @vercel/remix-builder@1.8.17 ### Patch Changes - Updated dependencies \[[`0750517af`](`0750517af9`)]: - @vercel/build-utils@6.8.2 ## @vercel/static-build@1.3.40 ### Patch Changes - Updated dependencies \[]: - @vercel/gatsby-plugin-vercel-builder@1.3.13 ## @vercel-internals/types@1.0.5 ### Patch Changes - Updated dependencies \[[`0750517af`](`0750517af9`)]: - @vercel/build-utils@6.8.2 Co-authored-by: github-actions[bot] <github-actions[bot]@users.noreply.github.com>	2023-07-13 19:17:13 -04:00
Steven	0750517af9	[build-utils] Push back `nodejs16.x` discontinue date to 2024-02-06 (#10209 ) The discontinue date for `nodejs16.x` needs to be pushed back until we can add support for `nodejs20.x`. Currently `nodejs18.x` can cause problems with native packages that depend on a specific version of glibc so the only solution for that use case is to stay on `nodejs16.x` at this time. ### Related Issues - https://github.com/orgs/vercel/discussions/3061 - https://github.com/orgs/vercel/discussions/2867 - https://github.com/orgs/vercel/discussions/2258 - https://github.com/orgs/vercel/discussions/2630 - https://github.com/orgs/vercel/discussions/2105 - https://github.com/orgs/vercel/discussions/2596 - https://github.com/orgs/vercel/discussions/2730	2023-07-13 22:47:03 +00:00
Steven	70f6782954	[tests] Add lockfile to `51-puppeteer-build` test (#10210 ) This test was failing so I'm adding a lockfile to prevent this build error: ``` Running "yarn run build" -- 16:40:10.239 \| yarn run v1.22.17 16:40:10.260 \| $ node build.js 16:40:40.630 \| node:internal/process/promises:288 16:40:40.630 \| triggerUncaughtException(err, true /* fromPromise */); 16:40:40.630 \| ^ 16:40:40.630 \| 16:40:40.630 \| TimeoutError: Navigation timeout of 30000 ms exceeded 16:40:40.631 \| at /vercel/path1/node_modules/puppeteer/lib/LifecycleWatcher.js:142:21 16:40:40.631 \| -- ASYNC -- 16:40:40.631 \| at Frame.<anonymous> (/vercel/path1/node_modules/puppeteer/lib/helper.js:111:15) 16:40:40.631 \| at Page.goto (/vercel/path1/node_modules/puppeteer/lib/Page.js:672:49) 16:40:40.631 \| at Page.<anonymous> (/vercel/path1/node_modules/puppeteer/lib/helper.js:112:23) 16:40:40.631 \| at /vercel/path1/build.js:10:14 16:40:40.631 \| at process.processTicksAndRejections (node:internal/process/task_queues:95:5) ```	2023-07-13 21:29:51 +00:00
Nathan Rajlich	5f1e37ee16	Update `supports-hyperlinks` to v3 (#10208 ) Enables proper detection for VSCode's terminal emulator, and allows us to remove the in-house types since v3 includes its own types.	2023-07-13 12:24:30 -07:00
Steven	680d666fdc	[tests] Add huozhi to cron job for Next.js (#10205 ) This adds Jiachi to the default reviewer list for the Next.js update cron job.	2023-07-13 13:48:27 +00:00
Chris Barber	06a5dccfed	[cli] Fix redeploy target to be `undefined` when `null` (#10201 )	2023-07-12 16:26:33 -05:00
Nathan Rajlich	f85df894c0	[fs-detectors] Add `detectFrameworks()` (#10195 ) Similar to `detectFramework()`, but this version returns all detected frameworks at the given path. It also returns the full `Framework` objects instead of just the slug. This will be useful for detecting when multiple Projects exist at the same root directory (i.e. Storybook). Note: I rearranged some tests, so probably review with [whitespace changes hidden](https://github.com/vercel/vercel/pull/10195/files?diff=split&w=1).	2023-07-11 20:08:55 +00:00
balazs4	e9ec779f1c	[rbac]s show forbidden error in case of missing permission (#10178 ) fixes [iam-941](https://linear.app/vercel/issue/IAM-941/cli-improve-handling-of-insufficient-permissions-no-access)	2023-07-11 12:32:43 +02:00
Vercel Release Bot	4333d1e6b2	[examples][tests] Upgrade Next.js to version 13.4.9 (#10183 ) This auto-generated PR updates 3 packages to Next.js version 13.4.9	2023-07-11 07:51:06 +00:00
Vercel Release Bot	493a31091d	Version Packages (#10158 ) ## @vercel/build-utils@6.8.1 ### Patch Changes - Revert "[build-utils] Allow file-ref sema to be controlled through env flag" ([#10167](https://github.com/vercel/vercel/pull/10167)) ## vercel@31.0.2 ### Patch Changes - Allow additional project settings in `createProject()` ([#10172](https://github.com/vercel/vercel/pull/10172)) - Run local Project detection during `vc link --repo`. ([#10094](https://github.com/vercel/vercel/pull/10094)) This allows for creation of new Projects that do not yet exist under the selected scope. - Redeploy command no longer redeploys preview deployments to production ([#10186](https://github.com/vercel/vercel/pull/10186)) - Added trailing new line at end of help output ([#10170](https://github.com/vercel/vercel/pull/10170)) - Create new help output and arg parsing for deploy command ([#10090](https://github.com/vercel/vercel/pull/10090)) - [cli] Remove `preinstall` script ([#10157](https://github.com/vercel/vercel/pull/10157)) - Updated dependencies \[[`7021279b2`](`7021279b28`), [`5e5332fbc`](`5e5332fbc9`), [`027bce00b`](`027bce00b3`)]: - @vercel/build-utils@6.8.1 - @vercel/node@2.15.4 - @vercel/remix-builder@1.8.16 - @vercel/static-build@1.3.39 ## @vercel/client@12.6.4 ### Patch Changes - Updated dependencies \[[`7021279b2`](`7021279b28`)]: - @vercel/build-utils@6.8.1 ## @vercel/gatsby-plugin-vercel-builder@1.3.12 ### Patch Changes - Updated dependencies \[[`7021279b2`](`7021279b28`), [`5e5332fbc`](`5e5332fbc9`)]: - @vercel/build-utils@6.8.1 - @vercel/node@2.15.4 ## @vercel/node@2.15.4 ### Patch Changes - [node] fix decompress mismatching ([#10184](https://github.com/vercel/vercel/pull/10184)) - Updated dependencies \[[`7021279b2`](`7021279b28`)]: - @vercel/build-utils@6.8.1 ## @vercel/remix-builder@1.8.16 ### Patch Changes - Update `@remix-run/dev` fork to v1.18.1 ([#10180](https://github.com/vercel/vercel/pull/10180)) - Updated dependencies \[[`7021279b2`](`7021279b28`)]: - @vercel/build-utils@6.8.1 ## @vercel/static-build@1.3.39 ### Patch Changes - Updated dependencies \[]: - @vercel/gatsby-plugin-vercel-builder@1.3.12 ## @vercel-internals/constants@1.0.4 ### Patch Changes - Create new help output and arg parsing for deploy command ([#10090](https://github.com/vercel/vercel/pull/10090)) ## @vercel-internals/types@1.0.4 ### Patch Changes - Updated dependencies \[[`7021279b2`](`7021279b28`), [`718bbd365`](`718bbd365a`)]: - @vercel/build-utils@6.8.1 - @vercel-internals/constants@1.0.4 Co-authored-by: github-actions[bot] <github-actions[bot]@users.noreply.github.com>	2023-07-10 15:48:32 -07:00
Nathan Rajlich	8d7206f5b6	[cli] Run local Project detection during `vc link --repo` (#10094 ) Run local Project detection during `vc link --repo`. This allows for creation of new Projects that do not yet exist under the selected scope.	2023-07-10 22:42:13 +00:00
Sean Massa	4bf2ca55ff	Revert "Add Changesets "ignore" configuration" (#10189 ) Reverts vercel/vercel#10181 This seems to be breaking releases of packages that depend on ignored packages. Example: https://github.com/vercel/vercel/actions/runs/5489491313/jobs/10003713249	2023-07-10 02:17:06 +00:00
Kiko Beats	5e5332fbc9	[node] fix decompress mismatching (#10184 ) This PR disabled `node-fetch` default compression handling when the response is not streamed. The default behavior in node-fetch is to handle the compression. That's great if you interact with node-fetch as user, but bad if you use it as intermediate proxy server, since it's creating a mismatching related with the body format and length expectations. Instead, we disable compression, get the buffered response and compress it again if needed. --------- Co-authored-by: Sean Massa <EndangeredMassa@gmail.com>	2023-07-07 12:33:05 -06:00
Ethan Arrowood	281ec776a5	Fix redeploy target (#10186 ) This PR fixes customer issue https://github.com/vercel/customer-issues/issues/1310 which identified an issue with the `redeploy` command. `redeploy` should not default the `target` to `'production'` as an `undefined` target is meant to mean `'preview'`.	2023-07-07 11:50:06 -06:00
Nathan Rajlich	ee8f9292b4	Add Changesets "ignore" configuration (#10181 ) These packages already don't get published since they have `private: true`, but adding to the "ignore" configuration also removes them from the selection prompt when executing the `changeset` CLI command.	2023-07-05 22:07:15 +00:00
Vercel Release Bot	027bce00b3	[remix] Update `@remix-run/dev` to v1.18.1 (#10180 ) This auto-generated PR updates `@remix-run/dev` to version 1.18.1.	2023-07-05 21:23:48 +00:00
Vercel Release Bot	ca1f41200a	[tests] Upgrade Turbo to version 1.10.7 (#10164 ) This auto-generated PR updates Turbo to version 1.10.7	2023-07-05 20:46:59 +00:00
Nathan Rajlich	834b3e652b	[cli] Allow additional project settings in `createProject()` (#10172 ) Previously, `createProject()` only allowed a string `name` to be provided, and another API call would need to be done after creation with `updateProject()`. This should not be necessary since the `POST` endpoint can accept additional properties already.	2023-07-03 21:42:00 +00:00
Steven	5c6941d18c	[tests] Fix `update-next.js` cron job to include changeset (#10173 ) The cron job script only updates the Next.js example so it should have an empty changeset	2023-07-03 21:03:42 +00:00
Vercel Release Bot	761ede2482	[examples][tests] Upgrade Next.js to version 13.4.8 (#10171 ) This auto-generated PR updates 3 packages to Next.js version 13.4.8	2023-07-03 20:22:59 +00:00
Chris Barber	1d01703dc3	[cli] Added line return at end of help output (#10170 ) I noticed the help output doesn't render a line return at the end. <img width="290" alt="image" src="https://github.com/vercel/vercel/assets/97262/8aea6be0-9620-4445-b05d-62b838cefb07">	2023-07-03 16:46:29 +00:00
Andrew Healey	7021279b28	Revert "[build-utils] Allow file-ref sema to be controlled through env flag" (#10167 ) Reverts vercel/vercel#8681 We ran an experiment here a while ago but it had flaky results. This PR cleans up the experiment code, and reverts to the previous behavior.	2023-07-03 15:42:16 +00:00
Ethan Arrowood	28acf50bdf	Removes a leftover `console.log` in the new `help` method (#10162 ) Removes a leftover `console.log` in the new `help` method. Whoops!	2023-06-30 15:50:22 +00:00
Ethan Arrowood	718bbd365a	Improve `help` output UX and DX (#10090 ) This PR adds a new utility for generating `help` output for CLI commands. Backed by a JSON data structure that represents the commands, this utility uses deterministic functions for generating the different output sections (such as `options` and `examples`). This change will let contributor easily add/modify command details. The data structure is also used by the CLI to generate the args parsing structure for the `deploy` command. Optimistically, this same data structure can be used to generate documentation output for `front` such that the online docs will match the `help` output. --------- Co-authored-by: Sean Massa <EndangeredMassa@gmail.com>	2023-06-29 14:08:17 -06:00
Steven	7e791ee080	[cli] Remove `preinstall` script (#10157 ) This will solve two of the warnings from [Socket.dev](https://socket.dev/npm/package/vercel): <img width="1126" alt="image" src="https://github.com/vercel/vercel/assets/229881/c890c973-4f5a-44d9-9b96-2580a1e40ed0"> This preinstall script isn't necessary to run Vercel CLI, its only used to improve the error message in two cases: - The system has `node` version prior to 14.x (3 years ago) - The system still has `now` installed but should be using `vercel` (last shipped 3 years ago) The usage of `preinstall` scripts have gone out of style due to security audits so we should remove this script now.	2023-06-28 22:30:49 +00:00
Vercel Release Bot	13769106cb	Version Packages (#10156 ) This PR was opened by the [Changesets release](https://github.com/changesets/action) GitHub action. When you're ready to do a release, you can merge this and the packages will be published to npm automatically. If you're not ready to do a release yet, that's fine, whenever you add more changesets to main, this PR will be updated. # Releases ## vercel@31.0.1 ### Patch Changes - Updated dependencies \[[`aa734efc6`](`aa734efc6c`)]: - @vercel/next@3.8.8 ## @vercel/next@3.8.8 ### Patch Changes - [next] Ensure RSC paths handle basePath ([#10155](https://github.com/vercel/vercel/pull/10155))	2023-06-28 14:49:14 -07:00
JJ Kasper	aa734efc6c	[next] Ensure RSC paths handle basePath (#10155 ) This ensures we properly create the `.rsc` variant of outputs when `basePath` is configured and adds a regression test for this. x-ref: [slack thread](https://vercel.slack.com/archives/C03S8ED1DKM/p1687944744404289) Fixes: https://github.com/vercel/next.js/issues/48305	2023-06-28 21:00:43 +00:00